diff --git a/Makefile b/Makefile
index b9e412d..658e8d7 100644
--- a/Makefile
+++ b/Makefile
@@ -9,7 +9,13 @@ run-release:
SECURE_SESSIONS=false RUST_LOG=info cargo run --release
css-watch:
- npx tailwindcss -i ./src/main.css -o ./static/main.css --watch
+ npm run css-watch
+
+typescript:
+ npm run build
+
+typescript-watch:
+ npm run build-watch
migrate:
sea-orm-cli migrate
diff --git a/frontend/main.css b/frontend/main.css
new file mode 100644
index 0000000..6260af8
--- /dev/null
+++ b/frontend/main.css
@@ -0,0 +1,60 @@
+@tailwind base;
+@tailwind components;
+@tailwind utilities;
+
+
+
+
+/* Borrowed from https://github.com/Milkdown/milkdown/blob/main/e2e/src/list-item-block/style.css
+which is licensed under MIT. */
+
+.prose :where(li):not(:where([class~="not-prose"] *)) {
+ margin-top: 0.5em;
+ margin-bottom: 0;
+}
+
+.prose :where(blockquote):not(:where([class~="not-prose"] *)) {
+ font-style: inherit;
+ font-weight: inherit;
+}
+
+.prose :where(ul ul, ul ol, ol ul, ol ol):not(:where([class~="not-prose"] *)) {
+ margin-top: 0.5em;
+ margin-bottom: 0;
+}
+
+.prose ol,
+.prose ul {
+ list-style: none !important;
+ padding: 0;
+}
+
+.prose li p {
+ @apply !m-0 !leading-6;
+}
+
+.prose li p + p {
+ @apply !mt-2;
+}
+
+.prose li.ProseMirror-selectednode {
+ outline: 2px solid #8cf;
+}
+
+.prose li::after {
+ all: unset !important;
+}
+
+milkdown-list-item-block .list-item {
+ gap: 8px;
+}
+
+milkdown-list-item-block .label-wrapper {
+ height: 24px;
+ display: inline-flex;
+ justify-content: center;
+ align-items: center;
+ color: darkcyan;
+}
+
+/* End borrowed block. */
diff --git a/frontend/main.ts b/frontend/main.ts
new file mode 100644
index 0000000..a36f1d4
--- /dev/null
+++ b/frontend/main.ts
@@ -0,0 +1,57 @@
+import { defaultValueCtx, Editor, rootCtx } from '@milkdown/core';
+import { html } from 'atomico';
+import { listItemBlockComponent, listItemBlockConfig, ListItemBlockConfig, listItemBlockView } from '@milkdown/components/list-item-block'
+import { commonmark } from '@milkdown/preset-commonmark';
+import { gfm } from '@milkdown/preset-gfm';
+import { nord } from '@milkdown/theme-nord'
+import { listener, listenerCtx } from '@milkdown/plugin-listener';
+import '@milkdown/theme-nord/style.css'
+
+const markdown =
+`# Milkdown Vanilla Commonmark
+
+> You're scared of a world where you're needed.
+
+This is a demo for using Milkdown with **Vanilla Typescript**.
+
+- A list
+- [ ] Something to do
+- [x] Something done`
+
+
+function configureListItem(ctx: Ctx) {
+ ctx.set(listItemBlockConfig.key, {
+ renderLabel: (label: string, listType, checked?: boolean) => {
+ if (checked == null) {
+ if (listType === 'bullet') {
+ return html`•`
+ }
+
+ return html`${label}`
+ } else {
+ return html``
+ }
+ },
+ })
+}
+
+Editor
+ .make()
+ .config(ctx => {
+ ctx.set(rootCtx, "#editor")
+ ctx.set(defaultValueCtx, markdown)
+
+ const listener = ctx.get(listenerCtx);
+ listener.markdownUpdated((ctx, markdown, prevMarkdown) => {
+ if (markdown !== prevMarkdown) {
+ console.log(markdown);
+ }
+ })
+ })
+ .config(configureListItem)
+ .use(commonmark)
+ .use(gfm)
+ .use(nord)
+ .use(listener)
+ .use(listItemBlockComponent)
+ .create();
diff --git a/package-lock.json b/package-lock.json
index 4a179af..edc791f 100644
--- a/package-lock.json
+++ b/package-lock.json
@@ -4,8 +4,22 @@
"requires": true,
"packages": {
"": {
+ "dependencies": {
+ "@milkdown/components": "^7.3.6",
+ "@milkdown/core": "^7.3.6",
+ "@milkdown/plugin-listener": "^7.3.6",
+ "@milkdown/preset-commonmark": "^7.3.6",
+ "@milkdown/preset-gfm": "^7.3.6",
+ "@milkdown/theme-nord": "^7.3.6",
+ "@prosemirror-adapter/lit": "^0.2.6",
+ "clsx": "^2.1.1",
+ "tailwindcss": "^3.4.3"
+ },
"devDependencies": {
+ "@tailwindcss/forms": "^0.5.7",
+ "@tailwindcss/typography": "^0.5.13",
"daisyui": "^4.10.5",
+ "esbuild": "0.21.1",
"tailwindcss": "^3.4.3"
}
},
@@ -21,6 +35,779 @@
"url": "https://github.com/sponsors/sindresorhus"
}
},
+ "node_modules/@atomico/hooks": {
+ "version": "4.2.0",
+ "resolved": "https://registry.npmjs.org/@atomico/hooks/-/hooks-4.2.0.tgz",
+ "integrity": "sha512-i0UImiedbZpfRn7HoPt3+EGWVTjqG+44JOH1qALGceCjheryPRckzOZaLK0U1U3Ih4O8X1mbfoFkmcli4eFviA==",
+ "dependencies": {
+ "@atomico/use-attributes": "^2.0.1",
+ "@atomico/use-child-nodes": "^1.0.1",
+ "@atomico/use-click-coordinates": "^1.0.1",
+ "@atomico/use-click-press": "^1.0.1",
+ "@atomico/use-copy": "^1.0.1",
+ "@atomico/use-css-light-dom": "^1.0.1",
+ "@atomico/use-current-value": "^1.0.1",
+ "@atomico/use-debounce-state": "^1.0.1",
+ "@atomico/use-disabled": "^2.0.1",
+ "@atomico/use-drag-resize": "^1.0.0",
+ "@atomico/use-form": "^1.0.1",
+ "@atomico/use-internals": "^1.0.1",
+ "@atomico/use-intersection-observer": "^1.1.0",
+ "@atomico/use-keyboard": "^1.1.0",
+ "@atomico/use-listener": "^1.1.0",
+ "@atomico/use-media-query": "^1.0.1",
+ "@atomico/use-mutation-observer": "^2.0.2",
+ "@atomico/use-parallax": "^1.0.1",
+ "@atomico/use-parent": "^1.1.1",
+ "@atomico/use-prop-proxy": "^1.0.1",
+ "@atomico/use-reflect-event": "^1.0.1",
+ "@atomico/use-render": "^1.1.1",
+ "@atomico/use-resize-observer": "^1.1.0",
+ "@atomico/use-resize-state": "^1.0.1",
+ "@atomico/use-responsive-state": "^1.0.1",
+ "@atomico/use-router": "^1.0.1",
+ "@atomico/use-script": "^1.0.1",
+ "@atomico/use-slot": "^1.0.1",
+ "@atomico/use-value-history": "^1.0.1"
+ },
+ "peerDependencies": {
+ "@atomico/react": "*",
+ "@atomico/vue": "*"
+ },
+ "peerDependenciesMeta": {
+ "@atomico/react": {
+ "optional": true
+ },
+ "@atomico/vue": {
+ "optional": true
+ }
+ }
+ },
+ "node_modules/@atomico/use-attributes": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-attributes/-/use-attributes-2.0.1.tgz",
+ "integrity": "sha512-YmnUYJAoQsNmY0zK55E7DijvvSl5EilWirHVzyeRVacphKAWYiphj5S0lz+8d2ZQDebw/noWG8PdSLsk84z3wA==",
+ "dependencies": {
+ "@atomico/use-mutation-observer": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-child-nodes": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-child-nodes/-/use-child-nodes-1.0.1.tgz",
+ "integrity": "sha512-Mjz0al79bh2TrLB6wuNImylhePtVQ5PpGYrVazGwzzmlBSRh1LYJq0QcvcvlUw2DKPkd697yFVaNgMwtQMrkjQ==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-click-coordinates": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-click-coordinates/-/use-click-coordinates-1.0.1.tgz",
+ "integrity": "sha512-u+6DpSDsFyby5+krDF4a+8xhDibFmCNPUTMRElYey9/D+khgBiw9anuYniKJyplXMkI5ns3ev7dxMQPMfMj5lA==",
+ "dependencies": {
+ "@atomico/use-current-value": "*",
+ "@atomico/use-listener": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-click-press": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-click-press/-/use-click-press-1.0.1.tgz",
+ "integrity": "sha512-vLhoStp1RXX0AysqolS8RYd1vSDKhOJU9QK45D/vtu4uqb1pZoT7sWMcQUIR7XgM4xoUkEI8Z/8ej1UrLpZhyA==",
+ "dependencies": {
+ "@atomico/use-listener": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-copy": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-copy/-/use-copy-1.0.1.tgz",
+ "integrity": "sha512-ces7MxytvCpDuGHHpeap2uZ+CJeKi++tWMKK5uwQ8LjsyuFAi7EP/JkBmaSoQzYp4N9uWlNkJnL9zJfoi+CaQQ==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-css-light-dom": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-css-light-dom/-/use-css-light-dom-1.0.1.tgz",
+ "integrity": "sha512-sClSNYbrnTTUqW9LiJrSi5BjVyPP1bxWWvWT+kiYIU+e6UX6gaR7wCoZ8m7B/ezTukMXjcQdOLlq4RsqxUGnXQ==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-current-value": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-current-value/-/use-current-value-1.0.1.tgz",
+ "integrity": "sha512-d59warzhAmWyOi2VSWzXH1hw3Pafnao30y5h0D6IFs+NMPibLLybeupdwHqtsjTQlAov7Ak7Q940tzKdgGasDw==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-debounce-state": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-debounce-state/-/use-debounce-state-1.0.1.tgz",
+ "integrity": "sha512-vCBGP0nDxxU+RTJ4yHI0JeGeWawEf/6UMj5X0tt0Gk5XKLE/kqKBgWG0uFUh33bbhW1eXuGboeB+/qcm2b8FYw==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-disabled": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-disabled/-/use-disabled-2.0.1.tgz",
+ "integrity": "sha512-73IcqP2Rpd41j5TVjB823J/J5q6i1F2ZEs2BZuDRy0YRbUYAkDsi+agsuqWWiWNAxezI4zc+wYWj8GOeqilXNA==",
+ "dependencies": {
+ "@atomico/use-mutation-observer": "*",
+ "@atomico/use-parent": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-drag-resize": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/@atomico/use-drag-resize/-/use-drag-resize-1.0.0.tgz",
+ "integrity": "sha512-+wSCARzFmOrURQKbqS0ki+fyQdNnQQosg3/Ov/PJMFLkdkCyHw9lgNjIhyHRo71AqN2hudiLC1Gtfgs5oQe/fA==",
+ "dependencies": {
+ "@atomico/use-debounce-state": "*",
+ "@atomico/use-listener": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-form": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-form/-/use-form-1.0.1.tgz",
+ "integrity": "sha512-N3RTdUHQlJsJNF4fPV3qj1fK9HPYRrKIYyq410PGICfm4VrTsU2Dbl/eBBnWXIH3MT4VXpUsy3jRk3EFJ8wYDA==",
+ "dependencies": {
+ "@atomico/use-listener": "*",
+ "@atomico/use-parent": "*",
+ "@atomico/use-render": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1",
+ "element-internals-polyfill": "^0.1.49"
+ }
+ },
+ "node_modules/@atomico/use-internals": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-internals/-/use-internals-1.0.1.tgz",
+ "integrity": "sha512-qLHWzW/lsq9KyoC6v8HM+WiVsbGd2oUy7rl4x/dsouEW/E9qcTsTVeB8tMGL6O+ixYq5fj9BxCuGl49sU2zqIQ==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-intersection-observer": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/@atomico/use-intersection-observer/-/use-intersection-observer-1.1.0.tgz",
+ "integrity": "sha512-0p1X6PSpoztM1wcL0wcO//g2fODSwqWETS4cL+X+3nW5Yjc5d++kjvHq0q2GvhN4VvCAZX9jod3I8iM2eXWWZg==",
+ "peerDependencies": {
+ "atomico": "^1.76.4"
+ }
+ },
+ "node_modules/@atomico/use-keyboard": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/@atomico/use-keyboard/-/use-keyboard-1.1.0.tgz",
+ "integrity": "sha512-VGA2jDh5nD361IColbRztN4/Wcydhx0MhLZ9emIPtvPsfzUyOdI7mm47OvlnzliaCUnu96G2DuMih9AnR+XzeA==",
+ "dependencies": {
+ "@atomico/use-current-value": "*",
+ "@atomico/use-listener": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.76.4"
+ }
+ },
+ "node_modules/@atomico/use-listener": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/@atomico/use-listener/-/use-listener-1.1.0.tgz",
+ "integrity": "sha512-d7LcW/Rvokfpb/FBBDaBedLygNJmIaznIgDc2xkUxfQFiXyzMAzsNAAHzY0ZEddiYKtxdbkwrZotDDWkhC6/ug==",
+ "dependencies": {
+ "@atomico/use-current-value": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.76.4"
+ }
+ },
+ "node_modules/@atomico/use-media-query": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-media-query/-/use-media-query-1.0.1.tgz",
+ "integrity": "sha512-7mWFsfs1PzoFXjpa08SZuAN5Ut9UXGNSc/5U9odAJgGvSRnbAoVTguDpHsHVyEAKVt6lRGJPGIytWaVpuzyyWg==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-mutation-observer": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/@atomico/use-mutation-observer/-/use-mutation-observer-2.0.2.tgz",
+ "integrity": "sha512-l5upQLTMSDvwCEq0oXL56vKtmg4SykKSMcNJsgA503hZ35AXmB0LJMz4+dfBCVcahxV7kT0RUnAb9ZE0Q+8rwA==",
+ "dependencies": {
+ "@atomico/use-current-value": "*",
+ "@atomico/use-ref-values": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-parallax": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-parallax/-/use-parallax-1.0.1.tgz",
+ "integrity": "sha512-0swK5Wr6ZD19gCql9iDSE8FlhJ67Ji+odVzhu4CdmU909e1B4Ob16rU5UuHnbDphAh2NZQ780O9CRhuxOUqWRw==",
+ "dependencies": {
+ "@atomico/use-debounce-state": "*",
+ "@atomico/use-intersection-observer": "*",
+ "@atomico/use-listener": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-parent": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-parent/-/use-parent-1.1.1.tgz",
+ "integrity": "sha512-a/gaEH9lVUgoc/ufyLCTjAZiOjRLBtZQLTV4V2DD9MKHQQsL6PColeDk9Qbf6RONo77cfJ60MN+ctjhu98Y8Ow==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-prop-proxy": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-prop-proxy/-/use-prop-proxy-1.0.1.tgz",
+ "integrity": "sha512-20j1nn8HL52iSo6Y0v210/I90+usm3N7VNcHOYQIjRhiB7YwOqAJhKlbWQwXSEV5pFBhwUGu+Ks9FQdvJG3Esg==",
+ "dependencies": {
+ "@atomico/use-current-value": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-ref-values": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-ref-values/-/use-ref-values-1.0.1.tgz",
+ "integrity": "sha512-IFuwav8IkZ9uSFGscPiubYZnfSbdz2yV4xXdEClBq6IiViP0j8cBisE6YB7eAATJ/EHf7uhIBQGL5LOCk8Vi7A==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-reflect-event": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-reflect-event/-/use-reflect-event-1.0.1.tgz",
+ "integrity": "sha512-HFAREdUlGp48PlhQ9UNfPX7DNI6GgqfmK61yoq3/F9KJow/48ZYnEPlyYy1/GxAeHOTnCK4C8OhclHH2jg8Gzw==",
+ "dependencies": {
+ "@atomico/use-listener": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-render": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-render/-/use-render-1.1.1.tgz",
+ "integrity": "sha512-SkXTapKVDU/8PzP2z3psOPi3hoKWckSo0T/Q/HSxeu7TGbIpLTsn9jugWZG/rqzTOToOnhLaZ8s0qEEXCsL7ag==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-resize-observer": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/@atomico/use-resize-observer/-/use-resize-observer-1.1.0.tgz",
+ "integrity": "sha512-NcFs6G4dFwckO4IPrCzEpPEn1btuHZlHrrvaJnDCW+mf0UuEynwpCUD/264rkVIp5jfdAq4WTE3CBmBm7Nk89g==",
+ "dependencies": {
+ "@atomico/use-current-value": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.76.4"
+ }
+ },
+ "node_modules/@atomico/use-resize-state": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-resize-state/-/use-resize-state-1.0.1.tgz",
+ "integrity": "sha512-4gAklY6MxluHCPvC+4oM1c4ArqzDhPRMoSx1egM4OopEew9MwPJymKCCKbKpMe0SIjayAZv9Y2ZdYopn0xrwhQ==",
+ "dependencies": {
+ "@atomico/use-resize-observer": "*",
+ "@uppercod/match-media": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-responsive-state": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-responsive-state/-/use-responsive-state-1.0.1.tgz",
+ "integrity": "sha512-OXjVEBtZRAO5S+mEHe7Lb0r3eDonzGhDCLK1slQwc0N09oxUbz18lSrOPvWB05ezL9fitrxfY+auAIB7AIAUPA==",
+ "dependencies": {
+ "@uppercod/match-media": "^1.1.0"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-router": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-router/-/use-router-1.0.1.tgz",
+ "integrity": "sha512-YaTSNDIdJHK18pUJmQR5cmHn0ek3OEJXw/Sids9+2VmXR/vNPuM79FXYlqCsxi5/9De2c+/jUypqxjp3PyXmhA==",
+ "dependencies": {
+ "@atomico/use-current-value": "*",
+ "@atomico/use-listener": "*",
+ "@uppercod/exp-route": "^1.4.2"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-script": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-script/-/use-script-1.0.1.tgz",
+ "integrity": "sha512-FXVlQrXVfkbqHzgOkkoE9RmuTlZ2m6Kp64JgM1+jsHL+LpHFtAI7vIRnzyfGA0XvLXESgU8391qPY5z8lxpY7Q==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-slot": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-slot/-/use-slot-1.0.1.tgz",
+ "integrity": "sha512-ndaaAjhu4RegzVL8shoKgHbWHXFgBdoeqc0rj4giIz4xv8//3uMcI0zQvRRHq1QKTvvc3/ROVW919AG5e/i0cQ==",
+ "dependencies": {
+ "@atomico/use-listener": "*"
+ },
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@atomico/use-value-history": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/@atomico/use-value-history/-/use-value-history-1.0.1.tgz",
+ "integrity": "sha512-a0mtNNQ7AXOtJF93ySqp0sw1AQg6GiAEtoThpePEH/CCU07tyW2lKsAINU4/SYxZKYhyMbqBTuziK4D7gixFXg==",
+ "peerDependencies": {
+ "atomico": "^1.75.1"
+ }
+ },
+ "node_modules/@codemirror/language": {
+ "version": "6.10.1",
+ "resolved": "https://registry.npmjs.org/@codemirror/language/-/language-6.10.1.tgz",
+ "integrity": "sha512-5GrXzrhq6k+gL5fjkAwt90nYDmjlzTIJV8THnxNFtNKWotMIlzzN+CpqxqwXOECnUdOndmSeWntVrVcv5axWRQ==",
+ "peer": true,
+ "dependencies": {
+ "@codemirror/state": "^6.0.0",
+ "@codemirror/view": "^6.23.0",
+ "@lezer/common": "^1.1.0",
+ "@lezer/highlight": "^1.0.0",
+ "@lezer/lr": "^1.0.0",
+ "style-mod": "^4.0.0"
+ }
+ },
+ "node_modules/@codemirror/state": {
+ "version": "6.4.1",
+ "resolved": "https://registry.npmjs.org/@codemirror/state/-/state-6.4.1.tgz",
+ "integrity": "sha512-QkEyUiLhsJoZkbumGZlswmAhA7CBU02Wrz7zvH4SrcifbsqwlXShVXg65f3v/ts57W3dqyamEriMhij1Z3Zz4A==",
+ "peer": true
+ },
+ "node_modules/@codemirror/view": {
+ "version": "6.26.3",
+ "resolved": "https://registry.npmjs.org/@codemirror/view/-/view-6.26.3.tgz",
+ "integrity": "sha512-gmqxkPALZjkgSxIeeweY/wGQXBfwTUaLs8h7OKtSwfbj9Ct3L11lD+u1sS7XHppxFQoMDiMDp07P9f3I2jWOHw==",
+ "peer": true,
+ "dependencies": {
+ "@codemirror/state": "^6.4.0",
+ "style-mod": "^4.1.0",
+ "w3c-keyname": "^2.2.4"
+ }
+ },
+ "node_modules/@esbuild/aix-ppc64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.21.1.tgz",
+ "integrity": "sha512-O7yppwipkXvnEPjzkSXJRk2g4bS8sUx9p9oXHq9MU/U7lxUzZVsnFZMDTmeeX9bfQxrFcvOacl/ENgOh0WP9pA==",
+ "cpu": [
+ "ppc64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "aix"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/android-arm": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.21.1.tgz",
+ "integrity": "sha512-hh3jKWikdnTtHCglDAeVO3Oyh8MaH8xZUaWMiCCvJ9/c3NtPqZq+CACOlGTxhddypXhl+8B45SeceYBfB/e8Ow==",
+ "cpu": [
+ "arm"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/android-arm64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.21.1.tgz",
+ "integrity": "sha512-jXhccq6es+onw7x8MxoFnm820mz7sGa9J14kLADclmiEUH4fyj+FjR6t0M93RgtlI/awHWhtF0Wgfhqgf9gDZA==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/android-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.21.1.tgz",
+ "integrity": "sha512-NPObtlBh4jQHE01gJeucqEhdoD/4ya2owSIS8lZYS58aR0x7oZo9lB2lVFxgTANSa5MGCBeoQtr+yA9oKCGPvA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "android"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/darwin-arm64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.21.1.tgz",
+ "integrity": "sha512-BLT7TDzqsVlQRmJfO/FirzKlzmDpBWwmCUlyggfzUwg1cAxVxeA4O6b1XkMInlxISdfPAOunV9zXjvh5x99Heg==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "darwin"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/darwin-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.21.1.tgz",
+ "integrity": "sha512-D3h3wBQmeS/vp93O4B+SWsXB8HvRDwMyhTNhBd8yMbh5wN/2pPWRW5o/hM3EKgk9bdKd9594lMGoTCTiglQGRQ==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "darwin"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/freebsd-arm64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.21.1.tgz",
+ "integrity": "sha512-/uVdqqpNKXIxT6TyS/oSK4XE4xWOqp6fh4B5tgAwozkyWdylcX+W4YF2v6SKsL4wCQ5h1bnaSNjWPXG/2hp8AQ==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "freebsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/freebsd-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.21.1.tgz",
+ "integrity": "sha512-paAkKN1n1jJitw+dAoR27TdCzxRl1FOEITx3h201R6NoXUojpMzgMLdkXVgCvaCSCqwYkeGLoe9UVNRDKSvQgw==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "freebsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-arm": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.21.1.tgz",
+ "integrity": "sha512-tRHnxWJnvNnDpNVnsyDhr1DIQZUfCXlHSCDohbXFqmg9W4kKR7g8LmA3kzcwbuxbRMKeit8ladnCabU5f2traA==",
+ "cpu": [
+ "arm"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-arm64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.21.1.tgz",
+ "integrity": "sha512-G65d08YoH00TL7Xg4LaL3gLV21bpoAhQ+r31NUu013YB7KK0fyXIt05VbsJtpqh/6wWxoLJZOvQHYnodRrnbUQ==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-ia32": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.21.1.tgz",
+ "integrity": "sha512-tt/54LqNNAqCz++QhxoqB9+XqdsaZOtFD/srEhHYwBd3ZUOepmR1Eeot8bS+Q7BiEvy9vvKbtpHf+r6q8hF5UA==",
+ "cpu": [
+ "ia32"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-loong64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.21.1.tgz",
+ "integrity": "sha512-MhNalK6r0nZD0q8VzUBPwheHzXPr9wronqmZrewLfP7ui9Fv1tdPmg6e7A8lmg0ziQCziSDHxh3cyRt4YMhGnQ==",
+ "cpu": [
+ "loong64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-mips64el": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.21.1.tgz",
+ "integrity": "sha512-YCKVY7Zen5rwZV+nZczOhFmHaeIxR4Zn3jcmNH53LbgF6IKRwmrMywqDrg4SiSNApEefkAbPSIzN39FC8VsxPg==",
+ "cpu": [
+ "mips64el"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-ppc64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.21.1.tgz",
+ "integrity": "sha512-bw7bcQ+270IOzDV4mcsKAnDtAFqKO0jVv3IgRSd8iM0ac3L8amvCrujRVt1ajBTJcpDaFhIX+lCNRKteoDSLig==",
+ "cpu": [
+ "ppc64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-riscv64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.21.1.tgz",
+ "integrity": "sha512-ARmDRNkcOGOm1AqUBSwRVDfDeD9hGYRfkudP2QdoonBz1ucWVnfBPfy7H4JPI14eYtZruRSczJxyu7SRYDVOcg==",
+ "cpu": [
+ "riscv64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-s390x": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.21.1.tgz",
+ "integrity": "sha512-o73TcUNMuoTZlhwFdsgr8SfQtmMV58sbgq6gQq9G1xUiYnHMTmJbwq65RzMx89l0iya69lR4bxBgtWiiOyDQZA==",
+ "cpu": [
+ "s390x"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/linux-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.21.1.tgz",
+ "integrity": "sha512-da4/1mBJwwgJkbj4fMH7SOXq2zapgTo0LKXX1VUZ0Dxr+e8N0WbS80nSZ5+zf3lvpf8qxrkZdqkOqFfm57gXwA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "linux"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/netbsd-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.21.1.tgz",
+ "integrity": "sha512-CPWs0HTFe5woTJN5eKPvgraUoRHrCtzlYIAv9wBC+FAyagBSaf+UdZrjwYyTGnwPGkThV4OCI7XibZOnPvONVw==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "netbsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/openbsd-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.21.1.tgz",
+ "integrity": "sha512-xxhTm5QtzNLc24R0hEkcH+zCx/o49AsdFZ0Cy5zSd/5tOj4X2g3/2AJB625NoadUuc4A8B3TenLJoYdWYOYCew==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "openbsd"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/sunos-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.21.1.tgz",
+ "integrity": "sha512-CWibXszpWys1pYmbr9UiKAkX6x+Sxw8HWtw1dRESK1dLW5fFJ6rMDVw0o8MbadusvVQx1a8xuOxnHXT941Hp1A==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "sunos"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/win32-arm64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.21.1.tgz",
+ "integrity": "sha512-jb5B4k+xkytGbGUS4T+Z89cQJ9DJ4lozGRSV+hhfmCPpfJ3880O31Q1srPCimm+V6UCbnigqD10EgDNgjvjerQ==",
+ "cpu": [
+ "arm64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/win32-ia32": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.21.1.tgz",
+ "integrity": "sha512-PgyFvjJhXqHn1uxPhyN1wZ6dIomKjiLUQh1LjFvjiV1JmnkZ/oMPrfeEAZg5R/1ftz4LZWZr02kefNIQ5SKREQ==",
+ "cpu": [
+ "ia32"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@esbuild/win32-x64": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.21.1.tgz",
+ "integrity": "sha512-W9NttRZQR5ehAiqHGDnvfDaGmQOm6Fi4vSlce8mjM75x//XKuVAByohlEX6N17yZnVXxQFuh4fDRunP8ca6bfA==",
+ "cpu": [
+ "x64"
+ ],
+ "dev": true,
+ "optional": true,
+ "os": [
+ "win32"
+ ],
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/@floating-ui/core": {
+ "version": "1.6.1",
+ "resolved": "https://registry.npmjs.org/@floating-ui/core/-/core-1.6.1.tgz",
+ "integrity": "sha512-42UH54oPZHPdRHdw6BgoBD6cg/eVTmVrFcgeRDM3jbO7uxSoipVcmcIGFcA5jmOHO5apcyvBhkSKES3fQJnu7A==",
+ "dependencies": {
+ "@floating-ui/utils": "^0.2.0"
+ }
+ },
+ "node_modules/@floating-ui/dom": {
+ "version": "1.6.5",
+ "resolved": "https://registry.npmjs.org/@floating-ui/dom/-/dom-1.6.5.tgz",
+ "integrity": "sha512-Nsdud2X65Dz+1RHjAIP0t8z5e2ff/IRbei6BqFrl1urT8sDVzM1HMQ+R0XcU5ceRfyO3I6ayeqIfh+6Wb8LGTw==",
+ "dependencies": {
+ "@floating-ui/core": "^1.0.0",
+ "@floating-ui/utils": "^0.2.0"
+ }
+ },
+ "node_modules/@floating-ui/utils": {
+ "version": "0.2.2",
+ "resolved": "https://registry.npmjs.org/@floating-ui/utils/-/utils-0.2.2.tgz",
+ "integrity": "sha512-J4yDIIthosAsRZ5CPYP/jQvUAQtlZTTD/4suA08/FEnlxqW3sKS9iAhgsa9VYLZ6vDHn/ixJgIqRQPotoBjxIw=="
+ },
"node_modules/@isaacs/cliui": {
"version": "8.0.2",
"resolved": "https://registry.npmjs.org/@isaacs/cliui/-/cliui-8.0.2.tgz",
@@ -86,6 +873,277 @@
"@jridgewell/sourcemap-codec": "^1.4.14"
}
},
+ "node_modules/@lezer/common": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/@lezer/common/-/common-1.2.1.tgz",
+ "integrity": "sha512-yemX0ZD2xS/73llMZIK6KplkjIjf2EvAHcinDi/TfJ9hS25G0388+ClHt6/3but0oOxinTcQHJLDXh6w1crzFQ==",
+ "peer": true
+ },
+ "node_modules/@lezer/highlight": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/@lezer/highlight/-/highlight-1.2.0.tgz",
+ "integrity": "sha512-WrS5Mw51sGrpqjlh3d4/fOwpEV2Hd3YOkp9DBt4k8XZQcoTHZFB7sx030A6OcahF4J1nDQAa3jXlTVVYH50IFA==",
+ "peer": true,
+ "dependencies": {
+ "@lezer/common": "^1.0.0"
+ }
+ },
+ "node_modules/@lezer/lr": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/@lezer/lr/-/lr-1.4.0.tgz",
+ "integrity": "sha512-Wst46p51km8gH0ZUmeNrtpRYmdlRHUpN1DQd3GFAyKANi8WVz8c2jHYTf1CVScFaCjQw1iO3ZZdqGDxQPRErTg==",
+ "peer": true,
+ "dependencies": {
+ "@lezer/common": "^1.0.0"
+ }
+ },
+ "node_modules/@lit-labs/context": {
+ "version": "0.3.3",
+ "resolved": "https://registry.npmjs.org/@lit-labs/context/-/context-0.3.3.tgz",
+ "integrity": "sha512-5pWPLiXJnx8fZREF4w7RXBwJOxqRBJ57tujo7k23s0ZDfnSltomvYGW4kTOurXfyzDR0OLBBkv9xsWGDhauqew==",
+ "peer": true,
+ "dependencies": {
+ "@lit/reactive-element": "^1.5.0",
+ "lit": "^2.7.0"
+ }
+ },
+ "node_modules/@lit-labs/ssr-dom-shim": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/@lit-labs/ssr-dom-shim/-/ssr-dom-shim-1.2.0.tgz",
+ "integrity": "sha512-yWJKmpGE6lUURKAaIltoPIE/wrbY3TEkqQt+X0m+7fQNnAv0keydnYvbiJFP1PnMhizmIWRWOG5KLhYyc/xl+g==",
+ "peer": true
+ },
+ "node_modules/@lit/reactive-element": {
+ "version": "1.6.3",
+ "resolved": "https://registry.npmjs.org/@lit/reactive-element/-/reactive-element-1.6.3.tgz",
+ "integrity": "sha512-QuTgnG52Poic7uM1AN5yJ09QMe0O28e10XzSvWDz02TJiiKee4stsiownEIadWm8nYzyDAyT+gKzUoZmiWQtsQ==",
+ "peer": true,
+ "dependencies": {
+ "@lit-labs/ssr-dom-shim": "^1.0.0"
+ }
+ },
+ "node_modules/@milkdown/components": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/components/-/components-7.3.6.tgz",
+ "integrity": "sha512-w/sE8duUtNYcEKADLZKimotuZG35/d1V9LMYj52HwOypPO6YXUjtAzWhhU31MApDX00BuqsIKjyhwfmhr2N0pg==",
+ "dependencies": {
+ "@atomico/hooks": "^4.1.2",
+ "@floating-ui/dom": "^1.5.1",
+ "@milkdown/exception": "7.3.6",
+ "@milkdown/utils": "7.3.6",
+ "@types/lodash.debounce": "^4.0.7",
+ "atomico": "^1.75.1",
+ "clsx": "^2.0.0",
+ "lodash.debounce": "^4.0.8",
+ "tslib": "^2.5.0",
+ "unist-util-visit": "^5.0.0"
+ },
+ "peerDependencies": {
+ "@codemirror/language": "^6",
+ "@codemirror/state": "^6",
+ "@codemirror/view": "^6",
+ "@milkdown/core": "^7.2.0",
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/plugin-tooltip": "^7.2.0",
+ "@milkdown/preset-commonmark": "^7.2.0",
+ "@milkdown/prose": "^7.2.0",
+ "@milkdown/transformer": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/core": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/core/-/core-7.3.6.tgz",
+ "integrity": "sha512-7jk1x0xNNr53FxZowxWNpIvD6yl8LlHP/8X9DyWuvKQl+H1oSpVrkcOv1CO3QEjCrSiGGStsoS4feCMhtCKODg==",
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "remark-parse": "^11.0.0",
+ "remark-stringify": "^11.0.0",
+ "tslib": "^2.5.0",
+ "unified": "^11.0.3"
+ },
+ "peerDependencies": {
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/prose": "^7.2.0",
+ "@milkdown/transformer": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/ctx": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/ctx/-/ctx-7.3.6.tgz",
+ "integrity": "sha512-ivVX5XIpT1/b4b5JC+ffpcxsrB+R0cNodry+AL63V2tvvTmG7IvKkCf8CHI6gnN17C3soHi8/auzYRYJBXzTAQ==",
+ "peer": true,
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "tslib": "^2.5.0"
+ }
+ },
+ "node_modules/@milkdown/exception": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/exception/-/exception-7.3.6.tgz",
+ "integrity": "sha512-oEcQVyp3Lcvw3ySBc2EeCFAN1t/zvY+pdBsBSsIDB2uYueQK2PGSkzhd5WbvHnzv4lV4P19hoyPLwviqvQbVqA==",
+ "dependencies": {
+ "tslib": "^2.5.0"
+ }
+ },
+ "node_modules/@milkdown/plugin-listener": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/plugin-listener/-/plugin-listener-7.3.6.tgz",
+ "integrity": "sha512-sp9w36Vn/XLSCKl/4fqUIz2NNJnU1hXzX5X/XHH3WXCszqs6cJPRTtR6k8wAoTG2le0sW8EOdmptdjEsC2w5+Q==",
+ "dependencies": {
+ "@milkdown/utils": "7.3.6",
+ "@types/lodash.debounce": "^4.0.7",
+ "lodash.debounce": "^4.0.8",
+ "tslib": "^2.5.0"
+ },
+ "peerDependencies": {
+ "@milkdown/core": "^7.2.0",
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/prose": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/plugin-tooltip": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/plugin-tooltip/-/plugin-tooltip-7.3.6.tgz",
+ "integrity": "sha512-oIKZIxq8XD51D9hpJtej1zZevwlk8up+EOgBLmQBEcdlP/PbY6r2GbUEE9Pk0yYorJjEzwlcL7tem185weebaQ==",
+ "peer": true,
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "@milkdown/utils": "7.3.6",
+ "@types/lodash.debounce": "^4.0.7",
+ "lodash.debounce": "^4.0.8",
+ "tippy.js": "^6.3.7",
+ "tslib": "^2.5.0"
+ },
+ "peerDependencies": {
+ "@milkdown/core": "^7.2.0",
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/prose": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/preset-commonmark": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/preset-commonmark/-/preset-commonmark-7.3.6.tgz",
+ "integrity": "sha512-AUhrcyPMPXWnHJLIth/cK4IHTshlJgIw2RavFOmE2IyTxjgN4JCLg8MSla5wqwNUcdDMxKH0VmVyNImwt+c4Mg==",
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "@milkdown/utils": "7.3.6",
+ "@sindresorhus/slugify": "^2.2.0",
+ "remark-inline-links": "^7.0.0",
+ "tslib": "^2.5.0",
+ "unist-util-visit": "^5.0.0"
+ },
+ "peerDependencies": {
+ "@milkdown/core": "^7.2.0",
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/prose": "^7.2.0",
+ "@milkdown/transformer": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/preset-gfm": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/preset-gfm/-/preset-gfm-7.3.6.tgz",
+ "integrity": "sha512-7T1EFTHgGLtdPUP4ciKbwpTo7NKu4BlLoJHmDS4yLZJtg+hw28ZPhya0mY+dOOjETf0Nd49hh4REM4kpOd7n2A==",
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "@milkdown/utils": "7.3.6",
+ "remark-gfm": "^4.0.0",
+ "tslib": "^2.5.0"
+ },
+ "peerDependencies": {
+ "@milkdown/core": "^7.2.0",
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/preset-commonmark": "^7.2.0",
+ "@milkdown/prose": "^7.2.0",
+ "@milkdown/transformer": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/prose": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/prose/-/prose-7.3.6.tgz",
+ "integrity": "sha512-uBPgqghlDLxlfFPPVpPslM0N1h/6RFol2NTug65LK00bqvnNz8AUB712LMORb+KC7SGPcfUSu3z54Wxx2a27fg==",
+ "peer": true,
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "prosemirror-changeset": "^2.2.1",
+ "prosemirror-commands": "^1.5.2",
+ "prosemirror-dropcursor": "^1.8.1",
+ "prosemirror-gapcursor": "^1.3.2",
+ "prosemirror-history": "^1.3.2",
+ "prosemirror-inputrules": "^1.2.1",
+ "prosemirror-keymap": "^1.2.2",
+ "prosemirror-model": "^1.19.3",
+ "prosemirror-schema-list": "^1.3.0",
+ "prosemirror-state": "^1.4.3",
+ "prosemirror-tables": "^1.3.4",
+ "prosemirror-transform": "^1.7.5",
+ "prosemirror-view": "^1.31.7",
+ "tslib": "^2.5.0"
+ }
+ },
+ "node_modules/@milkdown/theme-nord": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/theme-nord/-/theme-nord-7.3.6.tgz",
+ "integrity": "sha512-JGQKn2IGD312cmoyBa5aZkM/OBMku4O+OL7QkVcDCx2HEohdx+ym/Fn/2r4f1dDYSrd5JZlNHD/rRVDv7FfjzQ==",
+ "dependencies": {
+ "clsx": "^2.0.0",
+ "tslib": "^2.5.0"
+ },
+ "peerDependencies": {
+ "@milkdown/core": "^7.2.0",
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/prose": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/transformer": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/transformer/-/transformer-7.3.6.tgz",
+ "integrity": "sha512-uE3sRoufBRHyqULJg93g7eTcgmA6hJVX/hiy+p+whle2EB6q3nNJeHoZZrNR8A32o3i8IBvmEIvvguxUtK9RyQ==",
+ "peer": true,
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "remark": "^15.0.1",
+ "remark-parse": "^11.0.0",
+ "remark-stringify": "^11.0.0",
+ "tslib": "^2.5.0",
+ "unified": "^11.0.3"
+ },
+ "peerDependencies": {
+ "@milkdown/prose": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/utils": {
+ "version": "7.3.6",
+ "resolved": "https://registry.npmjs.org/@milkdown/utils/-/utils-7.3.6.tgz",
+ "integrity": "sha512-V2ljZN72PIJ/7dQmEtasyNVi7wpgfjxmPX+b82cncd3vA+m/4wKosTeK+oHRIlt0JlpMGNrxd4ikIGHoy1+6UQ==",
+ "dependencies": {
+ "@milkdown/exception": "7.3.6",
+ "nanoid": "^5.0.0",
+ "tslib": "^2.5.0"
+ },
+ "peerDependencies": {
+ "@milkdown/core": "^7.2.0",
+ "@milkdown/ctx": "^7.2.0",
+ "@milkdown/prose": "^7.2.0",
+ "@milkdown/transformer": "^7.2.0"
+ }
+ },
+ "node_modules/@milkdown/utils/node_modules/nanoid": {
+ "version": "5.0.7",
+ "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-5.0.7.tgz",
+ "integrity": "sha512-oLxFY2gd2IqnjcYyOXD8XGCftpGtZP2AbHbOkthDkvRywH5ayNtPVy9YlOPcHckXzbLTCHpkb7FB+yuxKV13pQ==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/ai"
+ }
+ ],
+ "bin": {
+ "nanoid": "bin/nanoid.js"
+ },
+ "engines": {
+ "node": "^18 || >=20"
+ }
+ },
"node_modules/@nodelib/fs.scandir": {
"version": "2.1.5",
"resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz",
@@ -131,6 +1189,179 @@
"node": ">=14"
}
},
+ "node_modules/@popperjs/core": {
+ "version": "2.11.8",
+ "resolved": "https://registry.npmjs.org/@popperjs/core/-/core-2.11.8.tgz",
+ "integrity": "sha512-P1st0aksCrn9sGZhp8GMYwBnQsbvAWsZAX44oXNNvLHGqAOcoVxmjZiohstwQ7SqKnbR47akdNi+uleWD8+g6A==",
+ "peer": true,
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/popperjs"
+ }
+ },
+ "node_modules/@prosemirror-adapter/core": {
+ "version": "0.2.6",
+ "resolved": "https://registry.npmjs.org/@prosemirror-adapter/core/-/core-0.2.6.tgz",
+ "integrity": "sha512-7GXWQBR/bd6ngvek8SgtlEVC0x3KL7LKZ5cxyZl4IBAlRDbITQWsuKLChEXNan9A6+9Ry4a46crbDGTQlzooOg==",
+ "dependencies": {
+ "tslib": "^2.5.0"
+ }
+ },
+ "node_modules/@prosemirror-adapter/lit": {
+ "version": "0.2.6",
+ "resolved": "https://registry.npmjs.org/@prosemirror-adapter/lit/-/lit-0.2.6.tgz",
+ "integrity": "sha512-vdTc51W8iu771bohR6JLLga+0eukMJZDDG9bLSfF9JzcNNlLo7LSw47tBsjn1Jqf5/dqYvsmXVxIbOOkZ/+vcA==",
+ "dependencies": {
+ "@prosemirror-adapter/core": "0.2.6",
+ "nanoid": "^4.0.2",
+ "tslib": "^2.5.0"
+ },
+ "peerDependencies": {
+ "@lit-labs/context": "^0.3.0",
+ "lit": "^2.6.1"
+ }
+ },
+ "node_modules/@prosemirror-adapter/lit/node_modules/nanoid": {
+ "version": "4.0.2",
+ "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-4.0.2.tgz",
+ "integrity": "sha512-7ZtY5KTCNheRGfEFxnedV5zFiORN1+Y1N6zvPTnHQd8ENUvfaDBeuJDZb2bN/oXwXxu3qkTXDzy57W5vAmDTBw==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/ai"
+ }
+ ],
+ "bin": {
+ "nanoid": "bin/nanoid.js"
+ },
+ "engines": {
+ "node": "^14 || ^16 || >=18"
+ }
+ },
+ "node_modules/@sindresorhus/slugify": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/@sindresorhus/slugify/-/slugify-2.2.1.tgz",
+ "integrity": "sha512-MkngSCRZ8JdSOCHRaYd+D01XhvU3Hjy6MGl06zhOk614hp9EOAp5gIkBeQg7wtmxpitU6eAL4kdiRMcJa2dlrw==",
+ "dependencies": {
+ "@sindresorhus/transliterate": "^1.0.0",
+ "escape-string-regexp": "^5.0.0"
+ },
+ "engines": {
+ "node": ">=12"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/@sindresorhus/transliterate": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/@sindresorhus/transliterate/-/transliterate-1.6.0.tgz",
+ "integrity": "sha512-doH1gimEu3A46VX6aVxpHTeHrytJAG6HgdxntYnCFiIFHEM/ZGpG8KiZGBChchjQmG0XFIBL552kBTjVcMZXwQ==",
+ "dependencies": {
+ "escape-string-regexp": "^5.0.0"
+ },
+ "engines": {
+ "node": ">=12"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/@tailwindcss/forms": {
+ "version": "0.5.7",
+ "resolved": "https://registry.npmjs.org/@tailwindcss/forms/-/forms-0.5.7.tgz",
+ "integrity": "sha512-QE7X69iQI+ZXwldE+rzasvbJiyV/ju1FGHH0Qn2W3FKbuYtqp8LKcy6iSw79fVUT5/Vvf+0XgLCeYVG+UV6hOw==",
+ "dev": true,
+ "dependencies": {
+ "mini-svg-data-uri": "^1.2.3"
+ },
+ "peerDependencies": {
+ "tailwindcss": ">=3.0.0 || >= 3.0.0-alpha.1"
+ }
+ },
+ "node_modules/@tailwindcss/typography": {
+ "version": "0.5.13",
+ "resolved": "https://registry.npmjs.org/@tailwindcss/typography/-/typography-0.5.13.tgz",
+ "integrity": "sha512-ADGcJ8dX21dVVHIwTRgzrcunY6YY9uSlAHHGVKvkA+vLc5qLwEszvKts40lx7z0qc4clpjclwLeK5rVCV2P/uw==",
+ "dev": true,
+ "dependencies": {
+ "lodash.castarray": "^4.4.0",
+ "lodash.isplainobject": "^4.0.6",
+ "lodash.merge": "^4.6.2",
+ "postcss-selector-parser": "6.0.10"
+ },
+ "peerDependencies": {
+ "tailwindcss": ">=3.0.0 || insiders"
+ }
+ },
+ "node_modules/@tailwindcss/typography/node_modules/postcss-selector-parser": {
+ "version": "6.0.10",
+ "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.0.10.tgz",
+ "integrity": "sha512-IQ7TZdoaqbT+LCpShg46jnZVlhWD2w6iQYAcYXfHARZ7X1t/UGhhceQDs5X0cGqKvYlHNOuv7Oa1xmb0oQuA3w==",
+ "dev": true,
+ "dependencies": {
+ "cssesc": "^3.0.0",
+ "util-deprecate": "^1.0.2"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/@types/debug": {
+ "version": "4.1.12",
+ "resolved": "https://registry.npmjs.org/@types/debug/-/debug-4.1.12.tgz",
+ "integrity": "sha512-vIChWdVG3LG1SMxEvI/AK+FWJthlrqlTu7fbrlywTkkaONwk/UAGaULXRlf8vkzFBLVm0zkMdCquhL5aOjhXPQ==",
+ "dependencies": {
+ "@types/ms": "*"
+ }
+ },
+ "node_modules/@types/lodash": {
+ "version": "4.17.1",
+ "resolved": "https://registry.npmjs.org/@types/lodash/-/lodash-4.17.1.tgz",
+ "integrity": "sha512-X+2qazGS3jxLAIz5JDXDzglAF3KpijdhFxlf/V1+hEsOUc+HnWi81L/uv/EvGuV90WY+7mPGFCUDGfQC3Gj95Q=="
+ },
+ "node_modules/@types/lodash.debounce": {
+ "version": "4.0.9",
+ "resolved": "https://registry.npmjs.org/@types/lodash.debounce/-/lodash.debounce-4.0.9.tgz",
+ "integrity": "sha512-Ma5JcgTREwpLRwMM+XwBR7DaWe96nC38uCBDFKZWbNKD+osjVzdpnUSwBcqCptrp16sSOLBAUb50Car5I0TCsQ==",
+ "dependencies": {
+ "@types/lodash": "*"
+ }
+ },
+ "node_modules/@types/mdast": {
+ "version": "4.0.3",
+ "resolved": "https://registry.npmjs.org/@types/mdast/-/mdast-4.0.3.tgz",
+ "integrity": "sha512-LsjtqsyF+d2/yFOYaN22dHZI1Cpwkrj+g06G8+qtUKlhovPW89YhqSnfKtMbkgmEtYpH2gydRNULd6y8mciAFg==",
+ "dependencies": {
+ "@types/unist": "*"
+ }
+ },
+ "node_modules/@types/ms": {
+ "version": "0.7.34",
+ "resolved": "https://registry.npmjs.org/@types/ms/-/ms-0.7.34.tgz",
+ "integrity": "sha512-nG96G3Wp6acyAgJqGasjODb+acrI7KltPiRxzHPXnP3NgI28bpQDRv53olbqGXbfcgF5aiiHmO3xpwEpS5Ld9g=="
+ },
+ "node_modules/@types/trusted-types": {
+ "version": "2.0.7",
+ "resolved": "https://registry.npmjs.org/@types/trusted-types/-/trusted-types-2.0.7.tgz",
+ "integrity": "sha512-ScaPdn1dQczgbl0QFTeTOmVHFULt394XJgOQNoyVhZ6r2vLnMLJfBPd53SB52T/3G36VI1/g2MZaX0cwDuXsfw==",
+ "peer": true
+ },
+ "node_modules/@types/unist": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/@types/unist/-/unist-3.0.2.tgz",
+ "integrity": "sha512-dqId9J8K/vGi5Zr7oo212BGii5m3q5Hxlkwy3WpYuKPklmBEvsbMYYyLxAQpSffdLl/gdW0XUpKWFvYmyoWCoQ=="
+ },
+ "node_modules/@uppercod/exp-route": {
+ "version": "1.4.2",
+ "resolved": "https://registry.npmjs.org/@uppercod/exp-route/-/exp-route-1.4.2.tgz",
+ "integrity": "sha512-rRljihqBd3fBdWSKi4F+ev7OVJfjQyXSfwAxtjaA6PUcpBPbT0GjlJrXKa3wcFAMqE5brAjW0rMxTpXwbKv0pQ=="
+ },
+ "node_modules/@uppercod/match-media": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/@uppercod/match-media/-/match-media-1.1.1.tgz",
+ "integrity": "sha512-ITGhdyxadb1ypwow3TkXGdF6vWAmRZWxxfUysZz2kvsGjgaCNSuJzbfLTeWEC+BeL651U18RwZlgpX93ZCRTFg=="
+ },
"node_modules/ansi-regex": {
"version": "6.0.1",
"resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz",
@@ -180,6 +1411,20 @@
"integrity": "sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg==",
"dev": true
},
+ "node_modules/atomico": {
+ "version": "1.79.2",
+ "resolved": "https://registry.npmjs.org/atomico/-/atomico-1.79.2.tgz",
+ "integrity": "sha512-mshhLRMeIltNYbnQnqgnrvJ/uDa8XDfTQcjw3ymOygQqwHIQ4Sp0LcNYMCbACkV3DtV+eDXb9szwU4qMUuGwYQ=="
+ },
+ "node_modules/bail": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/bail/-/bail-2.0.2.tgz",
+ "integrity": "sha512-0xO6mYd7JB2YesxDKplafRpsiOzPt9V02ddPCLbY1xYGPOX24NTyN50qnUxgCPcSoYMhKpAuBTjQoRZCAkUDRw==",
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
"node_modules/balanced-match": {
"version": "1.0.2",
"resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz",
@@ -228,6 +1473,24 @@
"node": ">= 6"
}
},
+ "node_modules/ccount": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/ccount/-/ccount-2.0.1.tgz",
+ "integrity": "sha512-eyrF0jiFpY+3drT6383f1qhkbGsLSifNAjA61IUjZjmLCWjItY6LB9ft9YhoDgwfmclB2zhu51Lc7+95b8NRAg==",
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
+ "node_modules/character-entities": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/character-entities/-/character-entities-2.0.2.tgz",
+ "integrity": "sha512-shx7oQ0Awen/BRIdkjkvz54PnEEI/EjwXDSIZp86/KKdbafHh1Df/RYGBhn4hbe2+uKC9FnT5UCEdyPz3ai9hQ==",
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
"node_modules/chokidar": {
"version": "3.6.0",
"resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz",
@@ -264,6 +1527,14 @@
"node": ">= 6"
}
},
+ "node_modules/clsx": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/clsx/-/clsx-2.1.1.tgz",
+ "integrity": "sha512-eYm0QWBtUrBWZWG0d386OGAw16Z995PiOVo2B7bjWSbHedGl5e0ZWaq65kOGgUSNesEIDkB9ISbTg/JK9dhCZA==",
+ "engines": {
+ "node": ">=6"
+ }
+ },
"node_modules/color-convert": {
"version": "2.0.1",
"resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz",
@@ -355,6 +1626,54 @@
"url": "https://opencollective.com/daisyui"
}
},
+ "node_modules/debug": {
+ "version": "4.3.4",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz",
+ "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==",
+ "dependencies": {
+ "ms": "2.1.2"
+ },
+ "engines": {
+ "node": ">=6.0"
+ },
+ "peerDependenciesMeta": {
+ "supports-color": {
+ "optional": true
+ }
+ }
+ },
+ "node_modules/decode-named-character-reference": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/decode-named-character-reference/-/decode-named-character-reference-1.0.2.tgz",
+ "integrity": "sha512-O8x12RzrUF8xyVcY0KJowWsmaJxQbmy0/EtnNtHRpsOcT7dFk5W598coHqBVpmWo1oQQfsCqfCmkZN5DJrZVdg==",
+ "dependencies": {
+ "character-entities": "^2.0.0"
+ },
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
+ "node_modules/dequal": {
+ "version": "2.0.3",
+ "resolved": "https://registry.npmjs.org/dequal/-/dequal-2.0.3.tgz",
+ "integrity": "sha512-0je+qPKHEMohvfRTCEo3CrPG6cAzAYgmzKyxRiYSSDkS6eGJdyVJm7WaYA5ECaAD9wLB2T4EEeymA5aFVcYXCA==",
+ "engines": {
+ "node": ">=6"
+ }
+ },
+ "node_modules/devlop": {
+ "version": "1.1.0",
+ "resolved": "https://registry.npmjs.org/devlop/-/devlop-1.1.0.tgz",
+ "integrity": "sha512-RWmIqhcFf1lRYBvNmr7qTNuyCt/7/ns2jbpp1+PalgE/rDQcBT0fioSMUpJ93irlUhC5hrg4cYqe6U+0ImW0rA==",
+ "dependencies": {
+ "dequal": "^2.0.0"
+ },
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
"node_modules/didyoumean": {
"version": "1.2.2",
"resolved": "https://registry.npmjs.org/didyoumean/-/didyoumean-1.2.2.tgz",
@@ -373,12 +1692,72 @@
"integrity": "sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA==",
"dev": true
},
+ "node_modules/element-internals-polyfill": {
+ "version": "0.1.55",
+ "resolved": "https://registry.npmjs.org/element-internals-polyfill/-/element-internals-polyfill-0.1.55.tgz",
+ "integrity": "sha512-clsNGQoOsCs8zlkT3q8Sgk9JcFZgYT0cDuXPEmD7ca8bthrYjhXQ19cIz5JGmo8CfQ+g7+SXJkfqBVw5mWB64w==",
+ "peer": true
+ },
"node_modules/emoji-regex": {
"version": "9.2.2",
"resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-9.2.2.tgz",
"integrity": "sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==",
"dev": true
},
+ "node_modules/esbuild": {
+ "version": "0.21.1",
+ "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.21.1.tgz",
+ "integrity": "sha512-GPqx+FX7mdqulCeQ4TsGZQ3djBJkx5k7zBGtqt9ycVlWNg8llJ4RO9n2vciu8BN2zAEs6lPbPl0asZsAh7oWzg==",
+ "dev": true,
+ "hasInstallScript": true,
+ "bin": {
+ "esbuild": "bin/esbuild"
+ },
+ "engines": {
+ "node": ">=12"
+ },
+ "optionalDependencies": {
+ "@esbuild/aix-ppc64": "0.21.1",
+ "@esbuild/android-arm": "0.21.1",
+ "@esbuild/android-arm64": "0.21.1",
+ "@esbuild/android-x64": "0.21.1",
+ "@esbuild/darwin-arm64": "0.21.1",
+ "@esbuild/darwin-x64": "0.21.1",
+ "@esbuild/freebsd-arm64": "0.21.1",
+ "@esbuild/freebsd-x64": "0.21.1",
+ "@esbuild/linux-arm": "0.21.1",
+ "@esbuild/linux-arm64": "0.21.1",
+ "@esbuild/linux-ia32": "0.21.1",
+ "@esbuild/linux-loong64": "0.21.1",
+ "@esbuild/linux-mips64el": "0.21.1",
+ "@esbuild/linux-ppc64": "0.21.1",
+ "@esbuild/linux-riscv64": "0.21.1",
+ "@esbuild/linux-s390x": "0.21.1",
+ "@esbuild/linux-x64": "0.21.1",
+ "@esbuild/netbsd-x64": "0.21.1",
+ "@esbuild/openbsd-x64": "0.21.1",
+ "@esbuild/sunos-x64": "0.21.1",
+ "@esbuild/win32-arm64": "0.21.1",
+ "@esbuild/win32-ia32": "0.21.1",
+ "@esbuild/win32-x64": "0.21.1"
+ }
+ },
+ "node_modules/escape-string-regexp": {
+ "version": "5.0.0",
+ "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-5.0.0.tgz",
+ "integrity": "sha512-/veY75JbMK4j1yjvuUxuVsiS/hr/4iHs9FTT6cgTexxdE0Ly/glccBAkloH/DofkjRbZU3bnoj38mOmhkZ0lHw==",
+ "engines": {
+ "node": ">=12"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/extend": {
+ "version": "3.0.2",
+ "resolved": "https://registry.npmjs.org/extend/-/extend-3.0.2.tgz",
+ "integrity": "sha512-fjquC59cD7CyW6urNXK0FBufkZcoiGG80wTuPujX590cB5Ttln20E2UB4S/WARVqhXffZl2LNgS+gQdPIIim/g=="
+ },
"node_modules/fast-glob": {
"version": "3.3.2",
"resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz",
@@ -582,6 +1961,17 @@
"node": ">=0.12.0"
}
},
+ "node_modules/is-plain-obj": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/is-plain-obj/-/is-plain-obj-4.1.0.tgz",
+ "integrity": "sha512-+Pgi+vMuUNkJyExiMBt5IlFoMyKnr5zhJ4Uspz58WOhBF5QoIZkFyNHIbBAtHwzVAgk5RtndVNsDRN61/mmDqg==",
+ "engines": {
+ "node": ">=12"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
"node_modules/isexe": {
"version": "2.0.0",
"resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
@@ -630,6 +2020,69 @@
"integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==",
"dev": true
},
+ "node_modules/lit": {
+ "version": "2.8.0",
+ "resolved": "https://registry.npmjs.org/lit/-/lit-2.8.0.tgz",
+ "integrity": "sha512-4Sc3OFX9QHOJaHbmTMk28SYgVxLN3ePDjg7hofEft2zWlehFL3LiAuapWc4U/kYwMYJSh2hTCPZ6/LIC7ii0MA==",
+ "peer": true,
+ "dependencies": {
+ "@lit/reactive-element": "^1.6.0",
+ "lit-element": "^3.3.0",
+ "lit-html": "^2.8.0"
+ }
+ },
+ "node_modules/lit-element": {
+ "version": "3.3.3",
+ "resolved": "https://registry.npmjs.org/lit-element/-/lit-element-3.3.3.tgz",
+ "integrity": "sha512-XbeRxmTHubXENkV4h8RIPyr8lXc+Ff28rkcQzw3G6up2xg5E8Zu1IgOWIwBLEQsu3cOVFqdYwiVi0hv0SlpqUA==",
+ "peer": true,
+ "dependencies": {
+ "@lit-labs/ssr-dom-shim": "^1.1.0",
+ "@lit/reactive-element": "^1.3.0",
+ "lit-html": "^2.8.0"
+ }
+ },
+ "node_modules/lit-html": {
+ "version": "2.8.0",
+ "resolved": "https://registry.npmjs.org/lit-html/-/lit-html-2.8.0.tgz",
+ "integrity": "sha512-o9t+MQM3P4y7M7yNzqAyjp7z+mQGa4NS4CxiyLqFPyFWyc4O+nodLrkrxSaCTrla6M5YOLaT3RpbbqjszB5g3Q==",
+ "peer": true,
+ "dependencies": {
+ "@types/trusted-types": "^2.0.2"
+ }
+ },
+ "node_modules/lodash.castarray": {
+ "version": "4.4.0",
+ "resolved": "https://registry.npmjs.org/lodash.castarray/-/lodash.castarray-4.4.0.tgz",
+ "integrity": "sha512-aVx8ztPv7/2ULbArGJ2Y42bG1mEQ5mGjpdvrbJcJFU3TbYybe+QlLS4pst9zV52ymy2in1KpFPiZnAOATxD4+Q==",
+ "dev": true
+ },
+ "node_modules/lodash.debounce": {
+ "version": "4.0.8",
+ "resolved": "https://registry.npmjs.org/lodash.debounce/-/lodash.debounce-4.0.8.tgz",
+ "integrity": "sha512-FT1yDzDYEoYWhnSGnpE/4Kj1fLZkDFyqRb7fNt6FdYOSxlUWAtp42Eh6Wb0rGIv/m9Bgo7x4GhQbm5Ys4SG5ow=="
+ },
+ "node_modules/lodash.isplainobject": {
+ "version": "4.0.6",
+ "resolved": "https://registry.npmjs.org/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz",
+ "integrity": "sha512-oSXzaWypCMHkPC3NvBEaPHf0KsA5mvPrOPgQWDsbg8n7orZ290M0BmC/jgRZ4vcJ6DTAhjrsSYgdsW/F+MFOBA==",
+ "dev": true
+ },
+ "node_modules/lodash.merge": {
+ "version": "4.6.2",
+ "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz",
+ "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==",
+ "dev": true
+ },
+ "node_modules/longest-streak": {
+ "version": "3.1.0",
+ "resolved": "https://registry.npmjs.org/longest-streak/-/longest-streak-3.1.0.tgz",
+ "integrity": "sha512-9Ri+o0JYgehTaVBBDoMqIl8GXtbWg711O3srftcHhZ0dqnETqLaoIK0x17fUw9rFSlK/0NlsKe0Ahhyl5pXE2g==",
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
"node_modules/lru-cache": {
"version": "10.2.2",
"resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-10.2.2.tgz",
@@ -639,6 +2092,206 @@
"node": "14 || >=16.14"
}
},
+ "node_modules/markdown-table": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/markdown-table/-/markdown-table-3.0.3.tgz",
+ "integrity": "sha512-Z1NL3Tb1M9wH4XESsCDEksWoKTdlUafKc4pt0GRwjUyXaCFZ+dc3g2erqB6zm3szA2IUSi7VnPI+o/9jnxh9hw==",
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
+ "node_modules/mdast-util-definitions": {
+ "version": "6.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-definitions/-/mdast-util-definitions-6.0.0.tgz",
+ "integrity": "sha512-scTllyX6pnYNZH/AIp/0ePz6s4cZtARxImwoPJ7kS42n+MnVsI4XbnG6d4ibehRIldYMWM2LD7ImQblVhUejVQ==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "@types/unist": "^3.0.0",
+ "unist-util-visit": "^5.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-find-and-replace": {
+ "version": "3.0.1",
+ "resolved": "https://registry.npmjs.org/mdast-util-find-and-replace/-/mdast-util-find-and-replace-3.0.1.tgz",
+ "integrity": "sha512-SG21kZHGC3XRTSUhtofZkBzZTJNM5ecCi0SK2IMKmSXR8vO3peL+kb1O0z7Zl83jKtutG4k5Wv/W7V3/YHvzPA==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "escape-string-regexp": "^5.0.0",
+ "unist-util-is": "^6.0.0",
+ "unist-util-visit-parents": "^6.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-from-markdown": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-from-markdown/-/mdast-util-from-markdown-2.0.0.tgz",
+ "integrity": "sha512-n7MTOr/z+8NAX/wmhhDji8O3bRvPTV/U0oTCaZJkjhPSKTPhS3xufVhKGF8s1pJ7Ox4QgoIU7KHseh09S+9rTA==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "@types/unist": "^3.0.0",
+ "decode-named-character-reference": "^1.0.0",
+ "devlop": "^1.0.0",
+ "mdast-util-to-string": "^4.0.0",
+ "micromark": "^4.0.0",
+ "micromark-util-decode-numeric-character-reference": "^2.0.0",
+ "micromark-util-decode-string": "^2.0.0",
+ "micromark-util-normalize-identifier": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0",
+ "unist-util-stringify-position": "^4.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-gfm": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-gfm/-/mdast-util-gfm-3.0.0.tgz",
+ "integrity": "sha512-dgQEX5Amaq+DuUqf26jJqSK9qgixgd6rYDHAv4aTBuA92cTknZlKpPfa86Z/s8Dj8xsAQpFfBmPUHWJBWqS4Bw==",
+ "dependencies": {
+ "mdast-util-from-markdown": "^2.0.0",
+ "mdast-util-gfm-autolink-literal": "^2.0.0",
+ "mdast-util-gfm-footnote": "^2.0.0",
+ "mdast-util-gfm-strikethrough": "^2.0.0",
+ "mdast-util-gfm-table": "^2.0.0",
+ "mdast-util-gfm-task-list-item": "^2.0.0",
+ "mdast-util-to-markdown": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-gfm-autolink-literal": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-gfm-autolink-literal/-/mdast-util-gfm-autolink-literal-2.0.0.tgz",
+ "integrity": "sha512-FyzMsduZZHSc3i0Px3PQcBT4WJY/X/RCtEJKuybiC6sjPqLv7h1yqAkmILZtuxMSsUyaLUWNp71+vQH2zqp5cg==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "ccount": "^2.0.0",
+ "devlop": "^1.0.0",
+ "mdast-util-find-and-replace": "^3.0.0",
+ "micromark-util-character": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-gfm-footnote": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-gfm-footnote/-/mdast-util-gfm-footnote-2.0.0.tgz",
+ "integrity": "sha512-5jOT2boTSVkMnQ7LTrd6n/18kqwjmuYqo7JUPe+tRCY6O7dAuTFMtTPauYYrMPpox9hlN0uOx/FL8XvEfG9/mQ==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "devlop": "^1.1.0",
+ "mdast-util-from-markdown": "^2.0.0",
+ "mdast-util-to-markdown": "^2.0.0",
+ "micromark-util-normalize-identifier": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-gfm-strikethrough": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-gfm-strikethrough/-/mdast-util-gfm-strikethrough-2.0.0.tgz",
+ "integrity": "sha512-mKKb915TF+OC5ptj5bJ7WFRPdYtuHv0yTRxK2tJvi+BDqbkiG7h7u/9SI89nRAYcmap2xHQL9D+QG/6wSrTtXg==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "mdast-util-from-markdown": "^2.0.0",
+ "mdast-util-to-markdown": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-gfm-table": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-gfm-table/-/mdast-util-gfm-table-2.0.0.tgz",
+ "integrity": "sha512-78UEvebzz/rJIxLvE7ZtDd/vIQ0RHv+3Mh5DR96p7cS7HsBhYIICDBCu8csTNWNO6tBWfqXPWekRuj2FNOGOZg==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "devlop": "^1.0.0",
+ "markdown-table": "^3.0.0",
+ "mdast-util-from-markdown": "^2.0.0",
+ "mdast-util-to-markdown": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-gfm-task-list-item": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-gfm-task-list-item/-/mdast-util-gfm-task-list-item-2.0.0.tgz",
+ "integrity": "sha512-IrtvNvjxC1o06taBAVJznEnkiHxLFTzgonUdy8hzFVeDun0uTjxxrRGVaNFqkU1wJR3RBPEfsxmU6jDWPofrTQ==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "devlop": "^1.0.0",
+ "mdast-util-from-markdown": "^2.0.0",
+ "mdast-util-to-markdown": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-phrasing": {
+ "version": "4.1.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-phrasing/-/mdast-util-phrasing-4.1.0.tgz",
+ "integrity": "sha512-TqICwyvJJpBwvGAMZjj4J2n0X8QWp21b9l0o7eXyVJ25YNWYbJDVIyD1bZXE6WtV6RmKJVYmQAKWa0zWOABz2w==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "unist-util-is": "^6.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-to-markdown": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-to-markdown/-/mdast-util-to-markdown-2.1.0.tgz",
+ "integrity": "sha512-SR2VnIEdVNCJbP6y7kVTJgPLifdr8WEU440fQec7qHoHOUz/oJ2jmNRqdDQ3rbiStOXb2mCDGTuwsK5OPUgYlQ==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "@types/unist": "^3.0.0",
+ "longest-streak": "^3.0.0",
+ "mdast-util-phrasing": "^4.0.0",
+ "mdast-util-to-string": "^4.0.0",
+ "micromark-util-decode-string": "^2.0.0",
+ "unist-util-visit": "^5.0.0",
+ "zwitch": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/mdast-util-to-string": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/mdast-util-to-string/-/mdast-util-to-string-4.0.0.tgz",
+ "integrity": "sha512-0H44vDimn51F0YwvxSJSm0eCDOJTRlmN0R1yBh4HLj9wiV1Dn0QoXGbvFAWj2hSItVTlCmBF1hqKlIyUBVFLPg==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
"node_modules/merge2": {
"version": "1.4.1",
"resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz",
@@ -648,6 +2301,541 @@
"node": ">= 8"
}
},
+ "node_modules/micromark": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/micromark/-/micromark-4.0.0.tgz",
+ "integrity": "sha512-o/sd0nMof8kYff+TqcDx3VSrgBTcZpSvYcAHIfHhv5VAuNmisCxjhx6YmxS8PFEpb9z5WKWKPdzf0jM23ro3RQ==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "@types/debug": "^4.0.0",
+ "debug": "^4.0.0",
+ "decode-named-character-reference": "^1.0.0",
+ "devlop": "^1.0.0",
+ "micromark-core-commonmark": "^2.0.0",
+ "micromark-factory-space": "^2.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-chunked": "^2.0.0",
+ "micromark-util-combine-extensions": "^2.0.0",
+ "micromark-util-decode-numeric-character-reference": "^2.0.0",
+ "micromark-util-encode": "^2.0.0",
+ "micromark-util-normalize-identifier": "^2.0.0",
+ "micromark-util-resolve-all": "^2.0.0",
+ "micromark-util-sanitize-uri": "^2.0.0",
+ "micromark-util-subtokenize": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-core-commonmark": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/micromark-core-commonmark/-/micromark-core-commonmark-2.0.1.tgz",
+ "integrity": "sha512-CUQyKr1e///ZODyD1U3xit6zXwy1a8q2a1S1HKtIlmgvurrEpaw/Y9y6KSIbF8P59cn/NjzHyO+Q2fAyYLQrAA==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "decode-named-character-reference": "^1.0.0",
+ "devlop": "^1.0.0",
+ "micromark-factory-destination": "^2.0.0",
+ "micromark-factory-label": "^2.0.0",
+ "micromark-factory-space": "^2.0.0",
+ "micromark-factory-title": "^2.0.0",
+ "micromark-factory-whitespace": "^2.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-chunked": "^2.0.0",
+ "micromark-util-classify-character": "^2.0.0",
+ "micromark-util-html-tag-name": "^2.0.0",
+ "micromark-util-normalize-identifier": "^2.0.0",
+ "micromark-util-resolve-all": "^2.0.0",
+ "micromark-util-subtokenize": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-extension-gfm": {
+ "version": "3.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-extension-gfm/-/micromark-extension-gfm-3.0.0.tgz",
+ "integrity": "sha512-vsKArQsicm7t0z2GugkCKtZehqUm31oeGBV/KVSorWSy8ZlNAv7ytjFhvaryUiCUJYqs+NoE6AFhpQvBTM6Q4w==",
+ "dependencies": {
+ "micromark-extension-gfm-autolink-literal": "^2.0.0",
+ "micromark-extension-gfm-footnote": "^2.0.0",
+ "micromark-extension-gfm-strikethrough": "^2.0.0",
+ "micromark-extension-gfm-table": "^2.0.0",
+ "micromark-extension-gfm-tagfilter": "^2.0.0",
+ "micromark-extension-gfm-task-list-item": "^2.0.0",
+ "micromark-util-combine-extensions": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/micromark-extension-gfm-autolink-literal": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-extension-gfm-autolink-literal/-/micromark-extension-gfm-autolink-literal-2.0.0.tgz",
+ "integrity": "sha512-rTHfnpt/Q7dEAK1Y5ii0W8bhfJlVJFnJMHIPisfPK3gpVNuOP0VnRl96+YJ3RYWV/P4gFeQoGKNlT3RhuvpqAg==",
+ "dependencies": {
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-sanitize-uri": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/micromark-extension-gfm-footnote": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-extension-gfm-footnote/-/micromark-extension-gfm-footnote-2.0.0.tgz",
+ "integrity": "sha512-6Rzu0CYRKDv3BfLAUnZsSlzx3ak6HAoI85KTiijuKIz5UxZxbUI+pD6oHgw+6UtQuiRwnGRhzMmPRv4smcz0fg==",
+ "dependencies": {
+ "devlop": "^1.0.0",
+ "micromark-core-commonmark": "^2.0.0",
+ "micromark-factory-space": "^2.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-normalize-identifier": "^2.0.0",
+ "micromark-util-sanitize-uri": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/micromark-extension-gfm-strikethrough": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-extension-gfm-strikethrough/-/micromark-extension-gfm-strikethrough-2.0.0.tgz",
+ "integrity": "sha512-c3BR1ClMp5fxxmwP6AoOY2fXO9U8uFMKs4ADD66ahLTNcwzSCyRVU4k7LPV5Nxo/VJiR4TdzxRQY2v3qIUceCw==",
+ "dependencies": {
+ "devlop": "^1.0.0",
+ "micromark-util-chunked": "^2.0.0",
+ "micromark-util-classify-character": "^2.0.0",
+ "micromark-util-resolve-all": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/micromark-extension-gfm-table": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-extension-gfm-table/-/micromark-extension-gfm-table-2.0.0.tgz",
+ "integrity": "sha512-PoHlhypg1ItIucOaHmKE8fbin3vTLpDOUg8KAr8gRCF1MOZI9Nquq2i/44wFvviM4WuxJzc3demT8Y3dkfvYrw==",
+ "dependencies": {
+ "devlop": "^1.0.0",
+ "micromark-factory-space": "^2.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/micromark-extension-gfm-tagfilter": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-extension-gfm-tagfilter/-/micromark-extension-gfm-tagfilter-2.0.0.tgz",
+ "integrity": "sha512-xHlTOmuCSotIA8TW1mDIM6X2O1SiX5P9IuDtqGonFhEK0qgRI4yeC6vMxEV2dgyr2TiD+2PQ10o+cOhdVAcwfg==",
+ "dependencies": {
+ "micromark-util-types": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/micromark-extension-gfm-task-list-item": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/micromark-extension-gfm-task-list-item/-/micromark-extension-gfm-task-list-item-2.0.1.tgz",
+ "integrity": "sha512-cY5PzGcnULaN5O7T+cOzfMoHjBW7j+T9D2sucA5d/KbsBTPcYdebm9zUd9zzdgJGCwahV+/W78Z3nbulBYVbTw==",
+ "dependencies": {
+ "devlop": "^1.0.0",
+ "micromark-factory-space": "^2.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/micromark-factory-destination": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-factory-destination/-/micromark-factory-destination-2.0.0.tgz",
+ "integrity": "sha512-j9DGrQLm/Uhl2tCzcbLhy5kXsgkHUrjJHg4fFAeoMRwJmJerT9aw4FEhIbZStWN8A3qMwOp1uzHr4UL8AInxtA==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-factory-label": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-factory-label/-/micromark-factory-label-2.0.0.tgz",
+ "integrity": "sha512-RR3i96ohZGde//4WSe/dJsxOX6vxIg9TimLAS3i4EhBAFx8Sm5SmqVfR8E87DPSR31nEAjZfbt91OMZWcNgdZw==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "devlop": "^1.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-factory-space": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-factory-space/-/micromark-factory-space-2.0.0.tgz",
+ "integrity": "sha512-TKr+LIDX2pkBJXFLzpyPyljzYK3MtmllMUMODTQJIUfDGncESaqB90db9IAUcz4AZAJFdd8U9zOp9ty1458rxg==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-factory-title": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-factory-title/-/micromark-factory-title-2.0.0.tgz",
+ "integrity": "sha512-jY8CSxmpWLOxS+t8W+FG3Xigc0RDQA9bKMY/EwILvsesiRniiVMejYTE4wumNc2f4UbAa4WsHqe3J1QS1sli+A==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-factory-space": "^2.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-factory-whitespace": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-factory-whitespace/-/micromark-factory-whitespace-2.0.0.tgz",
+ "integrity": "sha512-28kbwaBjc5yAI1XadbdPYHX/eDnqaUFVikLwrO7FDnKG7lpgxnvk/XGRhX/PN0mOZ+dBSZ+LgunHS+6tYQAzhA==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-factory-space": "^2.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-character": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-character/-/micromark-util-character-2.1.0.tgz",
+ "integrity": "sha512-KvOVV+X1yLBfs9dCBSopq/+G1PcgT3lAK07mC4BzXi5E7ahzMAF8oIupDDJ6mievI6F+lAATkbQQlQixJfT3aQ==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-chunked": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-chunked/-/micromark-util-chunked-2.0.0.tgz",
+ "integrity": "sha512-anK8SWmNphkXdaKgz5hJvGa7l00qmcaUQoMYsBwDlSKFKjc6gjGXPDw3FNL3Nbwq5L8gE+RCbGqTw49FK5Qyvg==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-symbol": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-classify-character": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-classify-character/-/micromark-util-classify-character-2.0.0.tgz",
+ "integrity": "sha512-S0ze2R9GH+fu41FA7pbSqNWObo/kzwf8rN/+IGlW/4tC6oACOs8B++bh+i9bVyNnwCcuksbFwsBme5OCKXCwIw==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-combine-extensions": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-combine-extensions/-/micromark-util-combine-extensions-2.0.0.tgz",
+ "integrity": "sha512-vZZio48k7ON0fVS3CUgFatWHoKbbLTK/rT7pzpJ4Bjp5JjkZeasRfrS9wsBdDJK2cJLHMckXZdzPSSr1B8a4oQ==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-chunked": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-decode-numeric-character-reference": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/micromark-util-decode-numeric-character-reference/-/micromark-util-decode-numeric-character-reference-2.0.1.tgz",
+ "integrity": "sha512-bmkNc7z8Wn6kgjZmVHOX3SowGmVdhYS7yBpMnuMnPzDq/6xwVA604DuOXMZTO1lvq01g+Adfa0pE2UKGlxL1XQ==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-symbol": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-decode-string": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-decode-string/-/micromark-util-decode-string-2.0.0.tgz",
+ "integrity": "sha512-r4Sc6leeUTn3P6gk20aFMj2ntPwn6qpDZqWvYmAG6NgvFTIlj4WtrAudLi65qYoaGdXYViXYw2pkmn7QnIFasA==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "decode-named-character-reference": "^1.0.0",
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-decode-numeric-character-reference": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-encode": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-encode/-/micromark-util-encode-2.0.0.tgz",
+ "integrity": "sha512-pS+ROfCXAGLWCOc8egcBvT0kf27GoWMqtdarNfDcjb6YLuV5cM3ioG45Ys2qOVqeqSbjaKg72vU+Wby3eddPsA==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ]
+ },
+ "node_modules/micromark-util-html-tag-name": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-html-tag-name/-/micromark-util-html-tag-name-2.0.0.tgz",
+ "integrity": "sha512-xNn4Pqkj2puRhKdKTm8t1YHC/BAjx6CEwRFXntTaRf/x16aqka6ouVoutm+QdkISTlT7e2zU7U4ZdlDLJd2Mcw==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ]
+ },
+ "node_modules/micromark-util-normalize-identifier": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-normalize-identifier/-/micromark-util-normalize-identifier-2.0.0.tgz",
+ "integrity": "sha512-2xhYT0sfo85FMrUPtHcPo2rrp1lwbDEEzpx7jiH2xXJLqBuy4H0GgXk5ToU8IEwoROtXuL8ND0ttVa4rNqYK3w==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-symbol": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-resolve-all": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-resolve-all/-/micromark-util-resolve-all-2.0.0.tgz",
+ "integrity": "sha512-6KU6qO7DZ7GJkaCgwBNtplXCvGkJToU86ybBAUdavvgsCiG8lSSvYxr9MhwmQ+udpzywHsl4RpGJsYWG1pDOcA==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-sanitize-uri": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-sanitize-uri/-/micromark-util-sanitize-uri-2.0.0.tgz",
+ "integrity": "sha512-WhYv5UEcZrbAtlsnPuChHUAsu/iBPOVaEVsntLBIdpibO0ddy8OzavZz3iL2xVvBZOpolujSliP65Kq0/7KIYw==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "micromark-util-character": "^2.0.0",
+ "micromark-util-encode": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-subtokenize": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/micromark-util-subtokenize/-/micromark-util-subtokenize-2.0.1.tgz",
+ "integrity": "sha512-jZNtiFl/1aY73yS3UGQkutD0UbhTt68qnRpw2Pifmz5wV9h8gOVsN70v+Lq/f1rKaU/W8pxRe8y8Q9FX1AOe1Q==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ],
+ "dependencies": {
+ "devlop": "^1.0.0",
+ "micromark-util-chunked": "^2.0.0",
+ "micromark-util-symbol": "^2.0.0",
+ "micromark-util-types": "^2.0.0"
+ }
+ },
+ "node_modules/micromark-util-symbol": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-symbol/-/micromark-util-symbol-2.0.0.tgz",
+ "integrity": "sha512-8JZt9ElZ5kyTnO94muPxIGS8oyElRJaiJO8EzV6ZSyGQ1Is8xwl4Q45qU5UOg+bGH4AikWziz0iN4sFLWs8PGw==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ]
+ },
+ "node_modules/micromark-util-types": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/micromark-util-types/-/micromark-util-types-2.0.0.tgz",
+ "integrity": "sha512-oNh6S2WMHWRZrmutsRmDDfkzKtxF+bc2VxLC9dvtrDIRFln627VsFP6fLMgTryGDljgLPjkrzQSDcPrjPyDJ5w==",
+ "funding": [
+ {
+ "type": "GitHub Sponsors",
+ "url": "https://github.com/sponsors/unifiedjs"
+ },
+ {
+ "type": "OpenCollective",
+ "url": "https://opencollective.com/unified"
+ }
+ ]
+ },
"node_modules/micromatch": {
"version": "4.0.5",
"resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.5.tgz",
@@ -661,6 +2849,15 @@
"node": ">=8.6"
}
},
+ "node_modules/mini-svg-data-uri": {
+ "version": "1.4.4",
+ "resolved": "https://registry.npmjs.org/mini-svg-data-uri/-/mini-svg-data-uri-1.4.4.tgz",
+ "integrity": "sha512-r9deDe9p5FJUPZAk3A59wGH7Ii9YrjjWw0jmw/liSbHl2CHiyXj6FcDXDu2K3TjVAXqiJdaw3xxwlZZr9E6nHg==",
+ "dev": true,
+ "bin": {
+ "mini-svg-data-uri": "cli.js"
+ }
+ },
"node_modules/minimatch": {
"version": "9.0.4",
"resolved": "https://registry.npmjs.org/minimatch/-/minimatch-9.0.4.tgz",
@@ -685,6 +2882,11 @@
"node": ">=16 || 14 >=14.17"
}
},
+ "node_modules/ms": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz",
+ "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w=="
+ },
"node_modules/mz": {
"version": "2.7.0",
"resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz",
@@ -741,6 +2943,12 @@
"node": ">= 6"
}
},
+ "node_modules/orderedmap": {
+ "version": "2.1.1",
+ "resolved": "https://registry.npmjs.org/orderedmap/-/orderedmap-2.1.1.tgz",
+ "integrity": "sha512-TvAWxi0nDe1j/rtMcWcIj94+Ffe6n7zhow33h40SKxmsmozs6dz/e+EajymfoFcHd7sxNn8yHM8839uixMOV6g==",
+ "peer": true
+ },
"node_modules/path-key": {
"version": "3.1.1",
"resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz",
@@ -957,6 +3165,145 @@
"integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==",
"dev": true
},
+ "node_modules/prosemirror-changeset": {
+ "version": "2.2.1",
+ "resolved": "https://registry.npmjs.org/prosemirror-changeset/-/prosemirror-changeset-2.2.1.tgz",
+ "integrity": "sha512-J7msc6wbxB4ekDFj+n9gTW/jav/p53kdlivvuppHsrZXCaQdVgRghoZbSS3kwrRyAstRVQ4/+u5k7YfLgkkQvQ==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-transform": "^1.0.0"
+ }
+ },
+ "node_modules/prosemirror-commands": {
+ "version": "1.5.2",
+ "resolved": "https://registry.npmjs.org/prosemirror-commands/-/prosemirror-commands-1.5.2.tgz",
+ "integrity": "sha512-hgLcPaakxH8tu6YvVAaILV2tXYsW3rAdDR8WNkeKGcgeMVQg3/TMhPdVoh7iAmfgVjZGtcOSjKiQaoeKjzd2mQ==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-model": "^1.0.0",
+ "prosemirror-state": "^1.0.0",
+ "prosemirror-transform": "^1.0.0"
+ }
+ },
+ "node_modules/prosemirror-dropcursor": {
+ "version": "1.8.1",
+ "resolved": "https://registry.npmjs.org/prosemirror-dropcursor/-/prosemirror-dropcursor-1.8.1.tgz",
+ "integrity": "sha512-M30WJdJZLyXHi3N8vxN6Zh5O8ZBbQCz0gURTfPmTIBNQ5pxrdU7A58QkNqfa98YEjSAL1HUyyU34f6Pm5xBSGw==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-state": "^1.0.0",
+ "prosemirror-transform": "^1.1.0",
+ "prosemirror-view": "^1.1.0"
+ }
+ },
+ "node_modules/prosemirror-gapcursor": {
+ "version": "1.3.2",
+ "resolved": "https://registry.npmjs.org/prosemirror-gapcursor/-/prosemirror-gapcursor-1.3.2.tgz",
+ "integrity": "sha512-wtjswVBd2vaQRrnYZaBCbyDqr232Ed4p2QPtRIUK5FuqHYKGWkEwl08oQM4Tw7DOR0FsasARV5uJFvMZWxdNxQ==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-keymap": "^1.0.0",
+ "prosemirror-model": "^1.0.0",
+ "prosemirror-state": "^1.0.0",
+ "prosemirror-view": "^1.0.0"
+ }
+ },
+ "node_modules/prosemirror-history": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/prosemirror-history/-/prosemirror-history-1.4.0.tgz",
+ "integrity": "sha512-UUiGzDVcqo1lovOPdi9YxxUps3oBFWAIYkXLu3Ot+JPv1qzVogRbcizxK3LhHmtaUxclohgiOVesRw5QSlMnbQ==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-state": "^1.2.2",
+ "prosemirror-transform": "^1.0.0",
+ "prosemirror-view": "^1.31.0",
+ "rope-sequence": "^1.3.0"
+ }
+ },
+ "node_modules/prosemirror-inputrules": {
+ "version": "1.4.0",
+ "resolved": "https://registry.npmjs.org/prosemirror-inputrules/-/prosemirror-inputrules-1.4.0.tgz",
+ "integrity": "sha512-6ygpPRuTJ2lcOXs9JkefieMst63wVJBgHZGl5QOytN7oSZs3Co/BYbc3Yx9zm9H37Bxw8kVzCnDsihsVsL4yEg==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-state": "^1.0.0",
+ "prosemirror-transform": "^1.0.0"
+ }
+ },
+ "node_modules/prosemirror-keymap": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/prosemirror-keymap/-/prosemirror-keymap-1.2.2.tgz",
+ "integrity": "sha512-EAlXoksqC6Vbocqc0GtzCruZEzYgrn+iiGnNjsJsH4mrnIGex4qbLdWWNza3AW5W36ZRrlBID0eM6bdKH4OStQ==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-state": "^1.0.0",
+ "w3c-keyname": "^2.2.0"
+ }
+ },
+ "node_modules/prosemirror-model": {
+ "version": "1.21.0",
+ "resolved": "https://registry.npmjs.org/prosemirror-model/-/prosemirror-model-1.21.0.tgz",
+ "integrity": "sha512-zLpS1mVCZLA7VTp82P+BfMiYVPcX1/z0Mf3gsjKZtzMWubwn2pN7CceMV0DycjlgE5JeXPR7UF4hJPbBV98oWA==",
+ "peer": true,
+ "dependencies": {
+ "orderedmap": "^2.0.0"
+ }
+ },
+ "node_modules/prosemirror-schema-list": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/prosemirror-schema-list/-/prosemirror-schema-list-1.3.0.tgz",
+ "integrity": "sha512-Hz/7gM4skaaYfRPNgr421CU4GSwotmEwBVvJh5ltGiffUJwm7C8GfN/Bc6DR1EKEp5pDKhODmdXXyi9uIsZl5A==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-model": "^1.0.0",
+ "prosemirror-state": "^1.0.0",
+ "prosemirror-transform": "^1.7.3"
+ }
+ },
+ "node_modules/prosemirror-state": {
+ "version": "1.4.3",
+ "resolved": "https://registry.npmjs.org/prosemirror-state/-/prosemirror-state-1.4.3.tgz",
+ "integrity": "sha512-goFKORVbvPuAQaXhpbemJFRKJ2aixr+AZMGiquiqKxaucC6hlpHNZHWgz5R7dS4roHiwq9vDctE//CZ++o0W1Q==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-model": "^1.0.0",
+ "prosemirror-transform": "^1.0.0",
+ "prosemirror-view": "^1.27.0"
+ }
+ },
+ "node_modules/prosemirror-tables": {
+ "version": "1.3.7",
+ "resolved": "https://registry.npmjs.org/prosemirror-tables/-/prosemirror-tables-1.3.7.tgz",
+ "integrity": "sha512-oEwX1wrziuxMtwFvdDWSFHVUWrFJWt929kVVfHvtTi8yvw+5ppxjXZkMG/fuTdFo+3DXyIPSKfid+Be1npKXDA==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-keymap": "^1.1.2",
+ "prosemirror-model": "^1.8.1",
+ "prosemirror-state": "^1.3.1",
+ "prosemirror-transform": "^1.2.1",
+ "prosemirror-view": "^1.13.3"
+ }
+ },
+ "node_modules/prosemirror-transform": {
+ "version": "1.9.0",
+ "resolved": "https://registry.npmjs.org/prosemirror-transform/-/prosemirror-transform-1.9.0.tgz",
+ "integrity": "sha512-5UXkr1LIRx3jmpXXNKDhv8OyAOeLTGuXNwdVfg8x27uASna/wQkr9p6fD3eupGOi4PLJfbezxTyi/7fSJypXHg==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-model": "^1.21.0"
+ }
+ },
+ "node_modules/prosemirror-view": {
+ "version": "1.33.6",
+ "resolved": "https://registry.npmjs.org/prosemirror-view/-/prosemirror-view-1.33.6.tgz",
+ "integrity": "sha512-zRLUNgLIQfd8IfGprsXxWTjdA8xEAFJe8cDNrOptj6Mop9sj+BMeVbJvceyAYCm5G2dOdT2prctH7K9dfnpIMw==",
+ "peer": true,
+ "dependencies": {
+ "prosemirror-model": "^1.20.0",
+ "prosemirror-state": "^1.0.0",
+ "prosemirror-transform": "^1.1.0"
+ }
+ },
"node_modules/queue-microtask": {
"version": "1.2.3",
"resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz",
@@ -998,6 +3345,82 @@
"node": ">=8.10.0"
}
},
+ "node_modules/remark": {
+ "version": "15.0.1",
+ "resolved": "https://registry.npmjs.org/remark/-/remark-15.0.1.tgz",
+ "integrity": "sha512-Eht5w30ruCXgFmxVUSlNWQ9iiimq07URKeFS3hNc8cUWy1llX4KDWfyEDZRycMc+znsN9Ux5/tJ/BFdgdOwA3A==",
+ "peer": true,
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "remark-parse": "^11.0.0",
+ "remark-stringify": "^11.0.0",
+ "unified": "^11.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/remark-gfm": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/remark-gfm/-/remark-gfm-4.0.0.tgz",
+ "integrity": "sha512-U92vJgBPkbw4Zfu/IiW2oTZLSL3Zpv+uI7My2eq8JxKgqraFdU8YUGicEJCEgSbeaG+QDFqIcwwfMTOEelPxuA==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "mdast-util-gfm": "^3.0.0",
+ "micromark-extension-gfm": "^3.0.0",
+ "remark-parse": "^11.0.0",
+ "remark-stringify": "^11.0.0",
+ "unified": "^11.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/remark-inline-links": {
+ "version": "7.0.0",
+ "resolved": "https://registry.npmjs.org/remark-inline-links/-/remark-inline-links-7.0.0.tgz",
+ "integrity": "sha512-4uj1pPM+F495ySZhTIB6ay2oSkTsKgmYaKk/q5HIdhX2fuyLEegpjWa0VdJRJ01sgOqAFo7MBKdDUejIYBMVMQ==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "mdast-util-definitions": "^6.0.0",
+ "unist-util-visit": "^5.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/remark-parse": {
+ "version": "11.0.0",
+ "resolved": "https://registry.npmjs.org/remark-parse/-/remark-parse-11.0.0.tgz",
+ "integrity": "sha512-FCxlKLNGknS5ba/1lmpYijMUzX2esxW5xQqjWxw2eHFfS2MSdaHVINFmhjo+qN1WhZhNimq0dZATN9pH0IDrpA==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "mdast-util-from-markdown": "^2.0.0",
+ "micromark-util-types": "^2.0.0",
+ "unified": "^11.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/remark-stringify": {
+ "version": "11.0.0",
+ "resolved": "https://registry.npmjs.org/remark-stringify/-/remark-stringify-11.0.0.tgz",
+ "integrity": "sha512-1OSmLd3awB/t8qdoEOMazZkNsfVTeY4fTsgzcQFdXNq8ToTN4ZGwrMnlda4K6smTFKD+GRV6O48i6Z4iKgPPpw==",
+ "dependencies": {
+ "@types/mdast": "^4.0.0",
+ "mdast-util-to-markdown": "^2.0.0",
+ "unified": "^11.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
"node_modules/resolve": {
"version": "1.22.8",
"resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.8.tgz",
@@ -1025,6 +3448,12 @@
"node": ">=0.10.0"
}
},
+ "node_modules/rope-sequence": {
+ "version": "1.3.4",
+ "resolved": "https://registry.npmjs.org/rope-sequence/-/rope-sequence-1.3.4.tgz",
+ "integrity": "sha512-UT5EDe2cu2E/6O4igUr5PSFs23nvvukicWHx6GnOPlHAiiYbzNuCRQCuiUdHJQcqKalLKlrYJnjY0ySGsXNQXQ==",
+ "peer": true
+ },
"node_modules/run-parallel": {
"version": "1.2.0",
"resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz",
@@ -1186,6 +3615,12 @@
"node": ">=8"
}
},
+ "node_modules/style-mod": {
+ "version": "4.1.2",
+ "resolved": "https://registry.npmjs.org/style-mod/-/style-mod-4.1.2.tgz",
+ "integrity": "sha512-wnD1HyVqpJUI2+eKZ+eo1UwghftP6yuFheBqqe+bWCotBjC2K1YnteJILRMs3SM4V/0dLEW1SC27MWP5y+mwmw==",
+ "peer": true
+ },
"node_modules/sucrase": {
"version": "3.35.0",
"resolved": "https://registry.npmjs.org/sucrase/-/sucrase-3.35.0.tgz",
@@ -1278,6 +3713,15 @@
"node": ">=0.8"
}
},
+ "node_modules/tippy.js": {
+ "version": "6.3.7",
+ "resolved": "https://registry.npmjs.org/tippy.js/-/tippy.js-6.3.7.tgz",
+ "integrity": "sha512-E1d3oP2emgJ9dRQZdf3Kkn0qJgI6ZLpyS5z6ZkY1DF3kaQaBsGZsndEpHwx+eC+tYM41HaSNvNtLx8tU57FzTQ==",
+ "peer": true,
+ "dependencies": {
+ "@popperjs/core": "^2.9.0"
+ }
+ },
"node_modules/to-regex-range": {
"version": "5.0.1",
"resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",
@@ -1290,18 +3734,134 @@
"node": ">=8.0"
}
},
+ "node_modules/trough": {
+ "version": "2.2.0",
+ "resolved": "https://registry.npmjs.org/trough/-/trough-2.2.0.tgz",
+ "integrity": "sha512-tmMpK00BjZiUyVyvrBK7knerNgmgvcV/KLVyuma/SC+TQN167GrMRciANTz09+k3zW8L8t60jWO1GpfkZdjTaw==",
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
+ },
"node_modules/ts-interface-checker": {
"version": "0.1.13",
"resolved": "https://registry.npmjs.org/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz",
"integrity": "sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==",
"dev": true
},
+ "node_modules/tslib": {
+ "version": "2.6.2",
+ "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.6.2.tgz",
+ "integrity": "sha512-AEYxH93jGFPn/a2iVAwW87VuUIkR1FVUKB77NwMF7nBTDkDrrT/Hpt/IrCJ0QXhW27jTBDcf5ZY7w6RiqTMw2Q=="
+ },
+ "node_modules/unified": {
+ "version": "11.0.4",
+ "resolved": "https://registry.npmjs.org/unified/-/unified-11.0.4.tgz",
+ "integrity": "sha512-apMPnyLjAX+ty4OrNap7yumyVAMlKx5IWU2wlzzUdYJO9A8f1p9m/gywF/GM2ZDFcjQPrx59Mc90KwmxsoklxQ==",
+ "dependencies": {
+ "@types/unist": "^3.0.0",
+ "bail": "^2.0.0",
+ "devlop": "^1.0.0",
+ "extend": "^3.0.0",
+ "is-plain-obj": "^4.0.0",
+ "trough": "^2.0.0",
+ "vfile": "^6.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/unist-util-is": {
+ "version": "6.0.0",
+ "resolved": "https://registry.npmjs.org/unist-util-is/-/unist-util-is-6.0.0.tgz",
+ "integrity": "sha512-2qCTHimwdxLfz+YzdGfkqNlH0tLi9xjTnHddPmJwtIG9MGsdbutfTc4P+haPD7l7Cjxf/WZj+we5qfVPvvxfYw==",
+ "dependencies": {
+ "@types/unist": "^3.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/unist-util-stringify-position": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/unist-util-stringify-position/-/unist-util-stringify-position-4.0.0.tgz",
+ "integrity": "sha512-0ASV06AAoKCDkS2+xw5RXJywruurpbC4JZSm7nr7MOt1ojAzvyyaO+UxZf18j8FCF6kmzCZKcAgN/yu2gm2XgQ==",
+ "dependencies": {
+ "@types/unist": "^3.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/unist-util-visit": {
+ "version": "5.0.0",
+ "resolved": "https://registry.npmjs.org/unist-util-visit/-/unist-util-visit-5.0.0.tgz",
+ "integrity": "sha512-MR04uvD+07cwl/yhVuVWAtw+3GOR/knlL55Nd/wAdblk27GCVt3lqpTivy/tkJcZoNPzTwS1Y+KMojlLDhoTzg==",
+ "dependencies": {
+ "@types/unist": "^3.0.0",
+ "unist-util-is": "^6.0.0",
+ "unist-util-visit-parents": "^6.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/unist-util-visit-parents": {
+ "version": "6.0.1",
+ "resolved": "https://registry.npmjs.org/unist-util-visit-parents/-/unist-util-visit-parents-6.0.1.tgz",
+ "integrity": "sha512-L/PqWzfTP9lzzEa6CKs0k2nARxTdZduw3zyh8d2NVBnsyvHjSX4TWse388YrrQKbvI8w20fGjGlhgT96WwKykw==",
+ "dependencies": {
+ "@types/unist": "^3.0.0",
+ "unist-util-is": "^6.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
"node_modules/util-deprecate": {
"version": "1.0.2",
"resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
"integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==",
"dev": true
},
+ "node_modules/vfile": {
+ "version": "6.0.1",
+ "resolved": "https://registry.npmjs.org/vfile/-/vfile-6.0.1.tgz",
+ "integrity": "sha512-1bYqc7pt6NIADBJ98UiG0Bn/CHIVOoZ/IyEkqIruLg0mE1BKzkOXY2D6CSqQIcKqgadppE5lrxgWXJmXd7zZJw==",
+ "dependencies": {
+ "@types/unist": "^3.0.0",
+ "unist-util-stringify-position": "^4.0.0",
+ "vfile-message": "^4.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/vfile-message": {
+ "version": "4.0.2",
+ "resolved": "https://registry.npmjs.org/vfile-message/-/vfile-message-4.0.2.tgz",
+ "integrity": "sha512-jRDZ1IMLttGj41KcZvlrYAaI3CfqpLpfpf+Mfig13viT6NKvRzWZ+lXz0Y5D60w6uJIBAOGq9mSHf0gktF0duw==",
+ "dependencies": {
+ "@types/unist": "^3.0.0",
+ "unist-util-stringify-position": "^4.0.0"
+ },
+ "funding": {
+ "type": "opencollective",
+ "url": "https://opencollective.com/unified"
+ }
+ },
+ "node_modules/w3c-keyname": {
+ "version": "2.2.8",
+ "resolved": "https://registry.npmjs.org/w3c-keyname/-/w3c-keyname-2.2.8.tgz",
+ "integrity": "sha512-dpojBhNsCNN7T82Tm7k26A6G9ML3NkhDsnw9n/eoxSRlVBB4CEtIQ/KTCLI2Fwf3ataSXRhYFkQi3SlnFwPvPQ==",
+ "peer": true
+ },
"node_modules/which": {
"version": "2.0.2",
"resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz",
@@ -1419,6 +3979,15 @@
"engines": {
"node": ">= 14"
}
+ },
+ "node_modules/zwitch": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/zwitch/-/zwitch-2.0.4.tgz",
+ "integrity": "sha512-bXE4cR/kVZhKZX/RjPEflHaKVhUVl85noU3v6b8apfQEc1x4A+zBxjZ4lN8LqGd6WZ3dl98pY4o717VFmoPp+A==",
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wooorm"
+ }
}
}
}
diff --git a/package.json b/package.json
index be0d4f8..d595706 100644
--- a/package.json
+++ b/package.json
@@ -1,6 +1,26 @@
{
"devDependencies": {
+ "@tailwindcss/forms": "^0.5.7",
+ "@tailwindcss/typography": "^0.5.13",
"daisyui": "^4.10.5",
+ "esbuild": "0.21.1",
+ "tailwindcss": "^3.4.3"
+ },
+ "scripts": {
+ "build": "esbuild frontend/main.ts --bundle --outfile=static/main.js --target=es2017",
+ "build-watch": "esbuild frontend/main.ts --bundle --outfile=static/main.js --target=es2017 --watch",
+ "css-watch": "tailwindcss -i ./frontend/main.css -o ./static/style.css --watch",
+ "css": "tailwindcss -i ./frontend/main.css -o ./static/style.css"
+ },
+ "dependencies": {
+ "@milkdown/components": "^7.3.6",
+ "@milkdown/core": "^7.3.6",
+ "@milkdown/plugin-listener": "^7.3.6",
+ "@milkdown/preset-commonmark": "^7.3.6",
+ "@milkdown/preset-gfm": "^7.3.6",
+ "@milkdown/theme-nord": "^7.3.6",
+ "@prosemirror-adapter/lit": "^0.2.6",
+ "clsx": "^2.1.1",
"tailwindcss": "^3.4.3"
}
}
diff --git a/src/main.css b/src/main.css
deleted file mode 100644
index b5c61c9..0000000
--- a/src/main.css
+++ /dev/null
@@ -1,3 +0,0 @@
-@tailwind base;
-@tailwind components;
-@tailwind utilities;
diff --git a/static/main.css b/static/main.css
index 8f0f36c..0456fee 100644
--- a/static/main.css
+++ b/static/main.css
@@ -1,1828 +1,196 @@
-/*
-! tailwindcss v3.4.3 | MIT License | https://tailwindcss.com
-*/
-
-/*
-1. Prevent padding and border from affecting element width. (https://github.com/mozdevs/cssremedy/issues/4)
-2. Allow adding a border to an element by just adding a border-width. (https://github.com/tailwindcss/tailwindcss/pull/116)
-*/
-
-*,
-::before,
-::after {
- box-sizing: border-box;
- /* 1 */
- border-width: 0;
- /* 2 */
- border-style: solid;
- /* 2 */
- border-color: #e5e7eb;
- /* 2 */
-}
-
-::before,
-::after {
- --tw-content: '';
-}
-
-/*
-1. Use a consistent sensible line-height in all browsers.
-2. Prevent adjustments of font size after orientation changes in iOS.
-3. Use a more readable tab size.
-4. Use the user's configured `sans` font-family by default.
-5. Use the user's configured `sans` font-feature-settings by default.
-6. Use the user's configured `sans` font-variation-settings by default.
-7. Disable tap highlights on iOS
-*/
-
-html,
-:host {
- line-height: 1.5;
- /* 1 */
- -webkit-text-size-adjust: 100%;
- /* 2 */
- -moz-tab-size: 4;
- /* 3 */
- -o-tab-size: 4;
- tab-size: 4;
- /* 3 */
- font-family: ui-sans-serif, system-ui, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
- /* 4 */
- font-feature-settings: normal;
- /* 5 */
- font-variation-settings: normal;
- /* 6 */
- -webkit-tap-highlight-color: transparent;
- /* 7 */
-}
-
-/*
-1. Remove the margin in all browsers.
-2. Inherit line-height from `html` so users can set them as a class directly on the `html` element.
-*/
-
-body {
- margin: 0;
- /* 1 */
- line-height: inherit;
- /* 2 */
-}
-
-/*
-1. Add the correct height in Firefox.
-2. Correct the inheritance of border color in Firefox. (https://bugzilla.mozilla.org/show_bug.cgi?id=190655)
-3. Ensure horizontal rules are visible by default.
-*/
-
-hr {
- height: 0;
- /* 1 */
- color: inherit;
- /* 2 */
- border-top-width: 1px;
- /* 3 */
-}
-
-/*
-Add the correct text decoration in Chrome, Edge, and Safari.
-*/
-
-abbr:where([title]) {
- -webkit-text-decoration: underline dotted;
- text-decoration: underline dotted;
-}
-
-/*
-Remove the default font size and weight for headings.
-*/
-
-h1,
-h2,
-h3,
-h4,
-h5,
-h6 {
- font-size: inherit;
- font-weight: inherit;
-}
-
-/*
-Reset links to optimize for opt-in styling instead of opt-out.
-*/
-
-a {
- color: inherit;
- text-decoration: inherit;
-}
-
-/*
-Add the correct font weight in Edge and Safari.
-*/
-
-b,
-strong {
- font-weight: bolder;
-}
-
-/*
-1. Use the user's configured `mono` font-family by default.
-2. Use the user's configured `mono` font-feature-settings by default.
-3. Use the user's configured `mono` font-variation-settings by default.
-4. Correct the odd `em` font sizing in all browsers.
-*/
-
-code,
-kbd,
-samp,
-pre {
- font-family: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
- /* 1 */
- font-feature-settings: normal;
- /* 2 */
- font-variation-settings: normal;
- /* 3 */
- font-size: 1em;
- /* 4 */
-}
-
-/*
-Add the correct font size in all browsers.
-*/
-
-small {
- font-size: 80%;
-}
-
-/*
-Prevent `sub` and `sup` elements from affecting the line height in all browsers.
-*/
-
-sub,
-sup {
- font-size: 75%;
- line-height: 0;
+/* node_modules/@milkdown/theme-nord/lib/style.css */
+.ProseMirror {
position: relative;
- vertical-align: baseline;
+ word-wrap: break-word;
+ white-space: pre-wrap;
+ white-space: break-spaces;
+ font-variant-ligatures: none;
+ font-feature-settings: "liga" 0;
}
-
-sub {
- bottom: -0.25em;
+.ProseMirror pre {
+ white-space: pre-wrap;
}
-
-sup {
- top: -0.5em;
+.ProseMirror li {
+ position: relative;
}
-
-/*
-1. Remove text indentation from table contents in Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=999088, https://bugs.webkit.org/show_bug.cgi?id=201297)
-2. Correct table border color inheritance in all Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=935729, https://bugs.webkit.org/show_bug.cgi?id=195016)
-3. Remove gaps between table borders by default.
-*/
-
-table {
- text-indent: 0;
- /* 1 */
- border-color: inherit;
- /* 2 */
- border-collapse: collapse;
- /* 3 */
+.ProseMirror-hideselection *::selection {
+ background: transparent;
}
-
-/*
-1. Change the font styles in all browsers.
-2. Remove the margin in Firefox and Safari.
-3. Remove default padding in all browsers.
-*/
-
-button,
-input,
-optgroup,
-select,
-textarea {
- font-family: inherit;
- /* 1 */
- font-feature-settings: inherit;
- /* 1 */
- font-variation-settings: inherit;
- /* 1 */
- font-size: 100%;
- /* 1 */
- font-weight: inherit;
- /* 1 */
- line-height: inherit;
- /* 1 */
- letter-spacing: inherit;
- /* 1 */
- color: inherit;
- /* 1 */
- margin: 0;
- /* 2 */
- padding: 0;
- /* 3 */
+.ProseMirror-hideselection *::-moz-selection {
+ background: transparent;
}
-
-/*
-Remove the inheritance of text transform in Edge and Firefox.
-*/
-
-button,
-select {
- text-transform: none;
+.ProseMirror-hideselection {
+ caret-color: transparent;
}
-
-/*
-1. Correct the inability to style clickable types in iOS and Safari.
-2. Remove default button styles.
-*/
-
-button,
-input:where([type='button']),
-input:where([type='reset']),
-input:where([type='submit']) {
- -webkit-appearance: button;
- /* 1 */
- background-color: transparent;
- /* 2 */
- background-image: none;
- /* 2 */
+.ProseMirror [draggable][contenteditable=false] {
+ -webkit-user-select: text;
+ -moz-user-select: text;
+ user-select: text;
}
-
-/*
-Use the modern Firefox focus style for all focusable elements.
-*/
-
-:-moz-focusring {
- outline: auto;
+.ProseMirror-selectednode {
+ outline: 2px solid #8cf;
}
-
-/*
-Remove the additional `:invalid` styles in Firefox. (https://github.com/mozilla/gecko-dev/blob/2f9eacd9d3d995c937b4251a5557d95d494c9be1/layout/style/res/forms.css#L728-L737)
-*/
-
-:-moz-ui-invalid {
- box-shadow: none;
+li.ProseMirror-selectednode {
+ outline: none;
}
-
-/*
-Add the correct vertical alignment in Chrome and Firefox.
-*/
-
-progress {
- vertical-align: baseline;
-}
-
-/*
-Correct the cursor style of increment and decrement buttons in Safari.
-*/
-
-::-webkit-inner-spin-button,
-::-webkit-outer-spin-button {
- height: auto;
-}
-
-/*
-1. Correct the odd appearance in Chrome and Safari.
-2. Correct the outline style in Safari.
-*/
-
-[type='search'] {
- -webkit-appearance: textfield;
- /* 1 */
- outline-offset: -2px;
- /* 2 */
-}
-
-/*
-Remove the inner padding in Chrome and Safari on macOS.
-*/
-
-::-webkit-search-decoration {
- -webkit-appearance: none;
-}
-
-/*
-1. Correct the inability to style clickable types in iOS and Safari.
-2. Change font properties to `inherit` in Safari.
-*/
-
-::-webkit-file-upload-button {
- -webkit-appearance: button;
- /* 1 */
- font: inherit;
- /* 2 */
-}
-
-/*
-Add the correct display in Chrome and Safari.
-*/
-
-summary {
- display: list-item;
-}
-
-/*
-Removes the default spacing and border for appropriate elements.
-*/
-
-blockquote,
-dl,
-dd,
-h1,
-h2,
-h3,
-h4,
-h5,
-h6,
-hr,
-figure,
-p,
-pre {
- margin: 0;
-}
-
-fieldset {
- margin: 0;
- padding: 0;
-}
-
-legend {
- padding: 0;
-}
-
-ol,
-ul,
-menu {
- list-style: none;
- margin: 0;
- padding: 0;
-}
-
-/*
-Reset default styling for dialogs.
-*/
-
-dialog {
- padding: 0;
-}
-
-/*
-Prevent resizing textareas horizontally by default.
-*/
-
-textarea {
- resize: vertical;
-}
-
-/*
-1. Reset the default placeholder opacity in Firefox. (https://github.com/tailwindlabs/tailwindcss/issues/3300)
-2. Set the default placeholder color to the user's configured gray 400 color.
-*/
-
-input::-moz-placeholder, textarea::-moz-placeholder {
- opacity: 1;
- /* 1 */
- color: #9ca3af;
- /* 2 */
-}
-
-input::placeholder,
-textarea::placeholder {
- opacity: 1;
- /* 1 */
- color: #9ca3af;
- /* 2 */
-}
-
-/*
-Set the default cursor for buttons.
-*/
-
-button,
-[role="button"] {
- cursor: pointer;
-}
-
-/*
-Make sure disabled buttons don't get the pointer cursor.
-*/
-
-:disabled {
- cursor: default;
-}
-
-/*
-1. Make replaced elements `display: block` by default. (https://github.com/mozdevs/cssremedy/issues/14)
-2. Add `vertical-align: middle` to align replaced elements more sensibly by default. (https://github.com/jensimmons/cssremedy/issues/14#issuecomment-634934210)
- This can trigger a poorly considered lint error in some tools but is included by design.
-*/
-
-img,
-svg,
-video,
-canvas,
-audio,
-iframe,
-embed,
-object {
- display: block;
- /* 1 */
- vertical-align: middle;
- /* 2 */
-}
-
-/*
-Constrain images and videos to the parent width and preserve their intrinsic aspect ratio. (https://github.com/mozdevs/cssremedy/issues/14)
-*/
-
-img,
-video {
- max-width: 100%;
- height: auto;
-}
-
-/* Make elements with the HTML hidden attribute stay hidden by default */
-
-[hidden] {
- display: none;
-}
-
-:root,
-[data-theme] {
- background-color: var(--fallback-b1,oklch(var(--b1)/1));
- color: var(--fallback-bc,oklch(var(--bc)/1));
-}
-
-@supports not (color: oklch(0% 0 0)) {
- :root {
- color-scheme: light;
- --fallback-p: #491eff;
- --fallback-pc: #d4dbff;
- --fallback-s: #ff41c7;
- --fallback-sc: #fff9fc;
- --fallback-a: #00cfbd;
- --fallback-ac: #00100d;
- --fallback-n: #2b3440;
- --fallback-nc: #d7dde4;
- --fallback-b1: #ffffff;
- --fallback-b2: #e5e6e6;
- --fallback-b3: #e5e6e6;
- --fallback-bc: #1f2937;
- --fallback-in: #00b3f0;
- --fallback-inc: #000000;
- --fallback-su: #00ca92;
- --fallback-suc: #000000;
- --fallback-wa: #ffc22d;
- --fallback-wac: #000000;
- --fallback-er: #ff6f70;
- --fallback-erc: #000000;
- }
-
- @media (prefers-color-scheme: dark) {
- :root {
- color-scheme: dark;
- --fallback-p: #7582ff;
- --fallback-pc: #050617;
- --fallback-s: #ff71cf;
- --fallback-sc: #190211;
- --fallback-a: #00c7b5;
- --fallback-ac: #000e0c;
- --fallback-n: #2a323c;
- --fallback-nc: #a6adbb;
- --fallback-b1: #1d232a;
- --fallback-b2: #191e24;
- --fallback-b3: #15191e;
- --fallback-bc: #a6adbb;
- --fallback-in: #00b3f0;
- --fallback-inc: #000000;
- --fallback-su: #00ca92;
- --fallback-suc: #000000;
- --fallback-wa: #ffc22d;
- --fallback-wac: #000000;
- --fallback-er: #ff6f70;
- --fallback-erc: #000000;
- }
- }
-}
-
-html {
- -webkit-tap-highlight-color: transparent;
-}
-
-:root {
- --p: 81.1787% 0.091182 6.323441;
- --rounded-box: 1rem;
- --rounded-btn: 0.5rem;
- --rounded-badge: 1.9rem;
- --animation-btn: 0.25s;
- --animation-input: .2s;
- --btn-focus-scale: 0.95;
- --border-btn: 1px;
- --tab-border: 1px;
- --tab-radius: 0.5rem;
- --pc: 16.1631% 0.019731 7.611912;
- --s: 80.2505% 0.120284 226.513023;
- --sc: 15.921% 0.023483 228.193635;
- --a: 86.2762% 0.090464 154.896727;
- --ac: 17.1651% 0.017414 151.988369;
- --n: 70.1674% 0.322491 328.363418;
- --nc: 14.047% 0.06456 328.363418;
- --b1: 100% 0 0;
- --b2: 90.0601% 0 0;
- --b3: 80.1517% 0 0;
- --bc: 20.0193% 0 0;
- --in: 51.0573% 0.230053 276.965635;
- --inc: 90.2553% 0.04582 275.978968;
- --su: 51.0938% 0.086055 186.391359;
- --suc: 90.2981% 0.017553 183.500117;
- --wa: 79.5243% 0.161668 86.046788;
- --wac: 15.9399% 0.03259 87.51442;
- --er: 63.6834% 0.207849 25.331328;
- --erc: 13.0045% 0.039838 24.572492;
-}
-
-*, ::before, ::after {
- --tw-border-spacing-x: 0;
- --tw-border-spacing-y: 0;
- --tw-translate-x: 0;
- --tw-translate-y: 0;
- --tw-rotate: 0;
- --tw-skew-x: 0;
- --tw-skew-y: 0;
- --tw-scale-x: 1;
- --tw-scale-y: 1;
- --tw-pan-x: ;
- --tw-pan-y: ;
- --tw-pinch-zoom: ;
- --tw-scroll-snap-strictness: proximity;
- --tw-gradient-from-position: ;
- --tw-gradient-via-position: ;
- --tw-gradient-to-position: ;
- --tw-ordinal: ;
- --tw-slashed-zero: ;
- --tw-numeric-figure: ;
- --tw-numeric-spacing: ;
- --tw-numeric-fraction: ;
- --tw-ring-inset: ;
- --tw-ring-offset-width: 0px;
- --tw-ring-offset-color: #fff;
- --tw-ring-color: rgb(59 130 246 / 0.5);
- --tw-ring-offset-shadow: 0 0 #0000;
- --tw-ring-shadow: 0 0 #0000;
- --tw-shadow: 0 0 #0000;
- --tw-shadow-colored: 0 0 #0000;
- --tw-blur: ;
- --tw-brightness: ;
- --tw-contrast: ;
- --tw-grayscale: ;
- --tw-hue-rotate: ;
- --tw-invert: ;
- --tw-saturate: ;
- --tw-sepia: ;
- --tw-drop-shadow: ;
- --tw-backdrop-blur: ;
- --tw-backdrop-brightness: ;
- --tw-backdrop-contrast: ;
- --tw-backdrop-grayscale: ;
- --tw-backdrop-hue-rotate: ;
- --tw-backdrop-invert: ;
- --tw-backdrop-opacity: ;
- --tw-backdrop-saturate: ;
- --tw-backdrop-sepia: ;
- --tw-contain-size: ;
- --tw-contain-layout: ;
- --tw-contain-paint: ;
- --tw-contain-style: ;
-}
-
-::backdrop {
- --tw-border-spacing-x: 0;
- --tw-border-spacing-y: 0;
- --tw-translate-x: 0;
- --tw-translate-y: 0;
- --tw-rotate: 0;
- --tw-skew-x: 0;
- --tw-skew-y: 0;
- --tw-scale-x: 1;
- --tw-scale-y: 1;
- --tw-pan-x: ;
- --tw-pan-y: ;
- --tw-pinch-zoom: ;
- --tw-scroll-snap-strictness: proximity;
- --tw-gradient-from-position: ;
- --tw-gradient-via-position: ;
- --tw-gradient-to-position: ;
- --tw-ordinal: ;
- --tw-slashed-zero: ;
- --tw-numeric-figure: ;
- --tw-numeric-spacing: ;
- --tw-numeric-fraction: ;
- --tw-ring-inset: ;
- --tw-ring-offset-width: 0px;
- --tw-ring-offset-color: #fff;
- --tw-ring-color: rgb(59 130 246 / 0.5);
- --tw-ring-offset-shadow: 0 0 #0000;
- --tw-ring-shadow: 0 0 #0000;
- --tw-shadow: 0 0 #0000;
- --tw-shadow-colored: 0 0 #0000;
- --tw-blur: ;
- --tw-brightness: ;
- --tw-contrast: ;
- --tw-grayscale: ;
- --tw-hue-rotate: ;
- --tw-invert: ;
- --tw-saturate: ;
- --tw-sepia: ;
- --tw-drop-shadow: ;
- --tw-backdrop-blur: ;
- --tw-backdrop-brightness: ;
- --tw-backdrop-contrast: ;
- --tw-backdrop-grayscale: ;
- --tw-backdrop-hue-rotate: ;
- --tw-backdrop-invert: ;
- --tw-backdrop-opacity: ;
- --tw-backdrop-saturate: ;
- --tw-backdrop-sepia: ;
- --tw-contain-size: ;
- --tw-contain-layout: ;
- --tw-contain-paint: ;
- --tw-contain-style: ;
-}
-
-.avatar.placeholder > div {
- display: flex;
- align-items: center;
- justify-content: center;
-}
-
-@media (hover:hover) {
- .label a:hover {
- --tw-text-opacity: 1;
- color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
- }
-}
-
-.btn {
- display: inline-flex;
- height: 3rem;
- min-height: 3rem;
- flex-shrink: 0;
- cursor: pointer;
- -webkit-user-select: none;
- -moz-user-select: none;
- user-select: none;
- flex-wrap: wrap;
- align-items: center;
- justify-content: center;
- border-radius: var(--rounded-btn, 0.5rem);
- border-color: transparent;
- border-color: oklch(var(--btn-color, var(--b2)) / var(--tw-border-opacity));
- padding-left: 1rem;
- padding-right: 1rem;
- text-align: center;
- font-size: 0.875rem;
- line-height: 1em;
- gap: 0.5rem;
- font-weight: 600;
- text-decoration-line: none;
- transition-duration: 200ms;
- transition-timing-function: cubic-bezier(0, 0, 0.2, 1);
- border-width: var(--border-btn, 1px);
- animation: button-pop var(--animation-btn, 0.25s) ease-out;
- transition-property: color, background-color, border-color, opacity, box-shadow, transform;
- --tw-text-opacity: 1;
- color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
- --tw-shadow: 0 1px 2px 0 rgb(0 0 0 / 0.05);
- --tw-shadow-colored: 0 1px 2px 0 var(--tw-shadow-color);
- box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
- outline-color: var(--fallback-bc,oklch(var(--bc)/1));
- background-color: oklch(var(--btn-color, var(--b2)) / var(--tw-bg-opacity));
- --tw-bg-opacity: 1;
- --tw-border-opacity: 1;
-}
-
-.btn-disabled,
- .btn[disabled],
- .btn:disabled {
+li.ProseMirror-selectednode:after {
+ content: "";
+ position: absolute;
+ left: -32px;
+ right: -2px;
+ top: -2px;
+ bottom: -2px;
+ border: 2px solid #8cf;
pointer-events: none;
}
-
-:where(.btn:is(input[type="checkbox"])),
-:where(.btn:is(input[type="radio"])) {
- width: auto;
- -webkit-appearance: none;
- -moz-appearance: none;
- appearance: none;
+img.ProseMirror-separator {
+ display: inline !important;
+ border: none !important;
+ margin: 0 !important;
}
-
-.btn:is(input[type="checkbox"]):after,
-.btn:is(input[type="radio"]):after {
- --tw-content: attr(aria-label);
- content: var(--tw-content);
+.ProseMirror .tableWrapper {
+ overflow-x: auto;
}
-
-.card {
+.ProseMirror table {
+ border-collapse: collapse;
+ table-layout: fixed;
+ width: 100%;
+ overflow: hidden;
+}
+.ProseMirror td,
+.ProseMirror th {
+ vertical-align: top;
+ box-sizing: border-box;
position: relative;
- display: flex;
- flex-direction: column;
- border-radius: var(--rounded-box, 1rem);
}
-
-.card:focus {
- outline: 2px solid transparent;
- outline-offset: 2px;
-}
-
-.card-body {
- display: flex;
- flex: 1 1 auto;
- flex-direction: column;
- padding: var(--padding-card, 2rem);
- gap: 0.5rem;
-}
-
-.card-body :where(p) {
- flex-grow: 1;
-}
-
-.card-actions {
- display: flex;
- flex-wrap: wrap;
- align-items: flex-start;
- gap: 0.5rem;
-}
-
-.card figure {
- display: flex;
- align-items: center;
- justify-content: center;
-}
-
-.card.image-full {
- display: grid;
-}
-
-.card.image-full:before {
- position: relative;
- content: "";
- z-index: 10;
- border-radius: var(--rounded-box, 1rem);
- --tw-bg-opacity: 1;
- background-color: var(--fallback-n,oklch(var(--n)/var(--tw-bg-opacity)));
- opacity: 0.75;
-}
-
-.card.image-full:before,
- .card.image-full > * {
- grid-column-start: 1;
- grid-row-start: 1;
-}
-
-.card.image-full > figure img {
- height: 100%;
- -o-object-fit: cover;
- object-fit: cover;
-}
-
-.card.image-full > .card-body {
- position: relative;
+.ProseMirror .column-resize-handle {
+ position: absolute;
+ right: -2px;
+ top: 0;
+ bottom: 0;
+ width: 4px;
z-index: 20;
- --tw-text-opacity: 1;
- color: var(--fallback-nc,oklch(var(--nc)/var(--tw-text-opacity)));
+ background-color: #adf;
+ pointer-events: none;
}
-
-@media (hover: hover) {
- .btn:hover {
- --tw-border-opacity: 1;
- border-color: var(--fallback-b3,oklch(var(--b3)/var(--tw-border-opacity)));
- --tw-bg-opacity: 1;
- background-color: var(--fallback-b3,oklch(var(--b3)/var(--tw-bg-opacity)));
- }
-
- @supports (color: color-mix(in oklab, black, black)) {
- .btn:hover {
- background-color: color-mix(
- in oklab,
- oklch(var(--btn-color, var(--b2)) / var(--tw-bg-opacity, 1)) 90%,
- black
- );
- border-color: color-mix(
- in oklab,
- oklch(var(--btn-color, var(--b2)) / var(--tw-border-opacity, 1)) 90%,
- black
- );
- }
- }
-
- @supports not (color: oklch(0% 0 0)) {
- .btn:hover {
- background-color: var(--btn-color, var(--fallback-b2));
- border-color: var(--btn-color, var(--fallback-b2));
- }
- }
-
- .btn.glass:hover {
- --glass-opacity: 25%;
- --glass-border-opacity: 15%;
- }
-
- .btn-outline.btn-primary:hover {
- --tw-text-opacity: 1;
- color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
- }
-
- @supports (color: color-mix(in oklab, black, black)) {
- .btn-outline.btn-primary:hover {
- background-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
- border-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
- }
- }
-
- .btn-disabled:hover,
- .btn[disabled]:hover,
- .btn:disabled:hover {
- --tw-border-opacity: 0;
- background-color: var(--fallback-n,oklch(var(--n)/var(--tw-bg-opacity)));
- --tw-bg-opacity: 0.2;
- color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
- --tw-text-opacity: 0.2;
- }
-
- @supports (color: color-mix(in oklab, black, black)) {
- .btn:is(input[type="checkbox"]:checked):hover, .btn:is(input[type="radio"]:checked):hover {
- background-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
- border-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
- }
- }
+.ProseMirror.resize-cursor {
+ cursor: ew-resize;
+ cursor: col-resize;
}
-
-.label {
- display: flex;
- -webkit-user-select: none;
- -moz-user-select: none;
- user-select: none;
- align-items: center;
- justify-content: space-between;
- padding-left: 0.25rem;
- padding-right: 0.25rem;
- padding-top: 0.5rem;
- padding-bottom: 0.5rem;
+.ProseMirror .selectedCell:after {
+ z-index: 2;
+ position: absolute;
+ content: "";
+ left: 0;
+ right: 0;
+ top: 0;
+ bottom: 0;
+ background: #c8c8ff66;
+ pointer-events: none;
}
-
-.input {
- flex-shrink: 1;
- -webkit-appearance: none;
- -moz-appearance: none;
- appearance: none;
- height: 3rem;
+.milkdown-theme-nord blockquote {
+ border-left-width: 4px;
+ --tw-border-opacity: 1;
+ border-color: rgb(94 129 172 / var(--tw-border-opacity));
padding-left: 1rem;
- padding-right: 1rem;
- font-size: 1rem;
- line-height: 2;
- line-height: 1.5rem;
- border-radius: var(--rounded-btn, 0.5rem);
- border-width: 1px;
- border-color: transparent;
- --tw-bg-opacity: 1;
- background-color: var(--fallback-b1,oklch(var(--b1)/var(--tw-bg-opacity)));
+ font-family:
+ ui-serif,
+ Georgia,
+ Cambria,
+ Times New Roman,
+ Times,
+ serif;
+ font-style: normal;
}
-
-.input[type="number"]::-webkit-inner-spin-button,
-.input-md[type="number"]::-webkit-inner-spin-button {
- margin-top: -1rem;
- margin-bottom: -1rem;
- margin-inline-end: -1rem;
-}
-
-.link {
- cursor: pointer;
- text-decoration-line: underline;
-}
-
-.navbar {
- display: flex;
- align-items: center;
- padding: var(--navbar-padding, 0.5rem);
- min-height: 4rem;
- width: 100%;
-}
-
-:where(.navbar > *:not(script, style)) {
- display: inline-flex;
- align-items: center;
-}
-
-.navbar-start {
- width: 50%;
- justify-content: flex-start;
-}
-
-.navbar-end {
- width: 50%;
- justify-content: flex-end;
-}
-
-.btm-nav > * .label {
- font-size: 1rem;
- line-height: 1.5rem;
-}
-
-.btn:active:hover,
- .btn:active:focus {
- animation: button-pop 0s ease-out;
- transform: scale(var(--btn-focus-scale, 0.97));
-}
-
-@supports not (color: oklch(0% 0 0)) {
- .btn {
- background-color: var(--btn-color, var(--fallback-b2));
- border-color: var(--btn-color, var(--fallback-b2));
- }
-
- .btn-primary {
- --btn-color: var(--fallback-p);
- }
-}
-
-@supports (color: color-mix(in oklab, black, black)) {
- .btn-outline.btn-primary.btn-active {
- background-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
- border-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
- }
-}
-
-.btn:focus-visible {
- outline-style: solid;
- outline-width: 2px;
- outline-offset: 2px;
-}
-
-.btn-primary {
+.milkdown-theme-nord code {
+ font-family:
+ ui-monospace,
+ SFMono-Regular,
+ Menlo,
+ Monaco,
+ Consolas,
+ Liberation Mono,
+ Courier New,
+ monospace;
+ font-weight: 400;
--tw-text-opacity: 1;
- color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
- outline-color: var(--fallback-p,oklch(var(--p)/1));
+ color: rgb(94 129 172 / var(--tw-text-opacity));
}
-
-@supports (color: oklch(0% 0 0)) {
- .btn-primary {
- --btn-color: var(--p);
- }
+.milkdown-theme-nord pre code {
+ color: inherit;
}
-
-.btn.glass {
- --tw-shadow: 0 0 #0000;
- --tw-shadow-colored: 0 0 #0000;
- box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
- outline-color: currentColor;
+.milkdown-theme-nord img {
+ margin-top: 0 !important;
+ margin-bottom: 0 !important;
+ display: inline-block;
+ max-width: 100%;
}
-
-.btn.glass.btn-active {
- --glass-opacity: 25%;
- --glass-border-opacity: 15%;
+.milkdown-theme-nord.prose :where(blockquote):not(:where([class~=not-prose] *)) {
+ font-weight: 400;
}
-
-.btn-outline.btn-primary {
+.milkdown-theme-nord.prose :where(ol > li):not(:where([class~=not-prose] *))::marker,
+.milkdown-theme-nord.prose :where(ul > li):not(:where([class~=not-prose] *))::marker {
--tw-text-opacity: 1;
- color: var(--fallback-p,oklch(var(--p)/var(--tw-text-opacity)));
+ color: rgb(94 129 172 / var(--tw-text-opacity));
}
-
-.btn-outline.btn-primary.btn-active {
- --tw-text-opacity: 1;
- color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
+.milkdown-theme-nord.prose :where(blockquote p:first-of-type):not(:where([class~=not-prose] *)):before,
+.milkdown-theme-nord.prose :where(blockquote p:first-of-type):not(:where([class~=not-prose] *)):after {
+ content: "";
}
-
-.btn.btn-disabled,
- .btn[disabled],
- .btn:disabled {
- --tw-border-opacity: 0;
- background-color: var(--fallback-n,oklch(var(--n)/var(--tw-bg-opacity)));
- --tw-bg-opacity: 0.2;
- color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
- --tw-text-opacity: 0.2;
+.milkdown-theme-nord.prose :where(code):not(:where([class~=not-prose] *)):before,
+.milkdown-theme-nord.prose :where(code):not(:where([class~=not-prose] *)):after {
+ content: "";
}
-
-.btn:is(input[type="checkbox"]:checked),
-.btn:is(input[type="radio"]:checked) {
- --tw-border-opacity: 1;
- border-color: var(--fallback-p,oklch(var(--p)/var(--tw-border-opacity)));
- --tw-bg-opacity: 1;
- background-color: var(--fallback-p,oklch(var(--p)/var(--tw-bg-opacity)));
- --tw-text-opacity: 1;
- color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
-}
-
-.btn:is(input[type="checkbox"]:checked):focus-visible, .btn:is(input[type="radio"]:checked):focus-visible {
- outline-color: var(--fallback-p,oklch(var(--p)/1));
-}
-
-@keyframes button-pop {
- 0% {
- transform: scale(var(--btn-focus-scale, 0.98));
- }
-
- 40% {
- transform: scale(1.02);
- }
-
- 100% {
- transform: scale(1);
- }
-}
-
-.card :where(figure:first-child) {
- overflow: hidden;
- border-start-start-radius: inherit;
- border-start-end-radius: inherit;
- border-end-start-radius: unset;
- border-end-end-radius: unset;
-}
-
-.card :where(figure:last-child) {
- overflow: hidden;
- border-start-start-radius: unset;
- border-start-end-radius: unset;
- border-end-start-radius: inherit;
- border-end-end-radius: inherit;
-}
-
-.card:focus-visible {
- outline: 2px solid currentColor;
- outline-offset: 2px;
-}
-
-.card.bordered {
- border-width: 1px;
- --tw-border-opacity: 1;
- border-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-border-opacity)));
-}
-
-.card.compact .card-body {
- padding: 1rem;
- font-size: 0.875rem;
- line-height: 1.25rem;
-}
-
-.card-title {
- display: flex;
- align-items: center;
- gap: 0.5rem;
- font-size: 1.25rem;
- line-height: 1.75rem;
- font-weight: 600;
-}
-
-.card.image-full :where(figure) {
- overflow: hidden;
- border-radius: inherit;
-}
-
-@keyframes checkmark {
- 0% {
- background-position-y: 5px;
- }
-
- 50% {
- background-position-y: -2px;
- }
-
- 100% {
- background-position-y: 0;
- }
-}
-
-.input input {
- --tw-bg-opacity: 1;
- background-color: var(--fallback-p,oklch(var(--p)/var(--tw-bg-opacity)));
- background-color: transparent;
-}
-
-.input input:focus {
- outline: 2px solid transparent;
- outline-offset: 2px;
-}
-
-.input[list]::-webkit-calendar-picker-indicator {
- line-height: 1em;
-}
-
-.input-bordered {
- border-color: var(--fallback-bc,oklch(var(--bc)/0.2));
-}
-
-.input:focus,
- .input:focus-within {
- box-shadow: none;
- border-color: var(--fallback-bc,oklch(var(--bc)/0.2));
- outline-style: solid;
- outline-width: 2px;
- outline-offset: 2px;
- outline-color: var(--fallback-bc,oklch(var(--bc)/0.2));
-}
-
-.input:has(> input[disabled]),
- .input-disabled,
- .input:disabled,
- .input[disabled] {
- cursor: not-allowed;
- --tw-border-opacity: 1;
- border-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-border-opacity)));
- --tw-bg-opacity: 1;
- background-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-bg-opacity)));
- color: var(--fallback-bc,oklch(var(--bc)/0.4));
-}
-
-.input:has(> input[disabled])::-moz-placeholder, .input-disabled::-moz-placeholder, .input:disabled::-moz-placeholder, .input[disabled]::-moz-placeholder {
- color: var(--fallback-bc,oklch(var(--bc)/var(--tw-placeholder-opacity)));
- --tw-placeholder-opacity: 0.2;
-}
-
-.input:has(> input[disabled])::placeholder,
- .input-disabled::placeholder,
- .input:disabled::placeholder,
- .input[disabled]::placeholder {
- color: var(--fallback-bc,oklch(var(--bc)/var(--tw-placeholder-opacity)));
- --tw-placeholder-opacity: 0.2;
-}
-
-.input:has(> input[disabled]) > input[disabled] {
- cursor: not-allowed;
-}
-
-.input::-webkit-date-and-time-value {
- text-align: inherit;
-}
-
-.link:focus {
- outline: 2px solid transparent;
- outline-offset: 2px;
-}
-
-.link:focus-visible {
- outline: 2px solid currentColor;
- outline-offset: 2px;
-}
-
-.mockup-browser .mockup-browser-toolbar .input {
+.milkdown-theme-nord.prose .tableWrapper {
position: relative;
- margin-left: auto;
- margin-right: auto;
- display: block;
- height: 1.75rem;
- width: 24rem;
- overflow: hidden;
- text-overflow: ellipsis;
- white-space: nowrap;
- --tw-bg-opacity: 1;
- background-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-bg-opacity)));
- padding-left: 2rem;
- direction: ltr;
+ margin-bottom: .5rem;
+ overflow-x: auto;
}
-
-.mockup-browser .mockup-browser-toolbar .input:before {
- content: "";
- position: absolute;
- left: 0.5rem;
- top: 50%;
- aspect-ratio: 1 / 1;
- height: 0.75rem;
- --tw-translate-y: -50%;
- transform: translate(var(--tw-translate-x), var(--tw-translate-y)) rotate(var(--tw-rotate)) skewX(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y));
- border-radius: 9999px;
- border-width: 2px;
- border-color: currentColor;
- opacity: 0.6;
-}
-
-.mockup-browser .mockup-browser-toolbar .input:after {
- content: "";
- position: absolute;
- left: 1.25rem;
- top: 50%;
- height: 0.5rem;
- --tw-translate-y: 25%;
- --tw-rotate: -45deg;
- transform: translate(var(--tw-translate-x), var(--tw-translate-y)) rotate(var(--tw-rotate)) skewX(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y));
- border-radius: 9999px;
- border-width: 1px;
- border-color: currentColor;
- opacity: 0.6;
-}
-
-@keyframes modal-pop {
- 0% {
- opacity: 0;
- }
-}
-
-@keyframes progress-loading {
- 50% {
- background-position-x: -115%;
- }
-}
-
-@keyframes radiomark {
- 0% {
- box-shadow: 0 0 0 12px var(--fallback-b1,oklch(var(--b1)/1)) inset,
- 0 0 0 12px var(--fallback-b1,oklch(var(--b1)/1)) inset;
- }
-
- 50% {
- box-shadow: 0 0 0 3px var(--fallback-b1,oklch(var(--b1)/1)) inset,
- 0 0 0 3px var(--fallback-b1,oklch(var(--b1)/1)) inset;
- }
-
- 100% {
- box-shadow: 0 0 0 4px var(--fallback-b1,oklch(var(--b1)/1)) inset,
- 0 0 0 4px var(--fallback-b1,oklch(var(--b1)/1)) inset;
- }
-}
-
-@keyframes rating-pop {
- 0% {
- transform: translateY(-0.125em);
- }
-
- 40% {
- transform: translateY(-0.125em);
- }
-
- 100% {
- transform: translateY(0);
- }
-}
-
-@keyframes skeleton {
- from {
- background-position: 150%;
- }
-
- to {
- background-position: -50%;
- }
-}
-
-@keyframes toast-pop {
- 0% {
- transform: scale(0.9);
- opacity: 0;
- }
-
- 100% {
- transform: scale(1);
- opacity: 1;
- }
-}
-
-.card-compact .card-body {
- padding: 1rem;
- font-size: 0.875rem;
+.milkdown-theme-nord.prose table {
+ margin: 1rem !important;
+ overflow: visible !important;
+ font-size: .875rem;
line-height: 1.25rem;
+ --tw-shadow: 0 4px 6px -1px rgb(0 0 0 / .1), 0 2px 4px -2px rgb(0 0 0 / .1);
+ --tw-shadow-colored: 0 4px 6px -1px var(--tw-shadow-color), 0 2px 4px -2px var(--tw-shadow-color);
+ box-shadow:
+ var(--tw-ring-offset-shadow, 0 0 #0000),
+ var(--tw-ring-shadow, 0 0 #0000),
+ var(--tw-shadow);
}
-
-.card-compact .card-title {
- margin-bottom: 0.25rem;
+@media (min-width: 640px) {
+ .milkdown-theme-nord.prose table {
+ border-radius: .5rem;
+ }
}
-
-.card-normal .card-body {
- padding: var(--padding-card, 2rem);
- font-size: 1rem;
- line-height: 1.5rem;
+.milkdown-theme-nord.prose td,
+.milkdown-theme-nord.prose th {
+ padding: .75rem 1.5rem !important;
}
-
-.card-normal .card-title {
- margin-bottom: 0.75rem;
-}
-
-.sr-only {
- position: absolute;
- width: 1px;
- height: 1px;
- padding: 0;
- margin: -1px;
- overflow: hidden;
- clip: rect(0, 0, 0, 0);
- white-space: nowrap;
- border-width: 0;
-}
-
-.fixed {
- position: fixed;
-}
-
-.inset-y-0 {
- top: 0px;
- bottom: 0px;
-}
-
-.z-50 {
- z-index: 50;
-}
-
-.-mx-2 {
- margin-left: -0.5rem;
- margin-right: -0.5rem;
-}
-
-.-mx-6 {
- margin-left: -1.5rem;
- margin-right: -1.5rem;
-}
-
-.mt-10 {
- margin-top: 2.5rem;
-}
-
-.mt-2 {
- margin-top: 0.5rem;
-}
-
-.mt-6 {
- margin-top: 1.5rem;
-}
-
-.mt-auto {
- margin-top: auto;
-}
-
-.block {
- display: block;
-}
-
-.flex {
- display: flex;
-}
-
-.h-16 {
- height: 4rem;
-}
-
-.h-6 {
- height: 1.5rem;
-}
-
-.h-8 {
- height: 2rem;
-}
-
-.h-full {
- height: 100%;
-}
-
-.min-h-full {
- min-height: 100%;
-}
-
-.w-10 {
- width: 2.5rem;
-}
-
-.w-6 {
- width: 1.5rem;
-}
-
-.w-72 {
- width: 18rem;
-}
-
-.w-8 {
- width: 2rem;
-}
-
-.w-96 {
- width: 24rem;
-}
-
-.w-auto {
- width: auto;
-}
-
-.w-full {
- width: 100%;
-}
-
-.flex-1 {
- flex: 1 1 0%;
-}
-
-.shrink-0 {
- flex-shrink: 0;
-}
-
-.grow {
- flex-grow: 1;
-}
-
-.flex-col {
- flex-direction: column;
-}
-
-.items-center {
- align-items: center;
-}
-
-.justify-end {
- justify-content: flex-end;
-}
-
-.justify-center {
- justify-content: center;
-}
-
-.justify-around {
- justify-content: space-around;
-}
-
-.gap-2 {
- gap: 0.5rem;
-}
-
-.gap-x-3 {
- -moz-column-gap: 0.75rem;
- column-gap: 0.75rem;
-}
-
-.gap-x-4 {
- -moz-column-gap: 1rem;
- column-gap: 1rem;
-}
-
-.gap-y-4 {
- row-gap: 1rem;
-}
-
-.gap-y-5 {
- row-gap: 1.25rem;
-}
-
-.gap-y-7 {
- row-gap: 1.75rem;
-}
-
-.space-y-1 > :not([hidden]) ~ :not([hidden]) {
- --tw-space-y-reverse: 0;
- margin-top: calc(0.25rem * calc(1 - var(--tw-space-y-reverse)));
- margin-bottom: calc(0.25rem * var(--tw-space-y-reverse));
-}
-
-.space-y-6 > :not([hidden]) ~ :not([hidden]) {
- --tw-space-y-reverse: 0;
- margin-top: calc(1.5rem * calc(1 - var(--tw-space-y-reverse)));
- margin-bottom: calc(1.5rem * var(--tw-space-y-reverse));
-}
-
-.overflow-y-auto {
- overflow-y: auto;
-}
-
-.truncate {
- overflow: hidden;
- text-overflow: ellipsis;
- white-space: nowrap;
-}
-
-.rounded-full {
- border-radius: 9999px;
-}
-
-.rounded-lg {
- border-radius: 0.5rem;
-}
-
-.rounded-md {
- border-radius: 0.375rem;
-}
-
-.border {
- border-width: 1px;
-}
-
-.border-0 {
- border-width: 0px;
-}
-
-.border-2 {
- border-width: 2px;
-}
-
-.border-r {
- border-right-width: 1px;
-}
-
-.border-solid {
- border-style: solid;
-}
-
-.border-gray-200 {
+.milkdown-theme-nord.prose tr {
+ border-bottom-width: 1px;
--tw-border-opacity: 1;
border-color: rgb(229 231 235 / var(--tw-border-opacity));
}
-
-.bg-accent {
- --tw-bg-opacity: 1;
- background-color: var(--fallback-a,oklch(var(--a)/var(--tw-bg-opacity)));
-}
-
-.bg-base-100 {
- --tw-bg-opacity: 1;
- background-color: var(--fallback-b1,oklch(var(--b1)/var(--tw-bg-opacity)));
-}
-
-.bg-gray-100 {
- --tw-bg-opacity: 1;
- background-color: rgb(243 244 246 / var(--tw-bg-opacity));
-}
-
-.bg-gray-50 {
- --tw-bg-opacity: 1;
- background-color: rgb(249 250 251 / var(--tw-bg-opacity));
-}
-
-.bg-secondary {
- --tw-bg-opacity: 1;
- background-color: var(--fallback-s,oklch(var(--s)/var(--tw-bg-opacity)));
-}
-
-.bg-white {
- --tw-bg-opacity: 1;
- background-color: rgb(255 255 255 / var(--tw-bg-opacity));
-}
-
-.p-2 {
- padding: 0.5rem;
-}
-
-.px-6 {
- padding-left: 1.5rem;
- padding-right: 1.5rem;
-}
-
-.px-8 {
- padding-left: 2rem;
- padding-right: 2rem;
-}
-
-.py-1 {
- padding-top: 0.25rem;
- padding-bottom: 0.25rem;
-}
-
-.py-1\.5 {
- padding-top: 0.375rem;
- padding-bottom: 0.375rem;
-}
-
-.py-10 {
- padding-top: 2.5rem;
- padding-bottom: 2.5rem;
-}
-
-.py-12 {
- padding-top: 3rem;
- padding-bottom: 3rem;
-}
-
-.py-3 {
- padding-top: 0.75rem;
- padding-bottom: 0.75rem;
-}
-
-.py-8 {
- padding-top: 2rem;
- padding-bottom: 2rem;
-}
-
-.pl-72 {
- padding-left: 18rem;
-}
-
-.text-center {
- text-align: center;
-}
-
-.text-2xl {
- font-size: 1.5rem;
- line-height: 2rem;
-}
-
-.text-\[0\.625rem\] {
- font-size: 0.625rem;
-}
-
-.text-sm {
- font-size: 0.875rem;
- line-height: 1.25rem;
-}
-
-.text-xl {
- font-size: 1.25rem;
- line-height: 1.75rem;
-}
-
-.text-xs {
- font-size: 0.75rem;
- line-height: 1rem;
-}
-
-.font-bold {
- font-weight: 700;
-}
-
-.font-medium {
- font-weight: 500;
-}
-
-.font-semibold {
- font-weight: 600;
-}
-
-.italic {
- font-style: italic;
-}
-
-.leading-6 {
- line-height: 1.5rem;
-}
-
-.leading-9 {
- line-height: 2.25rem;
-}
-
-.tracking-tight {
- letter-spacing: -0.025em;
-}
-
-.text-accent-content {
- --tw-text-opacity: 1;
- color: var(--fallback-ac,oklch(var(--ac)/var(--tw-text-opacity)));
-}
-
-.text-gray-400 {
- --tw-text-opacity: 1;
- color: rgb(156 163 175 / var(--tw-text-opacity));
-}
-
-.text-gray-500 {
- --tw-text-opacity: 1;
- color: rgb(107 114 128 / var(--tw-text-opacity));
-}
-
-.text-gray-700 {
- --tw-text-opacity: 1;
- color: rgb(55 65 81 / var(--tw-text-opacity));
-}
-
-.text-gray-900 {
- --tw-text-opacity: 1;
- color: rgb(17 24 39 / var(--tw-text-opacity));
-}
-
-.text-indigo-600 {
- --tw-text-opacity: 1;
- color: rgb(79 70 229 / var(--tw-text-opacity));
-}
-
-.text-secondary-content {
- --tw-text-opacity: 1;
- color: var(--fallback-sc,oklch(var(--sc)/var(--tw-text-opacity)));
-}
-
-.shadow {
- --tw-shadow: 0 1px 3px 0 rgb(0 0 0 / 0.1), 0 1px 2px -1px rgb(0 0 0 / 0.1);
- --tw-shadow-colored: 0 1px 3px 0 var(--tw-shadow-color), 0 1px 2px -1px var(--tw-shadow-color);
- box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
-}
-
-.shadow-md {
- --tw-shadow: 0 4px 6px -1px rgb(0 0 0 / 0.1), 0 2px 4px -2px rgb(0 0 0 / 0.1);
- --tw-shadow-colored: 0 4px 6px -1px var(--tw-shadow-color), 0 2px 4px -2px var(--tw-shadow-color);
- box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
-}
-
-.shadow-sm {
- --tw-shadow: 0 1px 2px 0 rgb(0 0 0 / 0.05);
- --tw-shadow-colored: 0 1px 2px 0 var(--tw-shadow-color);
- box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
-}
-
-.ring-1 {
- --tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);
- --tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);
- box-shadow: var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow, 0 0 #0000);
-}
-
-.ring-inset {
- --tw-ring-inset: inset;
-}
-
-.ring-gray-300 {
- --tw-ring-opacity: 1;
- --tw-ring-color: rgb(209 213 219 / var(--tw-ring-opacity));
-}
-
-.placeholder\:text-gray-400::-moz-placeholder {
- --tw-text-opacity: 1;
- color: rgb(156 163 175 / var(--tw-text-opacity));
-}
-
-.placeholder\:text-gray-400::placeholder {
- --tw-text-opacity: 1;
- color: rgb(156 163 175 / var(--tw-text-opacity));
-}
-
-.hover\:bg-gray-100:hover {
- --tw-bg-opacity: 1;
- background-color: rgb(243 244 246 / var(--tw-bg-opacity));
-}
-
-.hover\:bg-gray-50:hover {
- --tw-bg-opacity: 1;
- background-color: rgb(249 250 251 / var(--tw-bg-opacity));
-}
-
-.hover\:text-gray-900:hover {
- --tw-text-opacity: 1;
- color: rgb(17 24 39 / var(--tw-text-opacity));
-}
-
-.hover\:text-indigo-600:hover {
- --tw-text-opacity: 1;
- color: rgb(79 70 229 / var(--tw-text-opacity));
-}
-
-.focus\:ring-2:focus {
- --tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);
- --tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color);
- box-shadow: var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow, 0 0 #0000);
-}
-
-.focus\:ring-inset:focus {
- --tw-ring-inset: inset;
-}
-
-.focus\:ring-accent:focus {
- --tw-ring-opacity: 1;
- --tw-ring-color: var(--fallback-a,oklch(var(--a)/var(--tw-ring-opacity)));
-}
-
-.group:hover .group-hover\:border-indigo-600 {
+:is(.dark .milkdown-theme-nord.prose tr) {
--tw-border-opacity: 1;
- border-color: rgb(79 70 229 / var(--tw-border-opacity));
+ border-color: rgb(75 85 99 / var(--tw-border-opacity));
}
-
-.group:hover .group-hover\:text-gray-900 {
- --tw-text-opacity: 1;
- color: rgb(17 24 39 / var(--tw-text-opacity));
+.milkdown-theme-nord.prose :where(td, th) p {
+ margin: 0 !important;
}
-
-.group:hover .group-hover\:text-indigo-600 {
- --tw-text-opacity: 1;
- color: rgb(79 70 229 / var(--tw-text-opacity));
+.milkdown-theme-nord.prose :where(td, th):nth-child(odd) {
+ --tw-bg-opacity: 1;
+ background-color: rgb(249 250 251 / var(--tw-bg-opacity));
}
-
-@media (min-width: 640px) {
- .sm\:mx-auto {
- margin-left: auto;
- margin-right: auto;
- }
-
- .sm\:w-full {
- width: 100%;
- }
-
- .sm\:max-w-\[480px\] {
- max-width: 480px;
- }
-
- .sm\:max-w-md {
- max-width: 28rem;
- }
-
- .sm\:rounded-lg {
- border-radius: 0.5rem;
- }
-
- .sm\:px-12 {
- padding-left: 3rem;
- padding-right: 3rem;
- }
-
- .sm\:px-6 {
- padding-left: 1.5rem;
- padding-right: 1.5rem;
- }
-
- .sm\:text-sm {
- font-size: 0.875rem;
- line-height: 1.25rem;
- }
-
- .sm\:leading-6 {
- line-height: 1.5rem;
- }
+:is(.dark .milkdown-theme-nord.prose :where(td, th):nth-child(odd)) {
+ --tw-bg-opacity: 1;
+ background-color: rgb(17 24 39 / var(--tw-bg-opacity));
}
-
-@media (min-width: 1024px) {
- .lg\:px-8 {
- padding-left: 2rem;
- padding-right: 2rem;
- }
+.milkdown-theme-nord.prose.ProseMirror .selectedCell:after {
+ background-color: #88c0d04d;
+}
+.milkdown-theme-nord.prose br[data-is-inline=true],
+.milkdown-theme-nord.prose br[data-is-inline=true]:after {
+ content: " ";
}
diff --git a/static/main.js b/static/main.js
index afabf22..d7e98bb 100644
--- a/static/main.js
+++ b/static/main.js
@@ -1,46 +1,31855 @@
-//let mobile_open_button = document.getElementById("mobile-menu-open-button");
-//let mobile_close_button = document.getElementById("mobile-menu-close-button");
-//let mobile_menu = document.getElementById("mobile-menu");
-//
-//const profile_button = document.getElementById("profile-menu-button");
-//let profile_dropdown = document.getElementById("profile-dropdown");
-//
-//function toggle_mobile_menu() {
-//
-// if (mobile_open_button.classList.contains("block")) {
-// mobile_menu.classList.remove("hidden");
-// mobile_open_button.classList.remove("block");
-// mobile_open_button.classList.add("hidden");
-// mobile_close_button.classList.remove("hidden");
-// mobile_close_button.classList.add("block");
-// } else {
-// mobile_menu.classList.add("hidden");
-// mobile_close_button.classList.remove("block");
-// mobile_close_button.classList.add("hidden");
-// mobile_open_button.classList.remove("hidden");
-// mobile_open_button.classList.add("block");
-// }
-//}
-//
-//function toggle_profile_dropdown() {
-//
-// if (profile_dropdown.classList.contains("hidden")) {
-// profile_dropdown.classList.remove("hidden");
-// } else {
-// profile_dropdown.classList.add("hidden");
-// }
-//}
-//
-//function hide_profile_dropdown() {
-// let profile_dropdown = document.getElementById("profile-dropdown");
-//
-// if (!profile_dropdown.classList.contains("hidden")) {
-// profile_dropdown.classList.add("hidden");
-// }
-//}
-//
-//document.addEventListener("click", (event) => {
-// if (!profile_button.contains(event.target) && !profile_dropdown.contains(event.target)) {
-// profile_dropdown.classList.add("hidden");
-// }
-//});
+(() => {
+ var __create = Object.create;
+ var __defProp = Object.defineProperty;
+ var __defProps = Object.defineProperties;
+ var __getOwnPropDesc = Object.getOwnPropertyDescriptor;
+ var __getOwnPropDescs = Object.getOwnPropertyDescriptors;
+ var __getOwnPropNames = Object.getOwnPropertyNames;
+ var __getOwnPropSymbols = Object.getOwnPropertySymbols;
+ var __getProtoOf = Object.getPrototypeOf;
+ var __hasOwnProp = Object.prototype.hasOwnProperty;
+ var __propIsEnum = Object.prototype.propertyIsEnumerable;
+ var __typeError = (msg) => {
+ throw TypeError(msg);
+ };
+ var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+ var __spreadValues = (a2, b4) => {
+ for (var prop in b4 || (b4 = {}))
+ if (__hasOwnProp.call(b4, prop))
+ __defNormalProp(a2, prop, b4[prop]);
+ if (__getOwnPropSymbols)
+ for (var prop of __getOwnPropSymbols(b4)) {
+ if (__propIsEnum.call(b4, prop))
+ __defNormalProp(a2, prop, b4[prop]);
+ }
+ return a2;
+ };
+ var __spreadProps = (a2, b4) => __defProps(a2, __getOwnPropDescs(b4));
+ var __objRest = (source, exclude) => {
+ var target = {};
+ for (var prop in source)
+ if (__hasOwnProp.call(source, prop) && exclude.indexOf(prop) < 0)
+ target[prop] = source[prop];
+ if (source != null && __getOwnPropSymbols)
+ for (var prop of __getOwnPropSymbols(source)) {
+ if (exclude.indexOf(prop) < 0 && __propIsEnum.call(source, prop))
+ target[prop] = source[prop];
+ }
+ return target;
+ };
+ var __commonJS = (cb, mod) => function __require() {
+ return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports;
+ };
+ var __export = (target, all2) => {
+ for (var name in all2)
+ __defProp(target, name, { get: all2[name], enumerable: true });
+ };
+ var __copyProps = (to, from, except, desc) => {
+ if (from && typeof from === "object" || typeof from === "function") {
+ for (let key of __getOwnPropNames(from))
+ if (!__hasOwnProp.call(to, key) && key !== except)
+ __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable });
+ }
+ return to;
+ };
+ var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps(
+ // If the importer is in node compatibility mode or this is not an ESM
+ // file that has been converted to a CommonJS file using a Babel-
+ // compatible transform (i.e. "__esModule" has not been set), then set
+ // "default" to the CommonJS "module.exports" for node compatibility.
+ isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target,
+ mod
+ ));
+ var __accessCheck = (obj, member, msg) => member.has(obj) || __typeError("Cannot " + msg);
+ var __privateGet = (obj, member, getter) => (__accessCheck(obj, member, "read from private field"), getter ? getter.call(obj) : member.get(obj));
+ var __privateAdd = (obj, member, value) => member.has(obj) ? __typeError("Cannot add the same private member more than once") : member instanceof WeakSet ? member.add(obj) : member.set(obj, value);
+ var __privateSet = (obj, member, value, setter) => (__accessCheck(obj, member, "write to private field"), setter ? setter.call(obj, value) : member.set(obj, value), value);
+
+ // node_modules/extend/index.js
+ var require_extend = __commonJS({
+ "node_modules/extend/index.js"(exports, module) {
+ "use strict";
+ var hasOwn = Object.prototype.hasOwnProperty;
+ var toStr = Object.prototype.toString;
+ var defineProperty = Object.defineProperty;
+ var gOPD = Object.getOwnPropertyDescriptor;
+ var isArray2 = function isArray3(arr) {
+ if (typeof Array.isArray === "function") {
+ return Array.isArray(arr);
+ }
+ return toStr.call(arr) === "[object Array]";
+ };
+ var isPlainObject2 = function isPlainObject3(obj) {
+ if (!obj || toStr.call(obj) !== "[object Object]") {
+ return false;
+ }
+ var hasOwnConstructor = hasOwn.call(obj, "constructor");
+ var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, "isPrototypeOf");
+ if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) {
+ return false;
+ }
+ var key;
+ for (key in obj) {
+ }
+ return typeof key === "undefined" || hasOwn.call(obj, key);
+ };
+ var setProperty2 = function setProperty3(target, options2) {
+ if (defineProperty && options2.name === "__proto__") {
+ defineProperty(target, options2.name, {
+ enumerable: true,
+ configurable: true,
+ value: options2.newValue,
+ writable: true
+ });
+ } else {
+ target[options2.name] = options2.newValue;
+ }
+ };
+ var getProperty = function getProperty2(obj, name) {
+ if (name === "__proto__") {
+ if (!hasOwn.call(obj, name)) {
+ return void 0;
+ } else if (gOPD) {
+ return gOPD(obj, name).value;
+ }
+ }
+ return obj[name];
+ };
+ module.exports = function extend2() {
+ var options2, name, src, copy2, copyIsArray, clone;
+ var target = arguments[0];
+ var i2 = 1;
+ var length = arguments.length;
+ var deep = false;
+ if (typeof target === "boolean") {
+ deep = target;
+ target = arguments[1] || {};
+ i2 = 2;
+ }
+ if (target == null || typeof target !== "object" && typeof target !== "function") {
+ target = {};
+ }
+ for (; i2 < length; ++i2) {
+ options2 = arguments[i2];
+ if (options2 != null) {
+ for (name in options2) {
+ src = getProperty(target, name);
+ copy2 = getProperty(options2, name);
+ if (target !== copy2) {
+ if (deep && copy2 && (isPlainObject2(copy2) || (copyIsArray = isArray2(copy2)))) {
+ if (copyIsArray) {
+ copyIsArray = false;
+ clone = src && isArray2(src) ? src : [];
+ } else {
+ clone = src && isPlainObject2(src) ? src : {};
+ }
+ setProperty2(target, { name, newValue: extend2(deep, clone, copy2) });
+ } else if (typeof copy2 !== "undefined") {
+ setProperty2(target, { name, newValue: copy2 });
+ }
+ }
+ }
+ }
+ }
+ return target;
+ };
+ }
+ });
+
+ // node_modules/lodash.debounce/index.js
+ var require_lodash = __commonJS({
+ "node_modules/lodash.debounce/index.js"(exports, module) {
+ var FUNC_ERROR_TEXT = "Expected a function";
+ var NAN = 0 / 0;
+ var symbolTag = "[object Symbol]";
+ var reTrim = /^\s+|\s+$/g;
+ var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
+ var reIsBinary = /^0b[01]+$/i;
+ var reIsOctal = /^0o[0-7]+$/i;
+ var freeParseInt = parseInt;
+ var freeGlobal = typeof global == "object" && global && global.Object === Object && global;
+ var freeSelf = typeof self == "object" && self && self.Object === Object && self;
+ var root2 = freeGlobal || freeSelf || Function("return this")();
+ var objectProto = Object.prototype;
+ var objectToString = objectProto.toString;
+ var nativeMax = Math.max;
+ var nativeMin = Math.min;
+ var now = function() {
+ return root2.Date.now();
+ };
+ function debounce(func, wait, options2) {
+ var lastArgs, lastThis, maxWait, result, timerId, lastCallTime, lastInvokeTime = 0, leading = false, maxing = false, trailing = true;
+ if (typeof func != "function") {
+ throw new TypeError(FUNC_ERROR_TEXT);
+ }
+ wait = toNumber(wait) || 0;
+ if (isObject2(options2)) {
+ leading = !!options2.leading;
+ maxing = "maxWait" in options2;
+ maxWait = maxing ? nativeMax(toNumber(options2.maxWait) || 0, wait) : maxWait;
+ trailing = "trailing" in options2 ? !!options2.trailing : trailing;
+ }
+ function invokeFunc(time) {
+ var args = lastArgs, thisArg = lastThis;
+ lastArgs = lastThis = void 0;
+ lastInvokeTime = time;
+ result = func.apply(thisArg, args);
+ return result;
+ }
+ function leadingEdge(time) {
+ lastInvokeTime = time;
+ timerId = setTimeout(timerExpired, wait);
+ return leading ? invokeFunc(time) : result;
+ }
+ function remainingWait(time) {
+ var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime, result2 = wait - timeSinceLastCall;
+ return maxing ? nativeMin(result2, maxWait - timeSinceLastInvoke) : result2;
+ }
+ function shouldInvoke(time) {
+ var timeSinceLastCall = time - lastCallTime, timeSinceLastInvoke = time - lastInvokeTime;
+ return lastCallTime === void 0 || timeSinceLastCall >= wait || timeSinceLastCall < 0 || maxing && timeSinceLastInvoke >= maxWait;
+ }
+ function timerExpired() {
+ var time = now();
+ if (shouldInvoke(time)) {
+ return trailingEdge(time);
+ }
+ timerId = setTimeout(timerExpired, remainingWait(time));
+ }
+ function trailingEdge(time) {
+ timerId = void 0;
+ if (trailing && lastArgs) {
+ return invokeFunc(time);
+ }
+ lastArgs = lastThis = void 0;
+ return result;
+ }
+ function cancel() {
+ if (timerId !== void 0) {
+ clearTimeout(timerId);
+ }
+ lastInvokeTime = 0;
+ lastArgs = lastCallTime = lastThis = timerId = void 0;
+ }
+ function flush() {
+ return timerId === void 0 ? result : trailingEdge(now());
+ }
+ function debounced() {
+ var time = now(), isInvoking = shouldInvoke(time);
+ lastArgs = arguments;
+ lastThis = this;
+ lastCallTime = time;
+ if (isInvoking) {
+ if (timerId === void 0) {
+ return leadingEdge(lastCallTime);
+ }
+ if (maxing) {
+ timerId = setTimeout(timerExpired, wait);
+ return invokeFunc(lastCallTime);
+ }
+ }
+ if (timerId === void 0) {
+ timerId = setTimeout(timerExpired, wait);
+ }
+ return result;
+ }
+ debounced.cancel = cancel;
+ debounced.flush = flush;
+ return debounced;
+ }
+ function isObject2(value) {
+ var type = typeof value;
+ return !!value && (type == "object" || type == "function");
+ }
+ function isObjectLike(value) {
+ return !!value && typeof value == "object";
+ }
+ function isSymbol(value) {
+ return typeof value == "symbol" || isObjectLike(value) && objectToString.call(value) == symbolTag;
+ }
+ function toNumber(value) {
+ if (typeof value == "number") {
+ return value;
+ }
+ if (isSymbol(value)) {
+ return NAN;
+ }
+ if (isObject2(value)) {
+ var other = typeof value.valueOf == "function" ? value.valueOf() : value;
+ value = isObject2(other) ? other + "" : other;
+ }
+ if (typeof value != "string") {
+ return value === 0 ? value : +value;
+ }
+ value = value.replace(reTrim, "");
+ var isBinary = reIsBinary.test(value);
+ return isBinary || reIsOctal.test(value) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : reIsBadHex.test(value) ? NAN : +value;
+ }
+ module.exports = debounce;
+ }
+ });
+
+ // node_modules/@milkdown/exception/lib/index.es.js
+ var n = /* @__PURE__ */ ((e2) => (e2.docTypeError = "docTypeError", e2.contextNotFound = "contextNotFound", e2.timerNotFound = "timerNotFound", e2.ctxCallOutOfScope = "ctxCallOutOfScope", e2.createNodeInParserFail = "createNodeInParserFail", e2.stackOverFlow = "stackOverFlow", e2.parserMatchError = "parserMatchError", e2.serializerMatchError = "serializerMatchError", e2.getAtomFromSchemaFail = "getAtomFromSchemaFail", e2.expectDomTypeError = "expectDomTypeError", e2.callCommandBeforeEditorView = "callCommandBeforeEditorView", e2.missingRootElement = "missingRootElement", e2.missingNodeInSchema = "missingNodeInSchema", e2.missingMarkInSchema = "missingMarkInSchema", e2.ctxNotBind = "ctxNotBind", e2.missingYjsDoc = "missingYjsDoc", e2))(n || {});
+ var t = class extends Error {
+ constructor(o2, a2) {
+ super(a2), this.name = "MilkdownError", this.code = o2;
+ }
+ };
+ var u = (e2, o2) => typeof o2 == "function" ? "[Function]" : o2;
+ var i = (e2) => JSON.stringify(e2, u);
+ function l(e2) {
+ return new t(n.docTypeError, `Doc type error, unsupported type: ${i(e2)}`);
+ }
+ function d(e2) {
+ return new t(n.contextNotFound, `Context "${e2}" not found, do you forget to inject it?`);
+ }
+ function f(e2) {
+ return new t(n.timerNotFound, `Timer "${e2}" not found, do you forget to record it?`);
+ }
+ function p() {
+ return new t(n.ctxCallOutOfScope, "Should not call a context out of the plugin.");
+ }
+ function g(...e2) {
+ const o2 = e2.reduce((a2, c6) => {
+ if (!c6)
+ return a2;
+ const s2 = (r3) => Array.isArray(r3) ? r3.map((m3) => s2(m3)).join(", ") : r3.toJSON ? i(r3.toJSON()) : r3.spec ? i(r3.spec) : r3.toString();
+ return `${a2}, ${s2(c6)}`;
+ }, "Create prosemirror node from remark failed in parser");
+ return new t(n.createNodeInParserFail, o2);
+ }
+ function h() {
+ return new t(n.stackOverFlow, "Stack over flow, cannot pop on an empty stack.");
+ }
+ function w(e2) {
+ return new t(n.parserMatchError, `Cannot match target parser for node: ${i(e2)}.`);
+ }
+ function F(e2) {
+ return new t(n.serializerMatchError, `Cannot match target serializer for node: ${i(e2)}.`);
+ }
+ function S(e2) {
+ return new t(n.expectDomTypeError, `Expect to be a dom, but get: ${i(e2)}.`);
+ }
+ function y() {
+ return new t(
+ n.callCommandBeforeEditorView,
+ "You're trying to call a command before editor view initialized, make sure to get commandManager from ctx after editor view has been initialized"
+ );
+ }
+ function M(e2) {
+ return new t(
+ n.missingNodeInSchema,
+ `Missing node in schema, milkdown cannot find "${e2}" in schema.`
+ );
+ }
+ function x(e2) {
+ return new t(
+ n.missingMarkInSchema,
+ `Missing mark in schema, milkdown cannot find "${e2}" in schema.`
+ );
+ }
+
+ // node_modules/@milkdown/ctx/lib/index.es.js
+ var P = (o2, s2, i2) => {
+ if (!s2.has(o2))
+ throw TypeError("Cannot " + i2);
+ };
+ var e = (o2, s2, i2) => (P(o2, s2, "read from private field"), i2 ? i2.call(o2) : s2.get(o2));
+ var a = (o2, s2, i2) => {
+ if (s2.has(o2))
+ throw TypeError("Cannot add the same private member more than once");
+ s2 instanceof WeakSet ? s2.add(o2) : s2.set(o2, i2);
+ };
+ var n2 = (o2, s2, i2, r3) => (P(o2, s2, "write to private field"), r3 ? r3.call(o2, i2) : s2.set(o2, i2), i2);
+ var G = class {
+ constructor() {
+ this.sliceMap = /* @__PURE__ */ new Map(), this.get = (s2) => {
+ const i2 = typeof s2 == "string" ? [...this.sliceMap.values()].find((r3) => r3.type.name === s2) : this.sliceMap.get(s2.id);
+ if (!i2) {
+ const r3 = typeof s2 == "string" ? s2 : s2.name;
+ throw d(r3);
+ }
+ return i2;
+ }, this.remove = (s2) => {
+ const i2 = typeof s2 == "string" ? [...this.sliceMap.values()].find((r3) => r3.type.name === s2) : this.sliceMap.get(s2.id);
+ i2 && this.sliceMap.delete(i2.type.id);
+ }, this.has = (s2) => typeof s2 == "string" ? [...this.sliceMap.values()].some((i2) => i2.type.name === s2) : this.sliceMap.has(s2.id);
+ }
+ };
+ var u2;
+ var m;
+ var y2;
+ var V = class {
+ /// @internal
+ constructor(s2, i2, r3) {
+ a(this, u2, void 0);
+ a(this, m, void 0);
+ a(this, y2, void 0);
+ n2(this, u2, []), n2(this, y2, () => {
+ e(this, u2).forEach((t2) => t2(e(this, m)));
+ }), this.set = (t2) => {
+ n2(this, m, t2), e(this, y2).call(this);
+ }, this.get = () => e(this, m), this.update = (t2) => {
+ n2(this, m, t2(e(this, m))), e(this, y2).call(this);
+ }, this.type = r3, n2(this, m, i2), s2.set(r3.id, this);
+ }
+ /// Add a watcher for changes in the slice.
+ /// Returns a function to remove the watcher.
+ on(s2) {
+ return e(this, u2).push(s2), () => {
+ n2(this, u2, e(this, u2).filter((i2) => i2 !== s2));
+ };
+ }
+ /// Add a one-time watcher for changes in the slice.
+ /// The watcher will be removed after it is called.
+ /// Returns a function to remove the watcher.
+ once(s2) {
+ const i2 = this.on((r3) => {
+ s2(r3), i2();
+ });
+ return i2;
+ }
+ /// Remove a watcher.
+ off(s2) {
+ n2(this, u2, e(this, u2).filter((i2) => i2 !== s2));
+ }
+ /// Remove all watchers.
+ offAll() {
+ n2(this, u2, []);
+ }
+ };
+ u2 = /* @__PURE__ */ new WeakMap(), m = /* @__PURE__ */ new WeakMap(), y2 = /* @__PURE__ */ new WeakMap();
+ var W = class {
+ /// Create a slice type with a default value and a name.
+ /// The name should be unique in the container.
+ constructor(s2, i2) {
+ this.id = Symbol(`Context-${i2}`), this.name = i2, this._defaultValue = s2, this._typeInfo = () => {
+ throw p();
+ };
+ }
+ /// Create a slice with a container.
+ /// You can also pass a value to override the default value.
+ create(s2, i2 = this._defaultValue) {
+ return new V(s2, i2, this);
+ }
+ };
+ var H = (o2, s2) => new W(o2, s2);
+ var D;
+ var x2;
+ var R;
+ var w2;
+ var S2;
+ var f2;
+ var M2;
+ var T;
+ var j;
+ var _ = class {
+ /// Create an inspector with container, clock and metadata.
+ constructor(s2, i2, r3) {
+ a(this, D, void 0);
+ a(this, x2, void 0);
+ a(this, R, void 0);
+ a(this, w2, void 0);
+ a(this, S2, void 0);
+ a(this, f2, void 0);
+ a(this, M2, void 0);
+ a(this, T, void 0);
+ a(this, j, void 0);
+ n2(this, w2, /* @__PURE__ */ new Set()), n2(this, S2, /* @__PURE__ */ new Set()), n2(this, f2, /* @__PURE__ */ new Map()), n2(this, M2, /* @__PURE__ */ new Map()), this.read = () => ({
+ metadata: e(this, D),
+ injectedSlices: [...e(this, w2)].map((t2) => ({
+ name: typeof t2 == "string" ? t2 : t2.name,
+ value: e(this, T).call(this, t2)
+ })),
+ consumedSlices: [...e(this, S2)].map((t2) => ({
+ name: typeof t2 == "string" ? t2 : t2.name,
+ value: e(this, T).call(this, t2)
+ })),
+ recordedTimers: [...e(this, f2)].map(([t2, { duration: h5 }]) => ({
+ name: t2.name,
+ duration: h5,
+ status: e(this, j).call(this, t2)
+ })),
+ waitTimers: [...e(this, M2)].map(([t2, { duration: h5 }]) => ({
+ name: t2.name,
+ duration: h5,
+ status: e(this, j).call(this, t2)
+ }))
+ }), this.onRecord = (t2) => {
+ e(this, f2).set(t2, { start: Date.now(), duration: 0 });
+ }, this.onClear = (t2) => {
+ e(this, f2).delete(t2);
+ }, this.onDone = (t2) => {
+ const h5 = e(this, f2).get(t2);
+ h5 && (h5.duration = Date.now() - h5.start);
+ }, this.onWait = (t2, h5) => {
+ const v4 = Date.now();
+ h5.finally(() => {
+ e(this, M2).set(t2, { duration: Date.now() - v4 });
+ });
+ }, this.onInject = (t2) => {
+ e(this, w2).add(t2);
+ }, this.onRemove = (t2) => {
+ e(this, w2).delete(t2);
+ }, this.onUse = (t2) => {
+ e(this, S2).add(t2);
+ }, n2(this, T, (t2) => e(this, x2).get(t2).get()), n2(this, j, (t2) => e(this, R).get(t2).status), n2(this, x2, s2), n2(this, R, i2), n2(this, D, r3);
+ }
+ };
+ D = /* @__PURE__ */ new WeakMap(), x2 = /* @__PURE__ */ new WeakMap(), R = /* @__PURE__ */ new WeakMap(), w2 = /* @__PURE__ */ new WeakMap(), S2 = /* @__PURE__ */ new WeakMap(), f2 = /* @__PURE__ */ new WeakMap(), M2 = /* @__PURE__ */ new WeakMap(), T = /* @__PURE__ */ new WeakMap(), j = /* @__PURE__ */ new WeakMap();
+ var d2;
+ var l2;
+ var b;
+ var c;
+ var L = class L2 {
+ /// Create a ctx object with container and clock.
+ constructor(s2, i2, r3) {
+ a(this, d2, void 0);
+ a(this, l2, void 0);
+ a(this, b, void 0);
+ a(this, c, void 0);
+ this.produce = (t2) => t2 && Object.keys(t2).length ? new L2(e(this, d2), e(this, l2), __spreadValues({}, t2)) : this, this.inject = (t2, h5) => {
+ var O4;
+ const v4 = t2.create(e(this, d2).sliceMap);
+ return h5 != null && v4.set(h5), (O4 = e(this, c)) == null || O4.onInject(t2), this;
+ }, this.remove = (t2) => {
+ var h5;
+ return e(this, d2).remove(t2), (h5 = e(this, c)) == null || h5.onRemove(t2), this;
+ }, this.record = (t2) => {
+ var h5;
+ return t2.create(e(this, l2).store), (h5 = e(this, c)) == null || h5.onRecord(t2), this;
+ }, this.clearTimer = (t2) => {
+ var h5;
+ return e(this, l2).remove(t2), (h5 = e(this, c)) == null || h5.onClear(t2), this;
+ }, this.isInjected = (t2) => e(this, d2).has(t2), this.isRecorded = (t2) => e(this, l2).has(t2), this.use = (t2) => {
+ var h5;
+ return (h5 = e(this, c)) == null || h5.onUse(t2), e(this, d2).get(t2);
+ }, this.get = (t2) => this.use(t2).get(), this.set = (t2, h5) => this.use(t2).set(h5), this.update = (t2, h5) => this.use(t2).update(h5), this.timer = (t2) => e(this, l2).get(t2), this.done = (t2) => {
+ var h5;
+ this.timer(t2).done(), (h5 = e(this, c)) == null || h5.onDone(t2);
+ }, this.wait = (t2) => {
+ var v4;
+ const h5 = this.timer(t2).start();
+ return (v4 = e(this, c)) == null || v4.onWait(t2, h5), h5;
+ }, this.waitTimers = async (t2) => {
+ await Promise.all(this.get(t2).map((h5) => this.wait(h5)));
+ }, n2(this, d2, s2), n2(this, l2, i2), n2(this, b, r3), r3 && n2(this, c, new _(s2, i2, r3));
+ }
+ /// Get metadata of the ctx.
+ get meta() {
+ return e(this, b);
+ }
+ /// Get the inspector of the ctx.
+ get inspector() {
+ return e(this, c);
+ }
+ };
+ d2 = /* @__PURE__ */ new WeakMap(), l2 = /* @__PURE__ */ new WeakMap(), b = /* @__PURE__ */ new WeakMap(), c = /* @__PURE__ */ new WeakMap();
+ var U = L;
+ var J = class {
+ constructor() {
+ this.store = /* @__PURE__ */ new Map(), this.get = (s2) => {
+ const i2 = this.store.get(s2.id);
+ if (!i2)
+ throw f(s2.name);
+ return i2;
+ }, this.remove = (s2) => {
+ this.store.delete(s2.id);
+ }, this.has = (s2) => this.store.has(s2.id);
+ }
+ };
+ var C;
+ var g2;
+ var E;
+ var p2;
+ var I;
+ var k;
+ var q = class {
+ /// @internal
+ constructor(s2, i2) {
+ a(this, C, void 0);
+ a(this, g2, void 0);
+ a(this, E, void 0);
+ a(this, p2, void 0);
+ a(this, I, void 0);
+ a(this, k, void 0);
+ n2(this, C, null), n2(this, g2, null), n2(this, p2, "pending"), this.start = () => {
+ var _a;
+ return (_a = e(this, C)) != null ? _a : n2(this, C, new Promise((r3, t2) => {
+ n2(this, g2, (h5) => {
+ h5 instanceof CustomEvent && h5.detail.id === e(this, E) && (n2(this, p2, "resolved"), e(this, I).call(this), h5.stopImmediatePropagation(), r3());
+ }), e(this, k).call(this, () => {
+ e(this, p2) === "pending" && n2(this, p2, "rejected"), e(this, I).call(this), t2(new Error(`Timing ${this.type.name} timeout.`));
+ }), n2(this, p2, "pending"), addEventListener(this.type.name, e(this, g2));
+ })), e(this, C);
+ }, this.done = () => {
+ const r3 = new CustomEvent(this.type.name, { detail: { id: e(this, E) } });
+ dispatchEvent(r3);
+ }, n2(this, I, () => {
+ e(this, g2) && removeEventListener(this.type.name, e(this, g2));
+ }), n2(this, k, (r3) => {
+ setTimeout(() => {
+ r3();
+ }, this.type.timeout);
+ }), n2(this, E, Symbol(i2.name)), this.type = i2, s2.set(i2.id, this);
+ }
+ /// The status of the timer.
+ /// Can be `pending`, `resolved` or `rejected`.
+ get status() {
+ return e(this, p2);
+ }
+ };
+ C = /* @__PURE__ */ new WeakMap(), g2 = /* @__PURE__ */ new WeakMap(), E = /* @__PURE__ */ new WeakMap(), p2 = /* @__PURE__ */ new WeakMap(), I = /* @__PURE__ */ new WeakMap(), k = /* @__PURE__ */ new WeakMap();
+ var A = class {
+ /// Create a timer type with a name and a timeout.
+ /// The name should be unique in the clock.
+ constructor(s2, i2 = 3e3) {
+ this.create = (r3) => new q(r3, this), this.id = Symbol(`Timer-${s2}`), this.name = s2, this.timeout = i2;
+ }
+ };
+ var K = (o2, s2 = 3e3) => new A(o2, s2);
+
+ // node_modules/orderedmap/dist/index.js
+ function OrderedMap(content3) {
+ this.content = content3;
+ }
+ OrderedMap.prototype = {
+ constructor: OrderedMap,
+ find: function(key) {
+ for (var i2 = 0; i2 < this.content.length; i2 += 2)
+ if (this.content[i2] === key) return i2;
+ return -1;
+ },
+ // :: (string) → ?any
+ // Retrieve the value stored under `key`, or return undefined when
+ // no such key exists.
+ get: function(key) {
+ var found2 = this.find(key);
+ return found2 == -1 ? void 0 : this.content[found2 + 1];
+ },
+ // :: (string, any, ?string) → OrderedMap
+ // Create a new map by replacing the value of `key` with a new
+ // value, or adding a binding to the end of the map. If `newKey` is
+ // given, the key of the binding will be replaced with that key.
+ update: function(key, value, newKey) {
+ var self2 = newKey && newKey != key ? this.remove(newKey) : this;
+ var found2 = self2.find(key), content3 = self2.content.slice();
+ if (found2 == -1) {
+ content3.push(newKey || key, value);
+ } else {
+ content3[found2 + 1] = value;
+ if (newKey) content3[found2] = newKey;
+ }
+ return new OrderedMap(content3);
+ },
+ // :: (string) → OrderedMap
+ // Return a map with the given key removed, if it existed.
+ remove: function(key) {
+ var found2 = this.find(key);
+ if (found2 == -1) return this;
+ var content3 = this.content.slice();
+ content3.splice(found2, 2);
+ return new OrderedMap(content3);
+ },
+ // :: (string, any) → OrderedMap
+ // Add a new key to the start of the map.
+ addToStart: function(key, value) {
+ return new OrderedMap([key, value].concat(this.remove(key).content));
+ },
+ // :: (string, any) → OrderedMap
+ // Add a new key to the end of the map.
+ addToEnd: function(key, value) {
+ var content3 = this.remove(key).content.slice();
+ content3.push(key, value);
+ return new OrderedMap(content3);
+ },
+ // :: (string, string, any) → OrderedMap
+ // Add a key after the given key. If `place` is not found, the new
+ // key is added to the end.
+ addBefore: function(place, key, value) {
+ var without = this.remove(key), content3 = without.content.slice();
+ var found2 = without.find(place);
+ content3.splice(found2 == -1 ? content3.length : found2, 0, key, value);
+ return new OrderedMap(content3);
+ },
+ // :: ((key: string, value: any))
+ // Call the given function for each key/value pair in the map, in
+ // order.
+ forEach: function(f3) {
+ for (var i2 = 0; i2 < this.content.length; i2 += 2)
+ f3(this.content[i2], this.content[i2 + 1]);
+ },
+ // :: (union) → OrderedMap
+ // Create a new map by prepending the keys in this map that don't
+ // appear in `map` before the keys in `map`.
+ prepend: function(map5) {
+ map5 = OrderedMap.from(map5);
+ if (!map5.size) return this;
+ return new OrderedMap(map5.content.concat(this.subtract(map5).content));
+ },
+ // :: (union) → OrderedMap
+ // Create a new map by appending the keys in this map that don't
+ // appear in `map` after the keys in `map`.
+ append: function(map5) {
+ map5 = OrderedMap.from(map5);
+ if (!map5.size) return this;
+ return new OrderedMap(this.subtract(map5).content.concat(map5.content));
+ },
+ // :: (union) → OrderedMap
+ // Create a map containing all the keys in this map that don't
+ // appear in `map`.
+ subtract: function(map5) {
+ var result = this;
+ map5 = OrderedMap.from(map5);
+ for (var i2 = 0; i2 < map5.content.length; i2 += 2)
+ result = result.remove(map5.content[i2]);
+ return result;
+ },
+ // :: () → Object
+ // Turn ordered map into a plain object.
+ toObject: function() {
+ var result = {};
+ this.forEach(function(key, value) {
+ result[key] = value;
+ });
+ return result;
+ },
+ // :: number
+ // The amount of keys in this map.
+ get size() {
+ return this.content.length >> 1;
+ }
+ };
+ OrderedMap.from = function(value) {
+ if (value instanceof OrderedMap) return value;
+ var content3 = [];
+ if (value) for (var prop in value) content3.push(prop, value[prop]);
+ return new OrderedMap(content3);
+ };
+ var dist_default = OrderedMap;
+
+ // node_modules/prosemirror-model/dist/index.js
+ function findDiffStart(a2, b4, pos) {
+ for (let i2 = 0; ; i2++) {
+ if (i2 == a2.childCount || i2 == b4.childCount)
+ return a2.childCount == b4.childCount ? null : pos;
+ let childA = a2.child(i2), childB = b4.child(i2);
+ if (childA == childB) {
+ pos += childA.nodeSize;
+ continue;
+ }
+ if (!childA.sameMarkup(childB))
+ return pos;
+ if (childA.isText && childA.text != childB.text) {
+ for (let j6 = 0; childA.text[j6] == childB.text[j6]; j6++)
+ pos++;
+ return pos;
+ }
+ if (childA.content.size || childB.content.size) {
+ let inner = findDiffStart(childA.content, childB.content, pos + 1);
+ if (inner != null)
+ return inner;
+ }
+ pos += childA.nodeSize;
+ }
+ }
+ function findDiffEnd(a2, b4, posA, posB) {
+ for (let iA = a2.childCount, iB = b4.childCount; ; ) {
+ if (iA == 0 || iB == 0)
+ return iA == iB ? null : { a: posA, b: posB };
+ let childA = a2.child(--iA), childB = b4.child(--iB), size = childA.nodeSize;
+ if (childA == childB) {
+ posA -= size;
+ posB -= size;
+ continue;
+ }
+ if (!childA.sameMarkup(childB))
+ return { a: posA, b: posB };
+ if (childA.isText && childA.text != childB.text) {
+ let same = 0, minSize = Math.min(childA.text.length, childB.text.length);
+ while (same < minSize && childA.text[childA.text.length - same - 1] == childB.text[childB.text.length - same - 1]) {
+ same++;
+ posA--;
+ posB--;
+ }
+ return { a: posA, b: posB };
+ }
+ if (childA.content.size || childB.content.size) {
+ let inner = findDiffEnd(childA.content, childB.content, posA - 1, posB - 1);
+ if (inner)
+ return inner;
+ }
+ posA -= size;
+ posB -= size;
+ }
+ }
+ var Fragment = class _Fragment {
+ /**
+ @internal
+ */
+ constructor(content3, size) {
+ this.content = content3;
+ this.size = size || 0;
+ if (size == null)
+ for (let i2 = 0; i2 < content3.length; i2++)
+ this.size += content3[i2].nodeSize;
+ }
+ /**
+ Invoke a callback for all descendant nodes between the given two
+ positions (relative to start of this fragment). Doesn't descend
+ into a node when the callback returns `false`.
+ */
+ nodesBetween(from, to, f3, nodeStart = 0, parent) {
+ for (let i2 = 0, pos = 0; pos < to; i2++) {
+ let child = this.content[i2], end = pos + child.nodeSize;
+ if (end > from && f3(child, nodeStart + pos, parent || null, i2) !== false && child.content.size) {
+ let start = pos + 1;
+ child.nodesBetween(Math.max(0, from - start), Math.min(child.content.size, to - start), f3, nodeStart + start);
+ }
+ pos = end;
+ }
+ }
+ /**
+ Call the given callback for every descendant node. `pos` will be
+ relative to the start of the fragment. The callback may return
+ `false` to prevent traversal of a given node's children.
+ */
+ descendants(f3) {
+ this.nodesBetween(0, this.size, f3);
+ }
+ /**
+ Extract the text between `from` and `to`. See the same method on
+ [`Node`](https://prosemirror.net/docs/ref/#model.Node.textBetween).
+ */
+ textBetween(from, to, blockSeparator, leafText) {
+ let text5 = "", first = true;
+ this.nodesBetween(from, to, (node2, pos) => {
+ let nodeText = node2.isText ? node2.text.slice(Math.max(from, pos) - pos, to - pos) : !node2.isLeaf ? "" : leafText ? typeof leafText === "function" ? leafText(node2) : leafText : node2.type.spec.leafText ? node2.type.spec.leafText(node2) : "";
+ if (node2.isBlock && (node2.isLeaf && nodeText || node2.isTextblock) && blockSeparator) {
+ if (first)
+ first = false;
+ else
+ text5 += blockSeparator;
+ }
+ text5 += nodeText;
+ }, 0);
+ return text5;
+ }
+ /**
+ Create a new fragment containing the combined content of this
+ fragment and the other.
+ */
+ append(other) {
+ if (!other.size)
+ return this;
+ if (!this.size)
+ return other;
+ let last = this.lastChild, first = other.firstChild, content3 = this.content.slice(), i2 = 0;
+ if (last.isText && last.sameMarkup(first)) {
+ content3[content3.length - 1] = last.withText(last.text + first.text);
+ i2 = 1;
+ }
+ for (; i2 < other.content.length; i2++)
+ content3.push(other.content[i2]);
+ return new _Fragment(content3, this.size + other.size);
+ }
+ /**
+ Cut out the sub-fragment between the two given positions.
+ */
+ cut(from, to = this.size) {
+ if (from == 0 && to == this.size)
+ return this;
+ let result = [], size = 0;
+ if (to > from)
+ for (let i2 = 0, pos = 0; pos < to; i2++) {
+ let child = this.content[i2], end = pos + child.nodeSize;
+ if (end > from) {
+ if (pos < from || end > to) {
+ if (child.isText)
+ child = child.cut(Math.max(0, from - pos), Math.min(child.text.length, to - pos));
+ else
+ child = child.cut(Math.max(0, from - pos - 1), Math.min(child.content.size, to - pos - 1));
+ }
+ result.push(child);
+ size += child.nodeSize;
+ }
+ pos = end;
+ }
+ return new _Fragment(result, size);
+ }
+ /**
+ @internal
+ */
+ cutByIndex(from, to) {
+ if (from == to)
+ return _Fragment.empty;
+ if (from == 0 && to == this.content.length)
+ return this;
+ return new _Fragment(this.content.slice(from, to));
+ }
+ /**
+ Create a new fragment in which the node at the given index is
+ replaced by the given node.
+ */
+ replaceChild(index2, node2) {
+ let current = this.content[index2];
+ if (current == node2)
+ return this;
+ let copy2 = this.content.slice();
+ let size = this.size + node2.nodeSize - current.nodeSize;
+ copy2[index2] = node2;
+ return new _Fragment(copy2, size);
+ }
+ /**
+ Create a new fragment by prepending the given node to this
+ fragment.
+ */
+ addToStart(node2) {
+ return new _Fragment([node2].concat(this.content), this.size + node2.nodeSize);
+ }
+ /**
+ Create a new fragment by appending the given node to this
+ fragment.
+ */
+ addToEnd(node2) {
+ return new _Fragment(this.content.concat(node2), this.size + node2.nodeSize);
+ }
+ /**
+ Compare this fragment to another one.
+ */
+ eq(other) {
+ if (this.content.length != other.content.length)
+ return false;
+ for (let i2 = 0; i2 < this.content.length; i2++)
+ if (!this.content[i2].eq(other.content[i2]))
+ return false;
+ return true;
+ }
+ /**
+ The first child of the fragment, or `null` if it is empty.
+ */
+ get firstChild() {
+ return this.content.length ? this.content[0] : null;
+ }
+ /**
+ The last child of the fragment, or `null` if it is empty.
+ */
+ get lastChild() {
+ return this.content.length ? this.content[this.content.length - 1] : null;
+ }
+ /**
+ The number of child nodes in this fragment.
+ */
+ get childCount() {
+ return this.content.length;
+ }
+ /**
+ Get the child node at the given index. Raise an error when the
+ index is out of range.
+ */
+ child(index2) {
+ let found2 = this.content[index2];
+ if (!found2)
+ throw new RangeError("Index " + index2 + " out of range for " + this);
+ return found2;
+ }
+ /**
+ Get the child node at the given index, if it exists.
+ */
+ maybeChild(index2) {
+ return this.content[index2] || null;
+ }
+ /**
+ Call `f` for every child node, passing the node, its offset
+ into this parent node, and its index.
+ */
+ forEach(f3) {
+ for (let i2 = 0, p4 = 0; i2 < this.content.length; i2++) {
+ let child = this.content[i2];
+ f3(child, p4, i2);
+ p4 += child.nodeSize;
+ }
+ }
+ /**
+ Find the first position at which this fragment and another
+ fragment differ, or `null` if they are the same.
+ */
+ findDiffStart(other, pos = 0) {
+ return findDiffStart(this, other, pos);
+ }
+ /**
+ Find the first position, searching from the end, at which this
+ fragment and the given fragment differ, or `null` if they are
+ the same. Since this position will not be the same in both
+ nodes, an object with two separate positions is returned.
+ */
+ findDiffEnd(other, pos = this.size, otherPos = other.size) {
+ return findDiffEnd(this, other, pos, otherPos);
+ }
+ /**
+ Find the index and inner offset corresponding to a given relative
+ position in this fragment. The result object will be reused
+ (overwritten) the next time the function is called. (Not public.)
+ */
+ findIndex(pos, round = -1) {
+ if (pos == 0)
+ return retIndex(0, pos);
+ if (pos == this.size)
+ return retIndex(this.content.length, pos);
+ if (pos > this.size || pos < 0)
+ throw new RangeError(`Position ${pos} outside of fragment (${this})`);
+ for (let i2 = 0, curPos = 0; ; i2++) {
+ let cur = this.child(i2), end = curPos + cur.nodeSize;
+ if (end >= pos) {
+ if (end == pos || round > 0)
+ return retIndex(i2 + 1, end);
+ return retIndex(i2, curPos);
+ }
+ curPos = end;
+ }
+ }
+ /**
+ Return a debugging string that describes this fragment.
+ */
+ toString() {
+ return "<" + this.toStringInner() + ">";
+ }
+ /**
+ @internal
+ */
+ toStringInner() {
+ return this.content.join(", ");
+ }
+ /**
+ Create a JSON-serializeable representation of this fragment.
+ */
+ toJSON() {
+ return this.content.length ? this.content.map((n4) => n4.toJSON()) : null;
+ }
+ /**
+ Deserialize a fragment from its JSON representation.
+ */
+ static fromJSON(schema, value) {
+ if (!value)
+ return _Fragment.empty;
+ if (!Array.isArray(value))
+ throw new RangeError("Invalid input for Fragment.fromJSON");
+ return new _Fragment(value.map(schema.nodeFromJSON));
+ }
+ /**
+ Build a fragment from an array of nodes. Ensures that adjacent
+ text nodes with the same marks are joined together.
+ */
+ static fromArray(array) {
+ if (!array.length)
+ return _Fragment.empty;
+ let joined, size = 0;
+ for (let i2 = 0; i2 < array.length; i2++) {
+ let node2 = array[i2];
+ size += node2.nodeSize;
+ if (i2 && node2.isText && array[i2 - 1].sameMarkup(node2)) {
+ if (!joined)
+ joined = array.slice(0, i2);
+ joined[joined.length - 1] = node2.withText(joined[joined.length - 1].text + node2.text);
+ } else if (joined) {
+ joined.push(node2);
+ }
+ }
+ return new _Fragment(joined || array, size);
+ }
+ /**
+ Create a fragment from something that can be interpreted as a
+ set of nodes. For `null`, it returns the empty fragment. For a
+ fragment, the fragment itself. For a node or array of nodes, a
+ fragment containing those nodes.
+ */
+ static from(nodes) {
+ if (!nodes)
+ return _Fragment.empty;
+ if (nodes instanceof _Fragment)
+ return nodes;
+ if (Array.isArray(nodes))
+ return this.fromArray(nodes);
+ if (nodes.attrs)
+ return new _Fragment([nodes], nodes.nodeSize);
+ throw new RangeError("Can not convert " + nodes + " to a Fragment" + (nodes.nodesBetween ? " (looks like multiple versions of prosemirror-model were loaded)" : ""));
+ }
+ };
+ Fragment.empty = new Fragment([], 0);
+ var found = { index: 0, offset: 0 };
+ function retIndex(index2, offset) {
+ found.index = index2;
+ found.offset = offset;
+ return found;
+ }
+ function compareDeep(a2, b4) {
+ if (a2 === b4)
+ return true;
+ if (!(a2 && typeof a2 == "object") || !(b4 && typeof b4 == "object"))
+ return false;
+ let array = Array.isArray(a2);
+ if (Array.isArray(b4) != array)
+ return false;
+ if (array) {
+ if (a2.length != b4.length)
+ return false;
+ for (let i2 = 0; i2 < a2.length; i2++)
+ if (!compareDeep(a2[i2], b4[i2]))
+ return false;
+ } else {
+ for (let p4 in a2)
+ if (!(p4 in b4) || !compareDeep(a2[p4], b4[p4]))
+ return false;
+ for (let p4 in b4)
+ if (!(p4 in a2))
+ return false;
+ }
+ return true;
+ }
+ var Mark = class _Mark {
+ /**
+ @internal
+ */
+ constructor(type, attrs) {
+ this.type = type;
+ this.attrs = attrs;
+ }
+ /**
+ Given a set of marks, create a new set which contains this one as
+ well, in the right position. If this mark is already in the set,
+ the set itself is returned. If any marks that are set to be
+ [exclusive](https://prosemirror.net/docs/ref/#model.MarkSpec.excludes) with this mark are present,
+ those are replaced by this one.
+ */
+ addToSet(set) {
+ let copy2, placed = false;
+ for (let i2 = 0; i2 < set.length; i2++) {
+ let other = set[i2];
+ if (this.eq(other))
+ return set;
+ if (this.type.excludes(other.type)) {
+ if (!copy2)
+ copy2 = set.slice(0, i2);
+ } else if (other.type.excludes(this.type)) {
+ return set;
+ } else {
+ if (!placed && other.type.rank > this.type.rank) {
+ if (!copy2)
+ copy2 = set.slice(0, i2);
+ copy2.push(this);
+ placed = true;
+ }
+ if (copy2)
+ copy2.push(other);
+ }
+ }
+ if (!copy2)
+ copy2 = set.slice();
+ if (!placed)
+ copy2.push(this);
+ return copy2;
+ }
+ /**
+ Remove this mark from the given set, returning a new set. If this
+ mark is not in the set, the set itself is returned.
+ */
+ removeFromSet(set) {
+ for (let i2 = 0; i2 < set.length; i2++)
+ if (this.eq(set[i2]))
+ return set.slice(0, i2).concat(set.slice(i2 + 1));
+ return set;
+ }
+ /**
+ Test whether this mark is in the given set of marks.
+ */
+ isInSet(set) {
+ for (let i2 = 0; i2 < set.length; i2++)
+ if (this.eq(set[i2]))
+ return true;
+ return false;
+ }
+ /**
+ Test whether this mark has the same type and attributes as
+ another mark.
+ */
+ eq(other) {
+ return this == other || this.type == other.type && compareDeep(this.attrs, other.attrs);
+ }
+ /**
+ Convert this mark to a JSON-serializeable representation.
+ */
+ toJSON() {
+ let obj = { type: this.type.name };
+ for (let _3 in this.attrs) {
+ obj.attrs = this.attrs;
+ break;
+ }
+ return obj;
+ }
+ /**
+ Deserialize a mark from JSON.
+ */
+ static fromJSON(schema, json) {
+ if (!json)
+ throw new RangeError("Invalid input for Mark.fromJSON");
+ let type = schema.marks[json.type];
+ if (!type)
+ throw new RangeError(`There is no mark type ${json.type} in this schema`);
+ return type.create(json.attrs);
+ }
+ /**
+ Test whether two sets of marks are identical.
+ */
+ static sameSet(a2, b4) {
+ if (a2 == b4)
+ return true;
+ if (a2.length != b4.length)
+ return false;
+ for (let i2 = 0; i2 < a2.length; i2++)
+ if (!a2[i2].eq(b4[i2]))
+ return false;
+ return true;
+ }
+ /**
+ Create a properly sorted mark set from null, a single mark, or an
+ unsorted array of marks.
+ */
+ static setFrom(marks) {
+ if (!marks || Array.isArray(marks) && marks.length == 0)
+ return _Mark.none;
+ if (marks instanceof _Mark)
+ return [marks];
+ let copy2 = marks.slice();
+ copy2.sort((a2, b4) => a2.type.rank - b4.type.rank);
+ return copy2;
+ }
+ };
+ Mark.none = [];
+ var ReplaceError = class extends Error {
+ };
+ var Slice = class _Slice {
+ /**
+ Create a slice. When specifying a non-zero open depth, you must
+ make sure that there are nodes of at least that depth at the
+ appropriate side of the fragment—i.e. if the fragment is an
+ empty paragraph node, `openStart` and `openEnd` can't be greater
+ than 1.
+
+ It is not necessary for the content of open nodes to conform to
+ the schema's content constraints, though it should be a valid
+ start/end/middle for such a node, depending on which sides are
+ open.
+ */
+ constructor(content3, openStart, openEnd) {
+ this.content = content3;
+ this.openStart = openStart;
+ this.openEnd = openEnd;
+ }
+ /**
+ The size this slice would add when inserted into a document.
+ */
+ get size() {
+ return this.content.size - this.openStart - this.openEnd;
+ }
+ /**
+ @internal
+ */
+ insertAt(pos, fragment) {
+ let content3 = insertInto(this.content, pos + this.openStart, fragment);
+ return content3 && new _Slice(content3, this.openStart, this.openEnd);
+ }
+ /**
+ @internal
+ */
+ removeBetween(from, to) {
+ return new _Slice(removeRange(this.content, from + this.openStart, to + this.openStart), this.openStart, this.openEnd);
+ }
+ /**
+ Tests whether this slice is equal to another slice.
+ */
+ eq(other) {
+ return this.content.eq(other.content) && this.openStart == other.openStart && this.openEnd == other.openEnd;
+ }
+ /**
+ @internal
+ */
+ toString() {
+ return this.content + "(" + this.openStart + "," + this.openEnd + ")";
+ }
+ /**
+ Convert a slice to a JSON-serializable representation.
+ */
+ toJSON() {
+ if (!this.content.size)
+ return null;
+ let json = { content: this.content.toJSON() };
+ if (this.openStart > 0)
+ json.openStart = this.openStart;
+ if (this.openEnd > 0)
+ json.openEnd = this.openEnd;
+ return json;
+ }
+ /**
+ Deserialize a slice from its JSON representation.
+ */
+ static fromJSON(schema, json) {
+ if (!json)
+ return _Slice.empty;
+ let openStart = json.openStart || 0, openEnd = json.openEnd || 0;
+ if (typeof openStart != "number" || typeof openEnd != "number")
+ throw new RangeError("Invalid input for Slice.fromJSON");
+ return new _Slice(Fragment.fromJSON(schema, json.content), openStart, openEnd);
+ }
+ /**
+ Create a slice from a fragment by taking the maximum possible
+ open value on both side of the fragment.
+ */
+ static maxOpen(fragment, openIsolating = true) {
+ let openStart = 0, openEnd = 0;
+ for (let n4 = fragment.firstChild; n4 && !n4.isLeaf && (openIsolating || !n4.type.spec.isolating); n4 = n4.firstChild)
+ openStart++;
+ for (let n4 = fragment.lastChild; n4 && !n4.isLeaf && (openIsolating || !n4.type.spec.isolating); n4 = n4.lastChild)
+ openEnd++;
+ return new _Slice(fragment, openStart, openEnd);
+ }
+ };
+ Slice.empty = new Slice(Fragment.empty, 0, 0);
+ function removeRange(content3, from, to) {
+ let { index: index2, offset } = content3.findIndex(from), child = content3.maybeChild(index2);
+ let { index: indexTo, offset: offsetTo } = content3.findIndex(to);
+ if (offset == from || child.isText) {
+ if (offsetTo != to && !content3.child(indexTo).isText)
+ throw new RangeError("Removing non-flat range");
+ return content3.cut(0, from).append(content3.cut(to));
+ }
+ if (index2 != indexTo)
+ throw new RangeError("Removing non-flat range");
+ return content3.replaceChild(index2, child.copy(removeRange(child.content, from - offset - 1, to - offset - 1)));
+ }
+ function insertInto(content3, dist, insert, parent) {
+ let { index: index2, offset } = content3.findIndex(dist), child = content3.maybeChild(index2);
+ if (offset == dist || child.isText) {
+ if (parent && !parent.canReplace(index2, index2, insert))
+ return null;
+ return content3.cut(0, dist).append(insert).append(content3.cut(dist));
+ }
+ let inner = insertInto(child.content, dist - offset - 1, insert);
+ return inner && content3.replaceChild(index2, child.copy(inner));
+ }
+ function replace($from, $to, slice) {
+ if (slice.openStart > $from.depth)
+ throw new ReplaceError("Inserted content deeper than insertion position");
+ if ($from.depth - slice.openStart != $to.depth - slice.openEnd)
+ throw new ReplaceError("Inconsistent open depths");
+ return replaceOuter($from, $to, slice, 0);
+ }
+ function replaceOuter($from, $to, slice, depth) {
+ let index2 = $from.index(depth), node2 = $from.node(depth);
+ if (index2 == $to.index(depth) && depth < $from.depth - slice.openStart) {
+ let inner = replaceOuter($from, $to, slice, depth + 1);
+ return node2.copy(node2.content.replaceChild(index2, inner));
+ } else if (!slice.content.size) {
+ return close(node2, replaceTwoWay($from, $to, depth));
+ } else if (!slice.openStart && !slice.openEnd && $from.depth == depth && $to.depth == depth) {
+ let parent = $from.parent, content3 = parent.content;
+ return close(parent, content3.cut(0, $from.parentOffset).append(slice.content).append(content3.cut($to.parentOffset)));
+ } else {
+ let { start, end } = prepareSliceForReplace(slice, $from);
+ return close(node2, replaceThreeWay($from, start, end, $to, depth));
+ }
+ }
+ function checkJoin(main, sub) {
+ if (!sub.type.compatibleContent(main.type))
+ throw new ReplaceError("Cannot join " + sub.type.name + " onto " + main.type.name);
+ }
+ function joinable($before, $after, depth) {
+ let node2 = $before.node(depth);
+ checkJoin(node2, $after.node(depth));
+ return node2;
+ }
+ function addNode(child, target) {
+ let last = target.length - 1;
+ if (last >= 0 && child.isText && child.sameMarkup(target[last]))
+ target[last] = child.withText(target[last].text + child.text);
+ else
+ target.push(child);
+ }
+ function addRange($start, $end, depth, target) {
+ let node2 = ($end || $start).node(depth);
+ let startIndex = 0, endIndex = $end ? $end.index(depth) : node2.childCount;
+ if ($start) {
+ startIndex = $start.index(depth);
+ if ($start.depth > depth) {
+ startIndex++;
+ } else if ($start.textOffset) {
+ addNode($start.nodeAfter, target);
+ startIndex++;
+ }
+ }
+ for (let i2 = startIndex; i2 < endIndex; i2++)
+ addNode(node2.child(i2), target);
+ if ($end && $end.depth == depth && $end.textOffset)
+ addNode($end.nodeBefore, target);
+ }
+ function close(node2, content3) {
+ node2.type.checkContent(content3);
+ return node2.copy(content3);
+ }
+ function replaceThreeWay($from, $start, $end, $to, depth) {
+ let openStart = $from.depth > depth && joinable($from, $start, depth + 1);
+ let openEnd = $to.depth > depth && joinable($end, $to, depth + 1);
+ let content3 = [];
+ addRange(null, $from, depth, content3);
+ if (openStart && openEnd && $start.index(depth) == $end.index(depth)) {
+ checkJoin(openStart, openEnd);
+ addNode(close(openStart, replaceThreeWay($from, $start, $end, $to, depth + 1)), content3);
+ } else {
+ if (openStart)
+ addNode(close(openStart, replaceTwoWay($from, $start, depth + 1)), content3);
+ addRange($start, $end, depth, content3);
+ if (openEnd)
+ addNode(close(openEnd, replaceTwoWay($end, $to, depth + 1)), content3);
+ }
+ addRange($to, null, depth, content3);
+ return new Fragment(content3);
+ }
+ function replaceTwoWay($from, $to, depth) {
+ let content3 = [];
+ addRange(null, $from, depth, content3);
+ if ($from.depth > depth) {
+ let type = joinable($from, $to, depth + 1);
+ addNode(close(type, replaceTwoWay($from, $to, depth + 1)), content3);
+ }
+ addRange($to, null, depth, content3);
+ return new Fragment(content3);
+ }
+ function prepareSliceForReplace(slice, $along) {
+ let extra = $along.depth - slice.openStart, parent = $along.node(extra);
+ let node2 = parent.copy(slice.content);
+ for (let i2 = extra - 1; i2 >= 0; i2--)
+ node2 = $along.node(i2).copy(Fragment.from(node2));
+ return {
+ start: node2.resolveNoCache(slice.openStart + extra),
+ end: node2.resolveNoCache(node2.content.size - slice.openEnd - extra)
+ };
+ }
+ var ResolvedPos = class _ResolvedPos {
+ /**
+ @internal
+ */
+ constructor(pos, path3, parentOffset) {
+ this.pos = pos;
+ this.path = path3;
+ this.parentOffset = parentOffset;
+ this.depth = path3.length / 3 - 1;
+ }
+ /**
+ @internal
+ */
+ resolveDepth(val) {
+ if (val == null)
+ return this.depth;
+ if (val < 0)
+ return this.depth + val;
+ return val;
+ }
+ /**
+ The parent node that the position points into. Note that even if
+ a position points into a text node, that node is not considered
+ the parent—text nodes are ‘flat’ in this model, and have no content.
+ */
+ get parent() {
+ return this.node(this.depth);
+ }
+ /**
+ The root node in which the position was resolved.
+ */
+ get doc() {
+ return this.node(0);
+ }
+ /**
+ The ancestor node at the given level. `p.node(p.depth)` is the
+ same as `p.parent`.
+ */
+ node(depth) {
+ return this.path[this.resolveDepth(depth) * 3];
+ }
+ /**
+ The index into the ancestor at the given level. If this points
+ at the 3rd node in the 2nd paragraph on the top level, for
+ example, `p.index(0)` is 1 and `p.index(1)` is 2.
+ */
+ index(depth) {
+ return this.path[this.resolveDepth(depth) * 3 + 1];
+ }
+ /**
+ The index pointing after this position into the ancestor at the
+ given level.
+ */
+ indexAfter(depth) {
+ depth = this.resolveDepth(depth);
+ return this.index(depth) + (depth == this.depth && !this.textOffset ? 0 : 1);
+ }
+ /**
+ The (absolute) position at the start of the node at the given
+ level.
+ */
+ start(depth) {
+ depth = this.resolveDepth(depth);
+ return depth == 0 ? 0 : this.path[depth * 3 - 1] + 1;
+ }
+ /**
+ The (absolute) position at the end of the node at the given
+ level.
+ */
+ end(depth) {
+ depth = this.resolveDepth(depth);
+ return this.start(depth) + this.node(depth).content.size;
+ }
+ /**
+ The (absolute) position directly before the wrapping node at the
+ given level, or, when `depth` is `this.depth + 1`, the original
+ position.
+ */
+ before(depth) {
+ depth = this.resolveDepth(depth);
+ if (!depth)
+ throw new RangeError("There is no position before the top-level node");
+ return depth == this.depth + 1 ? this.pos : this.path[depth * 3 - 1];
+ }
+ /**
+ The (absolute) position directly after the wrapping node at the
+ given level, or the original position when `depth` is `this.depth + 1`.
+ */
+ after(depth) {
+ depth = this.resolveDepth(depth);
+ if (!depth)
+ throw new RangeError("There is no position after the top-level node");
+ return depth == this.depth + 1 ? this.pos : this.path[depth * 3 - 1] + this.path[depth * 3].nodeSize;
+ }
+ /**
+ When this position points into a text node, this returns the
+ distance between the position and the start of the text node.
+ Will be zero for positions that point between nodes.
+ */
+ get textOffset() {
+ return this.pos - this.path[this.path.length - 1];
+ }
+ /**
+ Get the node directly after the position, if any. If the position
+ points into a text node, only the part of that node after the
+ position is returned.
+ */
+ get nodeAfter() {
+ let parent = this.parent, index2 = this.index(this.depth);
+ if (index2 == parent.childCount)
+ return null;
+ let dOff = this.pos - this.path[this.path.length - 1], child = parent.child(index2);
+ return dOff ? parent.child(index2).cut(dOff) : child;
+ }
+ /**
+ Get the node directly before the position, if any. If the
+ position points into a text node, only the part of that node
+ before the position is returned.
+ */
+ get nodeBefore() {
+ let index2 = this.index(this.depth);
+ let dOff = this.pos - this.path[this.path.length - 1];
+ if (dOff)
+ return this.parent.child(index2).cut(0, dOff);
+ return index2 == 0 ? null : this.parent.child(index2 - 1);
+ }
+ /**
+ Get the position at the given index in the parent node at the
+ given depth (which defaults to `this.depth`).
+ */
+ posAtIndex(index2, depth) {
+ depth = this.resolveDepth(depth);
+ let node2 = this.path[depth * 3], pos = depth == 0 ? 0 : this.path[depth * 3 - 1] + 1;
+ for (let i2 = 0; i2 < index2; i2++)
+ pos += node2.child(i2).nodeSize;
+ return pos;
+ }
+ /**
+ Get the marks at this position, factoring in the surrounding
+ marks' [`inclusive`](https://prosemirror.net/docs/ref/#model.MarkSpec.inclusive) property. If the
+ position is at the start of a non-empty node, the marks of the
+ node after it (if any) are returned.
+ */
+ marks() {
+ let parent = this.parent, index2 = this.index();
+ if (parent.content.size == 0)
+ return Mark.none;
+ if (this.textOffset)
+ return parent.child(index2).marks;
+ let main = parent.maybeChild(index2 - 1), other = parent.maybeChild(index2);
+ if (!main) {
+ let tmp = main;
+ main = other;
+ other = tmp;
+ }
+ let marks = main.marks;
+ for (var i2 = 0; i2 < marks.length; i2++)
+ if (marks[i2].type.spec.inclusive === false && (!other || !marks[i2].isInSet(other.marks)))
+ marks = marks[i2--].removeFromSet(marks);
+ return marks;
+ }
+ /**
+ Get the marks after the current position, if any, except those
+ that are non-inclusive and not present at position `$end`. This
+ is mostly useful for getting the set of marks to preserve after a
+ deletion. Will return `null` if this position is at the end of
+ its parent node or its parent node isn't a textblock (in which
+ case no marks should be preserved).
+ */
+ marksAcross($end) {
+ let after = this.parent.maybeChild(this.index());
+ if (!after || !after.isInline)
+ return null;
+ let marks = after.marks, next = $end.parent.maybeChild($end.index());
+ for (var i2 = 0; i2 < marks.length; i2++)
+ if (marks[i2].type.spec.inclusive === false && (!next || !marks[i2].isInSet(next.marks)))
+ marks = marks[i2--].removeFromSet(marks);
+ return marks;
+ }
+ /**
+ The depth up to which this position and the given (non-resolved)
+ position share the same parent nodes.
+ */
+ sharedDepth(pos) {
+ for (let depth = this.depth; depth > 0; depth--)
+ if (this.start(depth) <= pos && this.end(depth) >= pos)
+ return depth;
+ return 0;
+ }
+ /**
+ Returns a range based on the place where this position and the
+ given position diverge around block content. If both point into
+ the same textblock, for example, a range around that textblock
+ will be returned. If they point into different blocks, the range
+ around those blocks in their shared ancestor is returned. You can
+ pass in an optional predicate that will be called with a parent
+ node to see if a range into that parent is acceptable.
+ */
+ blockRange(other = this, pred) {
+ if (other.pos < this.pos)
+ return other.blockRange(this);
+ for (let d6 = this.depth - (this.parent.inlineContent || this.pos == other.pos ? 1 : 0); d6 >= 0; d6--)
+ if (other.pos <= this.end(d6) && (!pred || pred(this.node(d6))))
+ return new NodeRange(this, other, d6);
+ return null;
+ }
+ /**
+ Query whether the given position shares the same parent node.
+ */
+ sameParent(other) {
+ return this.pos - this.parentOffset == other.pos - other.parentOffset;
+ }
+ /**
+ Return the greater of this and the given position.
+ */
+ max(other) {
+ return other.pos > this.pos ? other : this;
+ }
+ /**
+ Return the smaller of this and the given position.
+ */
+ min(other) {
+ return other.pos < this.pos ? other : this;
+ }
+ /**
+ @internal
+ */
+ toString() {
+ let str = "";
+ for (let i2 = 1; i2 <= this.depth; i2++)
+ str += (str ? "/" : "") + this.node(i2).type.name + "_" + this.index(i2 - 1);
+ return str + ":" + this.parentOffset;
+ }
+ /**
+ @internal
+ */
+ static resolve(doc4, pos) {
+ if (!(pos >= 0 && pos <= doc4.content.size))
+ throw new RangeError("Position " + pos + " out of range");
+ let path3 = [];
+ let start = 0, parentOffset = pos;
+ for (let node2 = doc4; ; ) {
+ let { index: index2, offset } = node2.content.findIndex(parentOffset);
+ let rem = parentOffset - offset;
+ path3.push(node2, index2, start + offset);
+ if (!rem)
+ break;
+ node2 = node2.child(index2);
+ if (node2.isText)
+ break;
+ parentOffset = rem - 1;
+ start += offset + 1;
+ }
+ return new _ResolvedPos(pos, path3, parentOffset);
+ }
+ /**
+ @internal
+ */
+ static resolveCached(doc4, pos) {
+ for (let i2 = 0; i2 < resolveCache.length; i2++) {
+ let cached = resolveCache[i2];
+ if (cached.pos == pos && cached.doc == doc4)
+ return cached;
+ }
+ let result = resolveCache[resolveCachePos] = _ResolvedPos.resolve(doc4, pos);
+ resolveCachePos = (resolveCachePos + 1) % resolveCacheSize;
+ return result;
+ }
+ };
+ var resolveCache = [];
+ var resolveCachePos = 0;
+ var resolveCacheSize = 12;
+ var NodeRange = class {
+ /**
+ Construct a node range. `$from` and `$to` should point into the
+ same node until at least the given `depth`, since a node range
+ denotes an adjacent set of nodes in a single parent node.
+ */
+ constructor($from, $to, depth) {
+ this.$from = $from;
+ this.$to = $to;
+ this.depth = depth;
+ }
+ /**
+ The position at the start of the range.
+ */
+ get start() {
+ return this.$from.before(this.depth + 1);
+ }
+ /**
+ The position at the end of the range.
+ */
+ get end() {
+ return this.$to.after(this.depth + 1);
+ }
+ /**
+ The parent node that the range points into.
+ */
+ get parent() {
+ return this.$from.node(this.depth);
+ }
+ /**
+ The start index of the range in the parent node.
+ */
+ get startIndex() {
+ return this.$from.index(this.depth);
+ }
+ /**
+ The end index of the range in the parent node.
+ */
+ get endIndex() {
+ return this.$to.indexAfter(this.depth);
+ }
+ };
+ var emptyAttrs = /* @__PURE__ */ Object.create(null);
+ var Node2 = class _Node {
+ /**
+ @internal
+ */
+ constructor(type, attrs, content3, marks = Mark.none) {
+ this.type = type;
+ this.attrs = attrs;
+ this.marks = marks;
+ this.content = content3 || Fragment.empty;
+ }
+ /**
+ The size of this node, as defined by the integer-based [indexing
+ scheme](/docs/guide/#doc.indexing). For text nodes, this is the
+ amount of characters. For other leaf nodes, it is one. For
+ non-leaf nodes, it is the size of the content plus two (the
+ start and end token).
+ */
+ get nodeSize() {
+ return this.isLeaf ? 1 : 2 + this.content.size;
+ }
+ /**
+ The number of children that the node has.
+ */
+ get childCount() {
+ return this.content.childCount;
+ }
+ /**
+ Get the child node at the given index. Raises an error when the
+ index is out of range.
+ */
+ child(index2) {
+ return this.content.child(index2);
+ }
+ /**
+ Get the child node at the given index, if it exists.
+ */
+ maybeChild(index2) {
+ return this.content.maybeChild(index2);
+ }
+ /**
+ Call `f` for every child node, passing the node, its offset
+ into this parent node, and its index.
+ */
+ forEach(f3) {
+ this.content.forEach(f3);
+ }
+ /**
+ Invoke a callback for all descendant nodes recursively between
+ the given two positions that are relative to start of this
+ node's content. The callback is invoked with the node, its
+ position relative to the original node (method receiver),
+ its parent node, and its child index. When the callback returns
+ false for a given node, that node's children will not be
+ recursed over. The last parameter can be used to specify a
+ starting position to count from.
+ */
+ nodesBetween(from, to, f3, startPos = 0) {
+ this.content.nodesBetween(from, to, f3, startPos, this);
+ }
+ /**
+ Call the given callback for every descendant node. Doesn't
+ descend into a node when the callback returns `false`.
+ */
+ descendants(f3) {
+ this.nodesBetween(0, this.content.size, f3);
+ }
+ /**
+ Concatenates all the text nodes found in this fragment and its
+ children.
+ */
+ get textContent() {
+ return this.isLeaf && this.type.spec.leafText ? this.type.spec.leafText(this) : this.textBetween(0, this.content.size, "");
+ }
+ /**
+ Get all text between positions `from` and `to`. When
+ `blockSeparator` is given, it will be inserted to separate text
+ from different block nodes. If `leafText` is given, it'll be
+ inserted for every non-text leaf node encountered, otherwise
+ [`leafText`](https://prosemirror.net/docs/ref/#model.NodeSpec^leafText) will be used.
+ */
+ textBetween(from, to, blockSeparator, leafText) {
+ return this.content.textBetween(from, to, blockSeparator, leafText);
+ }
+ /**
+ Returns this node's first child, or `null` if there are no
+ children.
+ */
+ get firstChild() {
+ return this.content.firstChild;
+ }
+ /**
+ Returns this node's last child, or `null` if there are no
+ children.
+ */
+ get lastChild() {
+ return this.content.lastChild;
+ }
+ /**
+ Test whether two nodes represent the same piece of document.
+ */
+ eq(other) {
+ return this == other || this.sameMarkup(other) && this.content.eq(other.content);
+ }
+ /**
+ Compare the markup (type, attributes, and marks) of this node to
+ those of another. Returns `true` if both have the same markup.
+ */
+ sameMarkup(other) {
+ return this.hasMarkup(other.type, other.attrs, other.marks);
+ }
+ /**
+ Check whether this node's markup correspond to the given type,
+ attributes, and marks.
+ */
+ hasMarkup(type, attrs, marks) {
+ return this.type == type && compareDeep(this.attrs, attrs || type.defaultAttrs || emptyAttrs) && Mark.sameSet(this.marks, marks || Mark.none);
+ }
+ /**
+ Create a new node with the same markup as this node, containing
+ the given content (or empty, if no content is given).
+ */
+ copy(content3 = null) {
+ if (content3 == this.content)
+ return this;
+ return new _Node(this.type, this.attrs, content3, this.marks);
+ }
+ /**
+ Create a copy of this node, with the given set of marks instead
+ of the node's own marks.
+ */
+ mark(marks) {
+ return marks == this.marks ? this : new _Node(this.type, this.attrs, this.content, marks);
+ }
+ /**
+ Create a copy of this node with only the content between the
+ given positions. If `to` is not given, it defaults to the end of
+ the node.
+ */
+ cut(from, to = this.content.size) {
+ if (from == 0 && to == this.content.size)
+ return this;
+ return this.copy(this.content.cut(from, to));
+ }
+ /**
+ Cut out the part of the document between the given positions, and
+ return it as a `Slice` object.
+ */
+ slice(from, to = this.content.size, includeParents = false) {
+ if (from == to)
+ return Slice.empty;
+ let $from = this.resolve(from), $to = this.resolve(to);
+ let depth = includeParents ? 0 : $from.sharedDepth(to);
+ let start = $from.start(depth), node2 = $from.node(depth);
+ let content3 = node2.content.cut($from.pos - start, $to.pos - start);
+ return new Slice(content3, $from.depth - depth, $to.depth - depth);
+ }
+ /**
+ Replace the part of the document between the given positions with
+ the given slice. The slice must 'fit', meaning its open sides
+ must be able to connect to the surrounding content, and its
+ content nodes must be valid children for the node they are placed
+ into. If any of this is violated, an error of type
+ [`ReplaceError`](https://prosemirror.net/docs/ref/#model.ReplaceError) is thrown.
+ */
+ replace(from, to, slice) {
+ return replace(this.resolve(from), this.resolve(to), slice);
+ }
+ /**
+ Find the node directly after the given position.
+ */
+ nodeAt(pos) {
+ for (let node2 = this; ; ) {
+ let { index: index2, offset } = node2.content.findIndex(pos);
+ node2 = node2.maybeChild(index2);
+ if (!node2)
+ return null;
+ if (offset == pos || node2.isText)
+ return node2;
+ pos -= offset + 1;
+ }
+ }
+ /**
+ Find the (direct) child node after the given offset, if any,
+ and return it along with its index and offset relative to this
+ node.
+ */
+ childAfter(pos) {
+ let { index: index2, offset } = this.content.findIndex(pos);
+ return { node: this.content.maybeChild(index2), index: index2, offset };
+ }
+ /**
+ Find the (direct) child node before the given offset, if any,
+ and return it along with its index and offset relative to this
+ node.
+ */
+ childBefore(pos) {
+ if (pos == 0)
+ return { node: null, index: 0, offset: 0 };
+ let { index: index2, offset } = this.content.findIndex(pos);
+ if (offset < pos)
+ return { node: this.content.child(index2), index: index2, offset };
+ let node2 = this.content.child(index2 - 1);
+ return { node: node2, index: index2 - 1, offset: offset - node2.nodeSize };
+ }
+ /**
+ Resolve the given position in the document, returning an
+ [object](https://prosemirror.net/docs/ref/#model.ResolvedPos) with information about its context.
+ */
+ resolve(pos) {
+ return ResolvedPos.resolveCached(this, pos);
+ }
+ /**
+ @internal
+ */
+ resolveNoCache(pos) {
+ return ResolvedPos.resolve(this, pos);
+ }
+ /**
+ Test whether a given mark or mark type occurs in this document
+ between the two given positions.
+ */
+ rangeHasMark(from, to, type) {
+ let found2 = false;
+ if (to > from)
+ this.nodesBetween(from, to, (node2) => {
+ if (type.isInSet(node2.marks))
+ found2 = true;
+ return !found2;
+ });
+ return found2;
+ }
+ /**
+ True when this is a block (non-inline node)
+ */
+ get isBlock() {
+ return this.type.isBlock;
+ }
+ /**
+ True when this is a textblock node, a block node with inline
+ content.
+ */
+ get isTextblock() {
+ return this.type.isTextblock;
+ }
+ /**
+ True when this node allows inline content.
+ */
+ get inlineContent() {
+ return this.type.inlineContent;
+ }
+ /**
+ True when this is an inline node (a text node or a node that can
+ appear among text).
+ */
+ get isInline() {
+ return this.type.isInline;
+ }
+ /**
+ True when this is a text node.
+ */
+ get isText() {
+ return this.type.isText;
+ }
+ /**
+ True when this is a leaf node.
+ */
+ get isLeaf() {
+ return this.type.isLeaf;
+ }
+ /**
+ True when this is an atom, i.e. when it does not have directly
+ editable content. This is usually the same as `isLeaf`, but can
+ be configured with the [`atom` property](https://prosemirror.net/docs/ref/#model.NodeSpec.atom)
+ on a node's spec (typically used when the node is displayed as
+ an uneditable [node view](https://prosemirror.net/docs/ref/#view.NodeView)).
+ */
+ get isAtom() {
+ return this.type.isAtom;
+ }
+ /**
+ Return a string representation of this node for debugging
+ purposes.
+ */
+ toString() {
+ if (this.type.spec.toDebugString)
+ return this.type.spec.toDebugString(this);
+ let name = this.type.name;
+ if (this.content.size)
+ name += "(" + this.content.toStringInner() + ")";
+ return wrapMarks(this.marks, name);
+ }
+ /**
+ Get the content match in this node at the given index.
+ */
+ contentMatchAt(index2) {
+ let match = this.type.contentMatch.matchFragment(this.content, 0, index2);
+ if (!match)
+ throw new Error("Called contentMatchAt on a node with invalid content");
+ return match;
+ }
+ /**
+ Test whether replacing the range between `from` and `to` (by
+ child index) with the given replacement fragment (which defaults
+ to the empty fragment) would leave the node's content valid. You
+ can optionally pass `start` and `end` indices into the
+ replacement fragment.
+ */
+ canReplace(from, to, replacement = Fragment.empty, start = 0, end = replacement.childCount) {
+ let one2 = this.contentMatchAt(from).matchFragment(replacement, start, end);
+ let two = one2 && one2.matchFragment(this.content, to);
+ if (!two || !two.validEnd)
+ return false;
+ for (let i2 = start; i2 < end; i2++)
+ if (!this.type.allowsMarks(replacement.child(i2).marks))
+ return false;
+ return true;
+ }
+ /**
+ Test whether replacing the range `from` to `to` (by index) with
+ a node of the given type would leave the node's content valid.
+ */
+ canReplaceWith(from, to, type, marks) {
+ if (marks && !this.type.allowsMarks(marks))
+ return false;
+ let start = this.contentMatchAt(from).matchType(type);
+ let end = start && start.matchFragment(this.content, to);
+ return end ? end.validEnd : false;
+ }
+ /**
+ Test whether the given node's content could be appended to this
+ node. If that node is empty, this will only return true if there
+ is at least one node type that can appear in both nodes (to avoid
+ merging completely incompatible nodes).
+ */
+ canAppend(other) {
+ if (other.content.size)
+ return this.canReplace(this.childCount, this.childCount, other.content);
+ else
+ return this.type.compatibleContent(other.type);
+ }
+ /**
+ Check whether this node and its descendants conform to the
+ schema, and raise error when they do not.
+ */
+ check() {
+ this.type.checkContent(this.content);
+ let copy2 = Mark.none;
+ for (let i2 = 0; i2 < this.marks.length; i2++)
+ copy2 = this.marks[i2].addToSet(copy2);
+ if (!Mark.sameSet(copy2, this.marks))
+ throw new RangeError(`Invalid collection of marks for node ${this.type.name}: ${this.marks.map((m3) => m3.type.name)}`);
+ this.content.forEach((node2) => node2.check());
+ }
+ /**
+ Return a JSON-serializeable representation of this node.
+ */
+ toJSON() {
+ let obj = { type: this.type.name };
+ for (let _3 in this.attrs) {
+ obj.attrs = this.attrs;
+ break;
+ }
+ if (this.content.size)
+ obj.content = this.content.toJSON();
+ if (this.marks.length)
+ obj.marks = this.marks.map((n4) => n4.toJSON());
+ return obj;
+ }
+ /**
+ Deserialize a node from its JSON representation.
+ */
+ static fromJSON(schema, json) {
+ if (!json)
+ throw new RangeError("Invalid input for Node.fromJSON");
+ let marks = null;
+ if (json.marks) {
+ if (!Array.isArray(json.marks))
+ throw new RangeError("Invalid mark data for Node.fromJSON");
+ marks = json.marks.map(schema.markFromJSON);
+ }
+ if (json.type == "text") {
+ if (typeof json.text != "string")
+ throw new RangeError("Invalid text node in JSON");
+ return schema.text(json.text, marks);
+ }
+ let content3 = Fragment.fromJSON(schema, json.content);
+ return schema.nodeType(json.type).create(json.attrs, content3, marks);
+ }
+ };
+ Node2.prototype.text = void 0;
+ var TextNode = class _TextNode extends Node2 {
+ /**
+ @internal
+ */
+ constructor(type, attrs, content3, marks) {
+ super(type, attrs, null, marks);
+ if (!content3)
+ throw new RangeError("Empty text nodes are not allowed");
+ this.text = content3;
+ }
+ toString() {
+ if (this.type.spec.toDebugString)
+ return this.type.spec.toDebugString(this);
+ return wrapMarks(this.marks, JSON.stringify(this.text));
+ }
+ get textContent() {
+ return this.text;
+ }
+ textBetween(from, to) {
+ return this.text.slice(from, to);
+ }
+ get nodeSize() {
+ return this.text.length;
+ }
+ mark(marks) {
+ return marks == this.marks ? this : new _TextNode(this.type, this.attrs, this.text, marks);
+ }
+ withText(text5) {
+ if (text5 == this.text)
+ return this;
+ return new _TextNode(this.type, this.attrs, text5, this.marks);
+ }
+ cut(from = 0, to = this.text.length) {
+ if (from == 0 && to == this.text.length)
+ return this;
+ return this.withText(this.text.slice(from, to));
+ }
+ eq(other) {
+ return this.sameMarkup(other) && this.text == other.text;
+ }
+ toJSON() {
+ let base2 = super.toJSON();
+ base2.text = this.text;
+ return base2;
+ }
+ };
+ function wrapMarks(marks, str) {
+ for (let i2 = marks.length - 1; i2 >= 0; i2--)
+ str = marks[i2].type.name + "(" + str + ")";
+ return str;
+ }
+ var ContentMatch = class _ContentMatch {
+ /**
+ @internal
+ */
+ constructor(validEnd) {
+ this.validEnd = validEnd;
+ this.next = [];
+ this.wrapCache = [];
+ }
+ /**
+ @internal
+ */
+ static parse(string3, nodeTypes) {
+ let stream = new TokenStream(string3, nodeTypes);
+ if (stream.next == null)
+ return _ContentMatch.empty;
+ let expr = parseExpr(stream);
+ if (stream.next)
+ stream.err("Unexpected trailing text");
+ let match = dfa(nfa(expr));
+ checkForDeadEnds(match, stream);
+ return match;
+ }
+ /**
+ Match a node type, returning a match after that node if
+ successful.
+ */
+ matchType(type) {
+ for (let i2 = 0; i2 < this.next.length; i2++)
+ if (this.next[i2].type == type)
+ return this.next[i2].next;
+ return null;
+ }
+ /**
+ Try to match a fragment. Returns the resulting match when
+ successful.
+ */
+ matchFragment(frag, start = 0, end = frag.childCount) {
+ let cur = this;
+ for (let i2 = start; cur && i2 < end; i2++)
+ cur = cur.matchType(frag.child(i2).type);
+ return cur;
+ }
+ /**
+ @internal
+ */
+ get inlineContent() {
+ return this.next.length != 0 && this.next[0].type.isInline;
+ }
+ /**
+ Get the first matching node type at this match position that can
+ be generated.
+ */
+ get defaultType() {
+ for (let i2 = 0; i2 < this.next.length; i2++) {
+ let { type } = this.next[i2];
+ if (!(type.isText || type.hasRequiredAttrs()))
+ return type;
+ }
+ return null;
+ }
+ /**
+ @internal
+ */
+ compatible(other) {
+ for (let i2 = 0; i2 < this.next.length; i2++)
+ for (let j6 = 0; j6 < other.next.length; j6++)
+ if (this.next[i2].type == other.next[j6].type)
+ return true;
+ return false;
+ }
+ /**
+ Try to match the given fragment, and if that fails, see if it can
+ be made to match by inserting nodes in front of it. When
+ successful, return a fragment of inserted nodes (which may be
+ empty if nothing had to be inserted). When `toEnd` is true, only
+ return a fragment if the resulting match goes to the end of the
+ content expression.
+ */
+ fillBefore(after, toEnd = false, startIndex = 0) {
+ let seen = [this];
+ function search2(match, types) {
+ let finished = match.matchFragment(after, startIndex);
+ if (finished && (!toEnd || finished.validEnd))
+ return Fragment.from(types.map((tp) => tp.createAndFill()));
+ for (let i2 = 0; i2 < match.next.length; i2++) {
+ let { type, next } = match.next[i2];
+ if (!(type.isText || type.hasRequiredAttrs()) && seen.indexOf(next) == -1) {
+ seen.push(next);
+ let found2 = search2(next, types.concat(type));
+ if (found2)
+ return found2;
+ }
+ }
+ return null;
+ }
+ return search2(this, []);
+ }
+ /**
+ Find a set of wrapping node types that would allow a node of the
+ given type to appear at this position. The result may be empty
+ (when it fits directly) and will be null when no such wrapping
+ exists.
+ */
+ findWrapping(target) {
+ for (let i2 = 0; i2 < this.wrapCache.length; i2 += 2)
+ if (this.wrapCache[i2] == target)
+ return this.wrapCache[i2 + 1];
+ let computed = this.computeWrapping(target);
+ this.wrapCache.push(target, computed);
+ return computed;
+ }
+ /**
+ @internal
+ */
+ computeWrapping(target) {
+ let seen = /* @__PURE__ */ Object.create(null), active = [{ match: this, type: null, via: null }];
+ while (active.length) {
+ let current = active.shift(), match = current.match;
+ if (match.matchType(target)) {
+ let result = [];
+ for (let obj = current; obj.type; obj = obj.via)
+ result.push(obj.type);
+ return result.reverse();
+ }
+ for (let i2 = 0; i2 < match.next.length; i2++) {
+ let { type, next } = match.next[i2];
+ if (!type.isLeaf && !type.hasRequiredAttrs() && !(type.name in seen) && (!current.type || next.validEnd)) {
+ active.push({ match: type.contentMatch, type, via: current });
+ seen[type.name] = true;
+ }
+ }
+ }
+ return null;
+ }
+ /**
+ The number of outgoing edges this node has in the finite
+ automaton that describes the content expression.
+ */
+ get edgeCount() {
+ return this.next.length;
+ }
+ /**
+ Get the _n_th outgoing edge from this node in the finite
+ automaton that describes the content expression.
+ */
+ edge(n4) {
+ if (n4 >= this.next.length)
+ throw new RangeError(`There's no ${n4}th edge in this content match`);
+ return this.next[n4];
+ }
+ /**
+ @internal
+ */
+ toString() {
+ let seen = [];
+ function scan(m3) {
+ seen.push(m3);
+ for (let i2 = 0; i2 < m3.next.length; i2++)
+ if (seen.indexOf(m3.next[i2].next) == -1)
+ scan(m3.next[i2].next);
+ }
+ scan(this);
+ return seen.map((m3, i2) => {
+ let out = i2 + (m3.validEnd ? "*" : " ") + " ";
+ for (let i3 = 0; i3 < m3.next.length; i3++)
+ out += (i3 ? ", " : "") + m3.next[i3].type.name + "->" + seen.indexOf(m3.next[i3].next);
+ return out;
+ }).join("\n");
+ }
+ };
+ ContentMatch.empty = new ContentMatch(true);
+ var TokenStream = class {
+ constructor(string3, nodeTypes) {
+ this.string = string3;
+ this.nodeTypes = nodeTypes;
+ this.inline = null;
+ this.pos = 0;
+ this.tokens = string3.split(/\s*(?=\b|\W|$)/);
+ if (this.tokens[this.tokens.length - 1] == "")
+ this.tokens.pop();
+ if (this.tokens[0] == "")
+ this.tokens.shift();
+ }
+ get next() {
+ return this.tokens[this.pos];
+ }
+ eat(tok) {
+ return this.next == tok && (this.pos++ || true);
+ }
+ err(str) {
+ throw new SyntaxError(str + " (in content expression '" + this.string + "')");
+ }
+ };
+ function parseExpr(stream) {
+ let exprs = [];
+ do {
+ exprs.push(parseExprSeq(stream));
+ } while (stream.eat("|"));
+ return exprs.length == 1 ? exprs[0] : { type: "choice", exprs };
+ }
+ function parseExprSeq(stream) {
+ let exprs = [];
+ do {
+ exprs.push(parseExprSubscript(stream));
+ } while (stream.next && stream.next != ")" && stream.next != "|");
+ return exprs.length == 1 ? exprs[0] : { type: "seq", exprs };
+ }
+ function parseExprSubscript(stream) {
+ let expr = parseExprAtom(stream);
+ for (; ; ) {
+ if (stream.eat("+"))
+ expr = { type: "plus", expr };
+ else if (stream.eat("*"))
+ expr = { type: "star", expr };
+ else if (stream.eat("?"))
+ expr = { type: "opt", expr };
+ else if (stream.eat("{"))
+ expr = parseExprRange(stream, expr);
+ else
+ break;
+ }
+ return expr;
+ }
+ function parseNum(stream) {
+ if (/\D/.test(stream.next))
+ stream.err("Expected number, got '" + stream.next + "'");
+ let result = Number(stream.next);
+ stream.pos++;
+ return result;
+ }
+ function parseExprRange(stream, expr) {
+ let min = parseNum(stream), max = min;
+ if (stream.eat(",")) {
+ if (stream.next != "}")
+ max = parseNum(stream);
+ else
+ max = -1;
+ }
+ if (!stream.eat("}"))
+ stream.err("Unclosed braced range");
+ return { type: "range", min, max, expr };
+ }
+ function resolveName(stream, name) {
+ let types = stream.nodeTypes, type = types[name];
+ if (type)
+ return [type];
+ let result = [];
+ for (let typeName in types) {
+ let type2 = types[typeName];
+ if (type2.groups.indexOf(name) > -1)
+ result.push(type2);
+ }
+ if (result.length == 0)
+ stream.err("No node type or group '" + name + "' found");
+ return result;
+ }
+ function parseExprAtom(stream) {
+ if (stream.eat("(")) {
+ let expr = parseExpr(stream);
+ if (!stream.eat(")"))
+ stream.err("Missing closing paren");
+ return expr;
+ } else if (!/\W/.test(stream.next)) {
+ let exprs = resolveName(stream, stream.next).map((type) => {
+ if (stream.inline == null)
+ stream.inline = type.isInline;
+ else if (stream.inline != type.isInline)
+ stream.err("Mixing inline and block content");
+ return { type: "name", value: type };
+ });
+ stream.pos++;
+ return exprs.length == 1 ? exprs[0] : { type: "choice", exprs };
+ } else {
+ stream.err("Unexpected token '" + stream.next + "'");
+ }
+ }
+ function nfa(expr) {
+ let nfa2 = [[]];
+ connect(compile(expr, 0), node2());
+ return nfa2;
+ function node2() {
+ return nfa2.push([]) - 1;
+ }
+ function edge(from, to, term) {
+ let edge2 = { term, to };
+ nfa2[from].push(edge2);
+ return edge2;
+ }
+ function connect(edges, to) {
+ edges.forEach((edge2) => edge2.to = to);
+ }
+ function compile(expr2, from) {
+ if (expr2.type == "choice") {
+ return expr2.exprs.reduce((out, expr3) => out.concat(compile(expr3, from)), []);
+ } else if (expr2.type == "seq") {
+ for (let i2 = 0; ; i2++) {
+ let next = compile(expr2.exprs[i2], from);
+ if (i2 == expr2.exprs.length - 1)
+ return next;
+ connect(next, from = node2());
+ }
+ } else if (expr2.type == "star") {
+ let loop = node2();
+ edge(from, loop);
+ connect(compile(expr2.expr, loop), loop);
+ return [edge(loop)];
+ } else if (expr2.type == "plus") {
+ let loop = node2();
+ connect(compile(expr2.expr, from), loop);
+ connect(compile(expr2.expr, loop), loop);
+ return [edge(loop)];
+ } else if (expr2.type == "opt") {
+ return [edge(from)].concat(compile(expr2.expr, from));
+ } else if (expr2.type == "range") {
+ let cur = from;
+ for (let i2 = 0; i2 < expr2.min; i2++) {
+ let next = node2();
+ connect(compile(expr2.expr, cur), next);
+ cur = next;
+ }
+ if (expr2.max == -1) {
+ connect(compile(expr2.expr, cur), cur);
+ } else {
+ for (let i2 = expr2.min; i2 < expr2.max; i2++) {
+ let next = node2();
+ edge(cur, next);
+ connect(compile(expr2.expr, cur), next);
+ cur = next;
+ }
+ }
+ return [edge(cur)];
+ } else if (expr2.type == "name") {
+ return [edge(from, void 0, expr2.value)];
+ } else {
+ throw new Error("Unknown expr type");
+ }
+ }
+ }
+ function cmp(a2, b4) {
+ return b4 - a2;
+ }
+ function nullFrom(nfa2, node2) {
+ let result = [];
+ scan(node2);
+ return result.sort(cmp);
+ function scan(node3) {
+ let edges = nfa2[node3];
+ if (edges.length == 1 && !edges[0].term)
+ return scan(edges[0].to);
+ result.push(node3);
+ for (let i2 = 0; i2 < edges.length; i2++) {
+ let { term, to } = edges[i2];
+ if (!term && result.indexOf(to) == -1)
+ scan(to);
+ }
+ }
+ }
+ function dfa(nfa2) {
+ let labeled = /* @__PURE__ */ Object.create(null);
+ return explore(nullFrom(nfa2, 0));
+ function explore(states) {
+ let out = [];
+ states.forEach((node2) => {
+ nfa2[node2].forEach(({ term, to }) => {
+ if (!term)
+ return;
+ let set;
+ for (let i2 = 0; i2 < out.length; i2++)
+ if (out[i2][0] == term)
+ set = out[i2][1];
+ nullFrom(nfa2, to).forEach((node3) => {
+ if (!set)
+ out.push([term, set = []]);
+ if (set.indexOf(node3) == -1)
+ set.push(node3);
+ });
+ });
+ });
+ let state = labeled[states.join(",")] = new ContentMatch(states.indexOf(nfa2.length - 1) > -1);
+ for (let i2 = 0; i2 < out.length; i2++) {
+ let states2 = out[i2][1].sort(cmp);
+ state.next.push({ type: out[i2][0], next: labeled[states2.join(",")] || explore(states2) });
+ }
+ return state;
+ }
+ }
+ function checkForDeadEnds(match, stream) {
+ for (let i2 = 0, work = [match]; i2 < work.length; i2++) {
+ let state = work[i2], dead = !state.validEnd, nodes = [];
+ for (let j6 = 0; j6 < state.next.length; j6++) {
+ let { type, next } = state.next[j6];
+ nodes.push(type.name);
+ if (dead && !(type.isText || type.hasRequiredAttrs()))
+ dead = false;
+ if (work.indexOf(next) == -1)
+ work.push(next);
+ }
+ if (dead)
+ stream.err("Only non-generatable nodes (" + nodes.join(", ") + ") in a required position (see https://prosemirror.net/docs/guide/#generatable)");
+ }
+ }
+ function defaultAttrs(attrs) {
+ let defaults = /* @__PURE__ */ Object.create(null);
+ for (let attrName in attrs) {
+ let attr = attrs[attrName];
+ if (!attr.hasDefault)
+ return null;
+ defaults[attrName] = attr.default;
+ }
+ return defaults;
+ }
+ function computeAttrs(attrs, value) {
+ let built = /* @__PURE__ */ Object.create(null);
+ for (let name in attrs) {
+ let given = value && value[name];
+ if (given === void 0) {
+ let attr = attrs[name];
+ if (attr.hasDefault)
+ given = attr.default;
+ else
+ throw new RangeError("No value supplied for attribute " + name);
+ }
+ built[name] = given;
+ }
+ return built;
+ }
+ function initAttrs(attrs) {
+ let result = /* @__PURE__ */ Object.create(null);
+ if (attrs)
+ for (let name in attrs)
+ result[name] = new Attribute(attrs[name]);
+ return result;
+ }
+ var NodeType = class _NodeType {
+ /**
+ @internal
+ */
+ constructor(name, schema, spec) {
+ this.name = name;
+ this.schema = schema;
+ this.spec = spec;
+ this.markSet = null;
+ this.groups = spec.group ? spec.group.split(" ") : [];
+ this.attrs = initAttrs(spec.attrs);
+ this.defaultAttrs = defaultAttrs(this.attrs);
+ this.contentMatch = null;
+ this.inlineContent = null;
+ this.isBlock = !(spec.inline || name == "text");
+ this.isText = name == "text";
+ }
+ /**
+ True if this is an inline type.
+ */
+ get isInline() {
+ return !this.isBlock;
+ }
+ /**
+ True if this is a textblock type, a block that contains inline
+ content.
+ */
+ get isTextblock() {
+ return this.isBlock && this.inlineContent;
+ }
+ /**
+ True for node types that allow no content.
+ */
+ get isLeaf() {
+ return this.contentMatch == ContentMatch.empty;
+ }
+ /**
+ True when this node is an atom, i.e. when it does not have
+ directly editable content.
+ */
+ get isAtom() {
+ return this.isLeaf || !!this.spec.atom;
+ }
+ /**
+ The node type's [whitespace](https://prosemirror.net/docs/ref/#model.NodeSpec.whitespace) option.
+ */
+ get whitespace() {
+ return this.spec.whitespace || (this.spec.code ? "pre" : "normal");
+ }
+ /**
+ Tells you whether this node type has any required attributes.
+ */
+ hasRequiredAttrs() {
+ for (let n4 in this.attrs)
+ if (this.attrs[n4].isRequired)
+ return true;
+ return false;
+ }
+ /**
+ Indicates whether this node allows some of the same content as
+ the given node type.
+ */
+ compatibleContent(other) {
+ return this == other || this.contentMatch.compatible(other.contentMatch);
+ }
+ /**
+ @internal
+ */
+ computeAttrs(attrs) {
+ if (!attrs && this.defaultAttrs)
+ return this.defaultAttrs;
+ else
+ return computeAttrs(this.attrs, attrs);
+ }
+ /**
+ Create a `Node` of this type. The given attributes are
+ checked and defaulted (you can pass `null` to use the type's
+ defaults entirely, if no required attributes exist). `content`
+ may be a `Fragment`, a node, an array of nodes, or
+ `null`. Similarly `marks` may be `null` to default to the empty
+ set of marks.
+ */
+ create(attrs = null, content3, marks) {
+ if (this.isText)
+ throw new Error("NodeType.create can't construct text nodes");
+ return new Node2(this, this.computeAttrs(attrs), Fragment.from(content3), Mark.setFrom(marks));
+ }
+ /**
+ Like [`create`](https://prosemirror.net/docs/ref/#model.NodeType.create), but check the given content
+ against the node type's content restrictions, and throw an error
+ if it doesn't match.
+ */
+ createChecked(attrs = null, content3, marks) {
+ content3 = Fragment.from(content3);
+ this.checkContent(content3);
+ return new Node2(this, this.computeAttrs(attrs), content3, Mark.setFrom(marks));
+ }
+ /**
+ Like [`create`](https://prosemirror.net/docs/ref/#model.NodeType.create), but see if it is
+ necessary to add nodes to the start or end of the given fragment
+ to make it fit the node. If no fitting wrapping can be found,
+ return null. Note that, due to the fact that required nodes can
+ always be created, this will always succeed if you pass null or
+ `Fragment.empty` as content.
+ */
+ createAndFill(attrs = null, content3, marks) {
+ attrs = this.computeAttrs(attrs);
+ content3 = Fragment.from(content3);
+ if (content3.size) {
+ let before = this.contentMatch.fillBefore(content3);
+ if (!before)
+ return null;
+ content3 = before.append(content3);
+ }
+ let matched = this.contentMatch.matchFragment(content3);
+ let after = matched && matched.fillBefore(Fragment.empty, true);
+ if (!after)
+ return null;
+ return new Node2(this, attrs, content3.append(after), Mark.setFrom(marks));
+ }
+ /**
+ Returns true if the given fragment is valid content for this node
+ type with the given attributes.
+ */
+ validContent(content3) {
+ let result = this.contentMatch.matchFragment(content3);
+ if (!result || !result.validEnd)
+ return false;
+ for (let i2 = 0; i2 < content3.childCount; i2++)
+ if (!this.allowsMarks(content3.child(i2).marks))
+ return false;
+ return true;
+ }
+ /**
+ Throws a RangeError if the given fragment is not valid content for this
+ node type.
+ @internal
+ */
+ checkContent(content3) {
+ if (!this.validContent(content3))
+ throw new RangeError(`Invalid content for node ${this.name}: ${content3.toString().slice(0, 50)}`);
+ }
+ /**
+ Check whether the given mark type is allowed in this node.
+ */
+ allowsMarkType(markType) {
+ return this.markSet == null || this.markSet.indexOf(markType) > -1;
+ }
+ /**
+ Test whether the given set of marks are allowed in this node.
+ */
+ allowsMarks(marks) {
+ if (this.markSet == null)
+ return true;
+ for (let i2 = 0; i2 < marks.length; i2++)
+ if (!this.allowsMarkType(marks[i2].type))
+ return false;
+ return true;
+ }
+ /**
+ Removes the marks that are not allowed in this node from the given set.
+ */
+ allowedMarks(marks) {
+ if (this.markSet == null)
+ return marks;
+ let copy2;
+ for (let i2 = 0; i2 < marks.length; i2++) {
+ if (!this.allowsMarkType(marks[i2].type)) {
+ if (!copy2)
+ copy2 = marks.slice(0, i2);
+ } else if (copy2) {
+ copy2.push(marks[i2]);
+ }
+ }
+ return !copy2 ? marks : copy2.length ? copy2 : Mark.none;
+ }
+ /**
+ @internal
+ */
+ static compile(nodes, schema) {
+ let result = /* @__PURE__ */ Object.create(null);
+ nodes.forEach((name, spec) => result[name] = new _NodeType(name, schema, spec));
+ let topType = schema.spec.topNode || "doc";
+ if (!result[topType])
+ throw new RangeError("Schema is missing its top node type ('" + topType + "')");
+ if (!result.text)
+ throw new RangeError("Every schema needs a 'text' type");
+ for (let _3 in result.text.attrs)
+ throw new RangeError("The text node type should not have attributes");
+ return result;
+ }
+ };
+ var Attribute = class {
+ constructor(options2) {
+ this.hasDefault = Object.prototype.hasOwnProperty.call(options2, "default");
+ this.default = options2.default;
+ }
+ get isRequired() {
+ return !this.hasDefault;
+ }
+ };
+ var MarkType = class _MarkType {
+ /**
+ @internal
+ */
+ constructor(name, rank, schema, spec) {
+ this.name = name;
+ this.rank = rank;
+ this.schema = schema;
+ this.spec = spec;
+ this.attrs = initAttrs(spec.attrs);
+ this.excluded = null;
+ let defaults = defaultAttrs(this.attrs);
+ this.instance = defaults ? new Mark(this, defaults) : null;
+ }
+ /**
+ Create a mark of this type. `attrs` may be `null` or an object
+ containing only some of the mark's attributes. The others, if
+ they have defaults, will be added.
+ */
+ create(attrs = null) {
+ if (!attrs && this.instance)
+ return this.instance;
+ return new Mark(this, computeAttrs(this.attrs, attrs));
+ }
+ /**
+ @internal
+ */
+ static compile(marks, schema) {
+ let result = /* @__PURE__ */ Object.create(null), rank = 0;
+ marks.forEach((name, spec) => result[name] = new _MarkType(name, rank++, schema, spec));
+ return result;
+ }
+ /**
+ When there is a mark of this type in the given set, a new set
+ without it is returned. Otherwise, the input set is returned.
+ */
+ removeFromSet(set) {
+ for (var i2 = 0; i2 < set.length; i2++)
+ if (set[i2].type == this) {
+ set = set.slice(0, i2).concat(set.slice(i2 + 1));
+ i2--;
+ }
+ return set;
+ }
+ /**
+ Tests whether there is a mark of this type in the given set.
+ */
+ isInSet(set) {
+ for (let i2 = 0; i2 < set.length; i2++)
+ if (set[i2].type == this)
+ return set[i2];
+ }
+ /**
+ Queries whether a given mark type is
+ [excluded](https://prosemirror.net/docs/ref/#model.MarkSpec.excludes) by this one.
+ */
+ excludes(other) {
+ return this.excluded.indexOf(other) > -1;
+ }
+ };
+ var Schema = class {
+ /**
+ Construct a schema from a schema [specification](https://prosemirror.net/docs/ref/#model.SchemaSpec).
+ */
+ constructor(spec) {
+ this.linebreakReplacement = null;
+ this.cached = /* @__PURE__ */ Object.create(null);
+ let instanceSpec = this.spec = {};
+ for (let prop in spec)
+ instanceSpec[prop] = spec[prop];
+ instanceSpec.nodes = dist_default.from(spec.nodes), instanceSpec.marks = dist_default.from(spec.marks || {}), this.nodes = NodeType.compile(this.spec.nodes, this);
+ this.marks = MarkType.compile(this.spec.marks, this);
+ let contentExprCache = /* @__PURE__ */ Object.create(null);
+ for (let prop in this.nodes) {
+ if (prop in this.marks)
+ throw new RangeError(prop + " can not be both a node and a mark");
+ let type = this.nodes[prop], contentExpr = type.spec.content || "", markExpr = type.spec.marks;
+ type.contentMatch = contentExprCache[contentExpr] || (contentExprCache[contentExpr] = ContentMatch.parse(contentExpr, this.nodes));
+ type.inlineContent = type.contentMatch.inlineContent;
+ if (type.spec.linebreakReplacement) {
+ if (this.linebreakReplacement)
+ throw new RangeError("Multiple linebreak nodes defined");
+ if (!type.isInline || !type.isLeaf)
+ throw new RangeError("Linebreak replacement nodes must be inline leaf nodes");
+ this.linebreakReplacement = type;
+ }
+ type.markSet = markExpr == "_" ? null : markExpr ? gatherMarks(this, markExpr.split(" ")) : markExpr == "" || !type.inlineContent ? [] : null;
+ }
+ for (let prop in this.marks) {
+ let type = this.marks[prop], excl = type.spec.excludes;
+ type.excluded = excl == null ? [type] : excl == "" ? [] : gatherMarks(this, excl.split(" "));
+ }
+ this.nodeFromJSON = this.nodeFromJSON.bind(this);
+ this.markFromJSON = this.markFromJSON.bind(this);
+ this.topNodeType = this.nodes[this.spec.topNode || "doc"];
+ this.cached.wrappings = /* @__PURE__ */ Object.create(null);
+ }
+ /**
+ Create a node in this schema. The `type` may be a string or a
+ `NodeType` instance. Attributes will be extended with defaults,
+ `content` may be a `Fragment`, `null`, a `Node`, or an array of
+ nodes.
+ */
+ node(type, attrs = null, content3, marks) {
+ if (typeof type == "string")
+ type = this.nodeType(type);
+ else if (!(type instanceof NodeType))
+ throw new RangeError("Invalid node type: " + type);
+ else if (type.schema != this)
+ throw new RangeError("Node type from different schema used (" + type.name + ")");
+ return type.createChecked(attrs, content3, marks);
+ }
+ /**
+ Create a text node in the schema. Empty text nodes are not
+ allowed.
+ */
+ text(text5, marks) {
+ let type = this.nodes.text;
+ return new TextNode(type, type.defaultAttrs, text5, Mark.setFrom(marks));
+ }
+ /**
+ Create a mark with the given type and attributes.
+ */
+ mark(type, attrs) {
+ if (typeof type == "string")
+ type = this.marks[type];
+ return type.create(attrs);
+ }
+ /**
+ Deserialize a node from its JSON representation. This method is
+ bound.
+ */
+ nodeFromJSON(json) {
+ return Node2.fromJSON(this, json);
+ }
+ /**
+ Deserialize a mark from its JSON representation. This method is
+ bound.
+ */
+ markFromJSON(json) {
+ return Mark.fromJSON(this, json);
+ }
+ /**
+ @internal
+ */
+ nodeType(name) {
+ let found2 = this.nodes[name];
+ if (!found2)
+ throw new RangeError("Unknown node type: " + name);
+ return found2;
+ }
+ };
+ function gatherMarks(schema, marks) {
+ let found2 = [];
+ for (let i2 = 0; i2 < marks.length; i2++) {
+ let name = marks[i2], mark = schema.marks[name], ok3 = mark;
+ if (mark) {
+ found2.push(mark);
+ } else {
+ for (let prop in schema.marks) {
+ let mark2 = schema.marks[prop];
+ if (name == "_" || mark2.spec.group && mark2.spec.group.split(" ").indexOf(name) > -1)
+ found2.push(ok3 = mark2);
+ }
+ }
+ if (!ok3)
+ throw new SyntaxError("Unknown mark type: '" + marks[i2] + "'");
+ }
+ return found2;
+ }
+ function isTagRule(rule) {
+ return rule.tag != null;
+ }
+ function isStyleRule(rule) {
+ return rule.style != null;
+ }
+ var DOMParser = class _DOMParser {
+ /**
+ Create a parser that targets the given schema, using the given
+ parsing rules.
+ */
+ constructor(schema, rules) {
+ this.schema = schema;
+ this.rules = rules;
+ this.tags = [];
+ this.styles = [];
+ rules.forEach((rule) => {
+ if (isTagRule(rule))
+ this.tags.push(rule);
+ else if (isStyleRule(rule))
+ this.styles.push(rule);
+ });
+ this.normalizeLists = !this.tags.some((r3) => {
+ if (!/^(ul|ol)\b/.test(r3.tag) || !r3.node)
+ return false;
+ let node2 = schema.nodes[r3.node];
+ return node2.contentMatch.matchType(node2);
+ });
+ }
+ /**
+ Parse a document from the content of a DOM node.
+ */
+ parse(dom, options2 = {}) {
+ let context = new ParseContext(this, options2, false);
+ context.addAll(dom, options2.from, options2.to);
+ return context.finish();
+ }
+ /**
+ Parses the content of the given DOM node, like
+ [`parse`](https://prosemirror.net/docs/ref/#model.DOMParser.parse), and takes the same set of
+ options. But unlike that method, which produces a whole node,
+ this one returns a slice that is open at the sides, meaning that
+ the schema constraints aren't applied to the start of nodes to
+ the left of the input and the end of nodes at the end.
+ */
+ parseSlice(dom, options2 = {}) {
+ let context = new ParseContext(this, options2, true);
+ context.addAll(dom, options2.from, options2.to);
+ return Slice.maxOpen(context.finish());
+ }
+ /**
+ @internal
+ */
+ matchTag(dom, context, after) {
+ for (let i2 = after ? this.tags.indexOf(after) + 1 : 0; i2 < this.tags.length; i2++) {
+ let rule = this.tags[i2];
+ if (matches(dom, rule.tag) && (rule.namespace === void 0 || dom.namespaceURI == rule.namespace) && (!rule.context || context.matchesContext(rule.context))) {
+ if (rule.getAttrs) {
+ let result = rule.getAttrs(dom);
+ if (result === false)
+ continue;
+ rule.attrs = result || void 0;
+ }
+ return rule;
+ }
+ }
+ }
+ /**
+ @internal
+ */
+ matchStyle(prop, value, context, after) {
+ for (let i2 = after ? this.styles.indexOf(after) + 1 : 0; i2 < this.styles.length; i2++) {
+ let rule = this.styles[i2], style2 = rule.style;
+ if (style2.indexOf(prop) != 0 || rule.context && !context.matchesContext(rule.context) || // Test that the style string either precisely matches the prop,
+ // or has an '=' sign after the prop, followed by the given
+ // value.
+ style2.length > prop.length && (style2.charCodeAt(prop.length) != 61 || style2.slice(prop.length + 1) != value))
+ continue;
+ if (rule.getAttrs) {
+ let result = rule.getAttrs(value);
+ if (result === false)
+ continue;
+ rule.attrs = result || void 0;
+ }
+ return rule;
+ }
+ }
+ /**
+ @internal
+ */
+ static schemaRules(schema) {
+ let result = [];
+ function insert(rule) {
+ let priority = rule.priority == null ? 50 : rule.priority, i2 = 0;
+ for (; i2 < result.length; i2++) {
+ let next = result[i2], nextPriority = next.priority == null ? 50 : next.priority;
+ if (nextPriority < priority)
+ break;
+ }
+ result.splice(i2, 0, rule);
+ }
+ for (let name in schema.marks) {
+ let rules = schema.marks[name].spec.parseDOM;
+ if (rules)
+ rules.forEach((rule) => {
+ insert(rule = copy(rule));
+ if (!(rule.mark || rule.ignore || rule.clearMark))
+ rule.mark = name;
+ });
+ }
+ for (let name in schema.nodes) {
+ let rules = schema.nodes[name].spec.parseDOM;
+ if (rules)
+ rules.forEach((rule) => {
+ insert(rule = copy(rule));
+ if (!(rule.node || rule.ignore || rule.mark))
+ rule.node = name;
+ });
+ }
+ return result;
+ }
+ /**
+ Construct a DOM parser using the parsing rules listed in a
+ schema's [node specs](https://prosemirror.net/docs/ref/#model.NodeSpec.parseDOM), reordered by
+ [priority](https://prosemirror.net/docs/ref/#model.ParseRule.priority).
+ */
+ static fromSchema(schema) {
+ return schema.cached.domParser || (schema.cached.domParser = new _DOMParser(schema, _DOMParser.schemaRules(schema)));
+ }
+ };
+ var blockTags = {
+ address: true,
+ article: true,
+ aside: true,
+ blockquote: true,
+ canvas: true,
+ dd: true,
+ div: true,
+ dl: true,
+ fieldset: true,
+ figcaption: true,
+ figure: true,
+ footer: true,
+ form: true,
+ h1: true,
+ h2: true,
+ h3: true,
+ h4: true,
+ h5: true,
+ h6: true,
+ header: true,
+ hgroup: true,
+ hr: true,
+ li: true,
+ noscript: true,
+ ol: true,
+ output: true,
+ p: true,
+ pre: true,
+ section: true,
+ table: true,
+ tfoot: true,
+ ul: true
+ };
+ var ignoreTags = {
+ head: true,
+ noscript: true,
+ object: true,
+ script: true,
+ style: true,
+ title: true
+ };
+ var listTags = { ol: true, ul: true };
+ var OPT_PRESERVE_WS = 1;
+ var OPT_PRESERVE_WS_FULL = 2;
+ var OPT_OPEN_LEFT = 4;
+ function wsOptionsFor(type, preserveWhitespace, base2) {
+ if (preserveWhitespace != null)
+ return (preserveWhitespace ? OPT_PRESERVE_WS : 0) | (preserveWhitespace === "full" ? OPT_PRESERVE_WS_FULL : 0);
+ return type && type.whitespace == "pre" ? OPT_PRESERVE_WS | OPT_PRESERVE_WS_FULL : base2 & ~OPT_OPEN_LEFT;
+ }
+ var NodeContext = class {
+ constructor(type, attrs, marks, pendingMarks, solid, match, options2) {
+ this.type = type;
+ this.attrs = attrs;
+ this.marks = marks;
+ this.pendingMarks = pendingMarks;
+ this.solid = solid;
+ this.options = options2;
+ this.content = [];
+ this.activeMarks = Mark.none;
+ this.stashMarks = [];
+ this.match = match || (options2 & OPT_OPEN_LEFT ? null : type.contentMatch);
+ }
+ findWrapping(node2) {
+ if (!this.match) {
+ if (!this.type)
+ return [];
+ let fill = this.type.contentMatch.fillBefore(Fragment.from(node2));
+ if (fill) {
+ this.match = this.type.contentMatch.matchFragment(fill);
+ } else {
+ let start = this.type.contentMatch, wrap3;
+ if (wrap3 = start.findWrapping(node2.type)) {
+ this.match = start;
+ return wrap3;
+ } else {
+ return null;
+ }
+ }
+ }
+ return this.match.findWrapping(node2.type);
+ }
+ finish(openEnd) {
+ if (!(this.options & OPT_PRESERVE_WS)) {
+ let last = this.content[this.content.length - 1], m3;
+ if (last && last.isText && (m3 = /[ \t\r\n\u000c]+$/.exec(last.text))) {
+ let text5 = last;
+ if (last.text.length == m3[0].length)
+ this.content.pop();
+ else
+ this.content[this.content.length - 1] = text5.withText(text5.text.slice(0, text5.text.length - m3[0].length));
+ }
+ }
+ let content3 = Fragment.from(this.content);
+ if (!openEnd && this.match)
+ content3 = content3.append(this.match.fillBefore(Fragment.empty, true));
+ return this.type ? this.type.create(this.attrs, content3, this.marks) : content3;
+ }
+ popFromStashMark(mark) {
+ for (let i2 = this.stashMarks.length - 1; i2 >= 0; i2--)
+ if (mark.eq(this.stashMarks[i2]))
+ return this.stashMarks.splice(i2, 1)[0];
+ }
+ applyPending(nextType) {
+ for (let i2 = 0, pending = this.pendingMarks; i2 < pending.length; i2++) {
+ let mark = pending[i2];
+ if ((this.type ? this.type.allowsMarkType(mark.type) : markMayApply(mark.type, nextType)) && !mark.isInSet(this.activeMarks)) {
+ this.activeMarks = mark.addToSet(this.activeMarks);
+ this.pendingMarks = mark.removeFromSet(this.pendingMarks);
+ }
+ }
+ }
+ inlineContext(node2) {
+ if (this.type)
+ return this.type.inlineContent;
+ if (this.content.length)
+ return this.content[0].isInline;
+ return node2.parentNode && !blockTags.hasOwnProperty(node2.parentNode.nodeName.toLowerCase());
+ }
+ };
+ var ParseContext = class {
+ constructor(parser, options2, isOpen) {
+ this.parser = parser;
+ this.options = options2;
+ this.isOpen = isOpen;
+ this.open = 0;
+ let topNode = options2.topNode, topContext;
+ let topOptions = wsOptionsFor(null, options2.preserveWhitespace, 0) | (isOpen ? OPT_OPEN_LEFT : 0);
+ if (topNode)
+ topContext = new NodeContext(topNode.type, topNode.attrs, Mark.none, Mark.none, true, options2.topMatch || topNode.type.contentMatch, topOptions);
+ else if (isOpen)
+ topContext = new NodeContext(null, null, Mark.none, Mark.none, true, null, topOptions);
+ else
+ topContext = new NodeContext(parser.schema.topNodeType, null, Mark.none, Mark.none, true, null, topOptions);
+ this.nodes = [topContext];
+ this.find = options2.findPositions;
+ this.needsBlock = false;
+ }
+ get top() {
+ return this.nodes[this.open];
+ }
+ // Add a DOM node to the content. Text is inserted as text node,
+ // otherwise, the node is passed to `addElement` or, if it has a
+ // `style` attribute, `addElementWithStyles`.
+ addDOM(dom) {
+ if (dom.nodeType == 3)
+ this.addTextNode(dom);
+ else if (dom.nodeType == 1)
+ this.addElement(dom);
+ }
+ withStyleRules(dom, f3) {
+ let style2 = dom.getAttribute("style");
+ if (!style2)
+ return f3();
+ let marks = this.readStyles(parseStyles(style2));
+ if (!marks)
+ return;
+ let [addMarks, removeMarks] = marks, top = this.top;
+ for (let i2 = 0; i2 < removeMarks.length; i2++)
+ this.removePendingMark(removeMarks[i2], top);
+ for (let i2 = 0; i2 < addMarks.length; i2++)
+ this.addPendingMark(addMarks[i2]);
+ f3();
+ for (let i2 = 0; i2 < addMarks.length; i2++)
+ this.removePendingMark(addMarks[i2], top);
+ for (let i2 = 0; i2 < removeMarks.length; i2++)
+ this.addPendingMark(removeMarks[i2]);
+ }
+ addTextNode(dom) {
+ let value = dom.nodeValue;
+ let top = this.top;
+ if (top.options & OPT_PRESERVE_WS_FULL || top.inlineContext(dom) || /[^ \t\r\n\u000c]/.test(value)) {
+ if (!(top.options & OPT_PRESERVE_WS)) {
+ value = value.replace(/[ \t\r\n\u000c]+/g, " ");
+ if (/^[ \t\r\n\u000c]/.test(value) && this.open == this.nodes.length - 1) {
+ let nodeBefore = top.content[top.content.length - 1];
+ let domNodeBefore = dom.previousSibling;
+ if (!nodeBefore || domNodeBefore && domNodeBefore.nodeName == "BR" || nodeBefore.isText && /[ \t\r\n\u000c]$/.test(nodeBefore.text))
+ value = value.slice(1);
+ }
+ } else if (!(top.options & OPT_PRESERVE_WS_FULL)) {
+ value = value.replace(/\r?\n|\r/g, " ");
+ } else {
+ value = value.replace(/\r\n?/g, "\n");
+ }
+ if (value)
+ this.insertNode(this.parser.schema.text(value));
+ this.findInText(dom);
+ } else {
+ this.findInside(dom);
+ }
+ }
+ // Try to find a handler for the given tag and use that to parse. If
+ // none is found, the element's content nodes are added directly.
+ addElement(dom, matchAfter) {
+ let name = dom.nodeName.toLowerCase(), ruleID;
+ if (listTags.hasOwnProperty(name) && this.parser.normalizeLists)
+ normalizeList(dom);
+ let rule = this.options.ruleFromNode && this.options.ruleFromNode(dom) || (ruleID = this.parser.matchTag(dom, this, matchAfter));
+ if (rule ? rule.ignore : ignoreTags.hasOwnProperty(name)) {
+ this.findInside(dom);
+ this.ignoreFallback(dom);
+ } else if (!rule || rule.skip || rule.closeParent) {
+ if (rule && rule.closeParent)
+ this.open = Math.max(0, this.open - 1);
+ else if (rule && rule.skip.nodeType)
+ dom = rule.skip;
+ let sync, top = this.top, oldNeedsBlock = this.needsBlock;
+ if (blockTags.hasOwnProperty(name)) {
+ if (top.content.length && top.content[0].isInline && this.open) {
+ this.open--;
+ top = this.top;
+ }
+ sync = true;
+ if (!top.type)
+ this.needsBlock = true;
+ } else if (!dom.firstChild) {
+ this.leafFallback(dom);
+ return;
+ }
+ if (rule && rule.skip)
+ this.addAll(dom);
+ else
+ this.withStyleRules(dom, () => this.addAll(dom));
+ if (sync)
+ this.sync(top);
+ this.needsBlock = oldNeedsBlock;
+ } else {
+ this.withStyleRules(dom, () => {
+ this.addElementByRule(dom, rule, rule.consuming === false ? ruleID : void 0);
+ });
+ }
+ }
+ // Called for leaf DOM nodes that would otherwise be ignored
+ leafFallback(dom) {
+ if (dom.nodeName == "BR" && this.top.type && this.top.type.inlineContent)
+ this.addTextNode(dom.ownerDocument.createTextNode("\n"));
+ }
+ // Called for ignored nodes
+ ignoreFallback(dom) {
+ if (dom.nodeName == "BR" && (!this.top.type || !this.top.type.inlineContent))
+ this.findPlace(this.parser.schema.text("-"));
+ }
+ // Run any style parser associated with the node's styles. Either
+ // return an array of marks, or null to indicate some of the styles
+ // had a rule with `ignore` set.
+ readStyles(styles) {
+ let add = Mark.none, remove = Mark.none;
+ for (let i2 = 0; i2 < styles.length; i2 += 2) {
+ for (let after = void 0; ; ) {
+ let rule = this.parser.matchStyle(styles[i2], styles[i2 + 1], this, after);
+ if (!rule)
+ break;
+ if (rule.ignore)
+ return null;
+ if (rule.clearMark) {
+ this.top.pendingMarks.concat(this.top.activeMarks).forEach((m3) => {
+ if (rule.clearMark(m3))
+ remove = m3.addToSet(remove);
+ });
+ } else {
+ add = this.parser.schema.marks[rule.mark].create(rule.attrs).addToSet(add);
+ }
+ if (rule.consuming === false)
+ after = rule;
+ else
+ break;
+ }
+ }
+ return [add, remove];
+ }
+ // Look up a handler for the given node. If none are found, return
+ // false. Otherwise, apply it, use its return value to drive the way
+ // the node's content is wrapped, and return true.
+ addElementByRule(dom, rule, continueAfter) {
+ let sync, nodeType, mark;
+ if (rule.node) {
+ nodeType = this.parser.schema.nodes[rule.node];
+ if (!nodeType.isLeaf) {
+ sync = this.enter(nodeType, rule.attrs || null, rule.preserveWhitespace);
+ } else if (!this.insertNode(nodeType.create(rule.attrs))) {
+ this.leafFallback(dom);
+ }
+ } else {
+ let markType = this.parser.schema.marks[rule.mark];
+ mark = markType.create(rule.attrs);
+ this.addPendingMark(mark);
+ }
+ let startIn = this.top;
+ if (nodeType && nodeType.isLeaf) {
+ this.findInside(dom);
+ } else if (continueAfter) {
+ this.addElement(dom, continueAfter);
+ } else if (rule.getContent) {
+ this.findInside(dom);
+ rule.getContent(dom, this.parser.schema).forEach((node2) => this.insertNode(node2));
+ } else {
+ let contentDOM = dom;
+ if (typeof rule.contentElement == "string")
+ contentDOM = dom.querySelector(rule.contentElement);
+ else if (typeof rule.contentElement == "function")
+ contentDOM = rule.contentElement(dom);
+ else if (rule.contentElement)
+ contentDOM = rule.contentElement;
+ this.findAround(dom, contentDOM, true);
+ this.addAll(contentDOM);
+ }
+ if (sync && this.sync(startIn))
+ this.open--;
+ if (mark)
+ this.removePendingMark(mark, startIn);
+ }
+ // Add all child nodes between `startIndex` and `endIndex` (or the
+ // whole node, if not given). If `sync` is passed, use it to
+ // synchronize after every block element.
+ addAll(parent, startIndex, endIndex) {
+ let index2 = startIndex || 0;
+ for (let dom = startIndex ? parent.childNodes[startIndex] : parent.firstChild, end = endIndex == null ? null : parent.childNodes[endIndex]; dom != end; dom = dom.nextSibling, ++index2) {
+ this.findAtPoint(parent, index2);
+ this.addDOM(dom);
+ }
+ this.findAtPoint(parent, index2);
+ }
+ // Try to find a way to fit the given node type into the current
+ // context. May add intermediate wrappers and/or leave non-solid
+ // nodes that we're in.
+ findPlace(node2) {
+ let route, sync;
+ for (let depth = this.open; depth >= 0; depth--) {
+ let cx = this.nodes[depth];
+ let found2 = cx.findWrapping(node2);
+ if (found2 && (!route || route.length > found2.length)) {
+ route = found2;
+ sync = cx;
+ if (!found2.length)
+ break;
+ }
+ if (cx.solid)
+ break;
+ }
+ if (!route)
+ return false;
+ this.sync(sync);
+ for (let i2 = 0; i2 < route.length; i2++)
+ this.enterInner(route[i2], null, false);
+ return true;
+ }
+ // Try to insert the given node, adjusting the context when needed.
+ insertNode(node2) {
+ if (node2.isInline && this.needsBlock && !this.top.type) {
+ let block = this.textblockFromContext();
+ if (block)
+ this.enterInner(block);
+ }
+ if (this.findPlace(node2)) {
+ this.closeExtra();
+ let top = this.top;
+ top.applyPending(node2.type);
+ if (top.match)
+ top.match = top.match.matchType(node2.type);
+ let marks = top.activeMarks;
+ for (let i2 = 0; i2 < node2.marks.length; i2++)
+ if (!top.type || top.type.allowsMarkType(node2.marks[i2].type))
+ marks = node2.marks[i2].addToSet(marks);
+ top.content.push(node2.mark(marks));
+ return true;
+ }
+ return false;
+ }
+ // Try to start a node of the given type, adjusting the context when
+ // necessary.
+ enter(type, attrs, preserveWS) {
+ let ok3 = this.findPlace(type.create(attrs));
+ if (ok3)
+ this.enterInner(type, attrs, true, preserveWS);
+ return ok3;
+ }
+ // Open a node of the given type
+ enterInner(type, attrs = null, solid = false, preserveWS) {
+ this.closeExtra();
+ let top = this.top;
+ top.applyPending(type);
+ top.match = top.match && top.match.matchType(type);
+ let options2 = wsOptionsFor(type, preserveWS, top.options);
+ if (top.options & OPT_OPEN_LEFT && top.content.length == 0)
+ options2 |= OPT_OPEN_LEFT;
+ this.nodes.push(new NodeContext(type, attrs, top.activeMarks, top.pendingMarks, solid, null, options2));
+ this.open++;
+ }
+ // Make sure all nodes above this.open are finished and added to
+ // their parents
+ closeExtra(openEnd = false) {
+ let i2 = this.nodes.length - 1;
+ if (i2 > this.open) {
+ for (; i2 > this.open; i2--)
+ this.nodes[i2 - 1].content.push(this.nodes[i2].finish(openEnd));
+ this.nodes.length = this.open + 1;
+ }
+ }
+ finish() {
+ this.open = 0;
+ this.closeExtra(this.isOpen);
+ return this.nodes[0].finish(this.isOpen || this.options.topOpen);
+ }
+ sync(to) {
+ for (let i2 = this.open; i2 >= 0; i2--)
+ if (this.nodes[i2] == to) {
+ this.open = i2;
+ return true;
+ }
+ return false;
+ }
+ get currentPos() {
+ this.closeExtra();
+ let pos = 0;
+ for (let i2 = this.open; i2 >= 0; i2--) {
+ let content3 = this.nodes[i2].content;
+ for (let j6 = content3.length - 1; j6 >= 0; j6--)
+ pos += content3[j6].nodeSize;
+ if (i2)
+ pos++;
+ }
+ return pos;
+ }
+ findAtPoint(parent, offset) {
+ if (this.find)
+ for (let i2 = 0; i2 < this.find.length; i2++) {
+ if (this.find[i2].node == parent && this.find[i2].offset == offset)
+ this.find[i2].pos = this.currentPos;
+ }
+ }
+ findInside(parent) {
+ if (this.find)
+ for (let i2 = 0; i2 < this.find.length; i2++) {
+ if (this.find[i2].pos == null && parent.nodeType == 1 && parent.contains(this.find[i2].node))
+ this.find[i2].pos = this.currentPos;
+ }
+ }
+ findAround(parent, content3, before) {
+ if (parent != content3 && this.find)
+ for (let i2 = 0; i2 < this.find.length; i2++) {
+ if (this.find[i2].pos == null && parent.nodeType == 1 && parent.contains(this.find[i2].node)) {
+ let pos = content3.compareDocumentPosition(this.find[i2].node);
+ if (pos & (before ? 2 : 4))
+ this.find[i2].pos = this.currentPos;
+ }
+ }
+ }
+ findInText(textNode) {
+ if (this.find)
+ for (let i2 = 0; i2 < this.find.length; i2++) {
+ if (this.find[i2].node == textNode)
+ this.find[i2].pos = this.currentPos - (textNode.nodeValue.length - this.find[i2].offset);
+ }
+ }
+ // Determines whether the given context string matches this context.
+ matchesContext(context) {
+ if (context.indexOf("|") > -1)
+ return context.split(/\s*\|\s*/).some(this.matchesContext, this);
+ let parts = context.split("/");
+ let option = this.options.context;
+ let useRoot = !this.isOpen && (!option || option.parent.type == this.nodes[0].type);
+ let minDepth = -(option ? option.depth + 1 : 0) + (useRoot ? 0 : 1);
+ let match = (i2, depth) => {
+ for (; i2 >= 0; i2--) {
+ let part = parts[i2];
+ if (part == "") {
+ if (i2 == parts.length - 1 || i2 == 0)
+ continue;
+ for (; depth >= minDepth; depth--)
+ if (match(i2 - 1, depth))
+ return true;
+ return false;
+ } else {
+ let next = depth > 0 || depth == 0 && useRoot ? this.nodes[depth].type : option && depth >= minDepth ? option.node(depth - minDepth).type : null;
+ if (!next || next.name != part && next.groups.indexOf(part) == -1)
+ return false;
+ depth--;
+ }
+ }
+ return true;
+ };
+ return match(parts.length - 1, this.open);
+ }
+ textblockFromContext() {
+ let $context = this.options.context;
+ if ($context)
+ for (let d6 = $context.depth; d6 >= 0; d6--) {
+ let deflt = $context.node(d6).contentMatchAt($context.indexAfter(d6)).defaultType;
+ if (deflt && deflt.isTextblock && deflt.defaultAttrs)
+ return deflt;
+ }
+ for (let name in this.parser.schema.nodes) {
+ let type = this.parser.schema.nodes[name];
+ if (type.isTextblock && type.defaultAttrs)
+ return type;
+ }
+ }
+ addPendingMark(mark) {
+ let found2 = findSameMarkInSet(mark, this.top.pendingMarks);
+ if (found2)
+ this.top.stashMarks.push(found2);
+ this.top.pendingMarks = mark.addToSet(this.top.pendingMarks);
+ }
+ removePendingMark(mark, upto) {
+ for (let depth = this.open; depth >= 0; depth--) {
+ let level = this.nodes[depth];
+ let found2 = level.pendingMarks.lastIndexOf(mark);
+ if (found2 > -1) {
+ level.pendingMarks = mark.removeFromSet(level.pendingMarks);
+ } else {
+ level.activeMarks = mark.removeFromSet(level.activeMarks);
+ let stashMark = level.popFromStashMark(mark);
+ if (stashMark && level.type && level.type.allowsMarkType(stashMark.type))
+ level.activeMarks = stashMark.addToSet(level.activeMarks);
+ }
+ if (level == upto)
+ break;
+ }
+ }
+ };
+ function normalizeList(dom) {
+ for (let child = dom.firstChild, prevItem = null; child; child = child.nextSibling) {
+ let name = child.nodeType == 1 ? child.nodeName.toLowerCase() : null;
+ if (name && listTags.hasOwnProperty(name) && prevItem) {
+ prevItem.appendChild(child);
+ child = prevItem;
+ } else if (name == "li") {
+ prevItem = child;
+ } else if (name) {
+ prevItem = null;
+ }
+ }
+ }
+ function matches(dom, selector) {
+ return (dom.matches || dom.msMatchesSelector || dom.webkitMatchesSelector || dom.mozMatchesSelector).call(dom, selector);
+ }
+ function parseStyles(style2) {
+ let re4 = /\s*([\w-]+)\s*:\s*([^;]+)/g, m3, result = [];
+ while (m3 = re4.exec(style2))
+ result.push(m3[1], m3[2].trim());
+ return result;
+ }
+ function copy(obj) {
+ let copy2 = {};
+ for (let prop in obj)
+ copy2[prop] = obj[prop];
+ return copy2;
+ }
+ function markMayApply(markType, nodeType) {
+ let nodes = nodeType.schema.nodes;
+ for (let name in nodes) {
+ let parent = nodes[name];
+ if (!parent.allowsMarkType(markType))
+ continue;
+ let seen = [], scan = (match) => {
+ seen.push(match);
+ for (let i2 = 0; i2 < match.edgeCount; i2++) {
+ let { type, next } = match.edge(i2);
+ if (type == nodeType)
+ return true;
+ if (seen.indexOf(next) < 0 && scan(next))
+ return true;
+ }
+ };
+ if (scan(parent.contentMatch))
+ return true;
+ }
+ }
+ function findSameMarkInSet(mark, set) {
+ for (let i2 = 0; i2 < set.length; i2++) {
+ if (mark.eq(set[i2]))
+ return set[i2];
+ }
+ }
+ var DOMSerializer = class _DOMSerializer {
+ /**
+ Create a serializer. `nodes` should map node names to functions
+ that take a node and return a description of the corresponding
+ DOM. `marks` does the same for mark names, but also gets an
+ argument that tells it whether the mark's content is block or
+ inline content (for typical use, it'll always be inline). A mark
+ serializer may be `null` to indicate that marks of that type
+ should not be serialized.
+ */
+ constructor(nodes, marks) {
+ this.nodes = nodes;
+ this.marks = marks;
+ }
+ /**
+ Serialize the content of this fragment to a DOM fragment. When
+ not in the browser, the `document` option, containing a DOM
+ document, should be passed so that the serializer can create
+ nodes.
+ */
+ serializeFragment(fragment, options2 = {}, target) {
+ if (!target)
+ target = doc(options2).createDocumentFragment();
+ let top = target, active = [];
+ fragment.forEach((node2) => {
+ if (active.length || node2.marks.length) {
+ let keep = 0, rendered = 0;
+ while (keep < active.length && rendered < node2.marks.length) {
+ let next = node2.marks[rendered];
+ if (!this.marks[next.type.name]) {
+ rendered++;
+ continue;
+ }
+ if (!next.eq(active[keep][0]) || next.type.spec.spanning === false)
+ break;
+ keep++;
+ rendered++;
+ }
+ while (keep < active.length)
+ top = active.pop()[1];
+ while (rendered < node2.marks.length) {
+ let add = node2.marks[rendered++];
+ let markDOM = this.serializeMark(add, node2.isInline, options2);
+ if (markDOM) {
+ active.push([add, top]);
+ top.appendChild(markDOM.dom);
+ top = markDOM.contentDOM || markDOM.dom;
+ }
+ }
+ }
+ top.appendChild(this.serializeNodeInner(node2, options2));
+ });
+ return target;
+ }
+ /**
+ @internal
+ */
+ serializeNodeInner(node2, options2) {
+ let { dom, contentDOM } = _DOMSerializer.renderSpec(doc(options2), this.nodes[node2.type.name](node2));
+ if (contentDOM) {
+ if (node2.isLeaf)
+ throw new RangeError("Content hole not allowed in a leaf node spec");
+ this.serializeFragment(node2.content, options2, contentDOM);
+ }
+ return dom;
+ }
+ /**
+ Serialize this node to a DOM node. This can be useful when you
+ need to serialize a part of a document, as opposed to the whole
+ document. To serialize a whole document, use
+ [`serializeFragment`](https://prosemirror.net/docs/ref/#model.DOMSerializer.serializeFragment) on
+ its [content](https://prosemirror.net/docs/ref/#model.Node.content).
+ */
+ serializeNode(node2, options2 = {}) {
+ let dom = this.serializeNodeInner(node2, options2);
+ for (let i2 = node2.marks.length - 1; i2 >= 0; i2--) {
+ let wrap3 = this.serializeMark(node2.marks[i2], node2.isInline, options2);
+ if (wrap3) {
+ (wrap3.contentDOM || wrap3.dom).appendChild(dom);
+ dom = wrap3.dom;
+ }
+ }
+ return dom;
+ }
+ /**
+ @internal
+ */
+ serializeMark(mark, inline, options2 = {}) {
+ let toDOM = this.marks[mark.type.name];
+ return toDOM && _DOMSerializer.renderSpec(doc(options2), toDOM(mark, inline));
+ }
+ /**
+ Render an [output spec](https://prosemirror.net/docs/ref/#model.DOMOutputSpec) to a DOM node. If
+ the spec has a hole (zero) in it, `contentDOM` will point at the
+ node with the hole.
+ */
+ static renderSpec(doc4, structure, xmlNS = null) {
+ if (typeof structure == "string")
+ return { dom: doc4.createTextNode(structure) };
+ if (structure.nodeType != null)
+ return { dom: structure };
+ if (structure.dom && structure.dom.nodeType != null)
+ return structure;
+ let tagName = structure[0], space = tagName.indexOf(" ");
+ if (space > 0) {
+ xmlNS = tagName.slice(0, space);
+ tagName = tagName.slice(space + 1);
+ }
+ let contentDOM;
+ let dom = xmlNS ? doc4.createElementNS(xmlNS, tagName) : doc4.createElement(tagName);
+ let attrs = structure[1], start = 1;
+ if (attrs && typeof attrs == "object" && attrs.nodeType == null && !Array.isArray(attrs)) {
+ start = 2;
+ for (let name in attrs)
+ if (attrs[name] != null) {
+ let space2 = name.indexOf(" ");
+ if (space2 > 0)
+ dom.setAttributeNS(name.slice(0, space2), name.slice(space2 + 1), attrs[name]);
+ else
+ dom.setAttribute(name, attrs[name]);
+ }
+ }
+ for (let i2 = start; i2 < structure.length; i2++) {
+ let child = structure[i2];
+ if (child === 0) {
+ if (i2 < structure.length - 1 || i2 > start)
+ throw new RangeError("Content hole must be the only child of its parent node");
+ return { dom, contentDOM: dom };
+ } else {
+ let { dom: inner, contentDOM: innerContent } = _DOMSerializer.renderSpec(doc4, child, xmlNS);
+ dom.appendChild(inner);
+ if (innerContent) {
+ if (contentDOM)
+ throw new RangeError("Multiple content holes");
+ contentDOM = innerContent;
+ }
+ }
+ }
+ return { dom, contentDOM };
+ }
+ /**
+ Build a serializer using the [`toDOM`](https://prosemirror.net/docs/ref/#model.NodeSpec.toDOM)
+ properties in a schema's node and mark specs.
+ */
+ static fromSchema(schema) {
+ return schema.cached.domSerializer || (schema.cached.domSerializer = new _DOMSerializer(this.nodesFromSchema(schema), this.marksFromSchema(schema)));
+ }
+ /**
+ Gather the serializers in a schema's node specs into an object.
+ This can be useful as a base to build a custom serializer from.
+ */
+ static nodesFromSchema(schema) {
+ let result = gatherToDOM(schema.nodes);
+ if (!result.text)
+ result.text = (node2) => node2.text;
+ return result;
+ }
+ /**
+ Gather the serializers in a schema's mark specs into an object.
+ */
+ static marksFromSchema(schema) {
+ return gatherToDOM(schema.marks);
+ }
+ };
+ function gatherToDOM(obj) {
+ let result = {};
+ for (let name in obj) {
+ let toDOM = obj[name].spec.toDOM;
+ if (toDOM)
+ result[name] = toDOM;
+ }
+ return result;
+ }
+ function doc(options2) {
+ return options2.document || window.document;
+ }
+
+ // node_modules/mdast-util-to-string/lib/index.js
+ var emptyOptions = {};
+ function toString(value, options2) {
+ const settings = options2 || emptyOptions;
+ const includeImageAlt = typeof settings.includeImageAlt === "boolean" ? settings.includeImageAlt : true;
+ const includeHtml = typeof settings.includeHtml === "boolean" ? settings.includeHtml : true;
+ return one(value, includeImageAlt, includeHtml);
+ }
+ function one(value, includeImageAlt, includeHtml) {
+ if (node(value)) {
+ if ("value" in value) {
+ return value.type === "html" && !includeHtml ? "" : value.value;
+ }
+ if (includeImageAlt && "alt" in value && value.alt) {
+ return value.alt;
+ }
+ if ("children" in value) {
+ return all(value.children, includeImageAlt, includeHtml);
+ }
+ }
+ if (Array.isArray(value)) {
+ return all(value, includeImageAlt, includeHtml);
+ }
+ return "";
+ }
+ function all(values, includeImageAlt, includeHtml) {
+ const result = [];
+ let index2 = -1;
+ while (++index2 < values.length) {
+ result[index2] = one(values[index2], includeImageAlt, includeHtml);
+ }
+ return result.join("");
+ }
+ function node(value) {
+ return Boolean(value && typeof value === "object");
+ }
+
+ // node_modules/decode-named-character-reference/index.dom.js
+ var element = document.createElement("i");
+ function decodeNamedCharacterReference(value) {
+ const characterReference2 = "&" + value + ";";
+ element.innerHTML = characterReference2;
+ const char = element.textContent;
+ if (char.charCodeAt(char.length - 1) === 59 && value !== "semi") {
+ return false;
+ }
+ return char === characterReference2 ? false : char;
+ }
+
+ // node_modules/micromark-util-chunked/index.js
+ function splice(list4, start, remove, items) {
+ const end = list4.length;
+ let chunkStart = 0;
+ let parameters;
+ if (start < 0) {
+ start = -start > end ? 0 : end + start;
+ } else {
+ start = start > end ? end : start;
+ }
+ remove = remove > 0 ? remove : 0;
+ if (items.length < 1e4) {
+ parameters = Array.from(items);
+ parameters.unshift(start, remove);
+ list4.splice(...parameters);
+ } else {
+ if (remove) list4.splice(start, remove);
+ while (chunkStart < items.length) {
+ parameters = items.slice(chunkStart, chunkStart + 1e4);
+ parameters.unshift(start, 0);
+ list4.splice(...parameters);
+ chunkStart += 1e4;
+ start += 1e4;
+ }
+ }
+ }
+ function push(list4, items) {
+ if (list4.length > 0) {
+ splice(list4, list4.length, 0, items);
+ return list4;
+ }
+ return items;
+ }
+
+ // node_modules/micromark-util-combine-extensions/index.js
+ var hasOwnProperty = {}.hasOwnProperty;
+ function combineExtensions(extensions) {
+ const all2 = {};
+ let index2 = -1;
+ while (++index2 < extensions.length) {
+ syntaxExtension(all2, extensions[index2]);
+ }
+ return all2;
+ }
+ function syntaxExtension(all2, extension2) {
+ let hook;
+ for (hook in extension2) {
+ const maybe = hasOwnProperty.call(all2, hook) ? all2[hook] : void 0;
+ const left = maybe || (all2[hook] = {});
+ const right = extension2[hook];
+ let code3;
+ if (right) {
+ for (code3 in right) {
+ if (!hasOwnProperty.call(left, code3)) left[code3] = [];
+ const value = right[code3];
+ constructs(
+ // @ts-expect-error Looks like a list.
+ left[code3],
+ Array.isArray(value) ? value : value ? [value] : []
+ );
+ }
+ }
+ }
+ }
+ function constructs(existing, list4) {
+ let index2 = -1;
+ const before = [];
+ while (++index2 < list4.length) {
+ ;
+ (list4[index2].add === "after" ? existing : before).push(list4[index2]);
+ }
+ splice(existing, 0, 0, before);
+ }
+
+ // node_modules/micromark-util-decode-numeric-character-reference/index.js
+ function decodeNumericCharacterReference(value, base2) {
+ const code3 = Number.parseInt(value, base2);
+ if (
+ // C0 except for HT, LF, FF, CR, space.
+ code3 < 9 || code3 === 11 || code3 > 13 && code3 < 32 || // Control character (DEL) of C0, and C1 controls.
+ code3 > 126 && code3 < 160 || // Lone high surrogates and low surrogates.
+ code3 > 55295 && code3 < 57344 || // Noncharacters.
+ code3 > 64975 && code3 < 65008 || /* eslint-disable no-bitwise */
+ (code3 & 65535) === 65535 || (code3 & 65535) === 65534 || /* eslint-enable no-bitwise */
+ // Out of range
+ code3 > 1114111
+ ) {
+ return "\uFFFD";
+ }
+ return String.fromCodePoint(code3);
+ }
+
+ // node_modules/micromark-util-normalize-identifier/index.js
+ function normalizeIdentifier(value) {
+ return value.replace(/[\t\n\r ]+/g, " ").replace(/^ | $/g, "").toLowerCase().toUpperCase();
+ }
+
+ // node_modules/micromark-util-character/index.js
+ var asciiAlpha = regexCheck(/[A-Za-z]/);
+ var asciiAlphanumeric = regexCheck(/[\dA-Za-z]/);
+ var asciiAtext = regexCheck(/[#-'*+\--9=?A-Z^-~]/);
+ function asciiControl(code3) {
+ return (
+ // Special whitespace codes (which have negative values), C0 and Control
+ // character DEL
+ code3 !== null && (code3 < 32 || code3 === 127)
+ );
+ }
+ var asciiDigit = regexCheck(/\d/);
+ var asciiHexDigit = regexCheck(/[\dA-Fa-f]/);
+ var asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/);
+ function markdownLineEnding(code3) {
+ return code3 !== null && code3 < -2;
+ }
+ function markdownLineEndingOrSpace(code3) {
+ return code3 !== null && (code3 < 0 || code3 === 32);
+ }
+ function markdownSpace(code3) {
+ return code3 === -2 || code3 === -1 || code3 === 32;
+ }
+ var unicodePunctuation = regexCheck(new RegExp("\\p{P}|\\p{S}", "u"));
+ var unicodeWhitespace = regexCheck(/\s/);
+ function regexCheck(regex) {
+ return check;
+ function check(code3) {
+ return code3 !== null && code3 > -1 && regex.test(String.fromCharCode(code3));
+ }
+ }
+
+ // node_modules/micromark-factory-space/index.js
+ function factorySpace(effects, ok3, type, max) {
+ const limit = max ? max - 1 : Number.POSITIVE_INFINITY;
+ let size = 0;
+ return start;
+ function start(code3) {
+ if (markdownSpace(code3)) {
+ effects.enter(type);
+ return prefix(code3);
+ }
+ return ok3(code3);
+ }
+ function prefix(code3) {
+ if (markdownSpace(code3) && size++ < limit) {
+ effects.consume(code3);
+ return prefix;
+ }
+ effects.exit(type);
+ return ok3(code3);
+ }
+ }
+
+ // node_modules/micromark/lib/initialize/content.js
+ var content = {
+ tokenize: initializeContent
+ };
+ function initializeContent(effects) {
+ const contentStart = effects.attempt(
+ this.parser.constructs.contentInitial,
+ afterContentStartConstruct,
+ paragraphInitial
+ );
+ let previous3;
+ return contentStart;
+ function afterContentStartConstruct(code3) {
+ if (code3 === null) {
+ effects.consume(code3);
+ return;
+ }
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return factorySpace(effects, contentStart, "linePrefix");
+ }
+ function paragraphInitial(code3) {
+ effects.enter("paragraph");
+ return lineStart(code3);
+ }
+ function lineStart(code3) {
+ const token = effects.enter("chunkText", {
+ contentType: "text",
+ previous: previous3
+ });
+ if (previous3) {
+ previous3.next = token;
+ }
+ previous3 = token;
+ return data(code3);
+ }
+ function data(code3) {
+ if (code3 === null) {
+ effects.exit("chunkText");
+ effects.exit("paragraph");
+ effects.consume(code3);
+ return;
+ }
+ if (markdownLineEnding(code3)) {
+ effects.consume(code3);
+ effects.exit("chunkText");
+ return lineStart;
+ }
+ effects.consume(code3);
+ return data;
+ }
+ }
+
+ // node_modules/micromark/lib/initialize/document.js
+ var document2 = {
+ tokenize: initializeDocument
+ };
+ var containerConstruct = {
+ tokenize: tokenizeContainer
+ };
+ function initializeDocument(effects) {
+ const self2 = this;
+ const stack = [];
+ let continued = 0;
+ let childFlow;
+ let childToken;
+ let lineStartOffset;
+ return start;
+ function start(code3) {
+ if (continued < stack.length) {
+ const item = stack[continued];
+ self2.containerState = item[1];
+ return effects.attempt(
+ item[0].continuation,
+ documentContinue,
+ checkNewContainers
+ )(code3);
+ }
+ return checkNewContainers(code3);
+ }
+ function documentContinue(code3) {
+ continued++;
+ if (self2.containerState._closeFlow) {
+ self2.containerState._closeFlow = void 0;
+ if (childFlow) {
+ closeFlow();
+ }
+ const indexBeforeExits = self2.events.length;
+ let indexBeforeFlow = indexBeforeExits;
+ let point3;
+ while (indexBeforeFlow--) {
+ if (self2.events[indexBeforeFlow][0] === "exit" && self2.events[indexBeforeFlow][1].type === "chunkFlow") {
+ point3 = self2.events[indexBeforeFlow][1].end;
+ break;
+ }
+ }
+ exitContainers(continued);
+ let index2 = indexBeforeExits;
+ while (index2 < self2.events.length) {
+ self2.events[index2][1].end = Object.assign({}, point3);
+ index2++;
+ }
+ splice(
+ self2.events,
+ indexBeforeFlow + 1,
+ 0,
+ self2.events.slice(indexBeforeExits)
+ );
+ self2.events.length = index2;
+ return checkNewContainers(code3);
+ }
+ return start(code3);
+ }
+ function checkNewContainers(code3) {
+ if (continued === stack.length) {
+ if (!childFlow) {
+ return documentContinued(code3);
+ }
+ if (childFlow.currentConstruct && childFlow.currentConstruct.concrete) {
+ return flowStart(code3);
+ }
+ self2.interrupt = Boolean(
+ childFlow.currentConstruct && !childFlow._gfmTableDynamicInterruptHack
+ );
+ }
+ self2.containerState = {};
+ return effects.check(
+ containerConstruct,
+ thereIsANewContainer,
+ thereIsNoNewContainer
+ )(code3);
+ }
+ function thereIsANewContainer(code3) {
+ if (childFlow) closeFlow();
+ exitContainers(continued);
+ return documentContinued(code3);
+ }
+ function thereIsNoNewContainer(code3) {
+ self2.parser.lazy[self2.now().line] = continued !== stack.length;
+ lineStartOffset = self2.now().offset;
+ return flowStart(code3);
+ }
+ function documentContinued(code3) {
+ self2.containerState = {};
+ return effects.attempt(
+ containerConstruct,
+ containerContinue,
+ flowStart
+ )(code3);
+ }
+ function containerContinue(code3) {
+ continued++;
+ stack.push([self2.currentConstruct, self2.containerState]);
+ return documentContinued(code3);
+ }
+ function flowStart(code3) {
+ if (code3 === null) {
+ if (childFlow) closeFlow();
+ exitContainers(0);
+ effects.consume(code3);
+ return;
+ }
+ childFlow = childFlow || self2.parser.flow(self2.now());
+ effects.enter("chunkFlow", {
+ contentType: "flow",
+ previous: childToken,
+ _tokenizer: childFlow
+ });
+ return flowContinue(code3);
+ }
+ function flowContinue(code3) {
+ if (code3 === null) {
+ writeToChild(effects.exit("chunkFlow"), true);
+ exitContainers(0);
+ effects.consume(code3);
+ return;
+ }
+ if (markdownLineEnding(code3)) {
+ effects.consume(code3);
+ writeToChild(effects.exit("chunkFlow"));
+ continued = 0;
+ self2.interrupt = void 0;
+ return start;
+ }
+ effects.consume(code3);
+ return flowContinue;
+ }
+ function writeToChild(token, eof) {
+ const stream = self2.sliceStream(token);
+ if (eof) stream.push(null);
+ token.previous = childToken;
+ if (childToken) childToken.next = token;
+ childToken = token;
+ childFlow.defineSkip(token.start);
+ childFlow.write(stream);
+ if (self2.parser.lazy[token.start.line]) {
+ let index2 = childFlow.events.length;
+ while (index2--) {
+ if (
+ // The token starts before the line ending…
+ childFlow.events[index2][1].start.offset < lineStartOffset && // …and either is not ended yet…
+ (!childFlow.events[index2][1].end || // …or ends after it.
+ childFlow.events[index2][1].end.offset > lineStartOffset)
+ ) {
+ return;
+ }
+ }
+ const indexBeforeExits = self2.events.length;
+ let indexBeforeFlow = indexBeforeExits;
+ let seen;
+ let point3;
+ while (indexBeforeFlow--) {
+ if (self2.events[indexBeforeFlow][0] === "exit" && self2.events[indexBeforeFlow][1].type === "chunkFlow") {
+ if (seen) {
+ point3 = self2.events[indexBeforeFlow][1].end;
+ break;
+ }
+ seen = true;
+ }
+ }
+ exitContainers(continued);
+ index2 = indexBeforeExits;
+ while (index2 < self2.events.length) {
+ self2.events[index2][1].end = Object.assign({}, point3);
+ index2++;
+ }
+ splice(
+ self2.events,
+ indexBeforeFlow + 1,
+ 0,
+ self2.events.slice(indexBeforeExits)
+ );
+ self2.events.length = index2;
+ }
+ }
+ function exitContainers(size) {
+ let index2 = stack.length;
+ while (index2-- > size) {
+ const entry = stack[index2];
+ self2.containerState = entry[1];
+ entry[0].exit.call(self2, effects);
+ }
+ stack.length = size;
+ }
+ function closeFlow() {
+ childFlow.write([null]);
+ childToken = void 0;
+ childFlow = void 0;
+ self2.containerState._closeFlow = void 0;
+ }
+ }
+ function tokenizeContainer(effects, ok3, nok) {
+ return factorySpace(
+ effects,
+ effects.attempt(this.parser.constructs.document, ok3, nok),
+ "linePrefix",
+ this.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4
+ );
+ }
+
+ // node_modules/micromark-util-classify-character/index.js
+ function classifyCharacter(code3) {
+ if (code3 === null || markdownLineEndingOrSpace(code3) || unicodeWhitespace(code3)) {
+ return 1;
+ }
+ if (unicodePunctuation(code3)) {
+ return 2;
+ }
+ }
+
+ // node_modules/micromark-util-resolve-all/index.js
+ function resolveAll(constructs2, events, context) {
+ const called = [];
+ let index2 = -1;
+ while (++index2 < constructs2.length) {
+ const resolve = constructs2[index2].resolveAll;
+ if (resolve && !called.includes(resolve)) {
+ events = resolve(events, context);
+ called.push(resolve);
+ }
+ }
+ return events;
+ }
+
+ // node_modules/micromark-core-commonmark/lib/attention.js
+ var attention = {
+ name: "attention",
+ tokenize: tokenizeAttention,
+ resolveAll: resolveAllAttention
+ };
+ function resolveAllAttention(events, context) {
+ let index2 = -1;
+ let open;
+ let group;
+ let text5;
+ let openingSequence;
+ let closingSequence;
+ let use;
+ let nextEvents;
+ let offset;
+ while (++index2 < events.length) {
+ if (events[index2][0] === "enter" && events[index2][1].type === "attentionSequence" && events[index2][1]._close) {
+ open = index2;
+ while (open--) {
+ if (events[open][0] === "exit" && events[open][1].type === "attentionSequence" && events[open][1]._open && // If the markers are the same:
+ context.sliceSerialize(events[open][1]).charCodeAt(0) === context.sliceSerialize(events[index2][1]).charCodeAt(0)) {
+ if ((events[open][1]._close || events[index2][1]._open) && (events[index2][1].end.offset - events[index2][1].start.offset) % 3 && !((events[open][1].end.offset - events[open][1].start.offset + events[index2][1].end.offset - events[index2][1].start.offset) % 3)) {
+ continue;
+ }
+ use = events[open][1].end.offset - events[open][1].start.offset > 1 && events[index2][1].end.offset - events[index2][1].start.offset > 1 ? 2 : 1;
+ const start = Object.assign({}, events[open][1].end);
+ const end = Object.assign({}, events[index2][1].start);
+ movePoint(start, -use);
+ movePoint(end, use);
+ openingSequence = {
+ type: use > 1 ? "strongSequence" : "emphasisSequence",
+ start,
+ end: Object.assign({}, events[open][1].end)
+ };
+ closingSequence = {
+ type: use > 1 ? "strongSequence" : "emphasisSequence",
+ start: Object.assign({}, events[index2][1].start),
+ end
+ };
+ text5 = {
+ type: use > 1 ? "strongText" : "emphasisText",
+ start: Object.assign({}, events[open][1].end),
+ end: Object.assign({}, events[index2][1].start)
+ };
+ group = {
+ type: use > 1 ? "strong" : "emphasis",
+ start: Object.assign({}, openingSequence.start),
+ end: Object.assign({}, closingSequence.end)
+ };
+ events[open][1].end = Object.assign({}, openingSequence.start);
+ events[index2][1].start = Object.assign({}, closingSequence.end);
+ nextEvents = [];
+ if (events[open][1].end.offset - events[open][1].start.offset) {
+ nextEvents = push(nextEvents, [["enter", events[open][1], context], ["exit", events[open][1], context]]);
+ }
+ nextEvents = push(nextEvents, [["enter", group, context], ["enter", openingSequence, context], ["exit", openingSequence, context], ["enter", text5, context]]);
+ nextEvents = push(nextEvents, resolveAll(context.parser.constructs.insideSpan.null, events.slice(open + 1, index2), context));
+ nextEvents = push(nextEvents, [["exit", text5, context], ["enter", closingSequence, context], ["exit", closingSequence, context], ["exit", group, context]]);
+ if (events[index2][1].end.offset - events[index2][1].start.offset) {
+ offset = 2;
+ nextEvents = push(nextEvents, [["enter", events[index2][1], context], ["exit", events[index2][1], context]]);
+ } else {
+ offset = 0;
+ }
+ splice(events, open - 1, index2 - open + 3, nextEvents);
+ index2 = open + nextEvents.length - offset - 2;
+ break;
+ }
+ }
+ }
+ }
+ index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][1].type === "attentionSequence") {
+ events[index2][1].type = "data";
+ }
+ }
+ return events;
+ }
+ function tokenizeAttention(effects, ok3) {
+ const attentionMarkers2 = this.parser.constructs.attentionMarkers.null;
+ const previous3 = this.previous;
+ const before = classifyCharacter(previous3);
+ let marker;
+ return start;
+ function start(code3) {
+ marker = code3;
+ effects.enter("attentionSequence");
+ return inside(code3);
+ }
+ function inside(code3) {
+ if (code3 === marker) {
+ effects.consume(code3);
+ return inside;
+ }
+ const token = effects.exit("attentionSequence");
+ const after = classifyCharacter(code3);
+ const open = !after || after === 2 && before || attentionMarkers2.includes(code3);
+ const close2 = !before || before === 2 && after || attentionMarkers2.includes(previous3);
+ token._open = Boolean(marker === 42 ? open : open && (before || !close2));
+ token._close = Boolean(marker === 42 ? close2 : close2 && (after || !open));
+ return ok3(code3);
+ }
+ }
+ function movePoint(point3, offset) {
+ point3.column += offset;
+ point3.offset += offset;
+ point3._bufferIndex += offset;
+ }
+
+ // node_modules/micromark-core-commonmark/lib/autolink.js
+ var autolink = {
+ name: "autolink",
+ tokenize: tokenizeAutolink
+ };
+ function tokenizeAutolink(effects, ok3, nok) {
+ let size = 0;
+ return start;
+ function start(code3) {
+ effects.enter("autolink");
+ effects.enter("autolinkMarker");
+ effects.consume(code3);
+ effects.exit("autolinkMarker");
+ effects.enter("autolinkProtocol");
+ return open;
+ }
+ function open(code3) {
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ return schemeOrEmailAtext;
+ }
+ if (code3 === 64) {
+ return nok(code3);
+ }
+ return emailAtext(code3);
+ }
+ function schemeOrEmailAtext(code3) {
+ if (code3 === 43 || code3 === 45 || code3 === 46 || asciiAlphanumeric(code3)) {
+ size = 1;
+ return schemeInsideOrEmailAtext(code3);
+ }
+ return emailAtext(code3);
+ }
+ function schemeInsideOrEmailAtext(code3) {
+ if (code3 === 58) {
+ effects.consume(code3);
+ size = 0;
+ return urlInside;
+ }
+ if ((code3 === 43 || code3 === 45 || code3 === 46 || asciiAlphanumeric(code3)) && size++ < 32) {
+ effects.consume(code3);
+ return schemeInsideOrEmailAtext;
+ }
+ size = 0;
+ return emailAtext(code3);
+ }
+ function urlInside(code3) {
+ if (code3 === 62) {
+ effects.exit("autolinkProtocol");
+ effects.enter("autolinkMarker");
+ effects.consume(code3);
+ effects.exit("autolinkMarker");
+ effects.exit("autolink");
+ return ok3;
+ }
+ if (code3 === null || code3 === 32 || code3 === 60 || asciiControl(code3)) {
+ return nok(code3);
+ }
+ effects.consume(code3);
+ return urlInside;
+ }
+ function emailAtext(code3) {
+ if (code3 === 64) {
+ effects.consume(code3);
+ return emailAtSignOrDot;
+ }
+ if (asciiAtext(code3)) {
+ effects.consume(code3);
+ return emailAtext;
+ }
+ return nok(code3);
+ }
+ function emailAtSignOrDot(code3) {
+ return asciiAlphanumeric(code3) ? emailLabel(code3) : nok(code3);
+ }
+ function emailLabel(code3) {
+ if (code3 === 46) {
+ effects.consume(code3);
+ size = 0;
+ return emailAtSignOrDot;
+ }
+ if (code3 === 62) {
+ effects.exit("autolinkProtocol").type = "autolinkEmail";
+ effects.enter("autolinkMarker");
+ effects.consume(code3);
+ effects.exit("autolinkMarker");
+ effects.exit("autolink");
+ return ok3;
+ }
+ return emailValue(code3);
+ }
+ function emailValue(code3) {
+ if ((code3 === 45 || asciiAlphanumeric(code3)) && size++ < 63) {
+ const next = code3 === 45 ? emailValue : emailLabel;
+ effects.consume(code3);
+ return next;
+ }
+ return nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/blank-line.js
+ var blankLine = {
+ tokenize: tokenizeBlankLine,
+ partial: true
+ };
+ function tokenizeBlankLine(effects, ok3, nok) {
+ return start;
+ function start(code3) {
+ return markdownSpace(code3) ? factorySpace(effects, after, "linePrefix")(code3) : after(code3);
+ }
+ function after(code3) {
+ return code3 === null || markdownLineEnding(code3) ? ok3(code3) : nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/block-quote.js
+ var blockQuote = {
+ name: "blockQuote",
+ tokenize: tokenizeBlockQuoteStart,
+ continuation: {
+ tokenize: tokenizeBlockQuoteContinuation
+ },
+ exit
+ };
+ function tokenizeBlockQuoteStart(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code3) {
+ if (code3 === 62) {
+ const state = self2.containerState;
+ if (!state.open) {
+ effects.enter("blockQuote", {
+ _container: true
+ });
+ state.open = true;
+ }
+ effects.enter("blockQuotePrefix");
+ effects.enter("blockQuoteMarker");
+ effects.consume(code3);
+ effects.exit("blockQuoteMarker");
+ return after;
+ }
+ return nok(code3);
+ }
+ function after(code3) {
+ if (markdownSpace(code3)) {
+ effects.enter("blockQuotePrefixWhitespace");
+ effects.consume(code3);
+ effects.exit("blockQuotePrefixWhitespace");
+ effects.exit("blockQuotePrefix");
+ return ok3;
+ }
+ effects.exit("blockQuotePrefix");
+ return ok3(code3);
+ }
+ }
+ function tokenizeBlockQuoteContinuation(effects, ok3, nok) {
+ const self2 = this;
+ return contStart;
+ function contStart(code3) {
+ if (markdownSpace(code3)) {
+ return factorySpace(effects, contBefore, "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code3);
+ }
+ return contBefore(code3);
+ }
+ function contBefore(code3) {
+ return effects.attempt(blockQuote, ok3, nok)(code3);
+ }
+ }
+ function exit(effects) {
+ effects.exit("blockQuote");
+ }
+
+ // node_modules/micromark-core-commonmark/lib/character-escape.js
+ var characterEscape = {
+ name: "characterEscape",
+ tokenize: tokenizeCharacterEscape
+ };
+ function tokenizeCharacterEscape(effects, ok3, nok) {
+ return start;
+ function start(code3) {
+ effects.enter("characterEscape");
+ effects.enter("escapeMarker");
+ effects.consume(code3);
+ effects.exit("escapeMarker");
+ return inside;
+ }
+ function inside(code3) {
+ if (asciiPunctuation(code3)) {
+ effects.enter("characterEscapeValue");
+ effects.consume(code3);
+ effects.exit("characterEscapeValue");
+ effects.exit("characterEscape");
+ return ok3;
+ }
+ return nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/character-reference.js
+ var characterReference = {
+ name: "characterReference",
+ tokenize: tokenizeCharacterReference
+ };
+ function tokenizeCharacterReference(effects, ok3, nok) {
+ const self2 = this;
+ let size = 0;
+ let max;
+ let test;
+ return start;
+ function start(code3) {
+ effects.enter("characterReference");
+ effects.enter("characterReferenceMarker");
+ effects.consume(code3);
+ effects.exit("characterReferenceMarker");
+ return open;
+ }
+ function open(code3) {
+ if (code3 === 35) {
+ effects.enter("characterReferenceMarkerNumeric");
+ effects.consume(code3);
+ effects.exit("characterReferenceMarkerNumeric");
+ return numeric;
+ }
+ effects.enter("characterReferenceValue");
+ max = 31;
+ test = asciiAlphanumeric;
+ return value(code3);
+ }
+ function numeric(code3) {
+ if (code3 === 88 || code3 === 120) {
+ effects.enter("characterReferenceMarkerHexadecimal");
+ effects.consume(code3);
+ effects.exit("characterReferenceMarkerHexadecimal");
+ effects.enter("characterReferenceValue");
+ max = 6;
+ test = asciiHexDigit;
+ return value;
+ }
+ effects.enter("characterReferenceValue");
+ max = 7;
+ test = asciiDigit;
+ return value(code3);
+ }
+ function value(code3) {
+ if (code3 === 59 && size) {
+ const token = effects.exit("characterReferenceValue");
+ if (test === asciiAlphanumeric && !decodeNamedCharacterReference(self2.sliceSerialize(token))) {
+ return nok(code3);
+ }
+ effects.enter("characterReferenceMarker");
+ effects.consume(code3);
+ effects.exit("characterReferenceMarker");
+ effects.exit("characterReference");
+ return ok3;
+ }
+ if (test(code3) && size++ < max) {
+ effects.consume(code3);
+ return value;
+ }
+ return nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/code-fenced.js
+ var nonLazyContinuation = {
+ tokenize: tokenizeNonLazyContinuation,
+ partial: true
+ };
+ var codeFenced = {
+ name: "codeFenced",
+ tokenize: tokenizeCodeFenced,
+ concrete: true
+ };
+ function tokenizeCodeFenced(effects, ok3, nok) {
+ const self2 = this;
+ const closeStart = {
+ tokenize: tokenizeCloseStart,
+ partial: true
+ };
+ let initialPrefix = 0;
+ let sizeOpen = 0;
+ let marker;
+ return start;
+ function start(code3) {
+ return beforeSequenceOpen(code3);
+ }
+ function beforeSequenceOpen(code3) {
+ const tail = self2.events[self2.events.length - 1];
+ initialPrefix = tail && tail[1].type === "linePrefix" ? tail[2].sliceSerialize(tail[1], true).length : 0;
+ marker = code3;
+ effects.enter("codeFenced");
+ effects.enter("codeFencedFence");
+ effects.enter("codeFencedFenceSequence");
+ return sequenceOpen(code3);
+ }
+ function sequenceOpen(code3) {
+ if (code3 === marker) {
+ sizeOpen++;
+ effects.consume(code3);
+ return sequenceOpen;
+ }
+ if (sizeOpen < 3) {
+ return nok(code3);
+ }
+ effects.exit("codeFencedFenceSequence");
+ return markdownSpace(code3) ? factorySpace(effects, infoBefore, "whitespace")(code3) : infoBefore(code3);
+ }
+ function infoBefore(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("codeFencedFence");
+ return self2.interrupt ? ok3(code3) : effects.check(nonLazyContinuation, atNonLazyBreak, after)(code3);
+ }
+ effects.enter("codeFencedFenceInfo");
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return info(code3);
+ }
+ function info(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("chunkString");
+ effects.exit("codeFencedFenceInfo");
+ return infoBefore(code3);
+ }
+ if (markdownSpace(code3)) {
+ effects.exit("chunkString");
+ effects.exit("codeFencedFenceInfo");
+ return factorySpace(effects, metaBefore, "whitespace")(code3);
+ }
+ if (code3 === 96 && code3 === marker) {
+ return nok(code3);
+ }
+ effects.consume(code3);
+ return info;
+ }
+ function metaBefore(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ return infoBefore(code3);
+ }
+ effects.enter("codeFencedFenceMeta");
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return meta(code3);
+ }
+ function meta(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("chunkString");
+ effects.exit("codeFencedFenceMeta");
+ return infoBefore(code3);
+ }
+ if (code3 === 96 && code3 === marker) {
+ return nok(code3);
+ }
+ effects.consume(code3);
+ return meta;
+ }
+ function atNonLazyBreak(code3) {
+ return effects.attempt(closeStart, after, contentBefore)(code3);
+ }
+ function contentBefore(code3) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return contentStart;
+ }
+ function contentStart(code3) {
+ return initialPrefix > 0 && markdownSpace(code3) ? factorySpace(effects, beforeContentChunk, "linePrefix", initialPrefix + 1)(code3) : beforeContentChunk(code3);
+ }
+ function beforeContentChunk(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ return effects.check(nonLazyContinuation, atNonLazyBreak, after)(code3);
+ }
+ effects.enter("codeFlowValue");
+ return contentChunk(code3);
+ }
+ function contentChunk(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("codeFlowValue");
+ return beforeContentChunk(code3);
+ }
+ effects.consume(code3);
+ return contentChunk;
+ }
+ function after(code3) {
+ effects.exit("codeFenced");
+ return ok3(code3);
+ }
+ function tokenizeCloseStart(effects2, ok4, nok2) {
+ let size = 0;
+ return startBefore;
+ function startBefore(code3) {
+ effects2.enter("lineEnding");
+ effects2.consume(code3);
+ effects2.exit("lineEnding");
+ return start2;
+ }
+ function start2(code3) {
+ effects2.enter("codeFencedFence");
+ return markdownSpace(code3) ? factorySpace(effects2, beforeSequenceClose, "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code3) : beforeSequenceClose(code3);
+ }
+ function beforeSequenceClose(code3) {
+ if (code3 === marker) {
+ effects2.enter("codeFencedFenceSequence");
+ return sequenceClose(code3);
+ }
+ return nok2(code3);
+ }
+ function sequenceClose(code3) {
+ if (code3 === marker) {
+ size++;
+ effects2.consume(code3);
+ return sequenceClose;
+ }
+ if (size >= sizeOpen) {
+ effects2.exit("codeFencedFenceSequence");
+ return markdownSpace(code3) ? factorySpace(effects2, sequenceCloseAfter, "whitespace")(code3) : sequenceCloseAfter(code3);
+ }
+ return nok2(code3);
+ }
+ function sequenceCloseAfter(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects2.exit("codeFencedFence");
+ return ok4(code3);
+ }
+ return nok2(code3);
+ }
+ }
+ }
+ function tokenizeNonLazyContinuation(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code3) {
+ if (code3 === null) {
+ return nok(code3);
+ }
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return lineStart;
+ }
+ function lineStart(code3) {
+ return self2.parser.lazy[self2.now().line] ? nok(code3) : ok3(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/code-indented.js
+ var codeIndented = {
+ name: "codeIndented",
+ tokenize: tokenizeCodeIndented
+ };
+ var furtherStart = {
+ tokenize: tokenizeFurtherStart,
+ partial: true
+ };
+ function tokenizeCodeIndented(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code3) {
+ effects.enter("codeIndented");
+ return factorySpace(effects, afterPrefix, "linePrefix", 4 + 1)(code3);
+ }
+ function afterPrefix(code3) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "linePrefix" && tail[2].sliceSerialize(tail[1], true).length >= 4 ? atBreak(code3) : nok(code3);
+ }
+ function atBreak(code3) {
+ if (code3 === null) {
+ return after(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ return effects.attempt(furtherStart, atBreak, after)(code3);
+ }
+ effects.enter("codeFlowValue");
+ return inside(code3);
+ }
+ function inside(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("codeFlowValue");
+ return atBreak(code3);
+ }
+ effects.consume(code3);
+ return inside;
+ }
+ function after(code3) {
+ effects.exit("codeIndented");
+ return ok3(code3);
+ }
+ }
+ function tokenizeFurtherStart(effects, ok3, nok) {
+ const self2 = this;
+ return furtherStart2;
+ function furtherStart2(code3) {
+ if (self2.parser.lazy[self2.now().line]) {
+ return nok(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return furtherStart2;
+ }
+ return factorySpace(effects, afterPrefix, "linePrefix", 4 + 1)(code3);
+ }
+ function afterPrefix(code3) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "linePrefix" && tail[2].sliceSerialize(tail[1], true).length >= 4 ? ok3(code3) : markdownLineEnding(code3) ? furtherStart2(code3) : nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/code-text.js
+ var codeText = {
+ name: "codeText",
+ tokenize: tokenizeCodeText,
+ resolve: resolveCodeText,
+ previous
+ };
+ function resolveCodeText(events) {
+ let tailExitIndex = events.length - 4;
+ let headEnterIndex = 3;
+ let index2;
+ let enter;
+ if ((events[headEnterIndex][1].type === "lineEnding" || events[headEnterIndex][1].type === "space") && (events[tailExitIndex][1].type === "lineEnding" || events[tailExitIndex][1].type === "space")) {
+ index2 = headEnterIndex;
+ while (++index2 < tailExitIndex) {
+ if (events[index2][1].type === "codeTextData") {
+ events[headEnterIndex][1].type = "codeTextPadding";
+ events[tailExitIndex][1].type = "codeTextPadding";
+ headEnterIndex += 2;
+ tailExitIndex -= 2;
+ break;
+ }
+ }
+ }
+ index2 = headEnterIndex - 1;
+ tailExitIndex++;
+ while (++index2 <= tailExitIndex) {
+ if (enter === void 0) {
+ if (index2 !== tailExitIndex && events[index2][1].type !== "lineEnding") {
+ enter = index2;
+ }
+ } else if (index2 === tailExitIndex || events[index2][1].type === "lineEnding") {
+ events[enter][1].type = "codeTextData";
+ if (index2 !== enter + 2) {
+ events[enter][1].end = events[index2 - 1][1].end;
+ events.splice(enter + 2, index2 - enter - 2);
+ tailExitIndex -= index2 - enter - 2;
+ index2 = enter + 2;
+ }
+ enter = void 0;
+ }
+ }
+ return events;
+ }
+ function previous(code3) {
+ return code3 !== 96 || this.events[this.events.length - 1][1].type === "characterEscape";
+ }
+ function tokenizeCodeText(effects, ok3, nok) {
+ const self2 = this;
+ let sizeOpen = 0;
+ let size;
+ let token;
+ return start;
+ function start(code3) {
+ effects.enter("codeText");
+ effects.enter("codeTextSequence");
+ return sequenceOpen(code3);
+ }
+ function sequenceOpen(code3) {
+ if (code3 === 96) {
+ effects.consume(code3);
+ sizeOpen++;
+ return sequenceOpen;
+ }
+ effects.exit("codeTextSequence");
+ return between2(code3);
+ }
+ function between2(code3) {
+ if (code3 === null) {
+ return nok(code3);
+ }
+ if (code3 === 32) {
+ effects.enter("space");
+ effects.consume(code3);
+ effects.exit("space");
+ return between2;
+ }
+ if (code3 === 96) {
+ token = effects.enter("codeTextSequence");
+ size = 0;
+ return sequenceClose(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return between2;
+ }
+ effects.enter("codeTextData");
+ return data(code3);
+ }
+ function data(code3) {
+ if (code3 === null || code3 === 32 || code3 === 96 || markdownLineEnding(code3)) {
+ effects.exit("codeTextData");
+ return between2(code3);
+ }
+ effects.consume(code3);
+ return data;
+ }
+ function sequenceClose(code3) {
+ if (code3 === 96) {
+ effects.consume(code3);
+ size++;
+ return sequenceClose;
+ }
+ if (size === sizeOpen) {
+ effects.exit("codeTextSequence");
+ effects.exit("codeText");
+ return ok3(code3);
+ }
+ token.type = "codeTextData";
+ return data(code3);
+ }
+ }
+
+ // node_modules/micromark-util-subtokenize/lib/splice-buffer.js
+ var SpliceBuffer = class {
+ /**
+ * @param {ReadonlyArray | null | undefined} [initial]
+ * Initial items (optional).
+ * @returns
+ * Splice buffer.
+ */
+ constructor(initial) {
+ this.left = initial ? [...initial] : [];
+ this.right = [];
+ }
+ /**
+ * Array access;
+ * does not move the cursor.
+ *
+ * @param {number} index
+ * Index.
+ * @return {T}
+ * Item.
+ */
+ get(index2) {
+ if (index2 < 0 || index2 >= this.left.length + this.right.length) {
+ throw new RangeError("Cannot access index `" + index2 + "` in a splice buffer of size `" + (this.left.length + this.right.length) + "`");
+ }
+ if (index2 < this.left.length) return this.left[index2];
+ return this.right[this.right.length - index2 + this.left.length - 1];
+ }
+ /**
+ * The length of the splice buffer, one greater than the largest index in the
+ * array.
+ */
+ get length() {
+ return this.left.length + this.right.length;
+ }
+ /**
+ * Remove and return `list[0]`;
+ * moves the cursor to `0`.
+ *
+ * @returns {T | undefined}
+ * Item, optional.
+ */
+ shift() {
+ this.setCursor(0);
+ return this.right.pop();
+ }
+ /**
+ * Slice the buffer to get an array;
+ * does not move the cursor.
+ *
+ * @param {number} start
+ * Start.
+ * @param {number | null | undefined} [end]
+ * End (optional).
+ * @returns {Array}
+ * Array of items.
+ */
+ slice(start, end) {
+ const stop = end === null || end === void 0 ? Number.POSITIVE_INFINITY : end;
+ if (stop < this.left.length) {
+ return this.left.slice(start, stop);
+ }
+ if (start > this.left.length) {
+ return this.right.slice(this.right.length - stop + this.left.length, this.right.length - start + this.left.length).reverse();
+ }
+ return this.left.slice(start).concat(this.right.slice(this.right.length - stop + this.left.length).reverse());
+ }
+ /**
+ * Mimics the behavior of Array.prototype.splice() except for the change of
+ * interface necessary to avoid segfaults when patching in very large arrays.
+ *
+ * This operation moves cursor is moved to `start` and results in the cursor
+ * placed after any inserted items.
+ *
+ * @param {number} start
+ * Start;
+ * zero-based index at which to start changing the array;
+ * negative numbers count backwards from the end of the array and values
+ * that are out-of bounds are clamped to the appropriate end of the array.
+ * @param {number | null | undefined} [deleteCount=0]
+ * Delete count (default: `0`);
+ * maximum number of elements to delete, starting from start.
+ * @param {Array | null | undefined} [items=[]]
+ * Items to include in place of the deleted items (default: `[]`).
+ * @return {Array}
+ * Any removed items.
+ */
+ splice(start, deleteCount, items) {
+ const count = deleteCount || 0;
+ this.setCursor(Math.trunc(start));
+ const removed = this.right.splice(this.right.length - count, Number.POSITIVE_INFINITY);
+ if (items) chunkedPush(this.left, items);
+ return removed.reverse();
+ }
+ /**
+ * Remove and return the highest-numbered item in the array, so
+ * `list[list.length - 1]`;
+ * Moves the cursor to `length`.
+ *
+ * @returns {T | undefined}
+ * Item, optional.
+ */
+ pop() {
+ this.setCursor(Number.POSITIVE_INFINITY);
+ return this.left.pop();
+ }
+ /**
+ * Inserts a single item to the high-numbered side of the array;
+ * moves the cursor to `length`.
+ *
+ * @param {T} item
+ * Item.
+ * @returns {undefined}
+ * Nothing.
+ */
+ push(item) {
+ this.setCursor(Number.POSITIVE_INFINITY);
+ this.left.push(item);
+ }
+ /**
+ * Inserts many items to the high-numbered side of the array.
+ * Moves the cursor to `length`.
+ *
+ * @param {Array} items
+ * Items.
+ * @returns {undefined}
+ * Nothing.
+ */
+ pushMany(items) {
+ this.setCursor(Number.POSITIVE_INFINITY);
+ chunkedPush(this.left, items);
+ }
+ /**
+ * Inserts a single item to the low-numbered side of the array;
+ * Moves the cursor to `0`.
+ *
+ * @param {T} item
+ * Item.
+ * @returns {undefined}
+ * Nothing.
+ */
+ unshift(item) {
+ this.setCursor(0);
+ this.right.push(item);
+ }
+ /**
+ * Inserts many items to the low-numbered side of the array;
+ * moves the cursor to `0`.
+ *
+ * @param {Array} items
+ * Items.
+ * @returns {undefined}
+ * Nothing.
+ */
+ unshiftMany(items) {
+ this.setCursor(0);
+ chunkedPush(this.right, items.reverse());
+ }
+ /**
+ * Move the cursor to a specific position in the array. Requires
+ * time proportional to the distance moved.
+ *
+ * If `n < 0`, the cursor will end up at the beginning.
+ * If `n > length`, the cursor will end up at the end.
+ *
+ * @param {number} n
+ * Position.
+ * @return {undefined}
+ * Nothing.
+ */
+ setCursor(n4) {
+ if (n4 === this.left.length || n4 > this.left.length && this.right.length === 0 || n4 < 0 && this.left.length === 0) return;
+ if (n4 < this.left.length) {
+ const removed = this.left.splice(n4, Number.POSITIVE_INFINITY);
+ chunkedPush(this.right, removed.reverse());
+ } else {
+ const removed = this.right.splice(this.left.length + this.right.length - n4, Number.POSITIVE_INFINITY);
+ chunkedPush(this.left, removed.reverse());
+ }
+ }
+ };
+ function chunkedPush(list4, right) {
+ let chunkStart = 0;
+ if (right.length < 1e4) {
+ list4.push(...right);
+ } else {
+ while (chunkStart < right.length) {
+ list4.push(...right.slice(chunkStart, chunkStart + 1e4));
+ chunkStart += 1e4;
+ }
+ }
+ }
+
+ // node_modules/micromark-util-subtokenize/index.js
+ function subtokenize(eventsArray) {
+ const jumps = {};
+ let index2 = -1;
+ let event;
+ let lineIndex;
+ let otherIndex;
+ let otherEvent;
+ let parameters;
+ let subevents;
+ let more;
+ const events = new SpliceBuffer(eventsArray);
+ while (++index2 < events.length) {
+ while (index2 in jumps) {
+ index2 = jumps[index2];
+ }
+ event = events.get(index2);
+ if (index2 && event[1].type === "chunkFlow" && events.get(index2 - 1)[1].type === "listItemPrefix") {
+ subevents = event[1]._tokenizer.events;
+ otherIndex = 0;
+ if (otherIndex < subevents.length && subevents[otherIndex][1].type === "lineEndingBlank") {
+ otherIndex += 2;
+ }
+ if (otherIndex < subevents.length && subevents[otherIndex][1].type === "content") {
+ while (++otherIndex < subevents.length) {
+ if (subevents[otherIndex][1].type === "content") {
+ break;
+ }
+ if (subevents[otherIndex][1].type === "chunkText") {
+ subevents[otherIndex][1]._isInFirstContentOfListItem = true;
+ otherIndex++;
+ }
+ }
+ }
+ }
+ if (event[0] === "enter") {
+ if (event[1].contentType) {
+ Object.assign(jumps, subcontent(events, index2));
+ index2 = jumps[index2];
+ more = true;
+ }
+ } else if (event[1]._container) {
+ otherIndex = index2;
+ lineIndex = void 0;
+ while (otherIndex--) {
+ otherEvent = events.get(otherIndex);
+ if (otherEvent[1].type === "lineEnding" || otherEvent[1].type === "lineEndingBlank") {
+ if (otherEvent[0] === "enter") {
+ if (lineIndex) {
+ events.get(lineIndex)[1].type = "lineEndingBlank";
+ }
+ otherEvent[1].type = "lineEnding";
+ lineIndex = otherIndex;
+ }
+ } else {
+ break;
+ }
+ }
+ if (lineIndex) {
+ event[1].end = Object.assign({}, events.get(lineIndex)[1].start);
+ parameters = events.slice(lineIndex, index2);
+ parameters.unshift(event);
+ events.splice(lineIndex, index2 - lineIndex + 1, parameters);
+ }
+ }
+ }
+ splice(eventsArray, 0, Number.POSITIVE_INFINITY, events.slice(0));
+ return !more;
+ }
+ function subcontent(events, eventIndex) {
+ const token = events.get(eventIndex)[1];
+ const context = events.get(eventIndex)[2];
+ let startPosition = eventIndex - 1;
+ const startPositions = [];
+ const tokenizer = token._tokenizer || context.parser[token.contentType](token.start);
+ const childEvents = tokenizer.events;
+ const jumps = [];
+ const gaps = {};
+ let stream;
+ let previous3;
+ let index2 = -1;
+ let current = token;
+ let adjust = 0;
+ let start = 0;
+ const breaks = [start];
+ while (current) {
+ while (events.get(++startPosition)[1] !== current) {
+ }
+ startPositions.push(startPosition);
+ if (!current._tokenizer) {
+ stream = context.sliceStream(current);
+ if (!current.next) {
+ stream.push(null);
+ }
+ if (previous3) {
+ tokenizer.defineSkip(current.start);
+ }
+ if (current._isInFirstContentOfListItem) {
+ tokenizer._gfmTasklistFirstContentOfListItem = true;
+ }
+ tokenizer.write(stream);
+ if (current._isInFirstContentOfListItem) {
+ tokenizer._gfmTasklistFirstContentOfListItem = void 0;
+ }
+ }
+ previous3 = current;
+ current = current.next;
+ }
+ current = token;
+ while (++index2 < childEvents.length) {
+ if (
+ // Find a void token that includes a break.
+ childEvents[index2][0] === "exit" && childEvents[index2 - 1][0] === "enter" && childEvents[index2][1].type === childEvents[index2 - 1][1].type && childEvents[index2][1].start.line !== childEvents[index2][1].end.line
+ ) {
+ start = index2 + 1;
+ breaks.push(start);
+ current._tokenizer = void 0;
+ current.previous = void 0;
+ current = current.next;
+ }
+ }
+ tokenizer.events = [];
+ if (current) {
+ current._tokenizer = void 0;
+ current.previous = void 0;
+ } else {
+ breaks.pop();
+ }
+ index2 = breaks.length;
+ while (index2--) {
+ const slice = childEvents.slice(breaks[index2], breaks[index2 + 1]);
+ const start2 = startPositions.pop();
+ jumps.push([start2, start2 + slice.length - 1]);
+ events.splice(start2, 2, slice);
+ }
+ jumps.reverse();
+ index2 = -1;
+ while (++index2 < jumps.length) {
+ gaps[adjust + jumps[index2][0]] = adjust + jumps[index2][1];
+ adjust += jumps[index2][1] - jumps[index2][0] - 1;
+ }
+ return gaps;
+ }
+
+ // node_modules/micromark-core-commonmark/lib/content.js
+ var content2 = {
+ tokenize: tokenizeContent,
+ resolve: resolveContent
+ };
+ var continuationConstruct = {
+ tokenize: tokenizeContinuation,
+ partial: true
+ };
+ function resolveContent(events) {
+ subtokenize(events);
+ return events;
+ }
+ function tokenizeContent(effects, ok3) {
+ let previous3;
+ return chunkStart;
+ function chunkStart(code3) {
+ effects.enter("content");
+ previous3 = effects.enter("chunkContent", {
+ contentType: "content"
+ });
+ return chunkInside(code3);
+ }
+ function chunkInside(code3) {
+ if (code3 === null) {
+ return contentEnd(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ return effects.check(continuationConstruct, contentContinue, contentEnd)(code3);
+ }
+ effects.consume(code3);
+ return chunkInside;
+ }
+ function contentEnd(code3) {
+ effects.exit("chunkContent");
+ effects.exit("content");
+ return ok3(code3);
+ }
+ function contentContinue(code3) {
+ effects.consume(code3);
+ effects.exit("chunkContent");
+ previous3.next = effects.enter("chunkContent", {
+ contentType: "content",
+ previous: previous3
+ });
+ previous3 = previous3.next;
+ return chunkInside;
+ }
+ }
+ function tokenizeContinuation(effects, ok3, nok) {
+ const self2 = this;
+ return startLookahead;
+ function startLookahead(code3) {
+ effects.exit("chunkContent");
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return factorySpace(effects, prefixed, "linePrefix");
+ }
+ function prefixed(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ return nok(code3);
+ }
+ const tail = self2.events[self2.events.length - 1];
+ if (!self2.parser.constructs.disable.null.includes("codeIndented") && tail && tail[1].type === "linePrefix" && tail[2].sliceSerialize(tail[1], true).length >= 4) {
+ return ok3(code3);
+ }
+ return effects.interrupt(self2.parser.constructs.flow, nok, ok3)(code3);
+ }
+ }
+
+ // node_modules/micromark-factory-destination/index.js
+ function factoryDestination(effects, ok3, nok, type, literalType, literalMarkerType, rawType, stringType, max) {
+ const limit = max || Number.POSITIVE_INFINITY;
+ let balance = 0;
+ return start;
+ function start(code3) {
+ if (code3 === 60) {
+ effects.enter(type);
+ effects.enter(literalType);
+ effects.enter(literalMarkerType);
+ effects.consume(code3);
+ effects.exit(literalMarkerType);
+ return enclosedBefore;
+ }
+ if (code3 === null || code3 === 32 || code3 === 41 || asciiControl(code3)) {
+ return nok(code3);
+ }
+ effects.enter(type);
+ effects.enter(rawType);
+ effects.enter(stringType);
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return raw(code3);
+ }
+ function enclosedBefore(code3) {
+ if (code3 === 62) {
+ effects.enter(literalMarkerType);
+ effects.consume(code3);
+ effects.exit(literalMarkerType);
+ effects.exit(literalType);
+ effects.exit(type);
+ return ok3;
+ }
+ effects.enter(stringType);
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return enclosed(code3);
+ }
+ function enclosed(code3) {
+ if (code3 === 62) {
+ effects.exit("chunkString");
+ effects.exit(stringType);
+ return enclosedBefore(code3);
+ }
+ if (code3 === null || code3 === 60 || markdownLineEnding(code3)) {
+ return nok(code3);
+ }
+ effects.consume(code3);
+ return code3 === 92 ? enclosedEscape : enclosed;
+ }
+ function enclosedEscape(code3) {
+ if (code3 === 60 || code3 === 62 || code3 === 92) {
+ effects.consume(code3);
+ return enclosed;
+ }
+ return enclosed(code3);
+ }
+ function raw(code3) {
+ if (!balance && (code3 === null || code3 === 41 || markdownLineEndingOrSpace(code3))) {
+ effects.exit("chunkString");
+ effects.exit(stringType);
+ effects.exit(rawType);
+ effects.exit(type);
+ return ok3(code3);
+ }
+ if (balance < limit && code3 === 40) {
+ effects.consume(code3);
+ balance++;
+ return raw;
+ }
+ if (code3 === 41) {
+ effects.consume(code3);
+ balance--;
+ return raw;
+ }
+ if (code3 === null || code3 === 32 || code3 === 40 || asciiControl(code3)) {
+ return nok(code3);
+ }
+ effects.consume(code3);
+ return code3 === 92 ? rawEscape : raw;
+ }
+ function rawEscape(code3) {
+ if (code3 === 40 || code3 === 41 || code3 === 92) {
+ effects.consume(code3);
+ return raw;
+ }
+ return raw(code3);
+ }
+ }
+
+ // node_modules/micromark-factory-label/index.js
+ function factoryLabel(effects, ok3, nok, type, markerType, stringType) {
+ const self2 = this;
+ let size = 0;
+ let seen;
+ return start;
+ function start(code3) {
+ effects.enter(type);
+ effects.enter(markerType);
+ effects.consume(code3);
+ effects.exit(markerType);
+ effects.enter(stringType);
+ return atBreak;
+ }
+ function atBreak(code3) {
+ if (size > 999 || code3 === null || code3 === 91 || code3 === 93 && !seen || // To do: remove in the future once we’ve switched from
+ // `micromark-extension-footnote` to `micromark-extension-gfm-footnote`,
+ // which doesn’t need this.
+ // Hidden footnotes hook.
+ /* c8 ignore next 3 */
+ code3 === 94 && !size && "_hiddenFootnoteSupport" in self2.parser.constructs) {
+ return nok(code3);
+ }
+ if (code3 === 93) {
+ effects.exit(stringType);
+ effects.enter(markerType);
+ effects.consume(code3);
+ effects.exit(markerType);
+ effects.exit(type);
+ return ok3;
+ }
+ if (markdownLineEnding(code3)) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return atBreak;
+ }
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return labelInside(code3);
+ }
+ function labelInside(code3) {
+ if (code3 === null || code3 === 91 || code3 === 93 || markdownLineEnding(code3) || size++ > 999) {
+ effects.exit("chunkString");
+ return atBreak(code3);
+ }
+ effects.consume(code3);
+ if (!seen) seen = !markdownSpace(code3);
+ return code3 === 92 ? labelEscape : labelInside;
+ }
+ function labelEscape(code3) {
+ if (code3 === 91 || code3 === 92 || code3 === 93) {
+ effects.consume(code3);
+ size++;
+ return labelInside;
+ }
+ return labelInside(code3);
+ }
+ }
+
+ // node_modules/micromark-factory-title/index.js
+ function factoryTitle(effects, ok3, nok, type, markerType, stringType) {
+ let marker;
+ return start;
+ function start(code3) {
+ if (code3 === 34 || code3 === 39 || code3 === 40) {
+ effects.enter(type);
+ effects.enter(markerType);
+ effects.consume(code3);
+ effects.exit(markerType);
+ marker = code3 === 40 ? 41 : code3;
+ return begin;
+ }
+ return nok(code3);
+ }
+ function begin(code3) {
+ if (code3 === marker) {
+ effects.enter(markerType);
+ effects.consume(code3);
+ effects.exit(markerType);
+ effects.exit(type);
+ return ok3;
+ }
+ effects.enter(stringType);
+ return atBreak(code3);
+ }
+ function atBreak(code3) {
+ if (code3 === marker) {
+ effects.exit(stringType);
+ return begin(marker);
+ }
+ if (code3 === null) {
+ return nok(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return factorySpace(effects, atBreak, "linePrefix");
+ }
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return inside(code3);
+ }
+ function inside(code3) {
+ if (code3 === marker || code3 === null || markdownLineEnding(code3)) {
+ effects.exit("chunkString");
+ return atBreak(code3);
+ }
+ effects.consume(code3);
+ return code3 === 92 ? escape : inside;
+ }
+ function escape(code3) {
+ if (code3 === marker || code3 === 92) {
+ effects.consume(code3);
+ return inside;
+ }
+ return inside(code3);
+ }
+ }
+
+ // node_modules/micromark-factory-whitespace/index.js
+ function factoryWhitespace(effects, ok3) {
+ let seen;
+ return start;
+ function start(code3) {
+ if (markdownLineEnding(code3)) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ seen = true;
+ return start;
+ }
+ if (markdownSpace(code3)) {
+ return factorySpace(
+ effects,
+ start,
+ seen ? "linePrefix" : "lineSuffix"
+ )(code3);
+ }
+ return ok3(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/definition.js
+ var definition = {
+ name: "definition",
+ tokenize: tokenizeDefinition
+ };
+ var titleBefore = {
+ tokenize: tokenizeTitleBefore,
+ partial: true
+ };
+ function tokenizeDefinition(effects, ok3, nok) {
+ const self2 = this;
+ let identifier;
+ return start;
+ function start(code3) {
+ effects.enter("definition");
+ return before(code3);
+ }
+ function before(code3) {
+ return factoryLabel.call(
+ self2,
+ effects,
+ labelAfter,
+ // Note: we don’t need to reset the way `markdown-rs` does.
+ nok,
+ "definitionLabel",
+ "definitionLabelMarker",
+ "definitionLabelString"
+ )(code3);
+ }
+ function labelAfter(code3) {
+ identifier = normalizeIdentifier(self2.sliceSerialize(self2.events[self2.events.length - 1][1]).slice(1, -1));
+ if (code3 === 58) {
+ effects.enter("definitionMarker");
+ effects.consume(code3);
+ effects.exit("definitionMarker");
+ return markerAfter;
+ }
+ return nok(code3);
+ }
+ function markerAfter(code3) {
+ return markdownLineEndingOrSpace(code3) ? factoryWhitespace(effects, destinationBefore)(code3) : destinationBefore(code3);
+ }
+ function destinationBefore(code3) {
+ return factoryDestination(
+ effects,
+ destinationAfter,
+ // Note: we don’t need to reset the way `markdown-rs` does.
+ nok,
+ "definitionDestination",
+ "definitionDestinationLiteral",
+ "definitionDestinationLiteralMarker",
+ "definitionDestinationRaw",
+ "definitionDestinationString"
+ )(code3);
+ }
+ function destinationAfter(code3) {
+ return effects.attempt(titleBefore, after, after)(code3);
+ }
+ function after(code3) {
+ return markdownSpace(code3) ? factorySpace(effects, afterWhitespace, "whitespace")(code3) : afterWhitespace(code3);
+ }
+ function afterWhitespace(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("definition");
+ self2.parser.defined.push(identifier);
+ return ok3(code3);
+ }
+ return nok(code3);
+ }
+ }
+ function tokenizeTitleBefore(effects, ok3, nok) {
+ return titleBefore2;
+ function titleBefore2(code3) {
+ return markdownLineEndingOrSpace(code3) ? factoryWhitespace(effects, beforeMarker)(code3) : nok(code3);
+ }
+ function beforeMarker(code3) {
+ return factoryTitle(effects, titleAfter, nok, "definitionTitle", "definitionTitleMarker", "definitionTitleString")(code3);
+ }
+ function titleAfter(code3) {
+ return markdownSpace(code3) ? factorySpace(effects, titleAfterOptionalWhitespace, "whitespace")(code3) : titleAfterOptionalWhitespace(code3);
+ }
+ function titleAfterOptionalWhitespace(code3) {
+ return code3 === null || markdownLineEnding(code3) ? ok3(code3) : nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/hard-break-escape.js
+ var hardBreakEscape = {
+ name: "hardBreakEscape",
+ tokenize: tokenizeHardBreakEscape
+ };
+ function tokenizeHardBreakEscape(effects, ok3, nok) {
+ return start;
+ function start(code3) {
+ effects.enter("hardBreakEscape");
+ effects.consume(code3);
+ return after;
+ }
+ function after(code3) {
+ if (markdownLineEnding(code3)) {
+ effects.exit("hardBreakEscape");
+ return ok3(code3);
+ }
+ return nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/heading-atx.js
+ var headingAtx = {
+ name: "headingAtx",
+ tokenize: tokenizeHeadingAtx,
+ resolve: resolveHeadingAtx
+ };
+ function resolveHeadingAtx(events, context) {
+ let contentEnd = events.length - 2;
+ let contentStart = 3;
+ let content3;
+ let text5;
+ if (events[contentStart][1].type === "whitespace") {
+ contentStart += 2;
+ }
+ if (contentEnd - 2 > contentStart && events[contentEnd][1].type === "whitespace") {
+ contentEnd -= 2;
+ }
+ if (events[contentEnd][1].type === "atxHeadingSequence" && (contentStart === contentEnd - 1 || contentEnd - 4 > contentStart && events[contentEnd - 2][1].type === "whitespace")) {
+ contentEnd -= contentStart + 1 === contentEnd ? 2 : 4;
+ }
+ if (contentEnd > contentStart) {
+ content3 = {
+ type: "atxHeadingText",
+ start: events[contentStart][1].start,
+ end: events[contentEnd][1].end
+ };
+ text5 = {
+ type: "chunkText",
+ start: events[contentStart][1].start,
+ end: events[contentEnd][1].end,
+ contentType: "text"
+ };
+ splice(events, contentStart, contentEnd - contentStart + 1, [["enter", content3, context], ["enter", text5, context], ["exit", text5, context], ["exit", content3, context]]);
+ }
+ return events;
+ }
+ function tokenizeHeadingAtx(effects, ok3, nok) {
+ let size = 0;
+ return start;
+ function start(code3) {
+ effects.enter("atxHeading");
+ return before(code3);
+ }
+ function before(code3) {
+ effects.enter("atxHeadingSequence");
+ return sequenceOpen(code3);
+ }
+ function sequenceOpen(code3) {
+ if (code3 === 35 && size++ < 6) {
+ effects.consume(code3);
+ return sequenceOpen;
+ }
+ if (code3 === null || markdownLineEndingOrSpace(code3)) {
+ effects.exit("atxHeadingSequence");
+ return atBreak(code3);
+ }
+ return nok(code3);
+ }
+ function atBreak(code3) {
+ if (code3 === 35) {
+ effects.enter("atxHeadingSequence");
+ return sequenceFurther(code3);
+ }
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("atxHeading");
+ return ok3(code3);
+ }
+ if (markdownSpace(code3)) {
+ return factorySpace(effects, atBreak, "whitespace")(code3);
+ }
+ effects.enter("atxHeadingText");
+ return data(code3);
+ }
+ function sequenceFurther(code3) {
+ if (code3 === 35) {
+ effects.consume(code3);
+ return sequenceFurther;
+ }
+ effects.exit("atxHeadingSequence");
+ return atBreak(code3);
+ }
+ function data(code3) {
+ if (code3 === null || code3 === 35 || markdownLineEndingOrSpace(code3)) {
+ effects.exit("atxHeadingText");
+ return atBreak(code3);
+ }
+ effects.consume(code3);
+ return data;
+ }
+ }
+
+ // node_modules/micromark-util-html-tag-name/index.js
+ var htmlBlockNames = [
+ "address",
+ "article",
+ "aside",
+ "base",
+ "basefont",
+ "blockquote",
+ "body",
+ "caption",
+ "center",
+ "col",
+ "colgroup",
+ "dd",
+ "details",
+ "dialog",
+ "dir",
+ "div",
+ "dl",
+ "dt",
+ "fieldset",
+ "figcaption",
+ "figure",
+ "footer",
+ "form",
+ "frame",
+ "frameset",
+ "h1",
+ "h2",
+ "h3",
+ "h4",
+ "h5",
+ "h6",
+ "head",
+ "header",
+ "hr",
+ "html",
+ "iframe",
+ "legend",
+ "li",
+ "link",
+ "main",
+ "menu",
+ "menuitem",
+ "nav",
+ "noframes",
+ "ol",
+ "optgroup",
+ "option",
+ "p",
+ "param",
+ "search",
+ "section",
+ "summary",
+ "table",
+ "tbody",
+ "td",
+ "tfoot",
+ "th",
+ "thead",
+ "title",
+ "tr",
+ "track",
+ "ul"
+ ];
+ var htmlRawNames = ["pre", "script", "style", "textarea"];
+
+ // node_modules/micromark-core-commonmark/lib/html-flow.js
+ var htmlFlow = {
+ name: "htmlFlow",
+ tokenize: tokenizeHtmlFlow,
+ resolveTo: resolveToHtmlFlow,
+ concrete: true
+ };
+ var blankLineBefore = {
+ tokenize: tokenizeBlankLineBefore,
+ partial: true
+ };
+ var nonLazyContinuationStart = {
+ tokenize: tokenizeNonLazyContinuationStart,
+ partial: true
+ };
+ function resolveToHtmlFlow(events) {
+ let index2 = events.length;
+ while (index2--) {
+ if (events[index2][0] === "enter" && events[index2][1].type === "htmlFlow") {
+ break;
+ }
+ }
+ if (index2 > 1 && events[index2 - 2][1].type === "linePrefix") {
+ events[index2][1].start = events[index2 - 2][1].start;
+ events[index2 + 1][1].start = events[index2 - 2][1].start;
+ events.splice(index2 - 2, 2);
+ }
+ return events;
+ }
+ function tokenizeHtmlFlow(effects, ok3, nok) {
+ const self2 = this;
+ let marker;
+ let closingTag;
+ let buffer;
+ let index2;
+ let markerB;
+ return start;
+ function start(code3) {
+ return before(code3);
+ }
+ function before(code3) {
+ effects.enter("htmlFlow");
+ effects.enter("htmlFlowData");
+ effects.consume(code3);
+ return open;
+ }
+ function open(code3) {
+ if (code3 === 33) {
+ effects.consume(code3);
+ return declarationOpen;
+ }
+ if (code3 === 47) {
+ effects.consume(code3);
+ closingTag = true;
+ return tagCloseStart;
+ }
+ if (code3 === 63) {
+ effects.consume(code3);
+ marker = 3;
+ return self2.interrupt ? ok3 : continuationDeclarationInside;
+ }
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ buffer = String.fromCharCode(code3);
+ return tagName;
+ }
+ return nok(code3);
+ }
+ function declarationOpen(code3) {
+ if (code3 === 45) {
+ effects.consume(code3);
+ marker = 2;
+ return commentOpenInside;
+ }
+ if (code3 === 91) {
+ effects.consume(code3);
+ marker = 5;
+ index2 = 0;
+ return cdataOpenInside;
+ }
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ marker = 4;
+ return self2.interrupt ? ok3 : continuationDeclarationInside;
+ }
+ return nok(code3);
+ }
+ function commentOpenInside(code3) {
+ if (code3 === 45) {
+ effects.consume(code3);
+ return self2.interrupt ? ok3 : continuationDeclarationInside;
+ }
+ return nok(code3);
+ }
+ function cdataOpenInside(code3) {
+ const value = "CDATA[";
+ if (code3 === value.charCodeAt(index2++)) {
+ effects.consume(code3);
+ if (index2 === value.length) {
+ return self2.interrupt ? ok3 : continuation;
+ }
+ return cdataOpenInside;
+ }
+ return nok(code3);
+ }
+ function tagCloseStart(code3) {
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ buffer = String.fromCharCode(code3);
+ return tagName;
+ }
+ return nok(code3);
+ }
+ function tagName(code3) {
+ if (code3 === null || code3 === 47 || code3 === 62 || markdownLineEndingOrSpace(code3)) {
+ const slash = code3 === 47;
+ const name = buffer.toLowerCase();
+ if (!slash && !closingTag && htmlRawNames.includes(name)) {
+ marker = 1;
+ return self2.interrupt ? ok3(code3) : continuation(code3);
+ }
+ if (htmlBlockNames.includes(buffer.toLowerCase())) {
+ marker = 6;
+ if (slash) {
+ effects.consume(code3);
+ return basicSelfClosing;
+ }
+ return self2.interrupt ? ok3(code3) : continuation(code3);
+ }
+ marker = 7;
+ return self2.interrupt && !self2.parser.lazy[self2.now().line] ? nok(code3) : closingTag ? completeClosingTagAfter(code3) : completeAttributeNameBefore(code3);
+ }
+ if (code3 === 45 || asciiAlphanumeric(code3)) {
+ effects.consume(code3);
+ buffer += String.fromCharCode(code3);
+ return tagName;
+ }
+ return nok(code3);
+ }
+ function basicSelfClosing(code3) {
+ if (code3 === 62) {
+ effects.consume(code3);
+ return self2.interrupt ? ok3 : continuation;
+ }
+ return nok(code3);
+ }
+ function completeClosingTagAfter(code3) {
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return completeClosingTagAfter;
+ }
+ return completeEnd(code3);
+ }
+ function completeAttributeNameBefore(code3) {
+ if (code3 === 47) {
+ effects.consume(code3);
+ return completeEnd;
+ }
+ if (code3 === 58 || code3 === 95 || asciiAlpha(code3)) {
+ effects.consume(code3);
+ return completeAttributeName;
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return completeAttributeNameBefore;
+ }
+ return completeEnd(code3);
+ }
+ function completeAttributeName(code3) {
+ if (code3 === 45 || code3 === 46 || code3 === 58 || code3 === 95 || asciiAlphanumeric(code3)) {
+ effects.consume(code3);
+ return completeAttributeName;
+ }
+ return completeAttributeNameAfter(code3);
+ }
+ function completeAttributeNameAfter(code3) {
+ if (code3 === 61) {
+ effects.consume(code3);
+ return completeAttributeValueBefore;
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return completeAttributeNameAfter;
+ }
+ return completeAttributeNameBefore(code3);
+ }
+ function completeAttributeValueBefore(code3) {
+ if (code3 === null || code3 === 60 || code3 === 61 || code3 === 62 || code3 === 96) {
+ return nok(code3);
+ }
+ if (code3 === 34 || code3 === 39) {
+ effects.consume(code3);
+ markerB = code3;
+ return completeAttributeValueQuoted;
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return completeAttributeValueBefore;
+ }
+ return completeAttributeValueUnquoted(code3);
+ }
+ function completeAttributeValueQuoted(code3) {
+ if (code3 === markerB) {
+ effects.consume(code3);
+ markerB = null;
+ return completeAttributeValueQuotedAfter;
+ }
+ if (code3 === null || markdownLineEnding(code3)) {
+ return nok(code3);
+ }
+ effects.consume(code3);
+ return completeAttributeValueQuoted;
+ }
+ function completeAttributeValueUnquoted(code3) {
+ if (code3 === null || code3 === 34 || code3 === 39 || code3 === 47 || code3 === 60 || code3 === 61 || code3 === 62 || code3 === 96 || markdownLineEndingOrSpace(code3)) {
+ return completeAttributeNameAfter(code3);
+ }
+ effects.consume(code3);
+ return completeAttributeValueUnquoted;
+ }
+ function completeAttributeValueQuotedAfter(code3) {
+ if (code3 === 47 || code3 === 62 || markdownSpace(code3)) {
+ return completeAttributeNameBefore(code3);
+ }
+ return nok(code3);
+ }
+ function completeEnd(code3) {
+ if (code3 === 62) {
+ effects.consume(code3);
+ return completeAfter;
+ }
+ return nok(code3);
+ }
+ function completeAfter(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ return continuation(code3);
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return completeAfter;
+ }
+ return nok(code3);
+ }
+ function continuation(code3) {
+ if (code3 === 45 && marker === 2) {
+ effects.consume(code3);
+ return continuationCommentInside;
+ }
+ if (code3 === 60 && marker === 1) {
+ effects.consume(code3);
+ return continuationRawTagOpen;
+ }
+ if (code3 === 62 && marker === 4) {
+ effects.consume(code3);
+ return continuationClose;
+ }
+ if (code3 === 63 && marker === 3) {
+ effects.consume(code3);
+ return continuationDeclarationInside;
+ }
+ if (code3 === 93 && marker === 5) {
+ effects.consume(code3);
+ return continuationCdataInside;
+ }
+ if (markdownLineEnding(code3) && (marker === 6 || marker === 7)) {
+ effects.exit("htmlFlowData");
+ return effects.check(blankLineBefore, continuationAfter, continuationStart)(code3);
+ }
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("htmlFlowData");
+ return continuationStart(code3);
+ }
+ effects.consume(code3);
+ return continuation;
+ }
+ function continuationStart(code3) {
+ return effects.check(nonLazyContinuationStart, continuationStartNonLazy, continuationAfter)(code3);
+ }
+ function continuationStartNonLazy(code3) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return continuationBefore;
+ }
+ function continuationBefore(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ return continuationStart(code3);
+ }
+ effects.enter("htmlFlowData");
+ return continuation(code3);
+ }
+ function continuationCommentInside(code3) {
+ if (code3 === 45) {
+ effects.consume(code3);
+ return continuationDeclarationInside;
+ }
+ return continuation(code3);
+ }
+ function continuationRawTagOpen(code3) {
+ if (code3 === 47) {
+ effects.consume(code3);
+ buffer = "";
+ return continuationRawEndTag;
+ }
+ return continuation(code3);
+ }
+ function continuationRawEndTag(code3) {
+ if (code3 === 62) {
+ const name = buffer.toLowerCase();
+ if (htmlRawNames.includes(name)) {
+ effects.consume(code3);
+ return continuationClose;
+ }
+ return continuation(code3);
+ }
+ if (asciiAlpha(code3) && buffer.length < 8) {
+ effects.consume(code3);
+ buffer += String.fromCharCode(code3);
+ return continuationRawEndTag;
+ }
+ return continuation(code3);
+ }
+ function continuationCdataInside(code3) {
+ if (code3 === 93) {
+ effects.consume(code3);
+ return continuationDeclarationInside;
+ }
+ return continuation(code3);
+ }
+ function continuationDeclarationInside(code3) {
+ if (code3 === 62) {
+ effects.consume(code3);
+ return continuationClose;
+ }
+ if (code3 === 45 && marker === 2) {
+ effects.consume(code3);
+ return continuationDeclarationInside;
+ }
+ return continuation(code3);
+ }
+ function continuationClose(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("htmlFlowData");
+ return continuationAfter(code3);
+ }
+ effects.consume(code3);
+ return continuationClose;
+ }
+ function continuationAfter(code3) {
+ effects.exit("htmlFlow");
+ return ok3(code3);
+ }
+ }
+ function tokenizeNonLazyContinuationStart(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code3) {
+ if (markdownLineEnding(code3)) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return after;
+ }
+ return nok(code3);
+ }
+ function after(code3) {
+ return self2.parser.lazy[self2.now().line] ? nok(code3) : ok3(code3);
+ }
+ }
+ function tokenizeBlankLineBefore(effects, ok3, nok) {
+ return start;
+ function start(code3) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return effects.attempt(blankLine, ok3, nok);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/html-text.js
+ var htmlText = {
+ name: "htmlText",
+ tokenize: tokenizeHtmlText
+ };
+ function tokenizeHtmlText(effects, ok3, nok) {
+ const self2 = this;
+ let marker;
+ let index2;
+ let returnState;
+ return start;
+ function start(code3) {
+ effects.enter("htmlText");
+ effects.enter("htmlTextData");
+ effects.consume(code3);
+ return open;
+ }
+ function open(code3) {
+ if (code3 === 33) {
+ effects.consume(code3);
+ return declarationOpen;
+ }
+ if (code3 === 47) {
+ effects.consume(code3);
+ return tagCloseStart;
+ }
+ if (code3 === 63) {
+ effects.consume(code3);
+ return instruction;
+ }
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ return tagOpen;
+ }
+ return nok(code3);
+ }
+ function declarationOpen(code3) {
+ if (code3 === 45) {
+ effects.consume(code3);
+ return commentOpenInside;
+ }
+ if (code3 === 91) {
+ effects.consume(code3);
+ index2 = 0;
+ return cdataOpenInside;
+ }
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ return declaration;
+ }
+ return nok(code3);
+ }
+ function commentOpenInside(code3) {
+ if (code3 === 45) {
+ effects.consume(code3);
+ return commentEnd;
+ }
+ return nok(code3);
+ }
+ function comment(code3) {
+ if (code3 === null) {
+ return nok(code3);
+ }
+ if (code3 === 45) {
+ effects.consume(code3);
+ return commentClose;
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = comment;
+ return lineEndingBefore(code3);
+ }
+ effects.consume(code3);
+ return comment;
+ }
+ function commentClose(code3) {
+ if (code3 === 45) {
+ effects.consume(code3);
+ return commentEnd;
+ }
+ return comment(code3);
+ }
+ function commentEnd(code3) {
+ return code3 === 62 ? end(code3) : code3 === 45 ? commentClose(code3) : comment(code3);
+ }
+ function cdataOpenInside(code3) {
+ const value = "CDATA[";
+ if (code3 === value.charCodeAt(index2++)) {
+ effects.consume(code3);
+ return index2 === value.length ? cdata : cdataOpenInside;
+ }
+ return nok(code3);
+ }
+ function cdata(code3) {
+ if (code3 === null) {
+ return nok(code3);
+ }
+ if (code3 === 93) {
+ effects.consume(code3);
+ return cdataClose;
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = cdata;
+ return lineEndingBefore(code3);
+ }
+ effects.consume(code3);
+ return cdata;
+ }
+ function cdataClose(code3) {
+ if (code3 === 93) {
+ effects.consume(code3);
+ return cdataEnd;
+ }
+ return cdata(code3);
+ }
+ function cdataEnd(code3) {
+ if (code3 === 62) {
+ return end(code3);
+ }
+ if (code3 === 93) {
+ effects.consume(code3);
+ return cdataEnd;
+ }
+ return cdata(code3);
+ }
+ function declaration(code3) {
+ if (code3 === null || code3 === 62) {
+ return end(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = declaration;
+ return lineEndingBefore(code3);
+ }
+ effects.consume(code3);
+ return declaration;
+ }
+ function instruction(code3) {
+ if (code3 === null) {
+ return nok(code3);
+ }
+ if (code3 === 63) {
+ effects.consume(code3);
+ return instructionClose;
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = instruction;
+ return lineEndingBefore(code3);
+ }
+ effects.consume(code3);
+ return instruction;
+ }
+ function instructionClose(code3) {
+ return code3 === 62 ? end(code3) : instruction(code3);
+ }
+ function tagCloseStart(code3) {
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ return tagClose;
+ }
+ return nok(code3);
+ }
+ function tagClose(code3) {
+ if (code3 === 45 || asciiAlphanumeric(code3)) {
+ effects.consume(code3);
+ return tagClose;
+ }
+ return tagCloseBetween(code3);
+ }
+ function tagCloseBetween(code3) {
+ if (markdownLineEnding(code3)) {
+ returnState = tagCloseBetween;
+ return lineEndingBefore(code3);
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return tagCloseBetween;
+ }
+ return end(code3);
+ }
+ function tagOpen(code3) {
+ if (code3 === 45 || asciiAlphanumeric(code3)) {
+ effects.consume(code3);
+ return tagOpen;
+ }
+ if (code3 === 47 || code3 === 62 || markdownLineEndingOrSpace(code3)) {
+ return tagOpenBetween(code3);
+ }
+ return nok(code3);
+ }
+ function tagOpenBetween(code3) {
+ if (code3 === 47) {
+ effects.consume(code3);
+ return end;
+ }
+ if (code3 === 58 || code3 === 95 || asciiAlpha(code3)) {
+ effects.consume(code3);
+ return tagOpenAttributeName;
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = tagOpenBetween;
+ return lineEndingBefore(code3);
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return tagOpenBetween;
+ }
+ return end(code3);
+ }
+ function tagOpenAttributeName(code3) {
+ if (code3 === 45 || code3 === 46 || code3 === 58 || code3 === 95 || asciiAlphanumeric(code3)) {
+ effects.consume(code3);
+ return tagOpenAttributeName;
+ }
+ return tagOpenAttributeNameAfter(code3);
+ }
+ function tagOpenAttributeNameAfter(code3) {
+ if (code3 === 61) {
+ effects.consume(code3);
+ return tagOpenAttributeValueBefore;
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = tagOpenAttributeNameAfter;
+ return lineEndingBefore(code3);
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return tagOpenAttributeNameAfter;
+ }
+ return tagOpenBetween(code3);
+ }
+ function tagOpenAttributeValueBefore(code3) {
+ if (code3 === null || code3 === 60 || code3 === 61 || code3 === 62 || code3 === 96) {
+ return nok(code3);
+ }
+ if (code3 === 34 || code3 === 39) {
+ effects.consume(code3);
+ marker = code3;
+ return tagOpenAttributeValueQuoted;
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = tagOpenAttributeValueBefore;
+ return lineEndingBefore(code3);
+ }
+ if (markdownSpace(code3)) {
+ effects.consume(code3);
+ return tagOpenAttributeValueBefore;
+ }
+ effects.consume(code3);
+ return tagOpenAttributeValueUnquoted;
+ }
+ function tagOpenAttributeValueQuoted(code3) {
+ if (code3 === marker) {
+ effects.consume(code3);
+ marker = void 0;
+ return tagOpenAttributeValueQuotedAfter;
+ }
+ if (code3 === null) {
+ return nok(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ returnState = tagOpenAttributeValueQuoted;
+ return lineEndingBefore(code3);
+ }
+ effects.consume(code3);
+ return tagOpenAttributeValueQuoted;
+ }
+ function tagOpenAttributeValueUnquoted(code3) {
+ if (code3 === null || code3 === 34 || code3 === 39 || code3 === 60 || code3 === 61 || code3 === 96) {
+ return nok(code3);
+ }
+ if (code3 === 47 || code3 === 62 || markdownLineEndingOrSpace(code3)) {
+ return tagOpenBetween(code3);
+ }
+ effects.consume(code3);
+ return tagOpenAttributeValueUnquoted;
+ }
+ function tagOpenAttributeValueQuotedAfter(code3) {
+ if (code3 === 47 || code3 === 62 || markdownLineEndingOrSpace(code3)) {
+ return tagOpenBetween(code3);
+ }
+ return nok(code3);
+ }
+ function end(code3) {
+ if (code3 === 62) {
+ effects.consume(code3);
+ effects.exit("htmlTextData");
+ effects.exit("htmlText");
+ return ok3;
+ }
+ return nok(code3);
+ }
+ function lineEndingBefore(code3) {
+ effects.exit("htmlTextData");
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return lineEndingAfter;
+ }
+ function lineEndingAfter(code3) {
+ return markdownSpace(code3) ? factorySpace(effects, lineEndingAfterPrefix, "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code3) : lineEndingAfterPrefix(code3);
+ }
+ function lineEndingAfterPrefix(code3) {
+ effects.enter("htmlTextData");
+ return returnState(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/label-end.js
+ var labelEnd = {
+ name: "labelEnd",
+ tokenize: tokenizeLabelEnd,
+ resolveTo: resolveToLabelEnd,
+ resolveAll: resolveAllLabelEnd
+ };
+ var resourceConstruct = {
+ tokenize: tokenizeResource
+ };
+ var referenceFullConstruct = {
+ tokenize: tokenizeReferenceFull
+ };
+ var referenceCollapsedConstruct = {
+ tokenize: tokenizeReferenceCollapsed
+ };
+ function resolveAllLabelEnd(events) {
+ let index2 = -1;
+ while (++index2 < events.length) {
+ const token = events[index2][1];
+ if (token.type === "labelImage" || token.type === "labelLink" || token.type === "labelEnd") {
+ events.splice(index2 + 1, token.type === "labelImage" ? 4 : 2);
+ token.type = "data";
+ index2++;
+ }
+ }
+ return events;
+ }
+ function resolveToLabelEnd(events, context) {
+ let index2 = events.length;
+ let offset = 0;
+ let token;
+ let open;
+ let close2;
+ let media;
+ while (index2--) {
+ token = events[index2][1];
+ if (open) {
+ if (token.type === "link" || token.type === "labelLink" && token._inactive) {
+ break;
+ }
+ if (events[index2][0] === "enter" && token.type === "labelLink") {
+ token._inactive = true;
+ }
+ } else if (close2) {
+ if (events[index2][0] === "enter" && (token.type === "labelImage" || token.type === "labelLink") && !token._balanced) {
+ open = index2;
+ if (token.type !== "labelLink") {
+ offset = 2;
+ break;
+ }
+ }
+ } else if (token.type === "labelEnd") {
+ close2 = index2;
+ }
+ }
+ const group = {
+ type: events[open][1].type === "labelLink" ? "link" : "image",
+ start: Object.assign({}, events[open][1].start),
+ end: Object.assign({}, events[events.length - 1][1].end)
+ };
+ const label = {
+ type: "label",
+ start: Object.assign({}, events[open][1].start),
+ end: Object.assign({}, events[close2][1].end)
+ };
+ const text5 = {
+ type: "labelText",
+ start: Object.assign({}, events[open + offset + 2][1].end),
+ end: Object.assign({}, events[close2 - 2][1].start)
+ };
+ media = [["enter", group, context], ["enter", label, context]];
+ media = push(media, events.slice(open + 1, open + offset + 3));
+ media = push(media, [["enter", text5, context]]);
+ media = push(media, resolveAll(context.parser.constructs.insideSpan.null, events.slice(open + offset + 4, close2 - 3), context));
+ media = push(media, [["exit", text5, context], events[close2 - 2], events[close2 - 1], ["exit", label, context]]);
+ media = push(media, events.slice(close2 + 1));
+ media = push(media, [["exit", group, context]]);
+ splice(events, open, events.length, media);
+ return events;
+ }
+ function tokenizeLabelEnd(effects, ok3, nok) {
+ const self2 = this;
+ let index2 = self2.events.length;
+ let labelStart;
+ let defined;
+ while (index2--) {
+ if ((self2.events[index2][1].type === "labelImage" || self2.events[index2][1].type === "labelLink") && !self2.events[index2][1]._balanced) {
+ labelStart = self2.events[index2][1];
+ break;
+ }
+ }
+ return start;
+ function start(code3) {
+ if (!labelStart) {
+ return nok(code3);
+ }
+ if (labelStart._inactive) {
+ return labelEndNok(code3);
+ }
+ defined = self2.parser.defined.includes(normalizeIdentifier(self2.sliceSerialize({
+ start: labelStart.end,
+ end: self2.now()
+ })));
+ effects.enter("labelEnd");
+ effects.enter("labelMarker");
+ effects.consume(code3);
+ effects.exit("labelMarker");
+ effects.exit("labelEnd");
+ return after;
+ }
+ function after(code3) {
+ if (code3 === 40) {
+ return effects.attempt(resourceConstruct, labelEndOk, defined ? labelEndOk : labelEndNok)(code3);
+ }
+ if (code3 === 91) {
+ return effects.attempt(referenceFullConstruct, labelEndOk, defined ? referenceNotFull : labelEndNok)(code3);
+ }
+ return defined ? labelEndOk(code3) : labelEndNok(code3);
+ }
+ function referenceNotFull(code3) {
+ return effects.attempt(referenceCollapsedConstruct, labelEndOk, labelEndNok)(code3);
+ }
+ function labelEndOk(code3) {
+ return ok3(code3);
+ }
+ function labelEndNok(code3) {
+ labelStart._balanced = true;
+ return nok(code3);
+ }
+ }
+ function tokenizeResource(effects, ok3, nok) {
+ return resourceStart;
+ function resourceStart(code3) {
+ effects.enter("resource");
+ effects.enter("resourceMarker");
+ effects.consume(code3);
+ effects.exit("resourceMarker");
+ return resourceBefore;
+ }
+ function resourceBefore(code3) {
+ return markdownLineEndingOrSpace(code3) ? factoryWhitespace(effects, resourceOpen)(code3) : resourceOpen(code3);
+ }
+ function resourceOpen(code3) {
+ if (code3 === 41) {
+ return resourceEnd(code3);
+ }
+ return factoryDestination(effects, resourceDestinationAfter, resourceDestinationMissing, "resourceDestination", "resourceDestinationLiteral", "resourceDestinationLiteralMarker", "resourceDestinationRaw", "resourceDestinationString", 32)(code3);
+ }
+ function resourceDestinationAfter(code3) {
+ return markdownLineEndingOrSpace(code3) ? factoryWhitespace(effects, resourceBetween)(code3) : resourceEnd(code3);
+ }
+ function resourceDestinationMissing(code3) {
+ return nok(code3);
+ }
+ function resourceBetween(code3) {
+ if (code3 === 34 || code3 === 39 || code3 === 40) {
+ return factoryTitle(effects, resourceTitleAfter, nok, "resourceTitle", "resourceTitleMarker", "resourceTitleString")(code3);
+ }
+ return resourceEnd(code3);
+ }
+ function resourceTitleAfter(code3) {
+ return markdownLineEndingOrSpace(code3) ? factoryWhitespace(effects, resourceEnd)(code3) : resourceEnd(code3);
+ }
+ function resourceEnd(code3) {
+ if (code3 === 41) {
+ effects.enter("resourceMarker");
+ effects.consume(code3);
+ effects.exit("resourceMarker");
+ effects.exit("resource");
+ return ok3;
+ }
+ return nok(code3);
+ }
+ }
+ function tokenizeReferenceFull(effects, ok3, nok) {
+ const self2 = this;
+ return referenceFull;
+ function referenceFull(code3) {
+ return factoryLabel.call(self2, effects, referenceFullAfter, referenceFullMissing, "reference", "referenceMarker", "referenceString")(code3);
+ }
+ function referenceFullAfter(code3) {
+ return self2.parser.defined.includes(normalizeIdentifier(self2.sliceSerialize(self2.events[self2.events.length - 1][1]).slice(1, -1))) ? ok3(code3) : nok(code3);
+ }
+ function referenceFullMissing(code3) {
+ return nok(code3);
+ }
+ }
+ function tokenizeReferenceCollapsed(effects, ok3, nok) {
+ return referenceCollapsedStart;
+ function referenceCollapsedStart(code3) {
+ effects.enter("reference");
+ effects.enter("referenceMarker");
+ effects.consume(code3);
+ effects.exit("referenceMarker");
+ return referenceCollapsedOpen;
+ }
+ function referenceCollapsedOpen(code3) {
+ if (code3 === 93) {
+ effects.enter("referenceMarker");
+ effects.consume(code3);
+ effects.exit("referenceMarker");
+ effects.exit("reference");
+ return ok3;
+ }
+ return nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/label-start-image.js
+ var labelStartImage = {
+ name: "labelStartImage",
+ tokenize: tokenizeLabelStartImage,
+ resolveAll: labelEnd.resolveAll
+ };
+ function tokenizeLabelStartImage(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code3) {
+ effects.enter("labelImage");
+ effects.enter("labelImageMarker");
+ effects.consume(code3);
+ effects.exit("labelImageMarker");
+ return open;
+ }
+ function open(code3) {
+ if (code3 === 91) {
+ effects.enter("labelMarker");
+ effects.consume(code3);
+ effects.exit("labelMarker");
+ effects.exit("labelImage");
+ return after;
+ }
+ return nok(code3);
+ }
+ function after(code3) {
+ return code3 === 94 && "_hiddenFootnoteSupport" in self2.parser.constructs ? nok(code3) : ok3(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/label-start-link.js
+ var labelStartLink = {
+ name: "labelStartLink",
+ tokenize: tokenizeLabelStartLink,
+ resolveAll: labelEnd.resolveAll
+ };
+ function tokenizeLabelStartLink(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code3) {
+ effects.enter("labelLink");
+ effects.enter("labelMarker");
+ effects.consume(code3);
+ effects.exit("labelMarker");
+ effects.exit("labelLink");
+ return after;
+ }
+ function after(code3) {
+ return code3 === 94 && "_hiddenFootnoteSupport" in self2.parser.constructs ? nok(code3) : ok3(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/line-ending.js
+ var lineEnding = {
+ name: "lineEnding",
+ tokenize: tokenizeLineEnding
+ };
+ function tokenizeLineEnding(effects, ok3) {
+ return start;
+ function start(code3) {
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return factorySpace(effects, ok3, "linePrefix");
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/thematic-break.js
+ var thematicBreak = {
+ name: "thematicBreak",
+ tokenize: tokenizeThematicBreak
+ };
+ function tokenizeThematicBreak(effects, ok3, nok) {
+ let size = 0;
+ let marker;
+ return start;
+ function start(code3) {
+ effects.enter("thematicBreak");
+ return before(code3);
+ }
+ function before(code3) {
+ marker = code3;
+ return atBreak(code3);
+ }
+ function atBreak(code3) {
+ if (code3 === marker) {
+ effects.enter("thematicBreakSequence");
+ return sequence(code3);
+ }
+ if (size >= 3 && (code3 === null || markdownLineEnding(code3))) {
+ effects.exit("thematicBreak");
+ return ok3(code3);
+ }
+ return nok(code3);
+ }
+ function sequence(code3) {
+ if (code3 === marker) {
+ effects.consume(code3);
+ size++;
+ return sequence;
+ }
+ effects.exit("thematicBreakSequence");
+ return markdownSpace(code3) ? factorySpace(effects, atBreak, "whitespace")(code3) : atBreak(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/list.js
+ var list = {
+ name: "list",
+ tokenize: tokenizeListStart,
+ continuation: {
+ tokenize: tokenizeListContinuation
+ },
+ exit: tokenizeListEnd
+ };
+ var listItemPrefixWhitespaceConstruct = {
+ tokenize: tokenizeListItemPrefixWhitespace,
+ partial: true
+ };
+ var indentConstruct = {
+ tokenize: tokenizeIndent,
+ partial: true
+ };
+ function tokenizeListStart(effects, ok3, nok) {
+ const self2 = this;
+ const tail = self2.events[self2.events.length - 1];
+ let initialSize = tail && tail[1].type === "linePrefix" ? tail[2].sliceSerialize(tail[1], true).length : 0;
+ let size = 0;
+ return start;
+ function start(code3) {
+ const kind = self2.containerState.type || (code3 === 42 || code3 === 43 || code3 === 45 ? "listUnordered" : "listOrdered");
+ if (kind === "listUnordered" ? !self2.containerState.marker || code3 === self2.containerState.marker : asciiDigit(code3)) {
+ if (!self2.containerState.type) {
+ self2.containerState.type = kind;
+ effects.enter(kind, {
+ _container: true
+ });
+ }
+ if (kind === "listUnordered") {
+ effects.enter("listItemPrefix");
+ return code3 === 42 || code3 === 45 ? effects.check(thematicBreak, nok, atMarker)(code3) : atMarker(code3);
+ }
+ if (!self2.interrupt || code3 === 49) {
+ effects.enter("listItemPrefix");
+ effects.enter("listItemValue");
+ return inside(code3);
+ }
+ }
+ return nok(code3);
+ }
+ function inside(code3) {
+ if (asciiDigit(code3) && ++size < 10) {
+ effects.consume(code3);
+ return inside;
+ }
+ if ((!self2.interrupt || size < 2) && (self2.containerState.marker ? code3 === self2.containerState.marker : code3 === 41 || code3 === 46)) {
+ effects.exit("listItemValue");
+ return atMarker(code3);
+ }
+ return nok(code3);
+ }
+ function atMarker(code3) {
+ effects.enter("listItemMarker");
+ effects.consume(code3);
+ effects.exit("listItemMarker");
+ self2.containerState.marker = self2.containerState.marker || code3;
+ return effects.check(
+ blankLine,
+ // Can’t be empty when interrupting.
+ self2.interrupt ? nok : onBlank,
+ effects.attempt(listItemPrefixWhitespaceConstruct, endOfPrefix, otherPrefix)
+ );
+ }
+ function onBlank(code3) {
+ self2.containerState.initialBlankLine = true;
+ initialSize++;
+ return endOfPrefix(code3);
+ }
+ function otherPrefix(code3) {
+ if (markdownSpace(code3)) {
+ effects.enter("listItemPrefixWhitespace");
+ effects.consume(code3);
+ effects.exit("listItemPrefixWhitespace");
+ return endOfPrefix;
+ }
+ return nok(code3);
+ }
+ function endOfPrefix(code3) {
+ self2.containerState.size = initialSize + self2.sliceSerialize(effects.exit("listItemPrefix"), true).length;
+ return ok3(code3);
+ }
+ }
+ function tokenizeListContinuation(effects, ok3, nok) {
+ const self2 = this;
+ self2.containerState._closeFlow = void 0;
+ return effects.check(blankLine, onBlank, notBlank);
+ function onBlank(code3) {
+ self2.containerState.furtherBlankLines = self2.containerState.furtherBlankLines || self2.containerState.initialBlankLine;
+ return factorySpace(effects, ok3, "listItemIndent", self2.containerState.size + 1)(code3);
+ }
+ function notBlank(code3) {
+ if (self2.containerState.furtherBlankLines || !markdownSpace(code3)) {
+ self2.containerState.furtherBlankLines = void 0;
+ self2.containerState.initialBlankLine = void 0;
+ return notInCurrentItem(code3);
+ }
+ self2.containerState.furtherBlankLines = void 0;
+ self2.containerState.initialBlankLine = void 0;
+ return effects.attempt(indentConstruct, ok3, notInCurrentItem)(code3);
+ }
+ function notInCurrentItem(code3) {
+ self2.containerState._closeFlow = true;
+ self2.interrupt = void 0;
+ return factorySpace(effects, effects.attempt(list, ok3, nok), "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code3);
+ }
+ }
+ function tokenizeIndent(effects, ok3, nok) {
+ const self2 = this;
+ return factorySpace(effects, afterPrefix, "listItemIndent", self2.containerState.size + 1);
+ function afterPrefix(code3) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "listItemIndent" && tail[2].sliceSerialize(tail[1], true).length === self2.containerState.size ? ok3(code3) : nok(code3);
+ }
+ }
+ function tokenizeListEnd(effects) {
+ effects.exit(this.containerState.type);
+ }
+ function tokenizeListItemPrefixWhitespace(effects, ok3, nok) {
+ const self2 = this;
+ return factorySpace(effects, afterPrefix, "listItemPrefixWhitespace", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4 + 1);
+ function afterPrefix(code3) {
+ const tail = self2.events[self2.events.length - 1];
+ return !markdownSpace(code3) && tail && tail[1].type === "listItemPrefixWhitespace" ? ok3(code3) : nok(code3);
+ }
+ }
+
+ // node_modules/micromark-core-commonmark/lib/setext-underline.js
+ var setextUnderline = {
+ name: "setextUnderline",
+ tokenize: tokenizeSetextUnderline,
+ resolveTo: resolveToSetextUnderline
+ };
+ function resolveToSetextUnderline(events, context) {
+ let index2 = events.length;
+ let content3;
+ let text5;
+ let definition3;
+ while (index2--) {
+ if (events[index2][0] === "enter") {
+ if (events[index2][1].type === "content") {
+ content3 = index2;
+ break;
+ }
+ if (events[index2][1].type === "paragraph") {
+ text5 = index2;
+ }
+ } else {
+ if (events[index2][1].type === "content") {
+ events.splice(index2, 1);
+ }
+ if (!definition3 && events[index2][1].type === "definition") {
+ definition3 = index2;
+ }
+ }
+ }
+ const heading2 = {
+ type: "setextHeading",
+ start: Object.assign({}, events[text5][1].start),
+ end: Object.assign({}, events[events.length - 1][1].end)
+ };
+ events[text5][1].type = "setextHeadingText";
+ if (definition3) {
+ events.splice(text5, 0, ["enter", heading2, context]);
+ events.splice(definition3 + 1, 0, ["exit", events[content3][1], context]);
+ events[content3][1].end = Object.assign({}, events[definition3][1].end);
+ } else {
+ events[content3][1] = heading2;
+ }
+ events.push(["exit", heading2, context]);
+ return events;
+ }
+ function tokenizeSetextUnderline(effects, ok3, nok) {
+ const self2 = this;
+ let marker;
+ return start;
+ function start(code3) {
+ let index2 = self2.events.length;
+ let paragraph2;
+ while (index2--) {
+ if (self2.events[index2][1].type !== "lineEnding" && self2.events[index2][1].type !== "linePrefix" && self2.events[index2][1].type !== "content") {
+ paragraph2 = self2.events[index2][1].type === "paragraph";
+ break;
+ }
+ }
+ if (!self2.parser.lazy[self2.now().line] && (self2.interrupt || paragraph2)) {
+ effects.enter("setextHeadingLine");
+ marker = code3;
+ return before(code3);
+ }
+ return nok(code3);
+ }
+ function before(code3) {
+ effects.enter("setextHeadingLineSequence");
+ return inside(code3);
+ }
+ function inside(code3) {
+ if (code3 === marker) {
+ effects.consume(code3);
+ return inside;
+ }
+ effects.exit("setextHeadingLineSequence");
+ return markdownSpace(code3) ? factorySpace(effects, after, "lineSuffix")(code3) : after(code3);
+ }
+ function after(code3) {
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("setextHeadingLine");
+ return ok3(code3);
+ }
+ return nok(code3);
+ }
+ }
+
+ // node_modules/micromark/lib/initialize/flow.js
+ var flow = {
+ tokenize: initializeFlow
+ };
+ function initializeFlow(effects) {
+ const self2 = this;
+ const initial = effects.attempt(
+ // Try to parse a blank line.
+ blankLine,
+ atBlankEnding,
+ // Try to parse initial flow (essentially, only code).
+ effects.attempt(
+ this.parser.constructs.flowInitial,
+ afterConstruct,
+ factorySpace(
+ effects,
+ effects.attempt(
+ this.parser.constructs.flow,
+ afterConstruct,
+ effects.attempt(content2, afterConstruct)
+ ),
+ "linePrefix"
+ )
+ )
+ );
+ return initial;
+ function atBlankEnding(code3) {
+ if (code3 === null) {
+ effects.consume(code3);
+ return;
+ }
+ effects.enter("lineEndingBlank");
+ effects.consume(code3);
+ effects.exit("lineEndingBlank");
+ self2.currentConstruct = void 0;
+ return initial;
+ }
+ function afterConstruct(code3) {
+ if (code3 === null) {
+ effects.consume(code3);
+ return;
+ }
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ self2.currentConstruct = void 0;
+ return initial;
+ }
+ }
+
+ // node_modules/micromark/lib/initialize/text.js
+ var resolver = {
+ resolveAll: createResolver()
+ };
+ var string = initializeFactory("string");
+ var text = initializeFactory("text");
+ function initializeFactory(field) {
+ return {
+ tokenize: initializeText,
+ resolveAll: createResolver(
+ field === "text" ? resolveAllLineSuffixes : void 0
+ )
+ };
+ function initializeText(effects) {
+ const self2 = this;
+ const constructs2 = this.parser.constructs[field];
+ const text5 = effects.attempt(constructs2, start, notText);
+ return start;
+ function start(code3) {
+ return atBreak(code3) ? text5(code3) : notText(code3);
+ }
+ function notText(code3) {
+ if (code3 === null) {
+ effects.consume(code3);
+ return;
+ }
+ effects.enter("data");
+ effects.consume(code3);
+ return data;
+ }
+ function data(code3) {
+ if (atBreak(code3)) {
+ effects.exit("data");
+ return text5(code3);
+ }
+ effects.consume(code3);
+ return data;
+ }
+ function atBreak(code3) {
+ if (code3 === null) {
+ return true;
+ }
+ const list4 = constructs2[code3];
+ let index2 = -1;
+ if (list4) {
+ while (++index2 < list4.length) {
+ const item = list4[index2];
+ if (!item.previous || item.previous.call(self2, self2.previous)) {
+ return true;
+ }
+ }
+ }
+ return false;
+ }
+ }
+ }
+ function createResolver(extraResolver) {
+ return resolveAllText;
+ function resolveAllText(events, context) {
+ let index2 = -1;
+ let enter;
+ while (++index2 <= events.length) {
+ if (enter === void 0) {
+ if (events[index2] && events[index2][1].type === "data") {
+ enter = index2;
+ index2++;
+ }
+ } else if (!events[index2] || events[index2][1].type !== "data") {
+ if (index2 !== enter + 2) {
+ events[enter][1].end = events[index2 - 1][1].end;
+ events.splice(enter + 2, index2 - enter - 2);
+ index2 = enter + 2;
+ }
+ enter = void 0;
+ }
+ }
+ return extraResolver ? extraResolver(events, context) : events;
+ }
+ }
+ function resolveAllLineSuffixes(events, context) {
+ let eventIndex = 0;
+ while (++eventIndex <= events.length) {
+ if ((eventIndex === events.length || events[eventIndex][1].type === "lineEnding") && events[eventIndex - 1][1].type === "data") {
+ const data = events[eventIndex - 1][1];
+ const chunks = context.sliceStream(data);
+ let index2 = chunks.length;
+ let bufferIndex = -1;
+ let size = 0;
+ let tabs;
+ while (index2--) {
+ const chunk = chunks[index2];
+ if (typeof chunk === "string") {
+ bufferIndex = chunk.length;
+ while (chunk.charCodeAt(bufferIndex - 1) === 32) {
+ size++;
+ bufferIndex--;
+ }
+ if (bufferIndex) break;
+ bufferIndex = -1;
+ } else if (chunk === -2) {
+ tabs = true;
+ size++;
+ } else if (chunk === -1) {
+ } else {
+ index2++;
+ break;
+ }
+ }
+ if (size) {
+ const token = {
+ type: eventIndex === events.length || tabs || size < 2 ? "lineSuffix" : "hardBreakTrailing",
+ start: {
+ line: data.end.line,
+ column: data.end.column - size,
+ offset: data.end.offset - size,
+ _index: data.start._index + index2,
+ _bufferIndex: index2 ? bufferIndex : data.start._bufferIndex + bufferIndex
+ },
+ end: Object.assign({}, data.end)
+ };
+ data.end = Object.assign({}, token.start);
+ if (data.start.offset === data.end.offset) {
+ Object.assign(data, token);
+ } else {
+ events.splice(
+ eventIndex,
+ 0,
+ ["enter", token, context],
+ ["exit", token, context]
+ );
+ eventIndex += 2;
+ }
+ }
+ eventIndex++;
+ }
+ }
+ return events;
+ }
+
+ // node_modules/micromark/lib/create-tokenizer.js
+ function createTokenizer(parser, initialize, from) {
+ let point3 = Object.assign(
+ from ? Object.assign({}, from) : {
+ line: 1,
+ column: 1,
+ offset: 0
+ },
+ {
+ _index: 0,
+ _bufferIndex: -1
+ }
+ );
+ const columnStart = {};
+ const resolveAllConstructs = [];
+ let chunks = [];
+ let stack = [];
+ let consumed = true;
+ const effects = {
+ consume,
+ enter,
+ exit: exit3,
+ attempt: constructFactory(onsuccessfulconstruct),
+ check: constructFactory(onsuccessfulcheck),
+ interrupt: constructFactory(onsuccessfulcheck, {
+ interrupt: true
+ })
+ };
+ const context = {
+ previous: null,
+ code: null,
+ containerState: {},
+ events: [],
+ parser,
+ sliceStream,
+ sliceSerialize,
+ now,
+ defineSkip,
+ write
+ };
+ let state = initialize.tokenize.call(context, effects);
+ let expectedCode;
+ if (initialize.resolveAll) {
+ resolveAllConstructs.push(initialize);
+ }
+ return context;
+ function write(slice) {
+ chunks = push(chunks, slice);
+ main();
+ if (chunks[chunks.length - 1] !== null) {
+ return [];
+ }
+ addResult(initialize, 0);
+ context.events = resolveAll(resolveAllConstructs, context.events, context);
+ return context.events;
+ }
+ function sliceSerialize(token, expandTabs) {
+ return serializeChunks(sliceStream(token), expandTabs);
+ }
+ function sliceStream(token) {
+ return sliceChunks(chunks, token);
+ }
+ function now() {
+ const { line, column, offset, _index, _bufferIndex } = point3;
+ return {
+ line,
+ column,
+ offset,
+ _index,
+ _bufferIndex
+ };
+ }
+ function defineSkip(value) {
+ columnStart[value.line] = value.column;
+ accountForPotentialSkip();
+ }
+ function main() {
+ let chunkIndex;
+ while (point3._index < chunks.length) {
+ const chunk = chunks[point3._index];
+ if (typeof chunk === "string") {
+ chunkIndex = point3._index;
+ if (point3._bufferIndex < 0) {
+ point3._bufferIndex = 0;
+ }
+ while (point3._index === chunkIndex && point3._bufferIndex < chunk.length) {
+ go(chunk.charCodeAt(point3._bufferIndex));
+ }
+ } else {
+ go(chunk);
+ }
+ }
+ }
+ function go(code3) {
+ consumed = void 0;
+ expectedCode = code3;
+ state = state(code3);
+ }
+ function consume(code3) {
+ if (markdownLineEnding(code3)) {
+ point3.line++;
+ point3.column = 1;
+ point3.offset += code3 === -3 ? 2 : 1;
+ accountForPotentialSkip();
+ } else if (code3 !== -1) {
+ point3.column++;
+ point3.offset++;
+ }
+ if (point3._bufferIndex < 0) {
+ point3._index++;
+ } else {
+ point3._bufferIndex++;
+ if (point3._bufferIndex === chunks[point3._index].length) {
+ point3._bufferIndex = -1;
+ point3._index++;
+ }
+ }
+ context.previous = code3;
+ consumed = true;
+ }
+ function enter(type, fields) {
+ const token = fields || {};
+ token.type = type;
+ token.start = now();
+ context.events.push(["enter", token, context]);
+ stack.push(token);
+ return token;
+ }
+ function exit3(type) {
+ const token = stack.pop();
+ token.end = now();
+ context.events.push(["exit", token, context]);
+ return token;
+ }
+ function onsuccessfulconstruct(construct, info) {
+ addResult(construct, info.from);
+ }
+ function onsuccessfulcheck(_3, info) {
+ info.restore();
+ }
+ function constructFactory(onreturn, fields) {
+ return hook;
+ function hook(constructs2, returnState, bogusState) {
+ let listOfConstructs;
+ let constructIndex;
+ let currentConstruct;
+ let info;
+ return Array.isArray(constructs2) ? handleListOfConstructs(constructs2) : "tokenize" in constructs2 ? (
+ // @ts-expect-error Looks like a construct.
+ handleListOfConstructs([constructs2])
+ ) : handleMapOfConstructs(constructs2);
+ function handleMapOfConstructs(map5) {
+ return start;
+ function start(code3) {
+ const def = code3 !== null && map5[code3];
+ const all2 = code3 !== null && map5.null;
+ const list4 = [
+ // To do: add more extension tests.
+ /* c8 ignore next 2 */
+ ...Array.isArray(def) ? def : def ? [def] : [],
+ ...Array.isArray(all2) ? all2 : all2 ? [all2] : []
+ ];
+ return handleListOfConstructs(list4)(code3);
+ }
+ }
+ function handleListOfConstructs(list4) {
+ listOfConstructs = list4;
+ constructIndex = 0;
+ if (list4.length === 0) {
+ return bogusState;
+ }
+ return handleConstruct(list4[constructIndex]);
+ }
+ function handleConstruct(construct) {
+ return start;
+ function start(code3) {
+ info = store();
+ currentConstruct = construct;
+ if (!construct.partial) {
+ context.currentConstruct = construct;
+ }
+ if (construct.name && context.parser.constructs.disable.null.includes(construct.name)) {
+ return nok(code3);
+ }
+ return construct.tokenize.call(
+ // If we do have fields, create an object w/ `context` as its
+ // prototype.
+ // This allows a “live binding”, which is needed for `interrupt`.
+ fields ? Object.assign(Object.create(context), fields) : context,
+ effects,
+ ok3,
+ nok
+ )(code3);
+ }
+ }
+ function ok3(code3) {
+ consumed = true;
+ onreturn(currentConstruct, info);
+ return returnState;
+ }
+ function nok(code3) {
+ consumed = true;
+ info.restore();
+ if (++constructIndex < listOfConstructs.length) {
+ return handleConstruct(listOfConstructs[constructIndex]);
+ }
+ return bogusState;
+ }
+ }
+ }
+ function addResult(construct, from2) {
+ if (construct.resolveAll && !resolveAllConstructs.includes(construct)) {
+ resolveAllConstructs.push(construct);
+ }
+ if (construct.resolve) {
+ splice(
+ context.events,
+ from2,
+ context.events.length - from2,
+ construct.resolve(context.events.slice(from2), context)
+ );
+ }
+ if (construct.resolveTo) {
+ context.events = construct.resolveTo(context.events, context);
+ }
+ }
+ function store() {
+ const startPoint = now();
+ const startPrevious = context.previous;
+ const startCurrentConstruct = context.currentConstruct;
+ const startEventsIndex = context.events.length;
+ const startStack = Array.from(stack);
+ return {
+ restore,
+ from: startEventsIndex
+ };
+ function restore() {
+ point3 = startPoint;
+ context.previous = startPrevious;
+ context.currentConstruct = startCurrentConstruct;
+ context.events.length = startEventsIndex;
+ stack = startStack;
+ accountForPotentialSkip();
+ }
+ }
+ function accountForPotentialSkip() {
+ if (point3.line in columnStart && point3.column < 2) {
+ point3.column = columnStart[point3.line];
+ point3.offset += columnStart[point3.line] - 1;
+ }
+ }
+ }
+ function sliceChunks(chunks, token) {
+ const startIndex = token.start._index;
+ const startBufferIndex = token.start._bufferIndex;
+ const endIndex = token.end._index;
+ const endBufferIndex = token.end._bufferIndex;
+ let view;
+ if (startIndex === endIndex) {
+ view = [chunks[startIndex].slice(startBufferIndex, endBufferIndex)];
+ } else {
+ view = chunks.slice(startIndex, endIndex);
+ if (startBufferIndex > -1) {
+ const head = view[0];
+ if (typeof head === "string") {
+ view[0] = head.slice(startBufferIndex);
+ } else {
+ view.shift();
+ }
+ }
+ if (endBufferIndex > 0) {
+ view.push(chunks[endIndex].slice(0, endBufferIndex));
+ }
+ }
+ return view;
+ }
+ function serializeChunks(chunks, expandTabs) {
+ let index2 = -1;
+ const result = [];
+ let atTab;
+ while (++index2 < chunks.length) {
+ const chunk = chunks[index2];
+ let value;
+ if (typeof chunk === "string") {
+ value = chunk;
+ } else
+ switch (chunk) {
+ case -5: {
+ value = "\r";
+ break;
+ }
+ case -4: {
+ value = "\n";
+ break;
+ }
+ case -3: {
+ value = "\r\n";
+ break;
+ }
+ case -2: {
+ value = expandTabs ? " " : " ";
+ break;
+ }
+ case -1: {
+ if (!expandTabs && atTab) continue;
+ value = " ";
+ break;
+ }
+ default: {
+ value = String.fromCharCode(chunk);
+ }
+ }
+ atTab = chunk === -2;
+ result.push(value);
+ }
+ return result.join("");
+ }
+
+ // node_modules/micromark/lib/constructs.js
+ var constructs_exports = {};
+ __export(constructs_exports, {
+ attentionMarkers: () => attentionMarkers,
+ contentInitial: () => contentInitial,
+ disable: () => disable,
+ document: () => document3,
+ flow: () => flow2,
+ flowInitial: () => flowInitial,
+ insideSpan: () => insideSpan,
+ string: () => string2,
+ text: () => text2
+ });
+ var document3 = {
+ [42]: list,
+ [43]: list,
+ [45]: list,
+ [48]: list,
+ [49]: list,
+ [50]: list,
+ [51]: list,
+ [52]: list,
+ [53]: list,
+ [54]: list,
+ [55]: list,
+ [56]: list,
+ [57]: list,
+ [62]: blockQuote
+ };
+ var contentInitial = {
+ [91]: definition
+ };
+ var flowInitial = {
+ [-2]: codeIndented,
+ [-1]: codeIndented,
+ [32]: codeIndented
+ };
+ var flow2 = {
+ [35]: headingAtx,
+ [42]: thematicBreak,
+ [45]: [setextUnderline, thematicBreak],
+ [60]: htmlFlow,
+ [61]: setextUnderline,
+ [95]: thematicBreak,
+ [96]: codeFenced,
+ [126]: codeFenced
+ };
+ var string2 = {
+ [38]: characterReference,
+ [92]: characterEscape
+ };
+ var text2 = {
+ [-5]: lineEnding,
+ [-4]: lineEnding,
+ [-3]: lineEnding,
+ [33]: labelStartImage,
+ [38]: characterReference,
+ [42]: attention,
+ [60]: [autolink, htmlText],
+ [91]: labelStartLink,
+ [92]: [hardBreakEscape, characterEscape],
+ [93]: labelEnd,
+ [95]: attention,
+ [96]: codeText
+ };
+ var insideSpan = {
+ null: [attention, resolver]
+ };
+ var attentionMarkers = {
+ null: [42, 95]
+ };
+ var disable = {
+ null: []
+ };
+
+ // node_modules/micromark/lib/parse.js
+ function parse(options2) {
+ const settings = options2 || {};
+ const constructs2 = (
+ /** @type {FullNormalizedExtension} */
+ combineExtensions([constructs_exports, ...settings.extensions || []])
+ );
+ const parser = {
+ defined: [],
+ lazy: {},
+ constructs: constructs2,
+ content: create(content),
+ document: create(document2),
+ flow: create(flow),
+ string: create(string),
+ text: create(text)
+ };
+ return parser;
+ function create(initial) {
+ return creator;
+ function creator(from) {
+ return createTokenizer(parser, initial, from);
+ }
+ }
+ }
+
+ // node_modules/micromark/lib/postprocess.js
+ function postprocess(events) {
+ while (!subtokenize(events)) {
+ }
+ return events;
+ }
+
+ // node_modules/micromark/lib/preprocess.js
+ var search = /[\0\t\n\r]/g;
+ function preprocess() {
+ let column = 1;
+ let buffer = "";
+ let start = true;
+ let atCarriageReturn;
+ return preprocessor;
+ function preprocessor(value, encoding, end) {
+ const chunks = [];
+ let match;
+ let next;
+ let startPosition;
+ let endPosition;
+ let code3;
+ value = buffer + (typeof value === "string" ? value.toString() : new TextDecoder(encoding || void 0).decode(value));
+ startPosition = 0;
+ buffer = "";
+ if (start) {
+ if (value.charCodeAt(0) === 65279) {
+ startPosition++;
+ }
+ start = void 0;
+ }
+ while (startPosition < value.length) {
+ search.lastIndex = startPosition;
+ match = search.exec(value);
+ endPosition = match && match.index !== void 0 ? match.index : value.length;
+ code3 = value.charCodeAt(endPosition);
+ if (!match) {
+ buffer = value.slice(startPosition);
+ break;
+ }
+ if (code3 === 10 && startPosition === endPosition && atCarriageReturn) {
+ chunks.push(-3);
+ atCarriageReturn = void 0;
+ } else {
+ if (atCarriageReturn) {
+ chunks.push(-5);
+ atCarriageReturn = void 0;
+ }
+ if (startPosition < endPosition) {
+ chunks.push(value.slice(startPosition, endPosition));
+ column += endPosition - startPosition;
+ }
+ switch (code3) {
+ case 0: {
+ chunks.push(65533);
+ column++;
+ break;
+ }
+ case 9: {
+ next = Math.ceil(column / 4) * 4;
+ chunks.push(-2);
+ while (column++ < next) chunks.push(-1);
+ break;
+ }
+ case 10: {
+ chunks.push(-4);
+ column = 1;
+ break;
+ }
+ default: {
+ atCarriageReturn = true;
+ column = 1;
+ }
+ }
+ }
+ startPosition = endPosition + 1;
+ }
+ if (end) {
+ if (atCarriageReturn) chunks.push(-5);
+ if (buffer) chunks.push(buffer);
+ chunks.push(null);
+ }
+ return chunks;
+ }
+ }
+
+ // node_modules/micromark-util-decode-string/index.js
+ var characterEscapeOrReference = /\\([!-/:-@[-`{-~])|&(#(?:\d{1,7}|x[\da-f]{1,6})|[\da-z]{1,31});/gi;
+ function decodeString(value) {
+ return value.replace(characterEscapeOrReference, decode);
+ }
+ function decode($0, $1, $22) {
+ if ($1) {
+ return $1;
+ }
+ const head = $22.charCodeAt(0);
+ if (head === 35) {
+ const head2 = $22.charCodeAt(1);
+ const hex = head2 === 120 || head2 === 88;
+ return decodeNumericCharacterReference($22.slice(hex ? 2 : 1), hex ? 16 : 10);
+ }
+ return decodeNamedCharacterReference($22) || $0;
+ }
+
+ // node_modules/unist-util-stringify-position/lib/index.js
+ function stringifyPosition(value) {
+ if (!value || typeof value !== "object") {
+ return "";
+ }
+ if ("position" in value || "type" in value) {
+ return position(value.position);
+ }
+ if ("start" in value || "end" in value) {
+ return position(value);
+ }
+ if ("line" in value || "column" in value) {
+ return point(value);
+ }
+ return "";
+ }
+ function point(point3) {
+ return index(point3 && point3.line) + ":" + index(point3 && point3.column);
+ }
+ function position(pos) {
+ return point(pos && pos.start) + "-" + point(pos && pos.end);
+ }
+ function index(value) {
+ return value && typeof value === "number" ? value : 1;
+ }
+
+ // node_modules/mdast-util-from-markdown/lib/index.js
+ var own = {}.hasOwnProperty;
+ function fromMarkdown(value, encoding, options2) {
+ if (typeof encoding !== "string") {
+ options2 = encoding;
+ encoding = void 0;
+ }
+ return compiler(options2)(
+ postprocess(
+ parse(options2).document().write(preprocess()(value, encoding, true))
+ )
+ );
+ }
+ function compiler(options2) {
+ const config = {
+ transforms: [],
+ canContainEols: ["emphasis", "fragment", "heading", "paragraph", "strong"],
+ enter: {
+ autolink: opener(link2),
+ autolinkProtocol: onenterdata,
+ autolinkEmail: onenterdata,
+ atxHeading: opener(heading2),
+ blockQuote: opener(blockQuote2),
+ characterEscape: onenterdata,
+ characterReference: onenterdata,
+ codeFenced: opener(codeFlow),
+ codeFencedFenceInfo: buffer,
+ codeFencedFenceMeta: buffer,
+ codeIndented: opener(codeFlow, buffer),
+ codeText: opener(codeText2, buffer),
+ codeTextData: onenterdata,
+ data: onenterdata,
+ codeFlowValue: onenterdata,
+ definition: opener(definition3),
+ definitionDestinationString: buffer,
+ definitionLabelString: buffer,
+ definitionTitleString: buffer,
+ emphasis: opener(emphasis2),
+ hardBreakEscape: opener(hardBreak2),
+ hardBreakTrailing: opener(hardBreak2),
+ htmlFlow: opener(html3, buffer),
+ htmlFlowData: onenterdata,
+ htmlText: opener(html3, buffer),
+ htmlTextData: onenterdata,
+ image: opener(image2),
+ label: buffer,
+ link: opener(link2),
+ listItem: opener(listItem2),
+ listItemValue: onenterlistitemvalue,
+ listOrdered: opener(list4, onenterlistordered),
+ listUnordered: opener(list4),
+ paragraph: opener(paragraph2),
+ reference: onenterreference,
+ referenceString: buffer,
+ resourceDestinationString: buffer,
+ resourceTitleString: buffer,
+ setextHeading: opener(heading2),
+ strong: opener(strong2),
+ thematicBreak: opener(thematicBreak3)
+ },
+ exit: {
+ atxHeading: closer(),
+ atxHeadingSequence: onexitatxheadingsequence,
+ autolink: closer(),
+ autolinkEmail: onexitautolinkemail,
+ autolinkProtocol: onexitautolinkprotocol,
+ blockQuote: closer(),
+ characterEscapeValue: onexitdata,
+ characterReferenceMarkerHexadecimal: onexitcharacterreferencemarker,
+ characterReferenceMarkerNumeric: onexitcharacterreferencemarker,
+ characterReferenceValue: onexitcharacterreferencevalue,
+ codeFenced: closer(onexitcodefenced),
+ codeFencedFence: onexitcodefencedfence,
+ codeFencedFenceInfo: onexitcodefencedfenceinfo,
+ codeFencedFenceMeta: onexitcodefencedfencemeta,
+ codeFlowValue: onexitdata,
+ codeIndented: closer(onexitcodeindented),
+ codeText: closer(onexitcodetext),
+ codeTextData: onexitdata,
+ data: onexitdata,
+ definition: closer(),
+ definitionDestinationString: onexitdefinitiondestinationstring,
+ definitionLabelString: onexitdefinitionlabelstring,
+ definitionTitleString: onexitdefinitiontitlestring,
+ emphasis: closer(),
+ hardBreakEscape: closer(onexithardbreak),
+ hardBreakTrailing: closer(onexithardbreak),
+ htmlFlow: closer(onexithtmlflow),
+ htmlFlowData: onexitdata,
+ htmlText: closer(onexithtmltext),
+ htmlTextData: onexitdata,
+ image: closer(onexitimage),
+ label: onexitlabel,
+ labelText: onexitlabeltext,
+ lineEnding: onexitlineending,
+ link: closer(onexitlink),
+ listItem: closer(),
+ listOrdered: closer(),
+ listUnordered: closer(),
+ paragraph: closer(),
+ referenceString: onexitreferencestring,
+ resourceDestinationString: onexitresourcedestinationstring,
+ resourceTitleString: onexitresourcetitlestring,
+ resource: onexitresource,
+ setextHeading: closer(onexitsetextheading),
+ setextHeadingLineSequence: onexitsetextheadinglinesequence,
+ setextHeadingText: onexitsetextheadingtext,
+ strong: closer(),
+ thematicBreak: closer()
+ }
+ };
+ configure(config, (options2 || {}).mdastExtensions || []);
+ const data = {};
+ return compile;
+ function compile(events) {
+ let tree = {
+ type: "root",
+ children: []
+ };
+ const context = {
+ stack: [tree],
+ tokenStack: [],
+ config,
+ enter,
+ exit: exit3,
+ buffer,
+ resume,
+ data
+ };
+ const listStack = [];
+ let index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][1].type === "listOrdered" || events[index2][1].type === "listUnordered") {
+ if (events[index2][0] === "enter") {
+ listStack.push(index2);
+ } else {
+ const tail = listStack.pop();
+ index2 = prepareList(events, tail, index2);
+ }
+ }
+ }
+ index2 = -1;
+ while (++index2 < events.length) {
+ const handler = config[events[index2][0]];
+ if (own.call(handler, events[index2][1].type)) {
+ handler[events[index2][1].type].call(
+ Object.assign(
+ {
+ sliceSerialize: events[index2][2].sliceSerialize
+ },
+ context
+ ),
+ events[index2][1]
+ );
+ }
+ }
+ if (context.tokenStack.length > 0) {
+ const tail = context.tokenStack[context.tokenStack.length - 1];
+ const handler = tail[1] || defaultOnError;
+ handler.call(context, void 0, tail[0]);
+ }
+ tree.position = {
+ start: point2(
+ events.length > 0 ? events[0][1].start : {
+ line: 1,
+ column: 1,
+ offset: 0
+ }
+ ),
+ end: point2(
+ events.length > 0 ? events[events.length - 2][1].end : {
+ line: 1,
+ column: 1,
+ offset: 0
+ }
+ )
+ };
+ index2 = -1;
+ while (++index2 < config.transforms.length) {
+ tree = config.transforms[index2](tree) || tree;
+ }
+ return tree;
+ }
+ function prepareList(events, start, length) {
+ let index2 = start - 1;
+ let containerBalance = -1;
+ let listSpread = false;
+ let listItem3;
+ let lineIndex;
+ let firstBlankLineIndex;
+ let atMarker;
+ while (++index2 <= length) {
+ const event = events[index2];
+ switch (event[1].type) {
+ case "listUnordered":
+ case "listOrdered":
+ case "blockQuote": {
+ if (event[0] === "enter") {
+ containerBalance++;
+ } else {
+ containerBalance--;
+ }
+ atMarker = void 0;
+ break;
+ }
+ case "lineEndingBlank": {
+ if (event[0] === "enter") {
+ if (listItem3 && !atMarker && !containerBalance && !firstBlankLineIndex) {
+ firstBlankLineIndex = index2;
+ }
+ atMarker = void 0;
+ }
+ break;
+ }
+ case "linePrefix":
+ case "listItemValue":
+ case "listItemMarker":
+ case "listItemPrefix":
+ case "listItemPrefixWhitespace": {
+ break;
+ }
+ default: {
+ atMarker = void 0;
+ }
+ }
+ if (!containerBalance && event[0] === "enter" && event[1].type === "listItemPrefix" || containerBalance === -1 && event[0] === "exit" && (event[1].type === "listUnordered" || event[1].type === "listOrdered")) {
+ if (listItem3) {
+ let tailIndex = index2;
+ lineIndex = void 0;
+ while (tailIndex--) {
+ const tailEvent = events[tailIndex];
+ if (tailEvent[1].type === "lineEnding" || tailEvent[1].type === "lineEndingBlank") {
+ if (tailEvent[0] === "exit") continue;
+ if (lineIndex) {
+ events[lineIndex][1].type = "lineEndingBlank";
+ listSpread = true;
+ }
+ tailEvent[1].type = "lineEnding";
+ lineIndex = tailIndex;
+ } else if (tailEvent[1].type === "linePrefix" || tailEvent[1].type === "blockQuotePrefix" || tailEvent[1].type === "blockQuotePrefixWhitespace" || tailEvent[1].type === "blockQuoteMarker" || tailEvent[1].type === "listItemIndent") {
+ } else {
+ break;
+ }
+ }
+ if (firstBlankLineIndex && (!lineIndex || firstBlankLineIndex < lineIndex)) {
+ listItem3._spread = true;
+ }
+ listItem3.end = Object.assign(
+ {},
+ lineIndex ? events[lineIndex][1].start : event[1].end
+ );
+ events.splice(lineIndex || index2, 0, ["exit", listItem3, event[2]]);
+ index2++;
+ length++;
+ }
+ if (event[1].type === "listItemPrefix") {
+ const item = {
+ type: "listItem",
+ _spread: false,
+ start: Object.assign({}, event[1].start),
+ // @ts-expect-error: we’ll add `end` in a second.
+ end: void 0
+ };
+ listItem3 = item;
+ events.splice(index2, 0, ["enter", item, event[2]]);
+ index2++;
+ length++;
+ firstBlankLineIndex = void 0;
+ atMarker = true;
+ }
+ }
+ }
+ events[start][1]._spread = listSpread;
+ return length;
+ }
+ function opener(create, and) {
+ return open;
+ function open(token) {
+ enter.call(this, create(token), token);
+ if (and) and.call(this, token);
+ }
+ }
+ function buffer() {
+ this.stack.push({
+ type: "fragment",
+ children: []
+ });
+ }
+ function enter(node2, token, errorHandler) {
+ const parent = this.stack[this.stack.length - 1];
+ const siblings = parent.children;
+ siblings.push(node2);
+ this.stack.push(node2);
+ this.tokenStack.push([token, errorHandler]);
+ node2.position = {
+ start: point2(token.start),
+ // @ts-expect-error: `end` will be patched later.
+ end: void 0
+ };
+ }
+ function closer(and) {
+ return close2;
+ function close2(token) {
+ if (and) and.call(this, token);
+ exit3.call(this, token);
+ }
+ }
+ function exit3(token, onExitError) {
+ const node2 = this.stack.pop();
+ const open = this.tokenStack.pop();
+ if (!open) {
+ throw new Error(
+ "Cannot close `" + token.type + "` (" + stringifyPosition({
+ start: token.start,
+ end: token.end
+ }) + "): it\u2019s not open"
+ );
+ } else if (open[0].type !== token.type) {
+ if (onExitError) {
+ onExitError.call(this, token, open[0]);
+ } else {
+ const handler = open[1] || defaultOnError;
+ handler.call(this, token, open[0]);
+ }
+ }
+ node2.position.end = point2(token.end);
+ }
+ function resume() {
+ return toString(this.stack.pop());
+ }
+ function onenterlistordered() {
+ this.data.expectingFirstListItemValue = true;
+ }
+ function onenterlistitemvalue(token) {
+ if (this.data.expectingFirstListItemValue) {
+ const ancestor = this.stack[this.stack.length - 2];
+ ancestor.start = Number.parseInt(this.sliceSerialize(token), 10);
+ this.data.expectingFirstListItemValue = void 0;
+ }
+ }
+ function onexitcodefencedfenceinfo() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.lang = data2;
+ }
+ function onexitcodefencedfencemeta() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.meta = data2;
+ }
+ function onexitcodefencedfence() {
+ if (this.data.flowCodeInside) return;
+ this.buffer();
+ this.data.flowCodeInside = true;
+ }
+ function onexitcodefenced() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data2.replace(/^(\r?\n|\r)|(\r?\n|\r)$/g, "");
+ this.data.flowCodeInside = void 0;
+ }
+ function onexitcodeindented() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data2.replace(/(\r?\n|\r)$/g, "");
+ }
+ function onexitdefinitionlabelstring(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.label = label;
+ node2.identifier = normalizeIdentifier(
+ this.sliceSerialize(token)
+ ).toLowerCase();
+ }
+ function onexitdefinitiontitlestring() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.title = data2;
+ }
+ function onexitdefinitiondestinationstring() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = data2;
+ }
+ function onexitatxheadingsequence(token) {
+ const node2 = this.stack[this.stack.length - 1];
+ if (!node2.depth) {
+ const depth = this.sliceSerialize(token).length;
+ node2.depth = depth;
+ }
+ }
+ function onexitsetextheadingtext() {
+ this.data.setextHeadingSlurpLineEnding = true;
+ }
+ function onexitsetextheadinglinesequence(token) {
+ const node2 = this.stack[this.stack.length - 1];
+ node2.depth = this.sliceSerialize(token).codePointAt(0) === 61 ? 1 : 2;
+ }
+ function onexitsetextheading() {
+ this.data.setextHeadingSlurpLineEnding = void 0;
+ }
+ function onenterdata(token) {
+ const node2 = this.stack[this.stack.length - 1];
+ const siblings = node2.children;
+ let tail = siblings[siblings.length - 1];
+ if (!tail || tail.type !== "text") {
+ tail = text5();
+ tail.position = {
+ start: point2(token.start),
+ // @ts-expect-error: we’ll add `end` later.
+ end: void 0
+ };
+ siblings.push(tail);
+ }
+ this.stack.push(tail);
+ }
+ function onexitdata(token) {
+ const tail = this.stack.pop();
+ tail.value += this.sliceSerialize(token);
+ tail.position.end = point2(token.end);
+ }
+ function onexitlineending(token) {
+ const context = this.stack[this.stack.length - 1];
+ if (this.data.atHardBreak) {
+ const tail = context.children[context.children.length - 1];
+ tail.position.end = point2(token.end);
+ this.data.atHardBreak = void 0;
+ return;
+ }
+ if (!this.data.setextHeadingSlurpLineEnding && config.canContainEols.includes(context.type)) {
+ onenterdata.call(this, token);
+ onexitdata.call(this, token);
+ }
+ }
+ function onexithardbreak() {
+ this.data.atHardBreak = true;
+ }
+ function onexithtmlflow() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data2;
+ }
+ function onexithtmltext() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data2;
+ }
+ function onexitcodetext() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data2;
+ }
+ function onexitlink() {
+ const node2 = this.stack[this.stack.length - 1];
+ if (this.data.inReference) {
+ const referenceType = this.data.referenceType || "shortcut";
+ node2.type += "Reference";
+ node2.referenceType = referenceType;
+ delete node2.url;
+ delete node2.title;
+ } else {
+ delete node2.identifier;
+ delete node2.label;
+ }
+ this.data.referenceType = void 0;
+ }
+ function onexitimage() {
+ const node2 = this.stack[this.stack.length - 1];
+ if (this.data.inReference) {
+ const referenceType = this.data.referenceType || "shortcut";
+ node2.type += "Reference";
+ node2.referenceType = referenceType;
+ delete node2.url;
+ delete node2.title;
+ } else {
+ delete node2.identifier;
+ delete node2.label;
+ }
+ this.data.referenceType = void 0;
+ }
+ function onexitlabeltext(token) {
+ const string3 = this.sliceSerialize(token);
+ const ancestor = this.stack[this.stack.length - 2];
+ ancestor.label = decodeString(string3);
+ ancestor.identifier = normalizeIdentifier(string3).toLowerCase();
+ }
+ function onexitlabel() {
+ const fragment = this.stack[this.stack.length - 1];
+ const value = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ this.data.inReference = true;
+ if (node2.type === "link") {
+ const children = fragment.children;
+ node2.children = children;
+ } else {
+ node2.alt = value;
+ }
+ }
+ function onexitresourcedestinationstring() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = data2;
+ }
+ function onexitresourcetitlestring() {
+ const data2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.title = data2;
+ }
+ function onexitresource() {
+ this.data.inReference = void 0;
+ }
+ function onenterreference() {
+ this.data.referenceType = "collapsed";
+ }
+ function onexitreferencestring(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.label = label;
+ node2.identifier = normalizeIdentifier(
+ this.sliceSerialize(token)
+ ).toLowerCase();
+ this.data.referenceType = "full";
+ }
+ function onexitcharacterreferencemarker(token) {
+ this.data.characterReferenceType = token.type;
+ }
+ function onexitcharacterreferencevalue(token) {
+ const data2 = this.sliceSerialize(token);
+ const type = this.data.characterReferenceType;
+ let value;
+ if (type) {
+ value = decodeNumericCharacterReference(
+ data2,
+ type === "characterReferenceMarkerNumeric" ? 10 : 16
+ );
+ this.data.characterReferenceType = void 0;
+ } else {
+ const result = decodeNamedCharacterReference(data2);
+ value = result;
+ }
+ const tail = this.stack.pop();
+ tail.value += value;
+ tail.position.end = point2(token.end);
+ }
+ function onexitautolinkprotocol(token) {
+ onexitdata.call(this, token);
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = this.sliceSerialize(token);
+ }
+ function onexitautolinkemail(token) {
+ onexitdata.call(this, token);
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = "mailto:" + this.sliceSerialize(token);
+ }
+ function blockQuote2() {
+ return {
+ type: "blockquote",
+ children: []
+ };
+ }
+ function codeFlow() {
+ return {
+ type: "code",
+ lang: null,
+ meta: null,
+ value: ""
+ };
+ }
+ function codeText2() {
+ return {
+ type: "inlineCode",
+ value: ""
+ };
+ }
+ function definition3() {
+ return {
+ type: "definition",
+ identifier: "",
+ label: null,
+ title: null,
+ url: ""
+ };
+ }
+ function emphasis2() {
+ return {
+ type: "emphasis",
+ children: []
+ };
+ }
+ function heading2() {
+ return {
+ type: "heading",
+ // @ts-expect-error `depth` will be set later.
+ depth: 0,
+ children: []
+ };
+ }
+ function hardBreak2() {
+ return {
+ type: "break"
+ };
+ }
+ function html3() {
+ return {
+ type: "html",
+ value: ""
+ };
+ }
+ function image2() {
+ return {
+ type: "image",
+ title: null,
+ url: "",
+ alt: null
+ };
+ }
+ function link2() {
+ return {
+ type: "link",
+ title: null,
+ url: "",
+ children: []
+ };
+ }
+ function list4(token) {
+ return {
+ type: "list",
+ ordered: token.type === "listOrdered",
+ start: null,
+ spread: token._spread,
+ children: []
+ };
+ }
+ function listItem2(token) {
+ return {
+ type: "listItem",
+ spread: token._spread,
+ checked: null,
+ children: []
+ };
+ }
+ function paragraph2() {
+ return {
+ type: "paragraph",
+ children: []
+ };
+ }
+ function strong2() {
+ return {
+ type: "strong",
+ children: []
+ };
+ }
+ function text5() {
+ return {
+ type: "text",
+ value: ""
+ };
+ }
+ function thematicBreak3() {
+ return {
+ type: "thematicBreak"
+ };
+ }
+ }
+ function point2(d6) {
+ return {
+ line: d6.line,
+ column: d6.column,
+ offset: d6.offset
+ };
+ }
+ function configure(combined, extensions) {
+ let index2 = -1;
+ while (++index2 < extensions.length) {
+ const value = extensions[index2];
+ if (Array.isArray(value)) {
+ configure(combined, value);
+ } else {
+ extension(combined, value);
+ }
+ }
+ }
+ function extension(combined, extension2) {
+ let key;
+ for (key in extension2) {
+ if (own.call(extension2, key)) {
+ switch (key) {
+ case "canContainEols": {
+ const right = extension2[key];
+ if (right) {
+ combined[key].push(...right);
+ }
+ break;
+ }
+ case "transforms": {
+ const right = extension2[key];
+ if (right) {
+ combined[key].push(...right);
+ }
+ break;
+ }
+ case "enter":
+ case "exit": {
+ const right = extension2[key];
+ if (right) {
+ Object.assign(combined[key], right);
+ }
+ break;
+ }
+ }
+ }
+ }
+ }
+ function defaultOnError(left, right) {
+ if (left) {
+ throw new Error(
+ "Cannot close `" + left.type + "` (" + stringifyPosition({
+ start: left.start,
+ end: left.end
+ }) + "): a different token (`" + right.type + "`, " + stringifyPosition({
+ start: right.start,
+ end: right.end
+ }) + ") is open"
+ );
+ } else {
+ throw new Error(
+ "Cannot close document, a token (`" + right.type + "`, " + stringifyPosition({
+ start: right.start,
+ end: right.end
+ }) + ") is still open"
+ );
+ }
+ }
+
+ // node_modules/remark-parse/lib/index.js
+ function remarkParse(options2) {
+ const self2 = this;
+ self2.parser = parser;
+ function parser(doc4) {
+ return fromMarkdown(doc4, __spreadProps(__spreadValues(__spreadValues({}, self2.data("settings")), options2), {
+ // Note: these options are not in the readme.
+ // The goal is for them to be set by plugins on `data` instead of being
+ // passed by users.
+ extensions: self2.data("micromarkExtensions") || [],
+ mdastExtensions: self2.data("fromMarkdownExtensions") || []
+ }));
+ }
+ }
+
+ // node_modules/zwitch/index.js
+ var own2 = {}.hasOwnProperty;
+ function zwitch(key, options2) {
+ const settings = options2 || {};
+ function one2(value, ...parameters) {
+ let fn = one2.invalid;
+ const handlers2 = one2.handlers;
+ if (value && own2.call(value, key)) {
+ const id = String(value[key]);
+ fn = own2.call(handlers2, id) ? handlers2[id] : one2.unknown;
+ }
+ if (fn) {
+ return fn.call(this, value, ...parameters);
+ }
+ }
+ one2.handlers = settings.handlers || {};
+ one2.invalid = settings.invalid;
+ one2.unknown = settings.unknown;
+ return one2;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/configure.js
+ var own3 = {}.hasOwnProperty;
+ function configure2(base2, extension2) {
+ let index2 = -1;
+ let key;
+ if (extension2.extensions) {
+ while (++index2 < extension2.extensions.length) {
+ configure2(base2, extension2.extensions[index2]);
+ }
+ }
+ for (key in extension2) {
+ if (own3.call(extension2, key)) {
+ switch (key) {
+ case "extensions": {
+ break;
+ }
+ case "unsafe": {
+ list2(base2[key], extension2[key]);
+ break;
+ }
+ case "join": {
+ list2(base2[key], extension2[key]);
+ break;
+ }
+ case "handlers": {
+ map(base2[key], extension2[key]);
+ break;
+ }
+ default: {
+ base2.options[key] = extension2[key];
+ }
+ }
+ }
+ }
+ return base2;
+ }
+ function list2(left, right) {
+ if (right) {
+ left.push(...right);
+ }
+ }
+ function map(left, right) {
+ if (right) {
+ Object.assign(left, right);
+ }
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/blockquote.js
+ function blockquote(node2, _3, state, info) {
+ const exit3 = state.enter("blockquote");
+ const tracker = state.createTracker(info);
+ tracker.move("> ");
+ tracker.shift(2);
+ const value = state.indentLines(
+ state.containerFlow(node2, tracker.current()),
+ map2
+ );
+ exit3();
+ return value;
+ }
+ function map2(line, _3, blank) {
+ return ">" + (blank ? "" : " ") + line;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/pattern-in-scope.js
+ function patternInScope(stack, pattern) {
+ return listInScope(stack, pattern.inConstruct, true) && !listInScope(stack, pattern.notInConstruct, false);
+ }
+ function listInScope(stack, list4, none2) {
+ if (typeof list4 === "string") {
+ list4 = [list4];
+ }
+ if (!list4 || list4.length === 0) {
+ return none2;
+ }
+ let index2 = -1;
+ while (++index2 < list4.length) {
+ if (stack.includes(list4[index2])) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/break.js
+ function hardBreak(_3, _1, state, info) {
+ let index2 = -1;
+ while (++index2 < state.unsafe.length) {
+ if (state.unsafe[index2].character === "\n" && patternInScope(state.stack, state.unsafe[index2])) {
+ return /[ \t]/.test(info.before) ? "" : " ";
+ }
+ }
+ return "\\\n";
+ }
+
+ // node_modules/longest-streak/index.js
+ function longestStreak(value, substring) {
+ const source = String(value);
+ let index2 = source.indexOf(substring);
+ let expected = index2;
+ let count = 0;
+ let max = 0;
+ if (typeof substring !== "string") {
+ throw new TypeError("Expected substring");
+ }
+ while (index2 !== -1) {
+ if (index2 === expected) {
+ if (++count > max) {
+ max = count;
+ }
+ } else {
+ count = 1;
+ }
+ expected = index2 + substring.length;
+ index2 = source.indexOf(substring, expected);
+ }
+ return max;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/format-code-as-indented.js
+ function formatCodeAsIndented(node2, state) {
+ return Boolean(
+ state.options.fences === false && node2.value && // If there’s no info…
+ !node2.lang && // And there’s a non-whitespace character…
+ /[^ \r\n]/.test(node2.value) && // And the value doesn’t start or end in a blank…
+ !/^[\t ]*(?:[\r\n]|$)|(?:^|[\r\n])[\t ]*$/.test(node2.value)
+ );
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-fence.js
+ function checkFence(state) {
+ const marker = state.options.fence || "`";
+ if (marker !== "`" && marker !== "~") {
+ throw new Error(
+ "Cannot serialize code with `" + marker + "` for `options.fence`, expected `` ` `` or `~`"
+ );
+ }
+ return marker;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/code.js
+ function code(node2, _3, state, info) {
+ const marker = checkFence(state);
+ const raw = node2.value || "";
+ const suffix = marker === "`" ? "GraveAccent" : "Tilde";
+ if (formatCodeAsIndented(node2, state)) {
+ const exit4 = state.enter("codeIndented");
+ const value2 = state.indentLines(raw, map3);
+ exit4();
+ return value2;
+ }
+ const tracker = state.createTracker(info);
+ const sequence = marker.repeat(Math.max(longestStreak(raw, marker) + 1, 3));
+ const exit3 = state.enter("codeFenced");
+ let value = tracker.move(sequence);
+ if (node2.lang) {
+ const subexit = state.enter(`codeFencedLang${suffix}`);
+ value += tracker.move(
+ state.safe(node2.lang, __spreadValues({
+ before: value,
+ after: " ",
+ encode: ["`"]
+ }, tracker.current()))
+ );
+ subexit();
+ }
+ if (node2.lang && node2.meta) {
+ const subexit = state.enter(`codeFencedMeta${suffix}`);
+ value += tracker.move(" ");
+ value += tracker.move(
+ state.safe(node2.meta, __spreadValues({
+ before: value,
+ after: "\n",
+ encode: ["`"]
+ }, tracker.current()))
+ );
+ subexit();
+ }
+ value += tracker.move("\n");
+ if (raw) {
+ value += tracker.move(raw + "\n");
+ }
+ value += tracker.move(sequence);
+ exit3();
+ return value;
+ }
+ function map3(line, _3, blank) {
+ return (blank ? "" : " ") + line;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-quote.js
+ function checkQuote(state) {
+ const marker = state.options.quote || '"';
+ if (marker !== '"' && marker !== "'") {
+ throw new Error(
+ "Cannot serialize title with `" + marker + "` for `options.quote`, expected `\"`, or `'`"
+ );
+ }
+ return marker;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/definition.js
+ function definition2(node2, _3, state, info) {
+ const quote = checkQuote(state);
+ const suffix = quote === '"' ? "Quote" : "Apostrophe";
+ const exit3 = state.enter("definition");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value = tracker.move("[");
+ value += tracker.move(
+ state.safe(state.associationId(node2), __spreadValues({
+ before: value,
+ after: "]"
+ }, tracker.current()))
+ );
+ value += tracker.move("]: ");
+ subexit();
+ if (
+ // If there’s no url, or…
+ !node2.url || // If there are control characters or whitespace.
+ /[\0- \u007F]/.test(node2.url)
+ ) {
+ subexit = state.enter("destinationLiteral");
+ value += tracker.move("<");
+ value += tracker.move(
+ state.safe(node2.url, __spreadValues({ before: value, after: ">" }, tracker.current()))
+ );
+ value += tracker.move(">");
+ } else {
+ subexit = state.enter("destinationRaw");
+ value += tracker.move(
+ state.safe(node2.url, __spreadValues({
+ before: value,
+ after: node2.title ? " " : "\n"
+ }, tracker.current()))
+ );
+ }
+ subexit();
+ if (node2.title) {
+ subexit = state.enter(`title${suffix}`);
+ value += tracker.move(" " + quote);
+ value += tracker.move(
+ state.safe(node2.title, __spreadValues({
+ before: value,
+ after: quote
+ }, tracker.current()))
+ );
+ value += tracker.move(quote);
+ subexit();
+ }
+ exit3();
+ return value;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-emphasis.js
+ function checkEmphasis(state) {
+ const marker = state.options.emphasis || "*";
+ if (marker !== "*" && marker !== "_") {
+ throw new Error(
+ "Cannot serialize emphasis with `" + marker + "` for `options.emphasis`, expected `*`, or `_`"
+ );
+ }
+ return marker;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/emphasis.js
+ emphasis.peek = emphasisPeek;
+ function emphasis(node2, _3, state, info) {
+ const marker = checkEmphasis(state);
+ const exit3 = state.enter("emphasis");
+ const tracker = state.createTracker(info);
+ let value = tracker.move(marker);
+ value += tracker.move(
+ state.containerPhrasing(node2, __spreadValues({
+ before: value,
+ after: marker
+ }, tracker.current()))
+ );
+ value += tracker.move(marker);
+ exit3();
+ return value;
+ }
+ function emphasisPeek(_3, _1, state) {
+ return state.options.emphasis || "*";
+ }
+
+ // node_modules/unist-util-is/lib/index.js
+ var convert = (
+ // Note: overloads in JSDoc can’t yet use different `@template`s.
+ /**
+ * @type {(
+ * ((test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & {type: Condition}) &
+ * ((test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Condition) &
+ * ((test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Predicate) &
+ * ((test?: null | undefined) => (node?: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node) &
+ * ((test?: Test) => Check)
+ * )}
+ */
+ /**
+ * @param {Test} [test]
+ * @returns {Check}
+ */
+ function(test) {
+ if (test === null || test === void 0) {
+ return ok;
+ }
+ if (typeof test === "function") {
+ return castFactory(test);
+ }
+ if (typeof test === "object") {
+ return Array.isArray(test) ? anyFactory(test) : propsFactory(test);
+ }
+ if (typeof test === "string") {
+ return typeFactory(test);
+ }
+ throw new Error("Expected function, string, or object as test");
+ }
+ );
+ function anyFactory(tests) {
+ const checks = [];
+ let index2 = -1;
+ while (++index2 < tests.length) {
+ checks[index2] = convert(tests[index2]);
+ }
+ return castFactory(any);
+ function any(...parameters) {
+ let index3 = -1;
+ while (++index3 < checks.length) {
+ if (checks[index3].apply(this, parameters)) return true;
+ }
+ return false;
+ }
+ }
+ function propsFactory(check) {
+ const checkAsRecord = (
+ /** @type {Record} */
+ check
+ );
+ return castFactory(all2);
+ function all2(node2) {
+ const nodeAsRecord = (
+ /** @type {Record} */
+ /** @type {unknown} */
+ node2
+ );
+ let key;
+ for (key in check) {
+ if (nodeAsRecord[key] !== checkAsRecord[key]) return false;
+ }
+ return true;
+ }
+ }
+ function typeFactory(check) {
+ return castFactory(type);
+ function type(node2) {
+ return node2 && node2.type === check;
+ }
+ }
+ function castFactory(testFunction) {
+ return check;
+ function check(value, index2, parent) {
+ return Boolean(
+ looksLikeANode(value) && testFunction.call(
+ this,
+ value,
+ typeof index2 === "number" ? index2 : void 0,
+ parent || void 0
+ )
+ );
+ }
+ }
+ function ok() {
+ return true;
+ }
+ function looksLikeANode(value) {
+ return value !== null && typeof value === "object" && "type" in value;
+ }
+
+ // node_modules/unist-util-visit-parents/lib/color.js
+ function color(d6) {
+ return d6;
+ }
+
+ // node_modules/unist-util-visit-parents/lib/index.js
+ var empty = [];
+ var CONTINUE = true;
+ var EXIT = false;
+ var SKIP = "skip";
+ function visitParents(tree, test, visitor, reverse) {
+ let check;
+ if (typeof test === "function" && typeof visitor !== "function") {
+ reverse = visitor;
+ visitor = test;
+ } else {
+ check = test;
+ }
+ const is2 = convert(check);
+ const step = reverse ? -1 : 1;
+ factory(tree, void 0, [])();
+ function factory(node2, index2, parents) {
+ const value = (
+ /** @type {Record} */
+ node2 && typeof node2 === "object" ? node2 : {}
+ );
+ if (typeof value.type === "string") {
+ const name = (
+ // `hast`
+ typeof value.tagName === "string" ? value.tagName : (
+ // `xast`
+ typeof value.name === "string" ? value.name : void 0
+ )
+ );
+ Object.defineProperty(visit2, "name", {
+ value: "node (" + color(node2.type + (name ? "<" + name + ">" : "")) + ")"
+ });
+ }
+ return visit2;
+ function visit2() {
+ let result = empty;
+ let subresult;
+ let offset;
+ let grandparents;
+ if (!test || is2(node2, index2, parents[parents.length - 1] || void 0)) {
+ result = toResult(visitor(node2, parents));
+ if (result[0] === EXIT) {
+ return result;
+ }
+ }
+ if ("children" in node2 && node2.children) {
+ const nodeAsParent = (
+ /** @type {UnistParent} */
+ node2
+ );
+ if (nodeAsParent.children && result[0] !== SKIP) {
+ offset = (reverse ? nodeAsParent.children.length : -1) + step;
+ grandparents = parents.concat(nodeAsParent);
+ while (offset > -1 && offset < nodeAsParent.children.length) {
+ const child = nodeAsParent.children[offset];
+ subresult = factory(child, offset, grandparents)();
+ if (subresult[0] === EXIT) {
+ return subresult;
+ }
+ offset = typeof subresult[1] === "number" ? subresult[1] : offset + step;
+ }
+ }
+ }
+ return result;
+ }
+ }
+ }
+ function toResult(value) {
+ if (Array.isArray(value)) {
+ return value;
+ }
+ if (typeof value === "number") {
+ return [CONTINUE, value];
+ }
+ return value === null || value === void 0 ? empty : [value];
+ }
+
+ // node_modules/unist-util-visit/lib/index.js
+ function visit(tree, testOrVisitor, visitorOrReverse, maybeReverse) {
+ let reverse;
+ let test;
+ let visitor;
+ if (typeof testOrVisitor === "function" && typeof visitorOrReverse !== "function") {
+ test = void 0;
+ visitor = testOrVisitor;
+ reverse = visitorOrReverse;
+ } else {
+ test = testOrVisitor;
+ visitor = visitorOrReverse;
+ reverse = maybeReverse;
+ }
+ visitParents(tree, test, overload, reverse);
+ function overload(node2, parents) {
+ const parent = parents[parents.length - 1];
+ const index2 = parent ? parent.children.indexOf(node2) : void 0;
+ return visitor(node2, index2, parent);
+ }
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/format-heading-as-setext.js
+ function formatHeadingAsSetext(node2, state) {
+ let literalWithBreak = false;
+ visit(node2, function(node3) {
+ if ("value" in node3 && /\r?\n|\r/.test(node3.value) || node3.type === "break") {
+ literalWithBreak = true;
+ return EXIT;
+ }
+ });
+ return Boolean(
+ (!node2.depth || node2.depth < 3) && toString(node2) && (state.options.setext || literalWithBreak)
+ );
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/heading.js
+ function heading(node2, _3, state, info) {
+ const rank = Math.max(Math.min(6, node2.depth || 1), 1);
+ const tracker = state.createTracker(info);
+ if (formatHeadingAsSetext(node2, state)) {
+ const exit4 = state.enter("headingSetext");
+ const subexit2 = state.enter("phrasing");
+ const value2 = state.containerPhrasing(node2, __spreadProps(__spreadValues({}, tracker.current()), {
+ before: "\n",
+ after: "\n"
+ }));
+ subexit2();
+ exit4();
+ return value2 + "\n" + (rank === 1 ? "=" : "-").repeat(
+ // The whole size…
+ value2.length - // Minus the position of the character after the last EOL (or
+ // 0 if there is none)…
+ (Math.max(value2.lastIndexOf("\r"), value2.lastIndexOf("\n")) + 1)
+ );
+ }
+ const sequence = "#".repeat(rank);
+ const exit3 = state.enter("headingAtx");
+ const subexit = state.enter("phrasing");
+ tracker.move(sequence + " ");
+ let value = state.containerPhrasing(node2, __spreadValues({
+ before: "# ",
+ after: "\n"
+ }, tracker.current()));
+ if (/^[\t ]/.test(value)) {
+ value = "&#x" + value.charCodeAt(0).toString(16).toUpperCase() + ";" + value.slice(1);
+ }
+ value = value ? sequence + " " + value : sequence;
+ if (state.options.closeAtx) {
+ value += " " + sequence;
+ }
+ subexit();
+ exit3();
+ return value;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/html.js
+ html.peek = htmlPeek;
+ function html(node2) {
+ return node2.value || "";
+ }
+ function htmlPeek() {
+ return "<";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/image.js
+ image.peek = imagePeek;
+ function image(node2, _3, state, info) {
+ const quote = checkQuote(state);
+ const suffix = quote === '"' ? "Quote" : "Apostrophe";
+ const exit3 = state.enter("image");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value = tracker.move("![");
+ value += tracker.move(
+ state.safe(node2.alt, __spreadValues({ before: value, after: "]" }, tracker.current()))
+ );
+ value += tracker.move("](");
+ subexit();
+ if (
+ // If there’s no url but there is a title…
+ !node2.url && node2.title || // If there are control characters or whitespace.
+ /[\0- \u007F]/.test(node2.url)
+ ) {
+ subexit = state.enter("destinationLiteral");
+ value += tracker.move("<");
+ value += tracker.move(
+ state.safe(node2.url, __spreadValues({ before: value, after: ">" }, tracker.current()))
+ );
+ value += tracker.move(">");
+ } else {
+ subexit = state.enter("destinationRaw");
+ value += tracker.move(
+ state.safe(node2.url, __spreadValues({
+ before: value,
+ after: node2.title ? " " : ")"
+ }, tracker.current()))
+ );
+ }
+ subexit();
+ if (node2.title) {
+ subexit = state.enter(`title${suffix}`);
+ value += tracker.move(" " + quote);
+ value += tracker.move(
+ state.safe(node2.title, __spreadValues({
+ before: value,
+ after: quote
+ }, tracker.current()))
+ );
+ value += tracker.move(quote);
+ subexit();
+ }
+ value += tracker.move(")");
+ exit3();
+ return value;
+ }
+ function imagePeek() {
+ return "!";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/image-reference.js
+ imageReference.peek = imageReferencePeek;
+ function imageReference(node2, _3, state, info) {
+ const type = node2.referenceType;
+ const exit3 = state.enter("imageReference");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value = tracker.move("![");
+ const alt = state.safe(node2.alt, __spreadValues({
+ before: value,
+ after: "]"
+ }, tracker.current()));
+ value += tracker.move(alt + "][");
+ subexit();
+ const stack = state.stack;
+ state.stack = [];
+ subexit = state.enter("reference");
+ const reference = state.safe(state.associationId(node2), __spreadValues({
+ before: value,
+ after: "]"
+ }, tracker.current()));
+ subexit();
+ state.stack = stack;
+ exit3();
+ if (type === "full" || !alt || alt !== reference) {
+ value += tracker.move(reference + "]");
+ } else if (type === "shortcut") {
+ value = value.slice(0, -1);
+ } else {
+ value += tracker.move("]");
+ }
+ return value;
+ }
+ function imageReferencePeek() {
+ return "!";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/inline-code.js
+ inlineCode.peek = inlineCodePeek;
+ function inlineCode(node2, _3, state) {
+ let value = node2.value || "";
+ let sequence = "`";
+ let index2 = -1;
+ while (new RegExp("(^|[^`])" + sequence + "([^`]|$)").test(value)) {
+ sequence += "`";
+ }
+ if (/[^ \r\n]/.test(value) && (/^[ \r\n]/.test(value) && /[ \r\n]$/.test(value) || /^`|`$/.test(value))) {
+ value = " " + value + " ";
+ }
+ while (++index2 < state.unsafe.length) {
+ const pattern = state.unsafe[index2];
+ const expression = state.compilePattern(pattern);
+ let match;
+ if (!pattern.atBreak) continue;
+ while (match = expression.exec(value)) {
+ let position2 = match.index;
+ if (value.charCodeAt(position2) === 10 && value.charCodeAt(position2 - 1) === 13) {
+ position2--;
+ }
+ value = value.slice(0, position2) + " " + value.slice(match.index + 1);
+ }
+ }
+ return sequence + value + sequence;
+ }
+ function inlineCodePeek() {
+ return "`";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/format-link-as-autolink.js
+ function formatLinkAsAutolink(node2, state) {
+ const raw = toString(node2);
+ return Boolean(
+ !state.options.resourceLink && // If there’s a url…
+ node2.url && // And there’s a no title…
+ !node2.title && // And the content of `node` is a single text node…
+ node2.children && node2.children.length === 1 && node2.children[0].type === "text" && // And if the url is the same as the content…
+ (raw === node2.url || "mailto:" + raw === node2.url) && // And that starts w/ a protocol…
+ /^[a-z][a-z+.-]+:/i.test(node2.url) && // And that doesn’t contain ASCII control codes (character escapes and
+ // references don’t work), space, or angle brackets…
+ !/[\0- <>\u007F]/.test(node2.url)
+ );
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/link.js
+ link.peek = linkPeek;
+ function link(node2, _3, state, info) {
+ const quote = checkQuote(state);
+ const suffix = quote === '"' ? "Quote" : "Apostrophe";
+ const tracker = state.createTracker(info);
+ let exit3;
+ let subexit;
+ if (formatLinkAsAutolink(node2, state)) {
+ const stack = state.stack;
+ state.stack = [];
+ exit3 = state.enter("autolink");
+ let value2 = tracker.move("<");
+ value2 += tracker.move(
+ state.containerPhrasing(node2, __spreadValues({
+ before: value2,
+ after: ">"
+ }, tracker.current()))
+ );
+ value2 += tracker.move(">");
+ exit3();
+ state.stack = stack;
+ return value2;
+ }
+ exit3 = state.enter("link");
+ subexit = state.enter("label");
+ let value = tracker.move("[");
+ value += tracker.move(
+ state.containerPhrasing(node2, __spreadValues({
+ before: value,
+ after: "]("
+ }, tracker.current()))
+ );
+ value += tracker.move("](");
+ subexit();
+ if (
+ // If there’s no url but there is a title…
+ !node2.url && node2.title || // If there are control characters or whitespace.
+ /[\0- \u007F]/.test(node2.url)
+ ) {
+ subexit = state.enter("destinationLiteral");
+ value += tracker.move("<");
+ value += tracker.move(
+ state.safe(node2.url, __spreadValues({ before: value, after: ">" }, tracker.current()))
+ );
+ value += tracker.move(">");
+ } else {
+ subexit = state.enter("destinationRaw");
+ value += tracker.move(
+ state.safe(node2.url, __spreadValues({
+ before: value,
+ after: node2.title ? " " : ")"
+ }, tracker.current()))
+ );
+ }
+ subexit();
+ if (node2.title) {
+ subexit = state.enter(`title${suffix}`);
+ value += tracker.move(" " + quote);
+ value += tracker.move(
+ state.safe(node2.title, __spreadValues({
+ before: value,
+ after: quote
+ }, tracker.current()))
+ );
+ value += tracker.move(quote);
+ subexit();
+ }
+ value += tracker.move(")");
+ exit3();
+ return value;
+ }
+ function linkPeek(node2, _3, state) {
+ return formatLinkAsAutolink(node2, state) ? "<" : "[";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/link-reference.js
+ linkReference.peek = linkReferencePeek;
+ function linkReference(node2, _3, state, info) {
+ const type = node2.referenceType;
+ const exit3 = state.enter("linkReference");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value = tracker.move("[");
+ const text5 = state.containerPhrasing(node2, __spreadValues({
+ before: value,
+ after: "]"
+ }, tracker.current()));
+ value += tracker.move(text5 + "][");
+ subexit();
+ const stack = state.stack;
+ state.stack = [];
+ subexit = state.enter("reference");
+ const reference = state.safe(state.associationId(node2), __spreadValues({
+ before: value,
+ after: "]"
+ }, tracker.current()));
+ subexit();
+ state.stack = stack;
+ exit3();
+ if (type === "full" || !text5 || text5 !== reference) {
+ value += tracker.move(reference + "]");
+ } else if (type === "shortcut") {
+ value = value.slice(0, -1);
+ } else {
+ value += tracker.move("]");
+ }
+ return value;
+ }
+ function linkReferencePeek() {
+ return "[";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-bullet.js
+ function checkBullet(state) {
+ const marker = state.options.bullet || "*";
+ if (marker !== "*" && marker !== "+" && marker !== "-") {
+ throw new Error(
+ "Cannot serialize items with `" + marker + "` for `options.bullet`, expected `*`, `+`, or `-`"
+ );
+ }
+ return marker;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-bullet-other.js
+ function checkBulletOther(state) {
+ const bullet = checkBullet(state);
+ const bulletOther = state.options.bulletOther;
+ if (!bulletOther) {
+ return bullet === "*" ? "-" : "*";
+ }
+ if (bulletOther !== "*" && bulletOther !== "+" && bulletOther !== "-") {
+ throw new Error(
+ "Cannot serialize items with `" + bulletOther + "` for `options.bulletOther`, expected `*`, `+`, or `-`"
+ );
+ }
+ if (bulletOther === bullet) {
+ throw new Error(
+ "Expected `bullet` (`" + bullet + "`) and `bulletOther` (`" + bulletOther + "`) to be different"
+ );
+ }
+ return bulletOther;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-bullet-ordered.js
+ function checkBulletOrdered(state) {
+ const marker = state.options.bulletOrdered || ".";
+ if (marker !== "." && marker !== ")") {
+ throw new Error(
+ "Cannot serialize items with `" + marker + "` for `options.bulletOrdered`, expected `.` or `)`"
+ );
+ }
+ return marker;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-rule.js
+ function checkRule(state) {
+ const marker = state.options.rule || "*";
+ if (marker !== "*" && marker !== "-" && marker !== "_") {
+ throw new Error(
+ "Cannot serialize rules with `" + marker + "` for `options.rule`, expected `*`, `-`, or `_`"
+ );
+ }
+ return marker;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/list.js
+ function list3(node2, parent, state, info) {
+ const exit3 = state.enter("list");
+ const bulletCurrent = state.bulletCurrent;
+ let bullet = node2.ordered ? checkBulletOrdered(state) : checkBullet(state);
+ const bulletOther = node2.ordered ? bullet === "." ? ")" : "." : checkBulletOther(state);
+ let useDifferentMarker = parent && state.bulletLastUsed ? bullet === state.bulletLastUsed : false;
+ if (!node2.ordered) {
+ const firstListItem = node2.children ? node2.children[0] : void 0;
+ if (
+ // Bullet could be used as a thematic break marker:
+ (bullet === "*" || bullet === "-") && // Empty first list item:
+ firstListItem && (!firstListItem.children || !firstListItem.children[0]) && // Directly in two other list items:
+ state.stack[state.stack.length - 1] === "list" && state.stack[state.stack.length - 2] === "listItem" && state.stack[state.stack.length - 3] === "list" && state.stack[state.stack.length - 4] === "listItem" && // That are each the first child.
+ state.indexStack[state.indexStack.length - 1] === 0 && state.indexStack[state.indexStack.length - 2] === 0 && state.indexStack[state.indexStack.length - 3] === 0
+ ) {
+ useDifferentMarker = true;
+ }
+ if (checkRule(state) === bullet && firstListItem) {
+ let index2 = -1;
+ while (++index2 < node2.children.length) {
+ const item = node2.children[index2];
+ if (item && item.type === "listItem" && item.children && item.children[0] && item.children[0].type === "thematicBreak") {
+ useDifferentMarker = true;
+ break;
+ }
+ }
+ }
+ }
+ if (useDifferentMarker) {
+ bullet = bulletOther;
+ }
+ state.bulletCurrent = bullet;
+ const value = state.containerFlow(node2, info);
+ state.bulletLastUsed = bullet;
+ state.bulletCurrent = bulletCurrent;
+ exit3();
+ return value;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-list-item-indent.js
+ function checkListItemIndent(state) {
+ const style2 = state.options.listItemIndent || "one";
+ if (style2 !== "tab" && style2 !== "one" && style2 !== "mixed") {
+ throw new Error(
+ "Cannot serialize items with `" + style2 + "` for `options.listItemIndent`, expected `tab`, `one`, or `mixed`"
+ );
+ }
+ return style2;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/list-item.js
+ function listItem(node2, parent, state, info) {
+ const listItemIndent = checkListItemIndent(state);
+ let bullet = state.bulletCurrent || checkBullet(state);
+ if (parent && parent.type === "list" && parent.ordered) {
+ bullet = (typeof parent.start === "number" && parent.start > -1 ? parent.start : 1) + (state.options.incrementListMarker === false ? 0 : parent.children.indexOf(node2)) + bullet;
+ }
+ let size = bullet.length + 1;
+ if (listItemIndent === "tab" || listItemIndent === "mixed" && (parent && parent.type === "list" && parent.spread || node2.spread)) {
+ size = Math.ceil(size / 4) * 4;
+ }
+ const tracker = state.createTracker(info);
+ tracker.move(bullet + " ".repeat(size - bullet.length));
+ tracker.shift(size);
+ const exit3 = state.enter("listItem");
+ const value = state.indentLines(
+ state.containerFlow(node2, tracker.current()),
+ map5
+ );
+ exit3();
+ return value;
+ function map5(line, index2, blank) {
+ if (index2) {
+ return (blank ? "" : " ".repeat(size)) + line;
+ }
+ return (blank ? bullet : bullet + " ".repeat(size - bullet.length)) + line;
+ }
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/paragraph.js
+ function paragraph(node2, _3, state, info) {
+ const exit3 = state.enter("paragraph");
+ const subexit = state.enter("phrasing");
+ const value = state.containerPhrasing(node2, info);
+ subexit();
+ exit3();
+ return value;
+ }
+
+ // node_modules/mdast-util-phrasing/lib/index.js
+ var phrasing = (
+ /** @type {(node?: unknown) => node is Exclude} */
+ convert([
+ "break",
+ "delete",
+ "emphasis",
+ // To do: next major: removed since footnotes were added to GFM.
+ "footnote",
+ "footnoteReference",
+ "image",
+ "imageReference",
+ "inlineCode",
+ // Enabled by `mdast-util-math`:
+ "inlineMath",
+ "link",
+ "linkReference",
+ // Enabled by `mdast-util-mdx`:
+ "mdxJsxTextElement",
+ // Enabled by `mdast-util-mdx`:
+ "mdxTextExpression",
+ "strong",
+ "text",
+ // Enabled by `mdast-util-directive`:
+ "textDirective"
+ ])
+ );
+
+ // node_modules/mdast-util-to-markdown/lib/handle/root.js
+ function root(node2, _3, state, info) {
+ const hasPhrasing = node2.children.some(function(d6) {
+ return phrasing(d6);
+ });
+ const fn = hasPhrasing ? state.containerPhrasing : state.containerFlow;
+ return fn.call(state, node2, info);
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-strong.js
+ function checkStrong(state) {
+ const marker = state.options.strong || "*";
+ if (marker !== "*" && marker !== "_") {
+ throw new Error(
+ "Cannot serialize strong with `" + marker + "` for `options.strong`, expected `*`, or `_`"
+ );
+ }
+ return marker;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/strong.js
+ strong.peek = strongPeek;
+ function strong(node2, _3, state, info) {
+ const marker = checkStrong(state);
+ const exit3 = state.enter("strong");
+ const tracker = state.createTracker(info);
+ let value = tracker.move(marker + marker);
+ value += tracker.move(
+ state.containerPhrasing(node2, __spreadValues({
+ before: value,
+ after: marker
+ }, tracker.current()))
+ );
+ value += tracker.move(marker + marker);
+ exit3();
+ return value;
+ }
+ function strongPeek(_3, _1, state) {
+ return state.options.strong || "*";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/text.js
+ function text3(node2, _3, state, info) {
+ return state.safe(node2.value, info);
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/check-rule-repetition.js
+ function checkRuleRepetition(state) {
+ const repetition = state.options.ruleRepetition || 3;
+ if (repetition < 3) {
+ throw new Error(
+ "Cannot serialize rules with repetition `" + repetition + "` for `options.ruleRepetition`, expected `3` or more"
+ );
+ }
+ return repetition;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/thematic-break.js
+ function thematicBreak2(_3, _1, state) {
+ const value = (checkRule(state) + (state.options.ruleSpaces ? " " : "")).repeat(checkRuleRepetition(state));
+ return state.options.ruleSpaces ? value.slice(0, -1) : value;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/handle/index.js
+ var handle = {
+ blockquote,
+ break: hardBreak,
+ code,
+ definition: definition2,
+ emphasis,
+ hardBreak,
+ heading,
+ html,
+ image,
+ imageReference,
+ inlineCode,
+ link,
+ linkReference,
+ list: list3,
+ listItem,
+ paragraph,
+ root,
+ strong,
+ text: text3,
+ thematicBreak: thematicBreak2
+ };
+
+ // node_modules/mdast-util-to-markdown/lib/join.js
+ var join = [joinDefaults];
+ function joinDefaults(left, right, parent, state) {
+ if (right.type === "code" && formatCodeAsIndented(right, state) && (left.type === "list" || left.type === right.type && formatCodeAsIndented(left, state))) {
+ return false;
+ }
+ if ("spread" in parent && typeof parent.spread === "boolean") {
+ if (left.type === "paragraph" && // Two paragraphs.
+ (left.type === right.type || right.type === "definition" || // Paragraph followed by a setext heading.
+ right.type === "heading" && formatHeadingAsSetext(right, state))) {
+ return;
+ }
+ return parent.spread ? 1 : 0;
+ }
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/unsafe.js
+ var fullPhrasingSpans = [
+ "autolink",
+ "destinationLiteral",
+ "destinationRaw",
+ "reference",
+ "titleQuote",
+ "titleApostrophe"
+ ];
+ var unsafe = [
+ { character: " ", after: "[\\r\\n]", inConstruct: "phrasing" },
+ { character: " ", before: "[\\r\\n]", inConstruct: "phrasing" },
+ {
+ character: " ",
+ inConstruct: ["codeFencedLangGraveAccent", "codeFencedLangTilde"]
+ },
+ {
+ character: "\r",
+ inConstruct: [
+ "codeFencedLangGraveAccent",
+ "codeFencedLangTilde",
+ "codeFencedMetaGraveAccent",
+ "codeFencedMetaTilde",
+ "destinationLiteral",
+ "headingAtx"
+ ]
+ },
+ {
+ character: "\n",
+ inConstruct: [
+ "codeFencedLangGraveAccent",
+ "codeFencedLangTilde",
+ "codeFencedMetaGraveAccent",
+ "codeFencedMetaTilde",
+ "destinationLiteral",
+ "headingAtx"
+ ]
+ },
+ { character: " ", after: "[\\r\\n]", inConstruct: "phrasing" },
+ { character: " ", before: "[\\r\\n]", inConstruct: "phrasing" },
+ {
+ character: " ",
+ inConstruct: ["codeFencedLangGraveAccent", "codeFencedLangTilde"]
+ },
+ // An exclamation mark can start an image, if it is followed by a link or
+ // a link reference.
+ {
+ character: "!",
+ after: "\\[",
+ inConstruct: "phrasing",
+ notInConstruct: fullPhrasingSpans
+ },
+ // A quote can break out of a title.
+ { character: '"', inConstruct: "titleQuote" },
+ // A number sign could start an ATX heading if it starts a line.
+ { atBreak: true, character: "#" },
+ { character: "#", inConstruct: "headingAtx", after: "(?:[\r\n]|$)" },
+ // Dollar sign and percentage are not used in markdown.
+ // An ampersand could start a character reference.
+ { character: "&", after: "[#A-Za-z]", inConstruct: "phrasing" },
+ // An apostrophe can break out of a title.
+ { character: "'", inConstruct: "titleApostrophe" },
+ // A left paren could break out of a destination raw.
+ { character: "(", inConstruct: "destinationRaw" },
+ // A left paren followed by `]` could make something into a link or image.
+ {
+ before: "\\]",
+ character: "(",
+ inConstruct: "phrasing",
+ notInConstruct: fullPhrasingSpans
+ },
+ // A right paren could start a list item or break out of a destination
+ // raw.
+ { atBreak: true, before: "\\d+", character: ")" },
+ { character: ")", inConstruct: "destinationRaw" },
+ // An asterisk can start thematic breaks, list items, emphasis, strong.
+ { atBreak: true, character: "*", after: "(?:[ \r\n*])" },
+ { character: "*", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ // A plus sign could start a list item.
+ { atBreak: true, character: "+", after: "(?:[ \r\n])" },
+ // A dash can start thematic breaks, list items, and setext heading
+ // underlines.
+ { atBreak: true, character: "-", after: "(?:[ \r\n-])" },
+ // A dot could start a list item.
+ { atBreak: true, before: "\\d+", character: ".", after: "(?:[ \r\n]|$)" },
+ // Slash, colon, and semicolon are not used in markdown for constructs.
+ // A less than can start html (flow or text) or an autolink.
+ // HTML could start with an exclamation mark (declaration, cdata, comment),
+ // slash (closing tag), question mark (instruction), or a letter (tag).
+ // An autolink also starts with a letter.
+ // Finally, it could break out of a destination literal.
+ { atBreak: true, character: "<", after: "[!/?A-Za-z]" },
+ {
+ character: "<",
+ after: "[!/?A-Za-z]",
+ inConstruct: "phrasing",
+ notInConstruct: fullPhrasingSpans
+ },
+ { character: "<", inConstruct: "destinationLiteral" },
+ // An equals to can start setext heading underlines.
+ { atBreak: true, character: "=" },
+ // A greater than can start block quotes and it can break out of a
+ // destination literal.
+ { atBreak: true, character: ">" },
+ { character: ">", inConstruct: "destinationLiteral" },
+ // Question mark and at sign are not used in markdown for constructs.
+ // A left bracket can start definitions, references, labels,
+ { atBreak: true, character: "[" },
+ { character: "[", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ { character: "[", inConstruct: ["label", "reference"] },
+ // A backslash can start an escape (when followed by punctuation) or a
+ // hard break (when followed by an eol).
+ // Note: typical escapes are handled in `safe`!
+ { character: "\\", after: "[\\r\\n]", inConstruct: "phrasing" },
+ // A right bracket can exit labels.
+ { character: "]", inConstruct: ["label", "reference"] },
+ // Caret is not used in markdown for constructs.
+ // An underscore can start emphasis, strong, or a thematic break.
+ { atBreak: true, character: "_" },
+ { character: "_", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ // A grave accent can start code (fenced or text), or it can break out of
+ // a grave accent code fence.
+ { atBreak: true, character: "`" },
+ {
+ character: "`",
+ inConstruct: ["codeFencedLangGraveAccent", "codeFencedMetaGraveAccent"]
+ },
+ { character: "`", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ // Left brace, vertical bar, right brace are not used in markdown for
+ // constructs.
+ // A tilde can start code (fenced).
+ { atBreak: true, character: "~" }
+ ];
+
+ // node_modules/mdast-util-to-markdown/lib/util/association.js
+ function association(node2) {
+ if (node2.label || !node2.identifier) {
+ return node2.label || "";
+ }
+ return decodeString(node2.identifier);
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/compile-pattern.js
+ function compilePattern(pattern) {
+ if (!pattern._compiled) {
+ const before = (pattern.atBreak ? "[\\r\\n][\\t ]*" : "") + (pattern.before ? "(?:" + pattern.before + ")" : "");
+ pattern._compiled = new RegExp(
+ (before ? "(" + before + ")" : "") + (/[|\\{}()[\]^$+*?.-]/.test(pattern.character) ? "\\" : "") + pattern.character + (pattern.after ? "(?:" + pattern.after + ")" : ""),
+ "g"
+ );
+ }
+ return pattern._compiled;
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/container-phrasing.js
+ function containerPhrasing(parent, state, info) {
+ const indexStack = state.indexStack;
+ const children = parent.children || [];
+ const results = [];
+ let index2 = -1;
+ let before = info.before;
+ indexStack.push(-1);
+ let tracker = state.createTracker(info);
+ while (++index2 < children.length) {
+ const child = children[index2];
+ let after;
+ indexStack[indexStack.length - 1] = index2;
+ if (index2 + 1 < children.length) {
+ let handle2 = state.handle.handlers[children[index2 + 1].type];
+ if (handle2 && handle2.peek) handle2 = handle2.peek;
+ after = handle2 ? handle2(children[index2 + 1], parent, state, __spreadValues({
+ before: "",
+ after: ""
+ }, tracker.current())).charAt(0) : "";
+ } else {
+ after = info.after;
+ }
+ if (results.length > 0 && (before === "\r" || before === "\n") && child.type === "html") {
+ results[results.length - 1] = results[results.length - 1].replace(
+ /(\r?\n|\r)$/,
+ " "
+ );
+ before = " ";
+ tracker = state.createTracker(info);
+ tracker.move(results.join(""));
+ }
+ results.push(
+ tracker.move(
+ state.handle(child, parent, state, __spreadProps(__spreadValues({}, tracker.current()), {
+ before,
+ after
+ }))
+ )
+ );
+ before = results[results.length - 1].slice(-1);
+ }
+ indexStack.pop();
+ return results.join("");
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/container-flow.js
+ function containerFlow(parent, state, info) {
+ const indexStack = state.indexStack;
+ const children = parent.children || [];
+ const tracker = state.createTracker(info);
+ const results = [];
+ let index2 = -1;
+ indexStack.push(-1);
+ while (++index2 < children.length) {
+ const child = children[index2];
+ indexStack[indexStack.length - 1] = index2;
+ results.push(
+ tracker.move(
+ state.handle(child, parent, state, __spreadValues({
+ before: "\n",
+ after: "\n"
+ }, tracker.current()))
+ )
+ );
+ if (child.type !== "list") {
+ state.bulletLastUsed = void 0;
+ }
+ if (index2 < children.length - 1) {
+ results.push(
+ tracker.move(between(child, children[index2 + 1], parent, state))
+ );
+ }
+ }
+ indexStack.pop();
+ return results.join("");
+ }
+ function between(left, right, parent, state) {
+ let index2 = state.join.length;
+ while (index2--) {
+ const result = state.join[index2](left, right, parent, state);
+ if (result === true || result === 1) {
+ break;
+ }
+ if (typeof result === "number") {
+ return "\n".repeat(1 + result);
+ }
+ if (result === false) {
+ return "\n\n\n\n";
+ }
+ }
+ return "\n\n";
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/indent-lines.js
+ var eol = /\r?\n|\r/g;
+ function indentLines(value, map5) {
+ const result = [];
+ let start = 0;
+ let line = 0;
+ let match;
+ while (match = eol.exec(value)) {
+ one2(value.slice(start, match.index));
+ result.push(match[0]);
+ start = match.index + match[0].length;
+ line++;
+ }
+ one2(value.slice(start));
+ return result.join("");
+ function one2(value2) {
+ result.push(map5(value2, line, !value2));
+ }
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/safe.js
+ function safe(state, input, config) {
+ const value = (config.before || "") + (input || "") + (config.after || "");
+ const positions = [];
+ const result = [];
+ const infos = {};
+ let index2 = -1;
+ while (++index2 < state.unsafe.length) {
+ const pattern = state.unsafe[index2];
+ if (!patternInScope(state.stack, pattern)) {
+ continue;
+ }
+ const expression = state.compilePattern(pattern);
+ let match;
+ while (match = expression.exec(value)) {
+ const before = "before" in pattern || Boolean(pattern.atBreak);
+ const after = "after" in pattern;
+ const position2 = match.index + (before ? match[1].length : 0);
+ if (positions.includes(position2)) {
+ if (infos[position2].before && !before) {
+ infos[position2].before = false;
+ }
+ if (infos[position2].after && !after) {
+ infos[position2].after = false;
+ }
+ } else {
+ positions.push(position2);
+ infos[position2] = { before, after };
+ }
+ }
+ }
+ positions.sort(numerical);
+ let start = config.before ? config.before.length : 0;
+ const end = value.length - (config.after ? config.after.length : 0);
+ index2 = -1;
+ while (++index2 < positions.length) {
+ const position2 = positions[index2];
+ if (position2 < start || position2 >= end) {
+ continue;
+ }
+ if (position2 + 1 < end && positions[index2 + 1] === position2 + 1 && infos[position2].after && !infos[position2 + 1].before && !infos[position2 + 1].after || positions[index2 - 1] === position2 - 1 && infos[position2].before && !infos[position2 - 1].before && !infos[position2 - 1].after) {
+ continue;
+ }
+ if (start !== position2) {
+ result.push(escapeBackslashes(value.slice(start, position2), "\\"));
+ }
+ start = position2;
+ if (/[!-/:-@[-`{-~]/.test(value.charAt(position2)) && (!config.encode || !config.encode.includes(value.charAt(position2)))) {
+ result.push("\\");
+ } else {
+ result.push(
+ "&#x" + value.charCodeAt(position2).toString(16).toUpperCase() + ";"
+ );
+ start++;
+ }
+ }
+ result.push(escapeBackslashes(value.slice(start, end), config.after));
+ return result.join("");
+ }
+ function numerical(a2, b4) {
+ return a2 - b4;
+ }
+ function escapeBackslashes(value, after) {
+ const expression = /\\(?=[!-/:-@[-`{-~])/g;
+ const positions = [];
+ const results = [];
+ const whole = value + after;
+ let index2 = -1;
+ let start = 0;
+ let match;
+ while (match = expression.exec(whole)) {
+ positions.push(match.index);
+ }
+ while (++index2 < positions.length) {
+ if (start !== positions[index2]) {
+ results.push(value.slice(start, positions[index2]));
+ }
+ results.push("\\");
+ start = positions[index2];
+ }
+ results.push(value.slice(start));
+ return results.join("");
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/util/track.js
+ function track(config) {
+ const options2 = config || {};
+ const now = options2.now || {};
+ let lineShift = options2.lineShift || 0;
+ let line = now.line || 1;
+ let column = now.column || 1;
+ return { move, current, shift: shift2 };
+ function current() {
+ return { now: { line, column }, lineShift };
+ }
+ function shift2(value) {
+ lineShift += value;
+ }
+ function move(input) {
+ const value = input || "";
+ const chunks = value.split(/\r?\n|\r/g);
+ const tail = chunks[chunks.length - 1];
+ line += chunks.length - 1;
+ column = chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift;
+ return value;
+ }
+ }
+
+ // node_modules/mdast-util-to-markdown/lib/index.js
+ function toMarkdown(tree, options2 = {}) {
+ const state = {
+ enter,
+ indentLines,
+ associationId: association,
+ containerPhrasing: containerPhrasingBound,
+ containerFlow: containerFlowBound,
+ createTracker: track,
+ compilePattern,
+ safe: safeBound,
+ stack: [],
+ unsafe: [...unsafe],
+ join: [...join],
+ // @ts-expect-error: GFM / frontmatter are typed in `mdast` but not defined
+ // here.
+ handlers: __spreadValues({}, handle),
+ options: {},
+ indexStack: [],
+ // @ts-expect-error: add `handle` in a second.
+ handle: void 0
+ };
+ configure2(state, options2);
+ if (state.options.tightDefinitions) {
+ state.join.push(joinDefinition);
+ }
+ state.handle = zwitch("type", {
+ invalid,
+ unknown,
+ handlers: state.handlers
+ });
+ let result = state.handle(tree, void 0, state, {
+ before: "\n",
+ after: "\n",
+ now: { line: 1, column: 1 },
+ lineShift: 0
+ });
+ if (result && result.charCodeAt(result.length - 1) !== 10 && result.charCodeAt(result.length - 1) !== 13) {
+ result += "\n";
+ }
+ return result;
+ function enter(name) {
+ state.stack.push(name);
+ return exit3;
+ function exit3() {
+ state.stack.pop();
+ }
+ }
+ }
+ function invalid(value) {
+ throw new Error("Cannot handle value `" + value + "`, expected node");
+ }
+ function unknown(value) {
+ const node2 = (
+ /** @type {Nodes} */
+ value
+ );
+ throw new Error("Cannot handle unknown node `" + node2.type + "`");
+ }
+ function joinDefinition(left, right) {
+ if (left.type === "definition" && left.type === right.type) {
+ return 0;
+ }
+ }
+ function containerPhrasingBound(parent, info) {
+ return containerPhrasing(parent, this, info);
+ }
+ function containerFlowBound(parent, info) {
+ return containerFlow(parent, this, info);
+ }
+ function safeBound(value, config) {
+ return safe(this, value, config);
+ }
+
+ // node_modules/remark-stringify/lib/index.js
+ function remarkStringify(options2) {
+ const self2 = this;
+ self2.compiler = compiler2;
+ function compiler2(tree) {
+ return toMarkdown(tree, __spreadProps(__spreadValues(__spreadValues({}, self2.data("settings")), options2), {
+ // Note: this option is not in the readme.
+ // The goal is for it to be set by plugins on `data` instead of being
+ // passed by users.
+ extensions: self2.data("toMarkdownExtensions") || []
+ }));
+ }
+ }
+
+ // node_modules/bail/index.js
+ function bail(error) {
+ if (error) {
+ throw error;
+ }
+ }
+
+ // node_modules/unified/lib/index.js
+ var import_extend = __toESM(require_extend(), 1);
+
+ // node_modules/devlop/lib/default.js
+ function ok2() {
+ }
+
+ // node_modules/is-plain-obj/index.js
+ function isPlainObject(value) {
+ if (typeof value !== "object" || value === null) {
+ return false;
+ }
+ const prototype = Object.getPrototypeOf(value);
+ return (prototype === null || prototype === Object.prototype || Object.getPrototypeOf(prototype) === null) && !(Symbol.toStringTag in value) && !(Symbol.iterator in value);
+ }
+
+ // node_modules/trough/lib/index.js
+ function trough() {
+ const fns = [];
+ const pipeline = { run: run2, use };
+ return pipeline;
+ function run2(...values) {
+ let middlewareIndex = -1;
+ const callback = values.pop();
+ if (typeof callback !== "function") {
+ throw new TypeError("Expected function as last argument, not " + callback);
+ }
+ next(null, ...values);
+ function next(error, ...output) {
+ const fn = fns[++middlewareIndex];
+ let index2 = -1;
+ if (error) {
+ callback(error);
+ return;
+ }
+ while (++index2 < values.length) {
+ if (output[index2] === null || output[index2] === void 0) {
+ output[index2] = values[index2];
+ }
+ }
+ values = output;
+ if (fn) {
+ wrap(fn, next)(...output);
+ } else {
+ callback(null, ...output);
+ }
+ }
+ }
+ function use(middelware) {
+ if (typeof middelware !== "function") {
+ throw new TypeError(
+ "Expected `middelware` to be a function, not " + middelware
+ );
+ }
+ fns.push(middelware);
+ return pipeline;
+ }
+ }
+ function wrap(middleware, callback) {
+ let called;
+ return wrapped;
+ function wrapped(...parameters) {
+ const fnExpectsCallback = middleware.length > parameters.length;
+ let result;
+ if (fnExpectsCallback) {
+ parameters.push(done);
+ }
+ try {
+ result = middleware.apply(this, parameters);
+ } catch (error) {
+ const exception = (
+ /** @type {Error} */
+ error
+ );
+ if (fnExpectsCallback && called) {
+ throw exception;
+ }
+ return done(exception);
+ }
+ if (!fnExpectsCallback) {
+ if (result && result.then && typeof result.then === "function") {
+ result.then(then, done);
+ } else if (result instanceof Error) {
+ done(result);
+ } else {
+ then(result);
+ }
+ }
+ }
+ function done(error, ...output) {
+ if (!called) {
+ called = true;
+ callback(error, ...output);
+ }
+ }
+ function then(value) {
+ done(null, value);
+ }
+ }
+
+ // node_modules/vfile-message/lib/index.js
+ var VFileMessage = class extends Error {
+ /**
+ * Create a message for `reason`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Options | null | undefined} [options]
+ * @returns
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | Options | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns
+ * Instance of `VFileMessage`.
+ */
+ // eslint-disable-next-line complexity
+ constructor(causeOrReason, optionsOrParentOrPlace, origin) {
+ super();
+ if (typeof optionsOrParentOrPlace === "string") {
+ origin = optionsOrParentOrPlace;
+ optionsOrParentOrPlace = void 0;
+ }
+ let reason = "";
+ let options2 = {};
+ let legacyCause = false;
+ if (optionsOrParentOrPlace) {
+ if ("line" in optionsOrParentOrPlace && "column" in optionsOrParentOrPlace) {
+ options2 = { place: optionsOrParentOrPlace };
+ } else if ("start" in optionsOrParentOrPlace && "end" in optionsOrParentOrPlace) {
+ options2 = { place: optionsOrParentOrPlace };
+ } else if ("type" in optionsOrParentOrPlace) {
+ options2 = {
+ ancestors: [optionsOrParentOrPlace],
+ place: optionsOrParentOrPlace.position
+ };
+ } else {
+ options2 = __spreadValues({}, optionsOrParentOrPlace);
+ }
+ }
+ if (typeof causeOrReason === "string") {
+ reason = causeOrReason;
+ } else if (!options2.cause && causeOrReason) {
+ legacyCause = true;
+ reason = causeOrReason.message;
+ options2.cause = causeOrReason;
+ }
+ if (!options2.ruleId && !options2.source && typeof origin === "string") {
+ const index2 = origin.indexOf(":");
+ if (index2 === -1) {
+ options2.ruleId = origin;
+ } else {
+ options2.source = origin.slice(0, index2);
+ options2.ruleId = origin.slice(index2 + 1);
+ }
+ }
+ if (!options2.place && options2.ancestors && options2.ancestors) {
+ const parent = options2.ancestors[options2.ancestors.length - 1];
+ if (parent) {
+ options2.place = parent.position;
+ }
+ }
+ const start = options2.place && "start" in options2.place ? options2.place.start : options2.place;
+ this.ancestors = options2.ancestors || void 0;
+ this.cause = options2.cause || void 0;
+ this.column = start ? start.column : void 0;
+ this.fatal = void 0;
+ this.file;
+ this.message = reason;
+ this.line = start ? start.line : void 0;
+ this.name = stringifyPosition(options2.place) || "1:1";
+ this.place = options2.place || void 0;
+ this.reason = this.message;
+ this.ruleId = options2.ruleId || void 0;
+ this.source = options2.source || void 0;
+ this.stack = legacyCause && options2.cause && typeof options2.cause.stack === "string" ? options2.cause.stack : "";
+ this.actual;
+ this.expected;
+ this.note;
+ this.url;
+ }
+ };
+ VFileMessage.prototype.file = "";
+ VFileMessage.prototype.name = "";
+ VFileMessage.prototype.reason = "";
+ VFileMessage.prototype.message = "";
+ VFileMessage.prototype.stack = "";
+ VFileMessage.prototype.column = void 0;
+ VFileMessage.prototype.line = void 0;
+ VFileMessage.prototype.ancestors = void 0;
+ VFileMessage.prototype.cause = void 0;
+ VFileMessage.prototype.fatal = void 0;
+ VFileMessage.prototype.place = void 0;
+ VFileMessage.prototype.ruleId = void 0;
+ VFileMessage.prototype.source = void 0;
+
+ // node_modules/vfile/lib/minpath.browser.js
+ var path = { basename, dirname, extname, join: join2, sep: "/" };
+ function basename(path3, ext) {
+ if (ext !== void 0 && typeof ext !== "string") {
+ throw new TypeError('"ext" argument must be a string');
+ }
+ assertPath(path3);
+ let start = 0;
+ let end = -1;
+ let index2 = path3.length;
+ let seenNonSlash;
+ if (ext === void 0 || ext.length === 0 || ext.length > path3.length) {
+ while (index2--) {
+ if (path3.codePointAt(index2) === 47) {
+ if (seenNonSlash) {
+ start = index2 + 1;
+ break;
+ }
+ } else if (end < 0) {
+ seenNonSlash = true;
+ end = index2 + 1;
+ }
+ }
+ return end < 0 ? "" : path3.slice(start, end);
+ }
+ if (ext === path3) {
+ return "";
+ }
+ let firstNonSlashEnd = -1;
+ let extIndex = ext.length - 1;
+ while (index2--) {
+ if (path3.codePointAt(index2) === 47) {
+ if (seenNonSlash) {
+ start = index2 + 1;
+ break;
+ }
+ } else {
+ if (firstNonSlashEnd < 0) {
+ seenNonSlash = true;
+ firstNonSlashEnd = index2 + 1;
+ }
+ if (extIndex > -1) {
+ if (path3.codePointAt(index2) === ext.codePointAt(extIndex--)) {
+ if (extIndex < 0) {
+ end = index2;
+ }
+ } else {
+ extIndex = -1;
+ end = firstNonSlashEnd;
+ }
+ }
+ }
+ }
+ if (start === end) {
+ end = firstNonSlashEnd;
+ } else if (end < 0) {
+ end = path3.length;
+ }
+ return path3.slice(start, end);
+ }
+ function dirname(path3) {
+ assertPath(path3);
+ if (path3.length === 0) {
+ return ".";
+ }
+ let end = -1;
+ let index2 = path3.length;
+ let unmatchedSlash;
+ while (--index2) {
+ if (path3.codePointAt(index2) === 47) {
+ if (unmatchedSlash) {
+ end = index2;
+ break;
+ }
+ } else if (!unmatchedSlash) {
+ unmatchedSlash = true;
+ }
+ }
+ return end < 0 ? path3.codePointAt(0) === 47 ? "/" : "." : end === 1 && path3.codePointAt(0) === 47 ? "//" : path3.slice(0, end);
+ }
+ function extname(path3) {
+ assertPath(path3);
+ let index2 = path3.length;
+ let end = -1;
+ let startPart = 0;
+ let startDot = -1;
+ let preDotState = 0;
+ let unmatchedSlash;
+ while (index2--) {
+ const code3 = path3.codePointAt(index2);
+ if (code3 === 47) {
+ if (unmatchedSlash) {
+ startPart = index2 + 1;
+ break;
+ }
+ continue;
+ }
+ if (end < 0) {
+ unmatchedSlash = true;
+ end = index2 + 1;
+ }
+ if (code3 === 46) {
+ if (startDot < 0) {
+ startDot = index2;
+ } else if (preDotState !== 1) {
+ preDotState = 1;
+ }
+ } else if (startDot > -1) {
+ preDotState = -1;
+ }
+ }
+ if (startDot < 0 || end < 0 || // We saw a non-dot character immediately before the dot.
+ preDotState === 0 || // The (right-most) trimmed path component is exactly `..`.
+ preDotState === 1 && startDot === end - 1 && startDot === startPart + 1) {
+ return "";
+ }
+ return path3.slice(startDot, end);
+ }
+ function join2(...segments) {
+ let index2 = -1;
+ let joined;
+ while (++index2 < segments.length) {
+ assertPath(segments[index2]);
+ if (segments[index2]) {
+ joined = joined === void 0 ? segments[index2] : joined + "/" + segments[index2];
+ }
+ }
+ return joined === void 0 ? "." : normalize(joined);
+ }
+ function normalize(path3) {
+ assertPath(path3);
+ const absolute = path3.codePointAt(0) === 47;
+ let value = normalizeString(path3, !absolute);
+ if (value.length === 0 && !absolute) {
+ value = ".";
+ }
+ if (value.length > 0 && path3.codePointAt(path3.length - 1) === 47) {
+ value += "/";
+ }
+ return absolute ? "/" + value : value;
+ }
+ function normalizeString(path3, allowAboveRoot) {
+ let result = "";
+ let lastSegmentLength = 0;
+ let lastSlash = -1;
+ let dots = 0;
+ let index2 = -1;
+ let code3;
+ let lastSlashIndex;
+ while (++index2 <= path3.length) {
+ if (index2 < path3.length) {
+ code3 = path3.codePointAt(index2);
+ } else if (code3 === 47) {
+ break;
+ } else {
+ code3 = 47;
+ }
+ if (code3 === 47) {
+ if (lastSlash === index2 - 1 || dots === 1) {
+ } else if (lastSlash !== index2 - 1 && dots === 2) {
+ if (result.length < 2 || lastSegmentLength !== 2 || result.codePointAt(result.length - 1) !== 46 || result.codePointAt(result.length - 2) !== 46) {
+ if (result.length > 2) {
+ lastSlashIndex = result.lastIndexOf("/");
+ if (lastSlashIndex !== result.length - 1) {
+ if (lastSlashIndex < 0) {
+ result = "";
+ lastSegmentLength = 0;
+ } else {
+ result = result.slice(0, lastSlashIndex);
+ lastSegmentLength = result.length - 1 - result.lastIndexOf("/");
+ }
+ lastSlash = index2;
+ dots = 0;
+ continue;
+ }
+ } else if (result.length > 0) {
+ result = "";
+ lastSegmentLength = 0;
+ lastSlash = index2;
+ dots = 0;
+ continue;
+ }
+ }
+ if (allowAboveRoot) {
+ result = result.length > 0 ? result + "/.." : "..";
+ lastSegmentLength = 2;
+ }
+ } else {
+ if (result.length > 0) {
+ result += "/" + path3.slice(lastSlash + 1, index2);
+ } else {
+ result = path3.slice(lastSlash + 1, index2);
+ }
+ lastSegmentLength = index2 - lastSlash - 1;
+ }
+ lastSlash = index2;
+ dots = 0;
+ } else if (code3 === 46 && dots > -1) {
+ dots++;
+ } else {
+ dots = -1;
+ }
+ }
+ return result;
+ }
+ function assertPath(path3) {
+ if (typeof path3 !== "string") {
+ throw new TypeError(
+ "Path must be a string. Received " + JSON.stringify(path3)
+ );
+ }
+ }
+
+ // node_modules/vfile/lib/minproc.browser.js
+ var proc = { cwd };
+ function cwd() {
+ return "/";
+ }
+
+ // node_modules/vfile/lib/minurl.shared.js
+ function isUrl(fileUrlOrPath) {
+ return Boolean(
+ fileUrlOrPath !== null && typeof fileUrlOrPath === "object" && "href" in fileUrlOrPath && fileUrlOrPath.href && "protocol" in fileUrlOrPath && fileUrlOrPath.protocol && // @ts-expect-error: indexing is fine.
+ fileUrlOrPath.auth === void 0
+ );
+ }
+
+ // node_modules/vfile/lib/minurl.browser.js
+ function urlToPath(path3) {
+ if (typeof path3 === "string") {
+ path3 = new URL(path3);
+ } else if (!isUrl(path3)) {
+ const error = new TypeError(
+ 'The "path" argument must be of type string or an instance of URL. Received `' + path3 + "`"
+ );
+ error.code = "ERR_INVALID_ARG_TYPE";
+ throw error;
+ }
+ if (path3.protocol !== "file:") {
+ const error = new TypeError("The URL must be of scheme file");
+ error.code = "ERR_INVALID_URL_SCHEME";
+ throw error;
+ }
+ return getPathFromURLPosix(path3);
+ }
+ function getPathFromURLPosix(url) {
+ if (url.hostname !== "") {
+ const error = new TypeError(
+ 'File URL host must be "localhost" or empty on darwin'
+ );
+ error.code = "ERR_INVALID_FILE_URL_HOST";
+ throw error;
+ }
+ const pathname = url.pathname;
+ let index2 = -1;
+ while (++index2 < pathname.length) {
+ if (pathname.codePointAt(index2) === 37 && pathname.codePointAt(index2 + 1) === 50) {
+ const third = pathname.codePointAt(index2 + 2);
+ if (third === 70 || third === 102) {
+ const error = new TypeError(
+ "File URL path must not include encoded / characters"
+ );
+ error.code = "ERR_INVALID_FILE_URL_PATH";
+ throw error;
+ }
+ }
+ }
+ return decodeURIComponent(pathname);
+ }
+
+ // node_modules/vfile/lib/index.js
+ var order = (
+ /** @type {const} */
+ [
+ "history",
+ "path",
+ "basename",
+ "stem",
+ "extname",
+ "dirname"
+ ]
+ );
+ var VFile = class {
+ /**
+ * Create a new virtual file.
+ *
+ * `options` is treated as:
+ *
+ * * `string` or `Uint8Array` — `{value: options}`
+ * * `URL` — `{path: options}`
+ * * `VFile` — shallow copies its data over to the new file
+ * * `object` — all fields are shallow copied over to the new file
+ *
+ * Path related fields are set in the following order (least specific to
+ * most specific): `history`, `path`, `basename`, `stem`, `extname`,
+ * `dirname`.
+ *
+ * You cannot set `dirname` or `extname` without setting either `history`,
+ * `path`, `basename`, or `stem` too.
+ *
+ * @param {Compatible | null | undefined} [value]
+ * File value.
+ * @returns
+ * New instance.
+ */
+ constructor(value) {
+ let options2;
+ if (!value) {
+ options2 = {};
+ } else if (isUrl(value)) {
+ options2 = { path: value };
+ } else if (typeof value === "string" || isUint8Array(value)) {
+ options2 = { value };
+ } else {
+ options2 = value;
+ }
+ this.cwd = proc.cwd();
+ this.data = {};
+ this.history = [];
+ this.messages = [];
+ this.value;
+ this.map;
+ this.result;
+ this.stored;
+ let index2 = -1;
+ while (++index2 < order.length) {
+ const prop2 = order[index2];
+ if (prop2 in options2 && options2[prop2] !== void 0 && options2[prop2] !== null) {
+ this[prop2] = prop2 === "history" ? [...options2[prop2]] : options2[prop2];
+ }
+ }
+ let prop;
+ for (prop in options2) {
+ if (!order.includes(prop)) {
+ this[prop] = options2[prop];
+ }
+ }
+ }
+ /**
+ * Get the basename (including extname) (example: `'index.min.js'`).
+ *
+ * @returns {string | undefined}
+ * Basename.
+ */
+ get basename() {
+ return typeof this.path === "string" ? path.basename(this.path) : void 0;
+ }
+ /**
+ * Set basename (including extname) (`'index.min.js'`).
+ *
+ * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\'`
+ * on windows).
+ * Cannot be nullified (use `file.path = file.dirname` instead).
+ *
+ * @param {string} basename
+ * Basename.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set basename(basename2) {
+ assertNonEmpty(basename2, "basename");
+ assertPart(basename2, "basename");
+ this.path = path.join(this.dirname || "", basename2);
+ }
+ /**
+ * Get the parent path (example: `'~'`).
+ *
+ * @returns {string | undefined}
+ * Dirname.
+ */
+ get dirname() {
+ return typeof this.path === "string" ? path.dirname(this.path) : void 0;
+ }
+ /**
+ * Set the parent path (example: `'~'`).
+ *
+ * Cannot be set if there’s no `path` yet.
+ *
+ * @param {string | undefined} dirname
+ * Dirname.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set dirname(dirname2) {
+ assertPath2(this.basename, "dirname");
+ this.path = path.join(dirname2 || "", this.basename);
+ }
+ /**
+ * Get the extname (including dot) (example: `'.js'`).
+ *
+ * @returns {string | undefined}
+ * Extname.
+ */
+ get extname() {
+ return typeof this.path === "string" ? path.extname(this.path) : void 0;
+ }
+ /**
+ * Set the extname (including dot) (example: `'.js'`).
+ *
+ * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\'`
+ * on windows).
+ * Cannot be set if there’s no `path` yet.
+ *
+ * @param {string | undefined} extname
+ * Extname.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set extname(extname2) {
+ assertPart(extname2, "extname");
+ assertPath2(this.dirname, "extname");
+ if (extname2) {
+ if (extname2.codePointAt(0) !== 46) {
+ throw new Error("`extname` must start with `.`");
+ }
+ if (extname2.includes(".", 1)) {
+ throw new Error("`extname` cannot contain multiple dots");
+ }
+ }
+ this.path = path.join(this.dirname, this.stem + (extname2 || ""));
+ }
+ /**
+ * Get the full path (example: `'~/index.min.js'`).
+ *
+ * @returns {string}
+ * Path.
+ */
+ get path() {
+ return this.history[this.history.length - 1];
+ }
+ /**
+ * Set the full path (example: `'~/index.min.js'`).
+ *
+ * Cannot be nullified.
+ * You can set a file URL (a `URL` object with a `file:` protocol) which will
+ * be turned into a path with `url.fileURLToPath`.
+ *
+ * @param {URL | string} path
+ * Path.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set path(path3) {
+ if (isUrl(path3)) {
+ path3 = urlToPath(path3);
+ }
+ assertNonEmpty(path3, "path");
+ if (this.path !== path3) {
+ this.history.push(path3);
+ }
+ }
+ /**
+ * Get the stem (basename w/o extname) (example: `'index.min'`).
+ *
+ * @returns {string | undefined}
+ * Stem.
+ */
+ get stem() {
+ return typeof this.path === "string" ? path.basename(this.path, this.extname) : void 0;
+ }
+ /**
+ * Set the stem (basename w/o extname) (example: `'index.min'`).
+ *
+ * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\'`
+ * on windows).
+ * Cannot be nullified (use `file.path = file.dirname` instead).
+ *
+ * @param {string} stem
+ * Stem.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set stem(stem) {
+ assertNonEmpty(stem, "stem");
+ assertPart(stem, "stem");
+ this.path = path.join(this.dirname || "", stem + (this.extname || ""));
+ }
+ // Normal prototypal methods.
+ /**
+ * Create a fatal message for `reason` associated with the file.
+ *
+ * The `fatal` field of the message is set to `true` (error; file not usable)
+ * and the `file` field is set to the current file path.
+ * The message is added to the `messages` field on `file`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {MessageOptions | null | undefined} [options]
+ * @returns {never}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns {never}
+ * Never.
+ * @throws {VFileMessage}
+ * Message.
+ */
+ fail(causeOrReason, optionsOrParentOrPlace, origin) {
+ const message = this.message(causeOrReason, optionsOrParentOrPlace, origin);
+ message.fatal = true;
+ throw message;
+ }
+ /**
+ * Create an info message for `reason` associated with the file.
+ *
+ * The `fatal` field of the message is set to `undefined` (info; change
+ * likely not needed) and the `file` field is set to the current file path.
+ * The message is added to the `messages` field on `file`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {MessageOptions | null | undefined} [options]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns {VFileMessage}
+ * Message.
+ */
+ info(causeOrReason, optionsOrParentOrPlace, origin) {
+ const message = this.message(causeOrReason, optionsOrParentOrPlace, origin);
+ message.fatal = void 0;
+ return message;
+ }
+ /**
+ * Create a message for `reason` associated with the file.
+ *
+ * The `fatal` field of the message is set to `false` (warning; change may be
+ * needed) and the `file` field is set to the current file path.
+ * The message is added to the `messages` field on `file`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {MessageOptions | null | undefined} [options]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns {VFileMessage}
+ * Message.
+ */
+ message(causeOrReason, optionsOrParentOrPlace, origin) {
+ const message = new VFileMessage(
+ // @ts-expect-error: the overloads are fine.
+ causeOrReason,
+ optionsOrParentOrPlace,
+ origin
+ );
+ if (this.path) {
+ message.name = this.path + ":" + message.name;
+ message.file = this.path;
+ }
+ message.fatal = false;
+ this.messages.push(message);
+ return message;
+ }
+ /**
+ * Serialize the file.
+ *
+ * > **Note**: which encodings are supported depends on the engine.
+ * > For info on Node.js, see:
+ * > .
+ *
+ * @param {string | null | undefined} [encoding='utf8']
+ * Character encoding to understand `value` as when it’s a `Uint8Array`
+ * (default: `'utf-8'`).
+ * @returns {string}
+ * Serialized file.
+ */
+ toString(encoding) {
+ if (this.value === void 0) {
+ return "";
+ }
+ if (typeof this.value === "string") {
+ return this.value;
+ }
+ const decoder = new TextDecoder(encoding || void 0);
+ return decoder.decode(this.value);
+ }
+ };
+ function assertPart(part, name) {
+ if (part && part.includes(path.sep)) {
+ throw new Error(
+ "`" + name + "` cannot be a path: did not expect `" + path.sep + "`"
+ );
+ }
+ }
+ function assertNonEmpty(part, name) {
+ if (!part) {
+ throw new Error("`" + name + "` cannot be empty");
+ }
+ }
+ function assertPath2(path3, name) {
+ if (!path3) {
+ throw new Error("Setting `" + name + "` requires `path` to be set too");
+ }
+ }
+ function isUint8Array(value) {
+ return Boolean(
+ value && typeof value === "object" && "byteLength" in value && "byteOffset" in value
+ );
+ }
+
+ // node_modules/unified/lib/callable-instance.js
+ var CallableInstance = (
+ /**
+ * @type {new , Result>(property: string | symbol) => (...parameters: Parameters) => Result}
+ */
+ /** @type {unknown} */
+ /**
+ * @this {Function}
+ * @param {string | symbol} property
+ * @returns {(...parameters: Array) => unknown}
+ */
+ function(property) {
+ const self2 = this;
+ const constr = self2.constructor;
+ const proto = (
+ /** @type {Record} */
+ // Prototypes do exist.
+ // type-coverage:ignore-next-line
+ constr.prototype
+ );
+ const func = proto[property];
+ const apply2 = function() {
+ return func.apply(apply2, arguments);
+ };
+ Object.setPrototypeOf(apply2, proto);
+ const names = Object.getOwnPropertyNames(func);
+ for (const p4 of names) {
+ const descriptor = Object.getOwnPropertyDescriptor(func, p4);
+ if (descriptor) Object.defineProperty(apply2, p4, descriptor);
+ }
+ return apply2;
+ }
+ );
+
+ // node_modules/unified/lib/index.js
+ var own4 = {}.hasOwnProperty;
+ var Processor = class _Processor extends CallableInstance {
+ /**
+ * Create a processor.
+ */
+ constructor() {
+ super("copy");
+ this.Compiler = void 0;
+ this.Parser = void 0;
+ this.attachers = [];
+ this.compiler = void 0;
+ this.freezeIndex = -1;
+ this.frozen = void 0;
+ this.namespace = {};
+ this.parser = void 0;
+ this.transformers = trough();
+ }
+ /**
+ * Copy a processor.
+ *
+ * @deprecated
+ * This is a private internal method and should not be used.
+ * @returns {Processor}
+ * New *unfrozen* processor ({@link Processor `Processor`}) that is
+ * configured to work the same as its ancestor.
+ * When the descendant processor is configured in the future it does not
+ * affect the ancestral processor.
+ */
+ copy() {
+ const destination = (
+ /** @type {Processor} */
+ new _Processor()
+ );
+ let index2 = -1;
+ while (++index2 < this.attachers.length) {
+ const attacher = this.attachers[index2];
+ destination.use(...attacher);
+ }
+ destination.data((0, import_extend.default)(true, {}, this.namespace));
+ return destination;
+ }
+ /**
+ * Configure the processor with info available to all plugins.
+ * Information is stored in an object.
+ *
+ * Typically, options can be given to a specific plugin, but sometimes it
+ * makes sense to have information shared with several plugins.
+ * For example, a list of HTML elements that are self-closing, which is
+ * needed during all phases.
+ *
+ * > 👉 **Note**: setting information cannot occur on *frozen* processors.
+ * > Call the processor first to create a new unfrozen processor.
+ *
+ * > 👉 **Note**: to register custom data in TypeScript, augment the
+ * > {@link Data `Data`} interface.
+ *
+ * @example
+ * This example show how to get and set info:
+ *
+ * ```js
+ * import {unified} from 'unified'
+ *
+ * const processor = unified().data('alpha', 'bravo')
+ *
+ * processor.data('alpha') // => 'bravo'
+ *
+ * processor.data() // => {alpha: 'bravo'}
+ *
+ * processor.data({charlie: 'delta'})
+ *
+ * processor.data() // => {charlie: 'delta'}
+ * ```
+ *
+ * @template {keyof Data} Key
+ *
+ * @overload
+ * @returns {Data}
+ *
+ * @overload
+ * @param {Data} dataset
+ * @returns {Processor}
+ *
+ * @overload
+ * @param {Key} key
+ * @returns {Data[Key]}
+ *
+ * @overload
+ * @param {Key} key
+ * @param {Data[Key]} value
+ * @returns {Processor}
+ *
+ * @param {Data | Key} [key]
+ * Key to get or set, or entire dataset to set, or nothing to get the
+ * entire dataset (optional).
+ * @param {Data[Key]} [value]
+ * Value to set (optional).
+ * @returns {unknown}
+ * The current processor when setting, the value at `key` when getting, or
+ * the entire dataset when getting without key.
+ */
+ data(key, value) {
+ if (typeof key === "string") {
+ if (arguments.length === 2) {
+ assertUnfrozen("data", this.frozen);
+ this.namespace[key] = value;
+ return this;
+ }
+ return own4.call(this.namespace, key) && this.namespace[key] || void 0;
+ }
+ if (key) {
+ assertUnfrozen("data", this.frozen);
+ this.namespace = key;
+ return this;
+ }
+ return this.namespace;
+ }
+ /**
+ * Freeze a processor.
+ *
+ * Frozen processors are meant to be extended and not to be configured
+ * directly.
+ *
+ * When a processor is frozen it cannot be unfrozen.
+ * New processors working the same way can be created by calling the
+ * processor.
+ *
+ * It’s possible to freeze processors explicitly by calling `.freeze()`.
+ * Processors freeze automatically when `.parse()`, `.run()`, `.runSync()`,
+ * `.stringify()`, `.process()`, or `.processSync()` are called.
+ *
+ * @returns {Processor}
+ * The current processor.
+ */
+ freeze() {
+ if (this.frozen) {
+ return this;
+ }
+ const self2 = (
+ /** @type {Processor} */
+ /** @type {unknown} */
+ this
+ );
+ while (++this.freezeIndex < this.attachers.length) {
+ const [attacher, ...options2] = this.attachers[this.freezeIndex];
+ if (options2[0] === false) {
+ continue;
+ }
+ if (options2[0] === true) {
+ options2[0] = void 0;
+ }
+ const transformer = attacher.call(self2, ...options2);
+ if (typeof transformer === "function") {
+ this.transformers.use(transformer);
+ }
+ }
+ this.frozen = true;
+ this.freezeIndex = Number.POSITIVE_INFINITY;
+ return this;
+ }
+ /**
+ * Parse text to a syntax tree.
+ *
+ * > 👉 **Note**: `parse` freezes the processor if not already *frozen*.
+ *
+ * > 👉 **Note**: `parse` performs the parse phase, not the run phase or other
+ * > phases.
+ *
+ * @param {Compatible | undefined} [file]
+ * file to parse (optional); typically `string` or `VFile`; any value
+ * accepted as `x` in `new VFile(x)`.
+ * @returns {ParseTree extends undefined ? Node : ParseTree}
+ * Syntax tree representing `file`.
+ */
+ parse(file) {
+ this.freeze();
+ const realFile = vfile(file);
+ const parser = this.parser || this.Parser;
+ assertParser("parse", parser);
+ return parser(String(realFile), realFile);
+ }
+ /**
+ * Process the given file as configured on the processor.
+ *
+ * > 👉 **Note**: `process` freezes the processor if not already *frozen*.
+ *
+ * > 👉 **Note**: `process` performs the parse, run, and stringify phases.
+ *
+ * @overload
+ * @param {Compatible | undefined} file
+ * @param {ProcessCallback>} done
+ * @returns {undefined}
+ *
+ * @overload
+ * @param {Compatible | undefined} [file]
+ * @returns {Promise>}
+ *
+ * @param {Compatible | undefined} [file]
+ * File (optional); typically `string` or `VFile`]; any value accepted as
+ * `x` in `new VFile(x)`.
+ * @param {ProcessCallback> | undefined} [done]
+ * Callback (optional).
+ * @returns {Promise | undefined}
+ * Nothing if `done` is given.
+ * Otherwise a promise, rejected with a fatal error or resolved with the
+ * processed file.
+ *
+ * The parsed, transformed, and compiled value is available at
+ * `file.value` (see note).
+ *
+ * > 👉 **Note**: unified typically compiles by serializing: most
+ * > compilers return `string` (or `Uint8Array`).
+ * > Some compilers, such as the one configured with
+ * > [`rehype-react`][rehype-react], return other values (in this case, a
+ * > React tree).
+ * > If you’re using a compiler that doesn’t serialize, expect different
+ * > result values.
+ * >
+ * > To register custom results in TypeScript, add them to
+ * > {@link CompileResultMap `CompileResultMap`}.
+ *
+ * [rehype-react]: https://github.com/rehypejs/rehype-react
+ */
+ process(file, done) {
+ const self2 = this;
+ this.freeze();
+ assertParser("process", this.parser || this.Parser);
+ assertCompiler("process", this.compiler || this.Compiler);
+ return done ? executor(void 0, done) : new Promise(executor);
+ function executor(resolve, reject) {
+ const realFile = vfile(file);
+ const parseTree = (
+ /** @type {HeadTree extends undefined ? Node : HeadTree} */
+ /** @type {unknown} */
+ self2.parse(realFile)
+ );
+ self2.run(parseTree, realFile, function(error, tree, file2) {
+ if (error || !tree || !file2) {
+ return realDone(error);
+ }
+ const compileTree = (
+ /** @type {CompileTree extends undefined ? Node : CompileTree} */
+ /** @type {unknown} */
+ tree
+ );
+ const compileResult = self2.stringify(compileTree, file2);
+ if (looksLikeAValue(compileResult)) {
+ file2.value = compileResult;
+ } else {
+ file2.result = compileResult;
+ }
+ realDone(
+ error,
+ /** @type {VFileWithOutput} */
+ file2
+ );
+ });
+ function realDone(error, file2) {
+ if (error || !file2) {
+ reject(error);
+ } else if (resolve) {
+ resolve(file2);
+ } else {
+ ok2(done, "`done` is defined if `resolve` is not");
+ done(void 0, file2);
+ }
+ }
+ }
+ }
+ /**
+ * Process the given file as configured on the processor.
+ *
+ * An error is thrown if asynchronous transforms are configured.
+ *
+ * > 👉 **Note**: `processSync` freezes the processor if not already *frozen*.
+ *
+ * > 👉 **Note**: `processSync` performs the parse, run, and stringify phases.
+ *
+ * @param {Compatible | undefined} [file]
+ * File (optional); typically `string` or `VFile`; any value accepted as
+ * `x` in `new VFile(x)`.
+ * @returns {VFileWithOutput}
+ * The processed file.
+ *
+ * The parsed, transformed, and compiled value is available at
+ * `file.value` (see note).
+ *
+ * > 👉 **Note**: unified typically compiles by serializing: most
+ * > compilers return `string` (or `Uint8Array`).
+ * > Some compilers, such as the one configured with
+ * > [`rehype-react`][rehype-react], return other values (in this case, a
+ * > React tree).
+ * > If you’re using a compiler that doesn’t serialize, expect different
+ * > result values.
+ * >
+ * > To register custom results in TypeScript, add them to
+ * > {@link CompileResultMap `CompileResultMap`}.
+ *
+ * [rehype-react]: https://github.com/rehypejs/rehype-react
+ */
+ processSync(file) {
+ let complete = false;
+ let result;
+ this.freeze();
+ assertParser("processSync", this.parser || this.Parser);
+ assertCompiler("processSync", this.compiler || this.Compiler);
+ this.process(file, realDone);
+ assertDone("processSync", "process", complete);
+ ok2(result, "we either bailed on an error or have a tree");
+ return result;
+ function realDone(error, file2) {
+ complete = true;
+ bail(error);
+ result = file2;
+ }
+ }
+ /**
+ * Run *transformers* on a syntax tree.
+ *
+ * > 👉 **Note**: `run` freezes the processor if not already *frozen*.
+ *
+ * > 👉 **Note**: `run` performs the run phase, not other phases.
+ *
+ * @overload
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * @param {RunCallback} done
+ * @returns {undefined}
+ *
+ * @overload
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * @param {Compatible | undefined} file
+ * @param {RunCallback} done
+ * @returns {undefined}
+ *
+ * @overload
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * @param {Compatible | undefined} [file]
+ * @returns {Promise}
+ *
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * Tree to transform and inspect.
+ * @param {(
+ * RunCallback |
+ * Compatible
+ * )} [file]
+ * File associated with `node` (optional); any value accepted as `x` in
+ * `new VFile(x)`.
+ * @param {RunCallback} [done]
+ * Callback (optional).
+ * @returns {Promise | undefined}
+ * Nothing if `done` is given.
+ * Otherwise, a promise rejected with a fatal error or resolved with the
+ * transformed tree.
+ */
+ run(tree, file, done) {
+ assertNode(tree);
+ this.freeze();
+ const transformers = this.transformers;
+ if (!done && typeof file === "function") {
+ done = file;
+ file = void 0;
+ }
+ return done ? executor(void 0, done) : new Promise(executor);
+ function executor(resolve, reject) {
+ ok2(
+ typeof file !== "function",
+ "`file` can\u2019t be a `done` anymore, we checked"
+ );
+ const realFile = vfile(file);
+ transformers.run(tree, realFile, realDone);
+ function realDone(error, outputTree, file2) {
+ const resultingTree = (
+ /** @type {TailTree extends undefined ? Node : TailTree} */
+ outputTree || tree
+ );
+ if (error) {
+ reject(error);
+ } else if (resolve) {
+ resolve(resultingTree);
+ } else {
+ ok2(done, "`done` is defined if `resolve` is not");
+ done(void 0, resultingTree, file2);
+ }
+ }
+ }
+ }
+ /**
+ * Run *transformers* on a syntax tree.
+ *
+ * An error is thrown if asynchronous transforms are configured.
+ *
+ * > 👉 **Note**: `runSync` freezes the processor if not already *frozen*.
+ *
+ * > 👉 **Note**: `runSync` performs the run phase, not other phases.
+ *
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * Tree to transform and inspect.
+ * @param {Compatible | undefined} [file]
+ * File associated with `node` (optional); any value accepted as `x` in
+ * `new VFile(x)`.
+ * @returns {TailTree extends undefined ? Node : TailTree}
+ * Transformed tree.
+ */
+ runSync(tree, file) {
+ let complete = false;
+ let result;
+ this.run(tree, file, realDone);
+ assertDone("runSync", "run", complete);
+ ok2(result, "we either bailed on an error or have a tree");
+ return result;
+ function realDone(error, tree2) {
+ bail(error);
+ result = tree2;
+ complete = true;
+ }
+ }
+ /**
+ * Compile a syntax tree.
+ *
+ * > 👉 **Note**: `stringify` freezes the processor if not already *frozen*.
+ *
+ * > 👉 **Note**: `stringify` performs the stringify phase, not the run phase
+ * > or other phases.
+ *
+ * @param {CompileTree extends undefined ? Node : CompileTree} tree
+ * Tree to compile.
+ * @param {Compatible | undefined} [file]
+ * File associated with `node` (optional); any value accepted as `x` in
+ * `new VFile(x)`.
+ * @returns {CompileResult extends undefined ? Value : CompileResult}
+ * Textual representation of the tree (see note).
+ *
+ * > 👉 **Note**: unified typically compiles by serializing: most compilers
+ * > return `string` (or `Uint8Array`).
+ * > Some compilers, such as the one configured with
+ * > [`rehype-react`][rehype-react], return other values (in this case, a
+ * > React tree).
+ * > If you’re using a compiler that doesn’t serialize, expect different
+ * > result values.
+ * >
+ * > To register custom results in TypeScript, add them to
+ * > {@link CompileResultMap `CompileResultMap`}.
+ *
+ * [rehype-react]: https://github.com/rehypejs/rehype-react
+ */
+ stringify(tree, file) {
+ this.freeze();
+ const realFile = vfile(file);
+ const compiler2 = this.compiler || this.Compiler;
+ assertCompiler("stringify", compiler2);
+ assertNode(tree);
+ return compiler2(tree, realFile);
+ }
+ /**
+ * Configure the processor to use a plugin, a list of usable values, or a
+ * preset.
+ *
+ * If the processor is already using a plugin, the previous plugin
+ * configuration is changed based on the options that are passed in.
+ * In other words, the plugin is not added a second time.
+ *
+ * > 👉 **Note**: `use` cannot be called on *frozen* processors.
+ * > Call the processor first to create a new unfrozen processor.
+ *
+ * @example
+ * There are many ways to pass plugins to `.use()`.
+ * This example gives an overview:
+ *
+ * ```js
+ * import {unified} from 'unified'
+ *
+ * unified()
+ * // Plugin with options:
+ * .use(pluginA, {x: true, y: true})
+ * // Passing the same plugin again merges configuration (to `{x: true, y: false, z: true}`):
+ * .use(pluginA, {y: false, z: true})
+ * // Plugins:
+ * .use([pluginB, pluginC])
+ * // Two plugins, the second with options:
+ * .use([pluginD, [pluginE, {}]])
+ * // Preset with plugins and settings:
+ * .use({plugins: [pluginF, [pluginG, {}]], settings: {position: false}})
+ * // Settings only:
+ * .use({settings: {position: false}})
+ * ```
+ *
+ * @template {Array} [Parameters=[]]
+ * @template {Node | string | undefined} [Input=undefined]
+ * @template [Output=Input]
+ *
+ * @overload
+ * @param {Preset | null | undefined} [preset]
+ * @returns {Processor}
+ *
+ * @overload
+ * @param {PluggableList} list
+ * @returns {Processor}
+ *
+ * @overload
+ * @param {Plugin} plugin
+ * @param {...(Parameters | [boolean])} parameters
+ * @returns {UsePlugin}
+ *
+ * @param {PluggableList | Plugin | Preset | null | undefined} value
+ * Usable value.
+ * @param {...unknown} parameters
+ * Parameters, when a plugin is given as a usable value.
+ * @returns {Processor}
+ * Current processor.
+ */
+ use(value, ...parameters) {
+ const attachers = this.attachers;
+ const namespace = this.namespace;
+ assertUnfrozen("use", this.frozen);
+ if (value === null || value === void 0) {
+ } else if (typeof value === "function") {
+ addPlugin(value, parameters);
+ } else if (typeof value === "object") {
+ if (Array.isArray(value)) {
+ addList(value);
+ } else {
+ addPreset(value);
+ }
+ } else {
+ throw new TypeError("Expected usable value, not `" + value + "`");
+ }
+ return this;
+ function add(value2) {
+ if (typeof value2 === "function") {
+ addPlugin(value2, []);
+ } else if (typeof value2 === "object") {
+ if (Array.isArray(value2)) {
+ const [plugin, ...parameters2] = (
+ /** @type {PluginTuple>} */
+ value2
+ );
+ addPlugin(plugin, parameters2);
+ } else {
+ addPreset(value2);
+ }
+ } else {
+ throw new TypeError("Expected usable value, not `" + value2 + "`");
+ }
+ }
+ function addPreset(result) {
+ if (!("plugins" in result) && !("settings" in result)) {
+ throw new Error(
+ "Expected usable value but received an empty preset, which is probably a mistake: presets typically come with `plugins` and sometimes with `settings`, but this has neither"
+ );
+ }
+ addList(result.plugins);
+ if (result.settings) {
+ namespace.settings = (0, import_extend.default)(true, namespace.settings, result.settings);
+ }
+ }
+ function addList(plugins) {
+ let index2 = -1;
+ if (plugins === null || plugins === void 0) {
+ } else if (Array.isArray(plugins)) {
+ while (++index2 < plugins.length) {
+ const thing = plugins[index2];
+ add(thing);
+ }
+ } else {
+ throw new TypeError("Expected a list of plugins, not `" + plugins + "`");
+ }
+ }
+ function addPlugin(plugin, parameters2) {
+ let index2 = -1;
+ let entryIndex = -1;
+ while (++index2 < attachers.length) {
+ if (attachers[index2][0] === plugin) {
+ entryIndex = index2;
+ break;
+ }
+ }
+ if (entryIndex === -1) {
+ attachers.push([plugin, ...parameters2]);
+ } else if (parameters2.length > 0) {
+ let [primary, ...rest] = parameters2;
+ const currentPrimary = attachers[entryIndex][1];
+ if (isPlainObject(currentPrimary) && isPlainObject(primary)) {
+ primary = (0, import_extend.default)(true, currentPrimary, primary);
+ }
+ attachers[entryIndex] = [plugin, primary, ...rest];
+ }
+ }
+ }
+ };
+ var unified = new Processor().freeze();
+ function assertParser(name, value) {
+ if (typeof value !== "function") {
+ throw new TypeError("Cannot `" + name + "` without `parser`");
+ }
+ }
+ function assertCompiler(name, value) {
+ if (typeof value !== "function") {
+ throw new TypeError("Cannot `" + name + "` without `compiler`");
+ }
+ }
+ function assertUnfrozen(name, frozen) {
+ if (frozen) {
+ throw new Error(
+ "Cannot call `" + name + "` on a frozen processor.\nCreate a new processor first, by calling it: use `processor()` instead of `processor`."
+ );
+ }
+ }
+ function assertNode(node2) {
+ if (!isPlainObject(node2) || typeof node2.type !== "string") {
+ throw new TypeError("Expected node, got `" + node2 + "`");
+ }
+ }
+ function assertDone(name, asyncName, complete) {
+ if (!complete) {
+ throw new Error(
+ "`" + name + "` finished async. Use `" + asyncName + "` instead"
+ );
+ }
+ }
+ function vfile(value) {
+ return looksLikeAVFile(value) ? value : new VFile(value);
+ }
+ function looksLikeAVFile(value) {
+ return Boolean(
+ value && typeof value === "object" && "message" in value && "messages" in value
+ );
+ }
+ function looksLikeAValue(value) {
+ return typeof value === "string" || isUint8Array2(value);
+ }
+ function isUint8Array2(value) {
+ return Boolean(
+ value && typeof value === "object" && "byteLength" in value && "byteOffset" in value
+ );
+ }
+
+ // node_modules/@milkdown/transformer/lib/index.es.js
+ var G2 = (p4, h5, n4) => {
+ if (!h5.has(p4))
+ throw TypeError("Cannot " + n4);
+ };
+ var r = (p4, h5, n4) => (G2(p4, h5, "read from private field"), n4 ? n4.call(p4) : h5.get(p4));
+ var c2 = (p4, h5, n4) => {
+ if (h5.has(p4))
+ throw TypeError("Cannot add the same private member more than once");
+ h5 instanceof WeakSet ? h5.add(p4) : h5.set(p4, n4);
+ };
+ var o = (p4, h5, n4, t2) => (G2(p4, h5, "write to private field"), t2 ? t2.call(p4, n4) : h5.set(p4, n4), n4);
+ var Q = class {
+ };
+ var U2 = class {
+ constructor() {
+ this.elements = [], this.size = () => this.elements.length, this.top = () => this.elements.at(-1), this.push = (h5) => {
+ var n4;
+ (n4 = this.top()) == null || n4.push(h5);
+ }, this.open = (h5) => {
+ this.elements.push(h5);
+ }, this.close = () => {
+ const h5 = this.elements.pop();
+ if (!h5)
+ throw h();
+ return h5;
+ };
+ }
+ };
+ var B = class _B extends Q {
+ constructor(h5, n4, t2) {
+ super(), this.type = h5, this.content = n4, this.attrs = t2;
+ }
+ push(h5, ...n4) {
+ this.content.push(h5, ...n4);
+ }
+ pop() {
+ return this.content.pop();
+ }
+ static create(h5, n4, t2) {
+ return new _B(h5, n4, t2);
+ }
+ };
+ var d3;
+ var N;
+ var O;
+ var T2;
+ var F2;
+ var k2;
+ var M3;
+ var S3 = class S4 extends U2 {
+ /// @internal
+ constructor(n4) {
+ super();
+ c2(this, d3, void 0);
+ c2(this, N, void 0);
+ c2(this, O, void 0);
+ c2(this, T2, void 0);
+ c2(this, F2, void 0);
+ c2(this, k2, void 0);
+ c2(this, M3, void 0);
+ o(this, d3, Mark.none), o(this, N, (t2) => t2.isText), o(this, O, (t2, s2) => {
+ if (r(this, N).call(this, t2) && r(this, N).call(this, s2) && Mark.sameSet(t2.marks, s2.marks))
+ return this.schema.text(t2.text + s2.text, t2.marks);
+ }), o(this, T2, (t2) => {
+ const s2 = Object.values(__spreadValues(__spreadValues({}, this.schema.nodes), this.schema.marks)).find((e2) => e2.spec.parseMarkdown.match(t2));
+ if (!s2)
+ throw w(t2);
+ return s2;
+ }), o(this, F2, (t2) => {
+ const s2 = r(this, T2).call(this, t2);
+ s2.spec.parseMarkdown.runner(this, t2, s2);
+ }), this.injectRoot = (t2, s2, e2) => (this.openNode(s2, e2), this.next(t2.children), this), this.openNode = (t2, s2) => (this.open(B.create(t2, [], s2)), this), o(this, k2, () => {
+ o(this, d3, Mark.none);
+ const t2 = this.close();
+ return r(this, M3).call(this, t2.type, t2.attrs, t2.content);
+ }), this.closeNode = () => (r(this, k2).call(this), this), o(this, M3, (t2, s2, e2) => {
+ const i2 = t2.createAndFill(s2, e2, r(this, d3));
+ if (!i2)
+ throw g(t2, s2, e2);
+ return this.push(i2), i2;
+ }), this.addNode = (t2, s2, e2) => (r(this, M3).call(this, t2, s2, e2), this), this.openMark = (t2, s2) => {
+ const e2 = t2.create(s2);
+ return o(this, d3, e2.addToSet(r(this, d3))), this;
+ }, this.closeMark = (t2) => (o(this, d3, t2.removeFromSet(r(this, d3))), this), this.addText = (t2) => {
+ const s2 = this.top();
+ if (!s2)
+ throw h();
+ const e2 = s2.pop(), i2 = this.schema.text(t2, r(this, d3));
+ if (!e2)
+ return s2.push(i2), this;
+ const a2 = r(this, O).call(this, e2, i2);
+ return a2 ? (s2.push(a2), this) : (s2.push(e2, i2), this);
+ }, this.build = () => {
+ let t2;
+ do
+ t2 = r(this, k2).call(this);
+ while (this.size());
+ return t2;
+ }, this.next = (t2 = []) => ([t2].flat().forEach((s2) => r(this, F2).call(this, s2)), this), this.toDoc = () => this.build(), this.run = (t2, s2) => {
+ const e2 = t2.runSync(t2.parse(s2), s2);
+ return this.next(e2), this;
+ }, this.schema = n4;
+ }
+ };
+ d3 = /* @__PURE__ */ new WeakMap(), N = /* @__PURE__ */ new WeakMap(), O = /* @__PURE__ */ new WeakMap(), T2 = /* @__PURE__ */ new WeakMap(), F2 = /* @__PURE__ */ new WeakMap(), k2 = /* @__PURE__ */ new WeakMap(), M3 = /* @__PURE__ */ new WeakMap(), S3.create = (n4, t2) => {
+ const s2 = new S3(n4);
+ return (e2) => (s2.run(t2, e2), s2.toDoc());
+ };
+ var H2 = S3;
+ var q2 = class q3 extends Q {
+ constructor(h5, n4, t2, s2 = {}) {
+ super(), this.type = h5, this.children = n4, this.value = t2, this.props = s2, this.push = (e2, ...i2) => {
+ this.children || (this.children = []), this.children.push(e2, ...i2);
+ }, this.pop = () => {
+ var e2;
+ return (e2 = this.children) == null ? void 0 : e2.pop();
+ };
+ }
+ };
+ q2.create = (h5, n4, t2, s2 = {}) => new q2(h5, n4, t2, s2);
+ var J2 = q2;
+ var Z = (p4) => Object.prototype.hasOwnProperty.call(p4, "size");
+ var l3;
+ var v;
+ var A2;
+ var E2;
+ var w3;
+ var j2;
+ var x3;
+ var R2;
+ var m2;
+ var g3;
+ var C2;
+ var P2;
+ var z = class z2 extends U2 {
+ /// @internal
+ constructor(n4) {
+ super();
+ c2(this, l3, void 0);
+ c2(this, v, void 0);
+ c2(this, A2, void 0);
+ c2(this, E2, void 0);
+ c2(this, w3, void 0);
+ c2(this, j2, void 0);
+ c2(this, x3, void 0);
+ c2(this, R2, void 0);
+ c2(this, m2, void 0);
+ c2(this, g3, void 0);
+ c2(this, C2, void 0);
+ c2(this, P2, void 0);
+ o(this, l3, Mark.none), o(this, v, (t2) => {
+ const s2 = Object.values(__spreadValues(__spreadValues({}, this.schema.nodes), this.schema.marks)).find((e2) => e2.spec.toMarkdown.match(t2));
+ if (!s2)
+ throw F(t2.type);
+ return s2;
+ }), o(this, A2, (t2) => r(this, v).call(this, t2).spec.toMarkdown.runner(this, t2)), o(this, E2, (t2, s2) => r(this, v).call(this, t2).spec.toMarkdown.runner(this, t2, s2)), o(this, w3, (t2) => {
+ const { marks: s2 } = t2, e2 = (u4) => {
+ var _a;
+ return (_a = u4.type.spec.priority) != null ? _a : 50;
+ };
+ [...s2].sort((u4, f3) => e2(u4) - e2(f3)).every((u4) => !r(this, E2).call(this, u4, t2)) && r(this, A2).call(this, t2), s2.forEach((u4) => r(this, P2).call(this, u4));
+ }), o(this, j2, (t2, s2) => {
+ var f3;
+ if (t2.type === s2 || ((f3 = t2.children) == null ? void 0 : f3.length) !== 1)
+ return t2;
+ const e2 = (y4) => {
+ var I4;
+ if (y4.type === s2)
+ return y4;
+ if (((I4 = y4.children) == null ? void 0 : I4.length) !== 1)
+ return null;
+ const [b4] = y4.children;
+ return b4 ? e2(b4) : null;
+ }, i2 = e2(t2);
+ if (!i2)
+ return t2;
+ const a2 = i2.children ? [...i2.children] : void 0, u4 = __spreadProps(__spreadValues({}, t2), { children: a2 });
+ return u4.children = a2, i2.children = [u4], i2;
+ }), o(this, x3, (t2) => {
+ const { children: s2 } = t2;
+ return s2 && (t2.children = s2.reduce((e2, i2, a2) => {
+ if (a2 === 0)
+ return [i2];
+ const u4 = e2.at(-1);
+ if (u4 && u4.isMark && i2.isMark) {
+ i2 = r(this, j2).call(this, i2, u4.type);
+ const _a = i2, { children: f3 } = _a, y4 = __objRest(_a, ["children"]), _b = u4, { children: b4 } = _b, I4 = __objRest(_b, ["children"]);
+ if (i2.type === u4.type && f3 && b4 && JSON.stringify(y4) === JSON.stringify(I4)) {
+ const V4 = __spreadProps(__spreadValues({}, I4), {
+ children: [...b4, ...f3]
+ });
+ return e2.slice(0, -1).concat(r(this, x3).call(this, V4));
+ }
+ }
+ return e2.concat(i2);
+ }, [])), t2;
+ }), o(this, R2, (t2) => {
+ const s2 = __spreadProps(__spreadValues({}, t2.props), {
+ type: t2.type
+ });
+ return t2.children && (s2.children = t2.children), t2.value && (s2.value = t2.value), s2;
+ }), this.openNode = (t2, s2, e2) => (this.open(J2.create(t2, void 0, s2, e2)), this), o(this, m2, () => {
+ const t2 = this.close();
+ return r(this, g3).call(this, t2.type, t2.children, t2.value, t2.props);
+ }), this.closeNode = () => (r(this, m2).call(this), this), o(this, g3, (t2, s2, e2, i2) => {
+ const a2 = J2.create(t2, s2, e2, i2), u4 = r(this, x3).call(this, r(this, R2).call(this, a2));
+ return this.push(u4), u4;
+ }), this.addNode = (t2, s2, e2, i2) => (r(this, g3).call(this, t2, s2, e2, i2), this), o(this, C2, (t2, s2, e2, i2) => t2.isInSet(r(this, l3)) ? this : (o(this, l3, t2.addToSet(r(this, l3))), this.openNode(s2, e2, __spreadProps(__spreadValues({}, i2), { isMark: true })))), o(this, P2, (t2) => {
+ t2.isInSet(r(this, l3)) && (o(this, l3, t2.type.removeFromSet(r(this, l3))), r(this, m2).call(this));
+ }), this.withMark = (t2, s2, e2, i2) => (r(this, C2).call(this, t2, s2, e2, i2), this), this.closeMark = (t2) => (r(this, P2).call(this, t2), this), this.build = () => {
+ let t2 = null;
+ do
+ t2 = r(this, m2).call(this);
+ while (this.size());
+ return t2;
+ }, this.next = (t2) => Z(t2) ? (t2.forEach((s2) => {
+ r(this, w3).call(this, s2);
+ }), this) : (r(this, w3).call(this, t2), this), this.toString = (t2) => t2.stringify(this.build()), this.run = (t2) => (this.next(t2), this), this.schema = n4;
+ }
+ };
+ l3 = /* @__PURE__ */ new WeakMap(), v = /* @__PURE__ */ new WeakMap(), A2 = /* @__PURE__ */ new WeakMap(), E2 = /* @__PURE__ */ new WeakMap(), w3 = /* @__PURE__ */ new WeakMap(), j2 = /* @__PURE__ */ new WeakMap(), x3 = /* @__PURE__ */ new WeakMap(), R2 = /* @__PURE__ */ new WeakMap(), m2 = /* @__PURE__ */ new WeakMap(), g3 = /* @__PURE__ */ new WeakMap(), C2 = /* @__PURE__ */ new WeakMap(), P2 = /* @__PURE__ */ new WeakMap(), z.create = (n4, t2) => {
+ const s2 = new z(n4);
+ return (e2) => (s2.run(e2), s2.toString(t2));
+ };
+ var K2 = z;
+
+ // node_modules/prosemirror-transform/dist/index.js
+ var lower16 = 65535;
+ var factor16 = Math.pow(2, 16);
+ function makeRecover(index2, offset) {
+ return index2 + offset * factor16;
+ }
+ function recoverIndex(value) {
+ return value & lower16;
+ }
+ function recoverOffset(value) {
+ return (value - (value & lower16)) / factor16;
+ }
+ var DEL_BEFORE = 1;
+ var DEL_AFTER = 2;
+ var DEL_ACROSS = 4;
+ var DEL_SIDE = 8;
+ var MapResult = class {
+ /**
+ @internal
+ */
+ constructor(pos, delInfo, recover) {
+ this.pos = pos;
+ this.delInfo = delInfo;
+ this.recover = recover;
+ }
+ /**
+ Tells you whether the position was deleted, that is, whether the
+ step removed the token on the side queried (via the `assoc`)
+ argument from the document.
+ */
+ get deleted() {
+ return (this.delInfo & DEL_SIDE) > 0;
+ }
+ /**
+ Tells you whether the token before the mapped position was deleted.
+ */
+ get deletedBefore() {
+ return (this.delInfo & (DEL_BEFORE | DEL_ACROSS)) > 0;
+ }
+ /**
+ True when the token after the mapped position was deleted.
+ */
+ get deletedAfter() {
+ return (this.delInfo & (DEL_AFTER | DEL_ACROSS)) > 0;
+ }
+ /**
+ Tells whether any of the steps mapped through deletes across the
+ position (including both the token before and after the
+ position).
+ */
+ get deletedAcross() {
+ return (this.delInfo & DEL_ACROSS) > 0;
+ }
+ };
+ var StepMap = class _StepMap {
+ /**
+ Create a position map. The modifications to the document are
+ represented as an array of numbers, in which each group of three
+ represents a modified chunk as `[start, oldSize, newSize]`.
+ */
+ constructor(ranges, inverted = false) {
+ this.ranges = ranges;
+ this.inverted = inverted;
+ if (!ranges.length && _StepMap.empty)
+ return _StepMap.empty;
+ }
+ /**
+ @internal
+ */
+ recover(value) {
+ let diff2 = 0, index2 = recoverIndex(value);
+ if (!this.inverted)
+ for (let i2 = 0; i2 < index2; i2++)
+ diff2 += this.ranges[i2 * 3 + 2] - this.ranges[i2 * 3 + 1];
+ return this.ranges[index2 * 3] + diff2 + recoverOffset(value);
+ }
+ mapResult(pos, assoc = 1) {
+ return this._map(pos, assoc, false);
+ }
+ map(pos, assoc = 1) {
+ return this._map(pos, assoc, true);
+ }
+ /**
+ @internal
+ */
+ _map(pos, assoc, simple) {
+ let diff2 = 0, oldIndex = this.inverted ? 2 : 1, newIndex = this.inverted ? 1 : 2;
+ for (let i2 = 0; i2 < this.ranges.length; i2 += 3) {
+ let start = this.ranges[i2] - (this.inverted ? diff2 : 0);
+ if (start > pos)
+ break;
+ let oldSize = this.ranges[i2 + oldIndex], newSize = this.ranges[i2 + newIndex], end = start + oldSize;
+ if (pos <= end) {
+ let side = !oldSize ? assoc : pos == start ? -1 : pos == end ? 1 : assoc;
+ let result = start + diff2 + (side < 0 ? 0 : newSize);
+ if (simple)
+ return result;
+ let recover = pos == (assoc < 0 ? start : end) ? null : makeRecover(i2 / 3, pos - start);
+ let del2 = pos == start ? DEL_AFTER : pos == end ? DEL_BEFORE : DEL_ACROSS;
+ if (assoc < 0 ? pos != start : pos != end)
+ del2 |= DEL_SIDE;
+ return new MapResult(result, del2, recover);
+ }
+ diff2 += newSize - oldSize;
+ }
+ return simple ? pos + diff2 : new MapResult(pos + diff2, 0, null);
+ }
+ /**
+ @internal
+ */
+ touches(pos, recover) {
+ let diff2 = 0, index2 = recoverIndex(recover);
+ let oldIndex = this.inverted ? 2 : 1, newIndex = this.inverted ? 1 : 2;
+ for (let i2 = 0; i2 < this.ranges.length; i2 += 3) {
+ let start = this.ranges[i2] - (this.inverted ? diff2 : 0);
+ if (start > pos)
+ break;
+ let oldSize = this.ranges[i2 + oldIndex], end = start + oldSize;
+ if (pos <= end && i2 == index2 * 3)
+ return true;
+ diff2 += this.ranges[i2 + newIndex] - oldSize;
+ }
+ return false;
+ }
+ /**
+ Calls the given function on each of the changed ranges included in
+ this map.
+ */
+ forEach(f3) {
+ let oldIndex = this.inverted ? 2 : 1, newIndex = this.inverted ? 1 : 2;
+ for (let i2 = 0, diff2 = 0; i2 < this.ranges.length; i2 += 3) {
+ let start = this.ranges[i2], oldStart = start - (this.inverted ? diff2 : 0), newStart = start + (this.inverted ? 0 : diff2);
+ let oldSize = this.ranges[i2 + oldIndex], newSize = this.ranges[i2 + newIndex];
+ f3(oldStart, oldStart + oldSize, newStart, newStart + newSize);
+ diff2 += newSize - oldSize;
+ }
+ }
+ /**
+ Create an inverted version of this map. The result can be used to
+ map positions in the post-step document to the pre-step document.
+ */
+ invert() {
+ return new _StepMap(this.ranges, !this.inverted);
+ }
+ /**
+ @internal
+ */
+ toString() {
+ return (this.inverted ? "-" : "") + JSON.stringify(this.ranges);
+ }
+ /**
+ Create a map that moves all positions by offset `n` (which may be
+ negative). This can be useful when applying steps meant for a
+ sub-document to a larger document, or vice-versa.
+ */
+ static offset(n4) {
+ return n4 == 0 ? _StepMap.empty : new _StepMap(n4 < 0 ? [0, -n4, 0] : [0, 0, n4]);
+ }
+ };
+ StepMap.empty = new StepMap([]);
+ var Mapping = class _Mapping {
+ /**
+ Create a new mapping with the given position maps.
+ */
+ constructor(maps = [], mirror, from = 0, to = maps.length) {
+ this.maps = maps;
+ this.mirror = mirror;
+ this.from = from;
+ this.to = to;
+ }
+ /**
+ Create a mapping that maps only through a part of this one.
+ */
+ slice(from = 0, to = this.maps.length) {
+ return new _Mapping(this.maps, this.mirror, from, to);
+ }
+ /**
+ @internal
+ */
+ copy() {
+ return new _Mapping(this.maps.slice(), this.mirror && this.mirror.slice(), this.from, this.to);
+ }
+ /**
+ Add a step map to the end of this mapping. If `mirrors` is
+ given, it should be the index of the step map that is the mirror
+ image of this one.
+ */
+ appendMap(map5, mirrors) {
+ this.to = this.maps.push(map5);
+ if (mirrors != null)
+ this.setMirror(this.maps.length - 1, mirrors);
+ }
+ /**
+ Add all the step maps in a given mapping to this one (preserving
+ mirroring information).
+ */
+ appendMapping(mapping) {
+ for (let i2 = 0, startSize = this.maps.length; i2 < mapping.maps.length; i2++) {
+ let mirr = mapping.getMirror(i2);
+ this.appendMap(mapping.maps[i2], mirr != null && mirr < i2 ? startSize + mirr : void 0);
+ }
+ }
+ /**
+ Finds the offset of the step map that mirrors the map at the
+ given offset, in this mapping (as per the second argument to
+ `appendMap`).
+ */
+ getMirror(n4) {
+ if (this.mirror) {
+ for (let i2 = 0; i2 < this.mirror.length; i2++)
+ if (this.mirror[i2] == n4)
+ return this.mirror[i2 + (i2 % 2 ? -1 : 1)];
+ }
+ }
+ /**
+ @internal
+ */
+ setMirror(n4, m3) {
+ if (!this.mirror)
+ this.mirror = [];
+ this.mirror.push(n4, m3);
+ }
+ /**
+ Append the inverse of the given mapping to this one.
+ */
+ appendMappingInverted(mapping) {
+ for (let i2 = mapping.maps.length - 1, totalSize = this.maps.length + mapping.maps.length; i2 >= 0; i2--) {
+ let mirr = mapping.getMirror(i2);
+ this.appendMap(mapping.maps[i2].invert(), mirr != null && mirr > i2 ? totalSize - mirr - 1 : void 0);
+ }
+ }
+ /**
+ Create an inverted version of this mapping.
+ */
+ invert() {
+ let inverse = new _Mapping();
+ inverse.appendMappingInverted(this);
+ return inverse;
+ }
+ /**
+ Map a position through this mapping.
+ */
+ map(pos, assoc = 1) {
+ if (this.mirror)
+ return this._map(pos, assoc, true);
+ for (let i2 = this.from; i2 < this.to; i2++)
+ pos = this.maps[i2].map(pos, assoc);
+ return pos;
+ }
+ /**
+ Map a position through this mapping, returning a mapping
+ result.
+ */
+ mapResult(pos, assoc = 1) {
+ return this._map(pos, assoc, false);
+ }
+ /**
+ @internal
+ */
+ _map(pos, assoc, simple) {
+ let delInfo = 0;
+ for (let i2 = this.from; i2 < this.to; i2++) {
+ let map5 = this.maps[i2], result = map5.mapResult(pos, assoc);
+ if (result.recover != null) {
+ let corr = this.getMirror(i2);
+ if (corr != null && corr > i2 && corr < this.to) {
+ i2 = corr;
+ pos = this.maps[corr].recover(result.recover);
+ continue;
+ }
+ }
+ delInfo |= result.delInfo;
+ pos = result.pos;
+ }
+ return simple ? pos : new MapResult(pos, delInfo, null);
+ }
+ };
+ var stepsByID = /* @__PURE__ */ Object.create(null);
+ var Step = class {
+ /**
+ Get the step map that represents the changes made by this step,
+ and which can be used to transform between positions in the old
+ and the new document.
+ */
+ getMap() {
+ return StepMap.empty;
+ }
+ /**
+ Try to merge this step with another one, to be applied directly
+ after it. Returns the merged step when possible, null if the
+ steps can't be merged.
+ */
+ merge(other) {
+ return null;
+ }
+ /**
+ Deserialize a step from its JSON representation. Will call
+ through to the step class' own implementation of this method.
+ */
+ static fromJSON(schema, json) {
+ if (!json || !json.stepType)
+ throw new RangeError("Invalid input for Step.fromJSON");
+ let type = stepsByID[json.stepType];
+ if (!type)
+ throw new RangeError(`No step type ${json.stepType} defined`);
+ return type.fromJSON(schema, json);
+ }
+ /**
+ To be able to serialize steps to JSON, each step needs a string
+ ID to attach to its JSON representation. Use this method to
+ register an ID for your step classes. Try to pick something
+ that's unlikely to clash with steps from other modules.
+ */
+ static jsonID(id, stepClass) {
+ if (id in stepsByID)
+ throw new RangeError("Duplicate use of step JSON ID " + id);
+ stepsByID[id] = stepClass;
+ stepClass.prototype.jsonID = id;
+ return stepClass;
+ }
+ };
+ var StepResult = class _StepResult {
+ /**
+ @internal
+ */
+ constructor(doc4, failed) {
+ this.doc = doc4;
+ this.failed = failed;
+ }
+ /**
+ Create a successful step result.
+ */
+ static ok(doc4) {
+ return new _StepResult(doc4, null);
+ }
+ /**
+ Create a failed step result.
+ */
+ static fail(message) {
+ return new _StepResult(null, message);
+ }
+ /**
+ Call [`Node.replace`](https://prosemirror.net/docs/ref/#model.Node.replace) with the given
+ arguments. Create a successful result if it succeeds, and a
+ failed one if it throws a `ReplaceError`.
+ */
+ static fromReplace(doc4, from, to, slice) {
+ try {
+ return _StepResult.ok(doc4.replace(from, to, slice));
+ } catch (e2) {
+ if (e2 instanceof ReplaceError)
+ return _StepResult.fail(e2.message);
+ throw e2;
+ }
+ }
+ };
+ function mapFragment(fragment, f3, parent) {
+ let mapped = [];
+ for (let i2 = 0; i2 < fragment.childCount; i2++) {
+ let child = fragment.child(i2);
+ if (child.content.size)
+ child = child.copy(mapFragment(child.content, f3, child));
+ if (child.isInline)
+ child = f3(child, parent, i2);
+ mapped.push(child);
+ }
+ return Fragment.fromArray(mapped);
+ }
+ var AddMarkStep = class _AddMarkStep extends Step {
+ /**
+ Create a mark step.
+ */
+ constructor(from, to, mark) {
+ super();
+ this.from = from;
+ this.to = to;
+ this.mark = mark;
+ }
+ apply(doc4) {
+ let oldSlice = doc4.slice(this.from, this.to), $from = doc4.resolve(this.from);
+ let parent = $from.node($from.sharedDepth(this.to));
+ let slice = new Slice(mapFragment(oldSlice.content, (node2, parent2) => {
+ if (!node2.isAtom || !parent2.type.allowsMarkType(this.mark.type))
+ return node2;
+ return node2.mark(this.mark.addToSet(node2.marks));
+ }, parent), oldSlice.openStart, oldSlice.openEnd);
+ return StepResult.fromReplace(doc4, this.from, this.to, slice);
+ }
+ invert() {
+ return new RemoveMarkStep(this.from, this.to, this.mark);
+ }
+ map(mapping) {
+ let from = mapping.mapResult(this.from, 1), to = mapping.mapResult(this.to, -1);
+ if (from.deleted && to.deleted || from.pos >= to.pos)
+ return null;
+ return new _AddMarkStep(from.pos, to.pos, this.mark);
+ }
+ merge(other) {
+ if (other instanceof _AddMarkStep && other.mark.eq(this.mark) && this.from <= other.to && this.to >= other.from)
+ return new _AddMarkStep(Math.min(this.from, other.from), Math.max(this.to, other.to), this.mark);
+ return null;
+ }
+ toJSON() {
+ return {
+ stepType: "addMark",
+ mark: this.mark.toJSON(),
+ from: this.from,
+ to: this.to
+ };
+ }
+ /**
+ @internal
+ */
+ static fromJSON(schema, json) {
+ if (typeof json.from != "number" || typeof json.to != "number")
+ throw new RangeError("Invalid input for AddMarkStep.fromJSON");
+ return new _AddMarkStep(json.from, json.to, schema.markFromJSON(json.mark));
+ }
+ };
+ Step.jsonID("addMark", AddMarkStep);
+ var RemoveMarkStep = class _RemoveMarkStep extends Step {
+ /**
+ Create a mark-removing step.
+ */
+ constructor(from, to, mark) {
+ super();
+ this.from = from;
+ this.to = to;
+ this.mark = mark;
+ }
+ apply(doc4) {
+ let oldSlice = doc4.slice(this.from, this.to);
+ let slice = new Slice(mapFragment(oldSlice.content, (node2) => {
+ return node2.mark(this.mark.removeFromSet(node2.marks));
+ }, doc4), oldSlice.openStart, oldSlice.openEnd);
+ return StepResult.fromReplace(doc4, this.from, this.to, slice);
+ }
+ invert() {
+ return new AddMarkStep(this.from, this.to, this.mark);
+ }
+ map(mapping) {
+ let from = mapping.mapResult(this.from, 1), to = mapping.mapResult(this.to, -1);
+ if (from.deleted && to.deleted || from.pos >= to.pos)
+ return null;
+ return new _RemoveMarkStep(from.pos, to.pos, this.mark);
+ }
+ merge(other) {
+ if (other instanceof _RemoveMarkStep && other.mark.eq(this.mark) && this.from <= other.to && this.to >= other.from)
+ return new _RemoveMarkStep(Math.min(this.from, other.from), Math.max(this.to, other.to), this.mark);
+ return null;
+ }
+ toJSON() {
+ return {
+ stepType: "removeMark",
+ mark: this.mark.toJSON(),
+ from: this.from,
+ to: this.to
+ };
+ }
+ /**
+ @internal
+ */
+ static fromJSON(schema, json) {
+ if (typeof json.from != "number" || typeof json.to != "number")
+ throw new RangeError("Invalid input for RemoveMarkStep.fromJSON");
+ return new _RemoveMarkStep(json.from, json.to, schema.markFromJSON(json.mark));
+ }
+ };
+ Step.jsonID("removeMark", RemoveMarkStep);
+ var AddNodeMarkStep = class _AddNodeMarkStep extends Step {
+ /**
+ Create a node mark step.
+ */
+ constructor(pos, mark) {
+ super();
+ this.pos = pos;
+ this.mark = mark;
+ }
+ apply(doc4) {
+ let node2 = doc4.nodeAt(this.pos);
+ if (!node2)
+ return StepResult.fail("No node at mark step's position");
+ let updated = node2.type.create(node2.attrs, null, this.mark.addToSet(node2.marks));
+ return StepResult.fromReplace(doc4, this.pos, this.pos + 1, new Slice(Fragment.from(updated), 0, node2.isLeaf ? 0 : 1));
+ }
+ invert(doc4) {
+ let node2 = doc4.nodeAt(this.pos);
+ if (node2) {
+ let newSet = this.mark.addToSet(node2.marks);
+ if (newSet.length == node2.marks.length) {
+ for (let i2 = 0; i2 < node2.marks.length; i2++)
+ if (!node2.marks[i2].isInSet(newSet))
+ return new _AddNodeMarkStep(this.pos, node2.marks[i2]);
+ return new _AddNodeMarkStep(this.pos, this.mark);
+ }
+ }
+ return new RemoveNodeMarkStep(this.pos, this.mark);
+ }
+ map(mapping) {
+ let pos = mapping.mapResult(this.pos, 1);
+ return pos.deletedAfter ? null : new _AddNodeMarkStep(pos.pos, this.mark);
+ }
+ toJSON() {
+ return { stepType: "addNodeMark", pos: this.pos, mark: this.mark.toJSON() };
+ }
+ /**
+ @internal
+ */
+ static fromJSON(schema, json) {
+ if (typeof json.pos != "number")
+ throw new RangeError("Invalid input for AddNodeMarkStep.fromJSON");
+ return new _AddNodeMarkStep(json.pos, schema.markFromJSON(json.mark));
+ }
+ };
+ Step.jsonID("addNodeMark", AddNodeMarkStep);
+ var RemoveNodeMarkStep = class _RemoveNodeMarkStep extends Step {
+ /**
+ Create a mark-removing step.
+ */
+ constructor(pos, mark) {
+ super();
+ this.pos = pos;
+ this.mark = mark;
+ }
+ apply(doc4) {
+ let node2 = doc4.nodeAt(this.pos);
+ if (!node2)
+ return StepResult.fail("No node at mark step's position");
+ let updated = node2.type.create(node2.attrs, null, this.mark.removeFromSet(node2.marks));
+ return StepResult.fromReplace(doc4, this.pos, this.pos + 1, new Slice(Fragment.from(updated), 0, node2.isLeaf ? 0 : 1));
+ }
+ invert(doc4) {
+ let node2 = doc4.nodeAt(this.pos);
+ if (!node2 || !this.mark.isInSet(node2.marks))
+ return this;
+ return new AddNodeMarkStep(this.pos, this.mark);
+ }
+ map(mapping) {
+ let pos = mapping.mapResult(this.pos, 1);
+ return pos.deletedAfter ? null : new _RemoveNodeMarkStep(pos.pos, this.mark);
+ }
+ toJSON() {
+ return { stepType: "removeNodeMark", pos: this.pos, mark: this.mark.toJSON() };
+ }
+ /**
+ @internal
+ */
+ static fromJSON(schema, json) {
+ if (typeof json.pos != "number")
+ throw new RangeError("Invalid input for RemoveNodeMarkStep.fromJSON");
+ return new _RemoveNodeMarkStep(json.pos, schema.markFromJSON(json.mark));
+ }
+ };
+ Step.jsonID("removeNodeMark", RemoveNodeMarkStep);
+ var ReplaceStep = class _ReplaceStep extends Step {
+ /**
+ The given `slice` should fit the 'gap' between `from` and
+ `to`—the depths must line up, and the surrounding nodes must be
+ able to be joined with the open sides of the slice. When
+ `structure` is true, the step will fail if the content between
+ from and to is not just a sequence of closing and then opening
+ tokens (this is to guard against rebased replace steps
+ overwriting something they weren't supposed to).
+ */
+ constructor(from, to, slice, structure = false) {
+ super();
+ this.from = from;
+ this.to = to;
+ this.slice = slice;
+ this.structure = structure;
+ }
+ apply(doc4) {
+ if (this.structure && contentBetween(doc4, this.from, this.to))
+ return StepResult.fail("Structure replace would overwrite content");
+ return StepResult.fromReplace(doc4, this.from, this.to, this.slice);
+ }
+ getMap() {
+ return new StepMap([this.from, this.to - this.from, this.slice.size]);
+ }
+ invert(doc4) {
+ return new _ReplaceStep(this.from, this.from + this.slice.size, doc4.slice(this.from, this.to));
+ }
+ map(mapping) {
+ let from = mapping.mapResult(this.from, 1), to = mapping.mapResult(this.to, -1);
+ if (from.deletedAcross && to.deletedAcross)
+ return null;
+ return new _ReplaceStep(from.pos, Math.max(from.pos, to.pos), this.slice);
+ }
+ merge(other) {
+ if (!(other instanceof _ReplaceStep) || other.structure || this.structure)
+ return null;
+ if (this.from + this.slice.size == other.from && !this.slice.openEnd && !other.slice.openStart) {
+ let slice = this.slice.size + other.slice.size == 0 ? Slice.empty : new Slice(this.slice.content.append(other.slice.content), this.slice.openStart, other.slice.openEnd);
+ return new _ReplaceStep(this.from, this.to + (other.to - other.from), slice, this.structure);
+ } else if (other.to == this.from && !this.slice.openStart && !other.slice.openEnd) {
+ let slice = this.slice.size + other.slice.size == 0 ? Slice.empty : new Slice(other.slice.content.append(this.slice.content), other.slice.openStart, this.slice.openEnd);
+ return new _ReplaceStep(other.from, this.to, slice, this.structure);
+ } else {
+ return null;
+ }
+ }
+ toJSON() {
+ let json = { stepType: "replace", from: this.from, to: this.to };
+ if (this.slice.size)
+ json.slice = this.slice.toJSON();
+ if (this.structure)
+ json.structure = true;
+ return json;
+ }
+ /**
+ @internal
+ */
+ static fromJSON(schema, json) {
+ if (typeof json.from != "number" || typeof json.to != "number")
+ throw new RangeError("Invalid input for ReplaceStep.fromJSON");
+ return new _ReplaceStep(json.from, json.to, Slice.fromJSON(schema, json.slice), !!json.structure);
+ }
+ };
+ Step.jsonID("replace", ReplaceStep);
+ var ReplaceAroundStep = class _ReplaceAroundStep extends Step {
+ /**
+ Create a replace-around step with the given range and gap.
+ `insert` should be the point in the slice into which the content
+ of the gap should be moved. `structure` has the same meaning as
+ it has in the [`ReplaceStep`](https://prosemirror.net/docs/ref/#transform.ReplaceStep) class.
+ */
+ constructor(from, to, gapFrom, gapTo, slice, insert, structure = false) {
+ super();
+ this.from = from;
+ this.to = to;
+ this.gapFrom = gapFrom;
+ this.gapTo = gapTo;
+ this.slice = slice;
+ this.insert = insert;
+ this.structure = structure;
+ }
+ apply(doc4) {
+ if (this.structure && (contentBetween(doc4, this.from, this.gapFrom) || contentBetween(doc4, this.gapTo, this.to)))
+ return StepResult.fail("Structure gap-replace would overwrite content");
+ let gap = doc4.slice(this.gapFrom, this.gapTo);
+ if (gap.openStart || gap.openEnd)
+ return StepResult.fail("Gap is not a flat range");
+ let inserted = this.slice.insertAt(this.insert, gap.content);
+ if (!inserted)
+ return StepResult.fail("Content does not fit in gap");
+ return StepResult.fromReplace(doc4, this.from, this.to, inserted);
+ }
+ getMap() {
+ return new StepMap([
+ this.from,
+ this.gapFrom - this.from,
+ this.insert,
+ this.gapTo,
+ this.to - this.gapTo,
+ this.slice.size - this.insert
+ ]);
+ }
+ invert(doc4) {
+ let gap = this.gapTo - this.gapFrom;
+ return new _ReplaceAroundStep(this.from, this.from + this.slice.size + gap, this.from + this.insert, this.from + this.insert + gap, doc4.slice(this.from, this.to).removeBetween(this.gapFrom - this.from, this.gapTo - this.from), this.gapFrom - this.from, this.structure);
+ }
+ map(mapping) {
+ let from = mapping.mapResult(this.from, 1), to = mapping.mapResult(this.to, -1);
+ let gapFrom = this.from == this.gapFrom ? from.pos : mapping.map(this.gapFrom, -1);
+ let gapTo = this.to == this.gapTo ? to.pos : mapping.map(this.gapTo, 1);
+ if (from.deletedAcross && to.deletedAcross || gapFrom < from.pos || gapTo > to.pos)
+ return null;
+ return new _ReplaceAroundStep(from.pos, to.pos, gapFrom, gapTo, this.slice, this.insert, this.structure);
+ }
+ toJSON() {
+ let json = {
+ stepType: "replaceAround",
+ from: this.from,
+ to: this.to,
+ gapFrom: this.gapFrom,
+ gapTo: this.gapTo,
+ insert: this.insert
+ };
+ if (this.slice.size)
+ json.slice = this.slice.toJSON();
+ if (this.structure)
+ json.structure = true;
+ return json;
+ }
+ /**
+ @internal
+ */
+ static fromJSON(schema, json) {
+ if (typeof json.from != "number" || typeof json.to != "number" || typeof json.gapFrom != "number" || typeof json.gapTo != "number" || typeof json.insert != "number")
+ throw new RangeError("Invalid input for ReplaceAroundStep.fromJSON");
+ return new _ReplaceAroundStep(json.from, json.to, json.gapFrom, json.gapTo, Slice.fromJSON(schema, json.slice), json.insert, !!json.structure);
+ }
+ };
+ Step.jsonID("replaceAround", ReplaceAroundStep);
+ function contentBetween(doc4, from, to) {
+ let $from = doc4.resolve(from), dist = to - from, depth = $from.depth;
+ while (dist > 0 && depth > 0 && $from.indexAfter(depth) == $from.node(depth).childCount) {
+ depth--;
+ dist--;
+ }
+ if (dist > 0) {
+ let next = $from.node(depth).maybeChild($from.indexAfter(depth));
+ while (dist > 0) {
+ if (!next || next.isLeaf)
+ return true;
+ next = next.firstChild;
+ dist--;
+ }
+ }
+ return false;
+ }
+ function addMark(tr, from, to, mark) {
+ let removed = [], added = [];
+ let removing, adding;
+ tr.doc.nodesBetween(from, to, (node2, pos, parent) => {
+ if (!node2.isInline)
+ return;
+ let marks = node2.marks;
+ if (!mark.isInSet(marks) && parent.type.allowsMarkType(mark.type)) {
+ let start = Math.max(pos, from), end = Math.min(pos + node2.nodeSize, to);
+ let newSet = mark.addToSet(marks);
+ for (let i2 = 0; i2 < marks.length; i2++) {
+ if (!marks[i2].isInSet(newSet)) {
+ if (removing && removing.to == start && removing.mark.eq(marks[i2]))
+ removing.to = end;
+ else
+ removed.push(removing = new RemoveMarkStep(start, end, marks[i2]));
+ }
+ }
+ if (adding && adding.to == start)
+ adding.to = end;
+ else
+ added.push(adding = new AddMarkStep(start, end, mark));
+ }
+ });
+ removed.forEach((s2) => tr.step(s2));
+ added.forEach((s2) => tr.step(s2));
+ }
+ function removeMark(tr, from, to, mark) {
+ let matched = [], step = 0;
+ tr.doc.nodesBetween(from, to, (node2, pos) => {
+ if (!node2.isInline)
+ return;
+ step++;
+ let toRemove = null;
+ if (mark instanceof MarkType) {
+ let set = node2.marks, found2;
+ while (found2 = mark.isInSet(set)) {
+ (toRemove || (toRemove = [])).push(found2);
+ set = found2.removeFromSet(set);
+ }
+ } else if (mark) {
+ if (mark.isInSet(node2.marks))
+ toRemove = [mark];
+ } else {
+ toRemove = node2.marks;
+ }
+ if (toRemove && toRemove.length) {
+ let end = Math.min(pos + node2.nodeSize, to);
+ for (let i2 = 0; i2 < toRemove.length; i2++) {
+ let style2 = toRemove[i2], found2;
+ for (let j6 = 0; j6 < matched.length; j6++) {
+ let m3 = matched[j6];
+ if (m3.step == step - 1 && style2.eq(matched[j6].style))
+ found2 = m3;
+ }
+ if (found2) {
+ found2.to = end;
+ found2.step = step;
+ } else {
+ matched.push({ style: style2, from: Math.max(pos, from), to: end, step });
+ }
+ }
+ }
+ });
+ matched.forEach((m3) => tr.step(new RemoveMarkStep(m3.from, m3.to, m3.style)));
+ }
+ function clearIncompatible(tr, pos, parentType, match = parentType.contentMatch, clearNewlines = true) {
+ let node2 = tr.doc.nodeAt(pos);
+ let replSteps = [], cur = pos + 1;
+ for (let i2 = 0; i2 < node2.childCount; i2++) {
+ let child = node2.child(i2), end = cur + child.nodeSize;
+ let allowed = match.matchType(child.type);
+ if (!allowed) {
+ replSteps.push(new ReplaceStep(cur, end, Slice.empty));
+ } else {
+ match = allowed;
+ for (let j6 = 0; j6 < child.marks.length; j6++)
+ if (!parentType.allowsMarkType(child.marks[j6].type))
+ tr.step(new RemoveMarkStep(cur, end, child.marks[j6]));
+ if (clearNewlines && child.isText && parentType.whitespace != "pre") {
+ let m3, newline = /\r?\n|\r/g, slice;
+ while (m3 = newline.exec(child.text)) {
+ if (!slice)
+ slice = new Slice(Fragment.from(parentType.schema.text(" ", parentType.allowedMarks(child.marks))), 0, 0);
+ replSteps.push(new ReplaceStep(cur + m3.index, cur + m3.index + m3[0].length, slice));
+ }
+ }
+ }
+ cur = end;
+ }
+ if (!match.validEnd) {
+ let fill = match.fillBefore(Fragment.empty, true);
+ tr.replace(cur, cur, new Slice(fill, 0, 0));
+ }
+ for (let i2 = replSteps.length - 1; i2 >= 0; i2--)
+ tr.step(replSteps[i2]);
+ }
+ function canCut(node2, start, end) {
+ return (start == 0 || node2.canReplace(start, node2.childCount)) && (end == node2.childCount || node2.canReplace(0, end));
+ }
+ function liftTarget(range) {
+ let parent = range.parent;
+ let content3 = parent.content.cutByIndex(range.startIndex, range.endIndex);
+ for (let depth = range.depth; ; --depth) {
+ let node2 = range.$from.node(depth);
+ let index2 = range.$from.index(depth), endIndex = range.$to.indexAfter(depth);
+ if (depth < range.depth && node2.canReplace(index2, endIndex, content3))
+ return depth;
+ if (depth == 0 || node2.type.spec.isolating || !canCut(node2, index2, endIndex))
+ break;
+ }
+ return null;
+ }
+ function lift(tr, range, target) {
+ let { $from, $to, depth } = range;
+ let gapStart = $from.before(depth + 1), gapEnd = $to.after(depth + 1);
+ let start = gapStart, end = gapEnd;
+ let before = Fragment.empty, openStart = 0;
+ for (let d6 = depth, splitting = false; d6 > target; d6--)
+ if (splitting || $from.index(d6) > 0) {
+ splitting = true;
+ before = Fragment.from($from.node(d6).copy(before));
+ openStart++;
+ } else {
+ start--;
+ }
+ let after = Fragment.empty, openEnd = 0;
+ for (let d6 = depth, splitting = false; d6 > target; d6--)
+ if (splitting || $to.after(d6 + 1) < $to.end(d6)) {
+ splitting = true;
+ after = Fragment.from($to.node(d6).copy(after));
+ openEnd++;
+ } else {
+ end++;
+ }
+ tr.step(new ReplaceAroundStep(start, end, gapStart, gapEnd, new Slice(before.append(after), openStart, openEnd), before.size - openStart, true));
+ }
+ function findWrapping(range, nodeType, attrs = null, innerRange = range) {
+ let around = findWrappingOutside(range, nodeType);
+ let inner = around && findWrappingInside(innerRange, nodeType);
+ if (!inner)
+ return null;
+ return around.map(withAttrs).concat({ type: nodeType, attrs }).concat(inner.map(withAttrs));
+ }
+ function withAttrs(type) {
+ return { type, attrs: null };
+ }
+ function findWrappingOutside(range, type) {
+ let { parent, startIndex, endIndex } = range;
+ let around = parent.contentMatchAt(startIndex).findWrapping(type);
+ if (!around)
+ return null;
+ let outer = around.length ? around[0] : type;
+ return parent.canReplaceWith(startIndex, endIndex, outer) ? around : null;
+ }
+ function findWrappingInside(range, type) {
+ let { parent, startIndex, endIndex } = range;
+ let inner = parent.child(startIndex);
+ let inside = type.contentMatch.findWrapping(inner.type);
+ if (!inside)
+ return null;
+ let lastType = inside.length ? inside[inside.length - 1] : type;
+ let innerMatch = lastType.contentMatch;
+ for (let i2 = startIndex; innerMatch && i2 < endIndex; i2++)
+ innerMatch = innerMatch.matchType(parent.child(i2).type);
+ if (!innerMatch || !innerMatch.validEnd)
+ return null;
+ return inside;
+ }
+ function wrap2(tr, range, wrappers) {
+ let content3 = Fragment.empty;
+ for (let i2 = wrappers.length - 1; i2 >= 0; i2--) {
+ if (content3.size) {
+ let match = wrappers[i2].type.contentMatch.matchFragment(content3);
+ if (!match || !match.validEnd)
+ throw new RangeError("Wrapper type given to Transform.wrap does not form valid content of its parent wrapper");
+ }
+ content3 = Fragment.from(wrappers[i2].type.create(wrappers[i2].attrs, content3));
+ }
+ let start = range.start, end = range.end;
+ tr.step(new ReplaceAroundStep(start, end, start, end, new Slice(content3, 0, 0), wrappers.length, true));
+ }
+ function setBlockType(tr, from, to, type, attrs) {
+ if (!type.isTextblock)
+ throw new RangeError("Type given to setBlockType should be a textblock");
+ let mapFrom = tr.steps.length;
+ tr.doc.nodesBetween(from, to, (node2, pos) => {
+ if (node2.isTextblock && !node2.hasMarkup(type, attrs) && canChangeType(tr.doc, tr.mapping.slice(mapFrom).map(pos), type)) {
+ let convertNewlines = null;
+ if (type.schema.linebreakReplacement) {
+ let pre = type.whitespace == "pre", supportLinebreak = !!type.contentMatch.matchType(type.schema.linebreakReplacement);
+ if (pre && !supportLinebreak)
+ convertNewlines = false;
+ else if (!pre && supportLinebreak)
+ convertNewlines = true;
+ }
+ if (convertNewlines === false)
+ replaceLinebreaks(tr, node2, pos, mapFrom);
+ clearIncompatible(tr, tr.mapping.slice(mapFrom).map(pos, 1), type, void 0, convertNewlines === null);
+ let mapping = tr.mapping.slice(mapFrom);
+ let startM = mapping.map(pos, 1), endM = mapping.map(pos + node2.nodeSize, 1);
+ tr.step(new ReplaceAroundStep(startM, endM, startM + 1, endM - 1, new Slice(Fragment.from(type.create(attrs, null, node2.marks)), 0, 0), 1, true));
+ if (convertNewlines === true)
+ replaceNewlines(tr, node2, pos, mapFrom);
+ return false;
+ }
+ });
+ }
+ function replaceNewlines(tr, node2, pos, mapFrom) {
+ node2.forEach((child, offset) => {
+ if (child.isText) {
+ let m3, newline = /\r?\n|\r/g;
+ while (m3 = newline.exec(child.text)) {
+ let start = tr.mapping.slice(mapFrom).map(pos + 1 + offset + m3.index);
+ tr.replaceWith(start, start + 1, node2.type.schema.linebreakReplacement.create());
+ }
+ }
+ });
+ }
+ function replaceLinebreaks(tr, node2, pos, mapFrom) {
+ node2.forEach((child, offset) => {
+ if (child.type == child.type.schema.linebreakReplacement) {
+ let start = tr.mapping.slice(mapFrom).map(pos + 1 + offset);
+ tr.replaceWith(start, start + 1, node2.type.schema.text("\n"));
+ }
+ });
+ }
+ function canChangeType(doc4, pos, type) {
+ let $pos = doc4.resolve(pos), index2 = $pos.index();
+ return $pos.parent.canReplaceWith(index2, index2 + 1, type);
+ }
+ function setNodeMarkup(tr, pos, type, attrs, marks) {
+ let node2 = tr.doc.nodeAt(pos);
+ if (!node2)
+ throw new RangeError("No node at given position");
+ if (!type)
+ type = node2.type;
+ let newNode = type.create(attrs, null, marks || node2.marks);
+ if (node2.isLeaf)
+ return tr.replaceWith(pos, pos + node2.nodeSize, newNode);
+ if (!type.validContent(node2.content))
+ throw new RangeError("Invalid content for node type " + type.name);
+ tr.step(new ReplaceAroundStep(pos, pos + node2.nodeSize, pos + 1, pos + node2.nodeSize - 1, new Slice(Fragment.from(newNode), 0, 0), 1, true));
+ }
+ function canSplit(doc4, pos, depth = 1, typesAfter) {
+ let $pos = doc4.resolve(pos), base2 = $pos.depth - depth;
+ let innerType = typesAfter && typesAfter[typesAfter.length - 1] || $pos.parent;
+ if (base2 < 0 || $pos.parent.type.spec.isolating || !$pos.parent.canReplace($pos.index(), $pos.parent.childCount) || !innerType.type.validContent($pos.parent.content.cutByIndex($pos.index(), $pos.parent.childCount)))
+ return false;
+ for (let d6 = $pos.depth - 1, i2 = depth - 2; d6 > base2; d6--, i2--) {
+ let node2 = $pos.node(d6), index3 = $pos.index(d6);
+ if (node2.type.spec.isolating)
+ return false;
+ let rest = node2.content.cutByIndex(index3, node2.childCount);
+ let overrideChild = typesAfter && typesAfter[i2 + 1];
+ if (overrideChild)
+ rest = rest.replaceChild(0, overrideChild.type.create(overrideChild.attrs));
+ let after = typesAfter && typesAfter[i2] || node2;
+ if (!node2.canReplace(index3 + 1, node2.childCount) || !after.type.validContent(rest))
+ return false;
+ }
+ let index2 = $pos.indexAfter(base2);
+ let baseType = typesAfter && typesAfter[0];
+ return $pos.node(base2).canReplaceWith(index2, index2, baseType ? baseType.type : $pos.node(base2 + 1).type);
+ }
+ function split(tr, pos, depth = 1, typesAfter) {
+ let $pos = tr.doc.resolve(pos), before = Fragment.empty, after = Fragment.empty;
+ for (let d6 = $pos.depth, e2 = $pos.depth - depth, i2 = depth - 1; d6 > e2; d6--, i2--) {
+ before = Fragment.from($pos.node(d6).copy(before));
+ let typeAfter = typesAfter && typesAfter[i2];
+ after = Fragment.from(typeAfter ? typeAfter.type.create(typeAfter.attrs, after) : $pos.node(d6).copy(after));
+ }
+ tr.step(new ReplaceStep(pos, pos, new Slice(before.append(after), depth, depth), true));
+ }
+ function canJoin(doc4, pos) {
+ let $pos = doc4.resolve(pos), index2 = $pos.index();
+ return joinable2($pos.nodeBefore, $pos.nodeAfter) && $pos.parent.canReplace(index2, index2 + 1);
+ }
+ function joinable2(a2, b4) {
+ return !!(a2 && b4 && !a2.isLeaf && a2.canAppend(b4));
+ }
+ function join3(tr, pos, depth) {
+ let step = new ReplaceStep(pos - depth, pos + depth, Slice.empty, true);
+ tr.step(step);
+ }
+ function insertPoint(doc4, pos, nodeType) {
+ let $pos = doc4.resolve(pos);
+ if ($pos.parent.canReplaceWith($pos.index(), $pos.index(), nodeType))
+ return pos;
+ if ($pos.parentOffset == 0)
+ for (let d6 = $pos.depth - 1; d6 >= 0; d6--) {
+ let index2 = $pos.index(d6);
+ if ($pos.node(d6).canReplaceWith(index2, index2, nodeType))
+ return $pos.before(d6 + 1);
+ if (index2 > 0)
+ return null;
+ }
+ if ($pos.parentOffset == $pos.parent.content.size)
+ for (let d6 = $pos.depth - 1; d6 >= 0; d6--) {
+ let index2 = $pos.indexAfter(d6);
+ if ($pos.node(d6).canReplaceWith(index2, index2, nodeType))
+ return $pos.after(d6 + 1);
+ if (index2 < $pos.node(d6).childCount)
+ return null;
+ }
+ return null;
+ }
+ function dropPoint(doc4, pos, slice) {
+ let $pos = doc4.resolve(pos);
+ if (!slice.content.size)
+ return pos;
+ let content3 = slice.content;
+ for (let i2 = 0; i2 < slice.openStart; i2++)
+ content3 = content3.firstChild.content;
+ for (let pass = 1; pass <= (slice.openStart == 0 && slice.size ? 2 : 1); pass++) {
+ for (let d6 = $pos.depth; d6 >= 0; d6--) {
+ let bias = d6 == $pos.depth ? 0 : $pos.pos <= ($pos.start(d6 + 1) + $pos.end(d6 + 1)) / 2 ? -1 : 1;
+ let insertPos = $pos.index(d6) + (bias > 0 ? 1 : 0);
+ let parent = $pos.node(d6), fits = false;
+ if (pass == 1) {
+ fits = parent.canReplace(insertPos, insertPos, content3);
+ } else {
+ let wrapping = parent.contentMatchAt(insertPos).findWrapping(content3.firstChild.type);
+ fits = wrapping && parent.canReplaceWith(insertPos, insertPos, wrapping[0]);
+ }
+ if (fits)
+ return bias == 0 ? $pos.pos : bias < 0 ? $pos.before(d6 + 1) : $pos.after(d6 + 1);
+ }
+ }
+ return null;
+ }
+ function replaceStep(doc4, from, to = from, slice = Slice.empty) {
+ if (from == to && !slice.size)
+ return null;
+ let $from = doc4.resolve(from), $to = doc4.resolve(to);
+ if (fitsTrivially($from, $to, slice))
+ return new ReplaceStep(from, to, slice);
+ return new Fitter($from, $to, slice).fit();
+ }
+ function fitsTrivially($from, $to, slice) {
+ return !slice.openStart && !slice.openEnd && $from.start() == $to.start() && $from.parent.canReplace($from.index(), $to.index(), slice.content);
+ }
+ var Fitter = class {
+ constructor($from, $to, unplaced) {
+ this.$from = $from;
+ this.$to = $to;
+ this.unplaced = unplaced;
+ this.frontier = [];
+ this.placed = Fragment.empty;
+ for (let i2 = 0; i2 <= $from.depth; i2++) {
+ let node2 = $from.node(i2);
+ this.frontier.push({
+ type: node2.type,
+ match: node2.contentMatchAt($from.indexAfter(i2))
+ });
+ }
+ for (let i2 = $from.depth; i2 > 0; i2--)
+ this.placed = Fragment.from($from.node(i2).copy(this.placed));
+ }
+ get depth() {
+ return this.frontier.length - 1;
+ }
+ fit() {
+ while (this.unplaced.size) {
+ let fit = this.findFittable();
+ if (fit)
+ this.placeNodes(fit);
+ else
+ this.openMore() || this.dropNode();
+ }
+ let moveInline = this.mustMoveInline(), placedSize = this.placed.size - this.depth - this.$from.depth;
+ let $from = this.$from, $to = this.close(moveInline < 0 ? this.$to : $from.doc.resolve(moveInline));
+ if (!$to)
+ return null;
+ let content3 = this.placed, openStart = $from.depth, openEnd = $to.depth;
+ while (openStart && openEnd && content3.childCount == 1) {
+ content3 = content3.firstChild.content;
+ openStart--;
+ openEnd--;
+ }
+ let slice = new Slice(content3, openStart, openEnd);
+ if (moveInline > -1)
+ return new ReplaceAroundStep($from.pos, moveInline, this.$to.pos, this.$to.end(), slice, placedSize);
+ if (slice.size || $from.pos != this.$to.pos)
+ return new ReplaceStep($from.pos, $to.pos, slice);
+ return null;
+ }
+ // Find a position on the start spine of `this.unplaced` that has
+ // content that can be moved somewhere on the frontier. Returns two
+ // depths, one for the slice and one for the frontier.
+ findFittable() {
+ let startDepth = this.unplaced.openStart;
+ for (let cur = this.unplaced.content, d6 = 0, openEnd = this.unplaced.openEnd; d6 < startDepth; d6++) {
+ let node2 = cur.firstChild;
+ if (cur.childCount > 1)
+ openEnd = 0;
+ if (node2.type.spec.isolating && openEnd <= d6) {
+ startDepth = d6;
+ break;
+ }
+ cur = node2.content;
+ }
+ for (let pass = 1; pass <= 2; pass++) {
+ for (let sliceDepth = pass == 1 ? startDepth : this.unplaced.openStart; sliceDepth >= 0; sliceDepth--) {
+ let fragment, parent = null;
+ if (sliceDepth) {
+ parent = contentAt(this.unplaced.content, sliceDepth - 1).firstChild;
+ fragment = parent.content;
+ } else {
+ fragment = this.unplaced.content;
+ }
+ let first = fragment.firstChild;
+ for (let frontierDepth = this.depth; frontierDepth >= 0; frontierDepth--) {
+ let { type, match } = this.frontier[frontierDepth], wrap3, inject = null;
+ if (pass == 1 && (first ? match.matchType(first.type) || (inject = match.fillBefore(Fragment.from(first), false)) : parent && type.compatibleContent(parent.type)))
+ return { sliceDepth, frontierDepth, parent, inject };
+ else if (pass == 2 && first && (wrap3 = match.findWrapping(first.type)))
+ return { sliceDepth, frontierDepth, parent, wrap: wrap3 };
+ if (parent && match.matchType(parent.type))
+ break;
+ }
+ }
+ }
+ }
+ openMore() {
+ let { content: content3, openStart, openEnd } = this.unplaced;
+ let inner = contentAt(content3, openStart);
+ if (!inner.childCount || inner.firstChild.isLeaf)
+ return false;
+ this.unplaced = new Slice(content3, openStart + 1, Math.max(openEnd, inner.size + openStart >= content3.size - openEnd ? openStart + 1 : 0));
+ return true;
+ }
+ dropNode() {
+ let { content: content3, openStart, openEnd } = this.unplaced;
+ let inner = contentAt(content3, openStart);
+ if (inner.childCount <= 1 && openStart > 0) {
+ let openAtEnd = content3.size - openStart <= openStart + inner.size;
+ this.unplaced = new Slice(dropFromFragment(content3, openStart - 1, 1), openStart - 1, openAtEnd ? openStart - 1 : openEnd);
+ } else {
+ this.unplaced = new Slice(dropFromFragment(content3, openStart, 1), openStart, openEnd);
+ }
+ }
+ // Move content from the unplaced slice at `sliceDepth` to the
+ // frontier node at `frontierDepth`. Close that frontier node when
+ // applicable.
+ placeNodes({ sliceDepth, frontierDepth, parent, inject, wrap: wrap3 }) {
+ while (this.depth > frontierDepth)
+ this.closeFrontierNode();
+ if (wrap3)
+ for (let i2 = 0; i2 < wrap3.length; i2++)
+ this.openFrontierNode(wrap3[i2]);
+ let slice = this.unplaced, fragment = parent ? parent.content : slice.content;
+ let openStart = slice.openStart - sliceDepth;
+ let taken = 0, add = [];
+ let { match, type } = this.frontier[frontierDepth];
+ if (inject) {
+ for (let i2 = 0; i2 < inject.childCount; i2++)
+ add.push(inject.child(i2));
+ match = match.matchFragment(inject);
+ }
+ let openEndCount = fragment.size + sliceDepth - (slice.content.size - slice.openEnd);
+ while (taken < fragment.childCount) {
+ let next = fragment.child(taken), matches2 = match.matchType(next.type);
+ if (!matches2)
+ break;
+ taken++;
+ if (taken > 1 || openStart == 0 || next.content.size) {
+ match = matches2;
+ add.push(closeNodeStart(next.mark(type.allowedMarks(next.marks)), taken == 1 ? openStart : 0, taken == fragment.childCount ? openEndCount : -1));
+ }
+ }
+ let toEnd = taken == fragment.childCount;
+ if (!toEnd)
+ openEndCount = -1;
+ this.placed = addToFragment(this.placed, frontierDepth, Fragment.from(add));
+ this.frontier[frontierDepth].match = match;
+ if (toEnd && openEndCount < 0 && parent && parent.type == this.frontier[this.depth].type && this.frontier.length > 1)
+ this.closeFrontierNode();
+ for (let i2 = 0, cur = fragment; i2 < openEndCount; i2++) {
+ let node2 = cur.lastChild;
+ this.frontier.push({ type: node2.type, match: node2.contentMatchAt(node2.childCount) });
+ cur = node2.content;
+ }
+ this.unplaced = !toEnd ? new Slice(dropFromFragment(slice.content, sliceDepth, taken), slice.openStart, slice.openEnd) : sliceDepth == 0 ? Slice.empty : new Slice(dropFromFragment(slice.content, sliceDepth - 1, 1), sliceDepth - 1, openEndCount < 0 ? slice.openEnd : sliceDepth - 1);
+ }
+ mustMoveInline() {
+ if (!this.$to.parent.isTextblock)
+ return -1;
+ let top = this.frontier[this.depth], level;
+ if (!top.type.isTextblock || !contentAfterFits(this.$to, this.$to.depth, top.type, top.match, false) || this.$to.depth == this.depth && (level = this.findCloseLevel(this.$to)) && level.depth == this.depth)
+ return -1;
+ let { depth } = this.$to, after = this.$to.after(depth);
+ while (depth > 1 && after == this.$to.end(--depth))
+ ++after;
+ return after;
+ }
+ findCloseLevel($to) {
+ scan: for (let i2 = Math.min(this.depth, $to.depth); i2 >= 0; i2--) {
+ let { match, type } = this.frontier[i2];
+ let dropInner = i2 < $to.depth && $to.end(i2 + 1) == $to.pos + ($to.depth - (i2 + 1));
+ let fit = contentAfterFits($to, i2, type, match, dropInner);
+ if (!fit)
+ continue;
+ for (let d6 = i2 - 1; d6 >= 0; d6--) {
+ let { match: match2, type: type2 } = this.frontier[d6];
+ let matches2 = contentAfterFits($to, d6, type2, match2, true);
+ if (!matches2 || matches2.childCount)
+ continue scan;
+ }
+ return { depth: i2, fit, move: dropInner ? $to.doc.resolve($to.after(i2 + 1)) : $to };
+ }
+ }
+ close($to) {
+ let close2 = this.findCloseLevel($to);
+ if (!close2)
+ return null;
+ while (this.depth > close2.depth)
+ this.closeFrontierNode();
+ if (close2.fit.childCount)
+ this.placed = addToFragment(this.placed, close2.depth, close2.fit);
+ $to = close2.move;
+ for (let d6 = close2.depth + 1; d6 <= $to.depth; d6++) {
+ let node2 = $to.node(d6), add = node2.type.contentMatch.fillBefore(node2.content, true, $to.index(d6));
+ this.openFrontierNode(node2.type, node2.attrs, add);
+ }
+ return $to;
+ }
+ openFrontierNode(type, attrs = null, content3) {
+ let top = this.frontier[this.depth];
+ top.match = top.match.matchType(type);
+ this.placed = addToFragment(this.placed, this.depth, Fragment.from(type.create(attrs, content3)));
+ this.frontier.push({ type, match: type.contentMatch });
+ }
+ closeFrontierNode() {
+ let open = this.frontier.pop();
+ let add = open.match.fillBefore(Fragment.empty, true);
+ if (add.childCount)
+ this.placed = addToFragment(this.placed, this.frontier.length, add);
+ }
+ };
+ function dropFromFragment(fragment, depth, count) {
+ if (depth == 0)
+ return fragment.cutByIndex(count, fragment.childCount);
+ return fragment.replaceChild(0, fragment.firstChild.copy(dropFromFragment(fragment.firstChild.content, depth - 1, count)));
+ }
+ function addToFragment(fragment, depth, content3) {
+ if (depth == 0)
+ return fragment.append(content3);
+ return fragment.replaceChild(fragment.childCount - 1, fragment.lastChild.copy(addToFragment(fragment.lastChild.content, depth - 1, content3)));
+ }
+ function contentAt(fragment, depth) {
+ for (let i2 = 0; i2 < depth; i2++)
+ fragment = fragment.firstChild.content;
+ return fragment;
+ }
+ function closeNodeStart(node2, openStart, openEnd) {
+ if (openStart <= 0)
+ return node2;
+ let frag = node2.content;
+ if (openStart > 1)
+ frag = frag.replaceChild(0, closeNodeStart(frag.firstChild, openStart - 1, frag.childCount == 1 ? openEnd - 1 : 0));
+ if (openStart > 0) {
+ frag = node2.type.contentMatch.fillBefore(frag).append(frag);
+ if (openEnd <= 0)
+ frag = frag.append(node2.type.contentMatch.matchFragment(frag).fillBefore(Fragment.empty, true));
+ }
+ return node2.copy(frag);
+ }
+ function contentAfterFits($to, depth, type, match, open) {
+ let node2 = $to.node(depth), index2 = open ? $to.indexAfter(depth) : $to.index(depth);
+ if (index2 == node2.childCount && !type.compatibleContent(node2.type))
+ return null;
+ let fit = match.fillBefore(node2.content, true, index2);
+ return fit && !invalidMarks(type, node2.content, index2) ? fit : null;
+ }
+ function invalidMarks(type, fragment, start) {
+ for (let i2 = start; i2 < fragment.childCount; i2++)
+ if (!type.allowsMarks(fragment.child(i2).marks))
+ return true;
+ return false;
+ }
+ function definesContent(type) {
+ return type.spec.defining || type.spec.definingForContent;
+ }
+ function replaceRange(tr, from, to, slice) {
+ if (!slice.size)
+ return tr.deleteRange(from, to);
+ let $from = tr.doc.resolve(from), $to = tr.doc.resolve(to);
+ if (fitsTrivially($from, $to, slice))
+ return tr.step(new ReplaceStep(from, to, slice));
+ let targetDepths = coveredDepths($from, tr.doc.resolve(to));
+ if (targetDepths[targetDepths.length - 1] == 0)
+ targetDepths.pop();
+ let preferredTarget = -($from.depth + 1);
+ targetDepths.unshift(preferredTarget);
+ for (let d6 = $from.depth, pos = $from.pos - 1; d6 > 0; d6--, pos--) {
+ let spec = $from.node(d6).type.spec;
+ if (spec.defining || spec.definingAsContext || spec.isolating)
+ break;
+ if (targetDepths.indexOf(d6) > -1)
+ preferredTarget = d6;
+ else if ($from.before(d6) == pos)
+ targetDepths.splice(1, 0, -d6);
+ }
+ let preferredTargetIndex = targetDepths.indexOf(preferredTarget);
+ let leftNodes = [], preferredDepth = slice.openStart;
+ for (let content3 = slice.content, i2 = 0; ; i2++) {
+ let node2 = content3.firstChild;
+ leftNodes.push(node2);
+ if (i2 == slice.openStart)
+ break;
+ content3 = node2.content;
+ }
+ for (let d6 = preferredDepth - 1; d6 >= 0; d6--) {
+ let leftNode = leftNodes[d6], def = definesContent(leftNode.type);
+ if (def && !leftNode.sameMarkup($from.node(Math.abs(preferredTarget) - 1)))
+ preferredDepth = d6;
+ else if (def || !leftNode.type.isTextblock)
+ break;
+ }
+ for (let j6 = slice.openStart; j6 >= 0; j6--) {
+ let openDepth = (j6 + preferredDepth + 1) % (slice.openStart + 1);
+ let insert = leftNodes[openDepth];
+ if (!insert)
+ continue;
+ for (let i2 = 0; i2 < targetDepths.length; i2++) {
+ let targetDepth = targetDepths[(i2 + preferredTargetIndex) % targetDepths.length], expand = true;
+ if (targetDepth < 0) {
+ expand = false;
+ targetDepth = -targetDepth;
+ }
+ let parent = $from.node(targetDepth - 1), index2 = $from.index(targetDepth - 1);
+ if (parent.canReplaceWith(index2, index2, insert.type, insert.marks))
+ return tr.replace($from.before(targetDepth), expand ? $to.after(targetDepth) : to, new Slice(closeFragment(slice.content, 0, slice.openStart, openDepth), openDepth, slice.openEnd));
+ }
+ }
+ let startSteps = tr.steps.length;
+ for (let i2 = targetDepths.length - 1; i2 >= 0; i2--) {
+ tr.replace(from, to, slice);
+ if (tr.steps.length > startSteps)
+ break;
+ let depth = targetDepths[i2];
+ if (depth < 0)
+ continue;
+ from = $from.before(depth);
+ to = $to.after(depth);
+ }
+ }
+ function closeFragment(fragment, depth, oldOpen, newOpen, parent) {
+ if (depth < oldOpen) {
+ let first = fragment.firstChild;
+ fragment = fragment.replaceChild(0, first.copy(closeFragment(first.content, depth + 1, oldOpen, newOpen, first)));
+ }
+ if (depth > newOpen) {
+ let match = parent.contentMatchAt(0);
+ let start = match.fillBefore(fragment).append(fragment);
+ fragment = start.append(match.matchFragment(start).fillBefore(Fragment.empty, true));
+ }
+ return fragment;
+ }
+ function replaceRangeWith(tr, from, to, node2) {
+ if (!node2.isInline && from == to && tr.doc.resolve(from).parent.content.size) {
+ let point3 = insertPoint(tr.doc, from, node2.type);
+ if (point3 != null)
+ from = to = point3;
+ }
+ tr.replaceRange(from, to, new Slice(Fragment.from(node2), 0, 0));
+ }
+ function deleteRange(tr, from, to) {
+ let $from = tr.doc.resolve(from), $to = tr.doc.resolve(to);
+ let covered = coveredDepths($from, $to);
+ for (let i2 = 0; i2 < covered.length; i2++) {
+ let depth = covered[i2], last = i2 == covered.length - 1;
+ if (last && depth == 0 || $from.node(depth).type.contentMatch.validEnd)
+ return tr.delete($from.start(depth), $to.end(depth));
+ if (depth > 0 && (last || $from.node(depth - 1).canReplace($from.index(depth - 1), $to.indexAfter(depth - 1))))
+ return tr.delete($from.before(depth), $to.after(depth));
+ }
+ for (let d6 = 1; d6 <= $from.depth && d6 <= $to.depth; d6++) {
+ if (from - $from.start(d6) == $from.depth - d6 && to > $from.end(d6) && $to.end(d6) - to != $to.depth - d6)
+ return tr.delete($from.before(d6), to);
+ }
+ tr.delete(from, to);
+ }
+ function coveredDepths($from, $to) {
+ let result = [], minDepth = Math.min($from.depth, $to.depth);
+ for (let d6 = minDepth; d6 >= 0; d6--) {
+ let start = $from.start(d6);
+ if (start < $from.pos - ($from.depth - d6) || $to.end(d6) > $to.pos + ($to.depth - d6) || $from.node(d6).type.spec.isolating || $to.node(d6).type.spec.isolating)
+ break;
+ if (start == $to.start(d6) || d6 == $from.depth && d6 == $to.depth && $from.parent.inlineContent && $to.parent.inlineContent && d6 && $to.start(d6 - 1) == start - 1)
+ result.push(d6);
+ }
+ return result;
+ }
+ var AttrStep = class _AttrStep extends Step {
+ /**
+ Construct an attribute step.
+ */
+ constructor(pos, attr, value) {
+ super();
+ this.pos = pos;
+ this.attr = attr;
+ this.value = value;
+ }
+ apply(doc4) {
+ let node2 = doc4.nodeAt(this.pos);
+ if (!node2)
+ return StepResult.fail("No node at attribute step's position");
+ let attrs = /* @__PURE__ */ Object.create(null);
+ for (let name in node2.attrs)
+ attrs[name] = node2.attrs[name];
+ attrs[this.attr] = this.value;
+ let updated = node2.type.create(attrs, null, node2.marks);
+ return StepResult.fromReplace(doc4, this.pos, this.pos + 1, new Slice(Fragment.from(updated), 0, node2.isLeaf ? 0 : 1));
+ }
+ getMap() {
+ return StepMap.empty;
+ }
+ invert(doc4) {
+ return new _AttrStep(this.pos, this.attr, doc4.nodeAt(this.pos).attrs[this.attr]);
+ }
+ map(mapping) {
+ let pos = mapping.mapResult(this.pos, 1);
+ return pos.deletedAfter ? null : new _AttrStep(pos.pos, this.attr, this.value);
+ }
+ toJSON() {
+ return { stepType: "attr", pos: this.pos, attr: this.attr, value: this.value };
+ }
+ static fromJSON(schema, json) {
+ if (typeof json.pos != "number" || typeof json.attr != "string")
+ throw new RangeError("Invalid input for AttrStep.fromJSON");
+ return new _AttrStep(json.pos, json.attr, json.value);
+ }
+ };
+ Step.jsonID("attr", AttrStep);
+ var DocAttrStep = class _DocAttrStep extends Step {
+ /**
+ Construct an attribute step.
+ */
+ constructor(attr, value) {
+ super();
+ this.attr = attr;
+ this.value = value;
+ }
+ apply(doc4) {
+ let attrs = /* @__PURE__ */ Object.create(null);
+ for (let name in doc4.attrs)
+ attrs[name] = doc4.attrs[name];
+ attrs[this.attr] = this.value;
+ let updated = doc4.type.create(attrs, doc4.content, doc4.marks);
+ return StepResult.ok(updated);
+ }
+ getMap() {
+ return StepMap.empty;
+ }
+ invert(doc4) {
+ return new _DocAttrStep(this.attr, doc4.attrs[this.attr]);
+ }
+ map(mapping) {
+ return this;
+ }
+ toJSON() {
+ return { stepType: "docAttr", attr: this.attr, value: this.value };
+ }
+ static fromJSON(schema, json) {
+ if (typeof json.attr != "string")
+ throw new RangeError("Invalid input for DocAttrStep.fromJSON");
+ return new _DocAttrStep(json.attr, json.value);
+ }
+ };
+ Step.jsonID("docAttr", DocAttrStep);
+ var TransformError = class extends Error {
+ };
+ TransformError = function TransformError2(message) {
+ let err = Error.call(this, message);
+ err.__proto__ = TransformError2.prototype;
+ return err;
+ };
+ TransformError.prototype = Object.create(Error.prototype);
+ TransformError.prototype.constructor = TransformError;
+ TransformError.prototype.name = "TransformError";
+ var Transform = class {
+ /**
+ Create a transform that starts with the given document.
+ */
+ constructor(doc4) {
+ this.doc = doc4;
+ this.steps = [];
+ this.docs = [];
+ this.mapping = new Mapping();
+ }
+ /**
+ The starting document.
+ */
+ get before() {
+ return this.docs.length ? this.docs[0] : this.doc;
+ }
+ /**
+ Apply a new step in this transform, saving the result. Throws an
+ error when the step fails.
+ */
+ step(step) {
+ let result = this.maybeStep(step);
+ if (result.failed)
+ throw new TransformError(result.failed);
+ return this;
+ }
+ /**
+ Try to apply a step in this transformation, ignoring it if it
+ fails. Returns the step result.
+ */
+ maybeStep(step) {
+ let result = step.apply(this.doc);
+ if (!result.failed)
+ this.addStep(step, result.doc);
+ return result;
+ }
+ /**
+ True when the document has been changed (when there are any
+ steps).
+ */
+ get docChanged() {
+ return this.steps.length > 0;
+ }
+ /**
+ @internal
+ */
+ addStep(step, doc4) {
+ this.docs.push(this.doc);
+ this.steps.push(step);
+ this.mapping.appendMap(step.getMap());
+ this.doc = doc4;
+ }
+ /**
+ Replace the part of the document between `from` and `to` with the
+ given `slice`.
+ */
+ replace(from, to = from, slice = Slice.empty) {
+ let step = replaceStep(this.doc, from, to, slice);
+ if (step)
+ this.step(step);
+ return this;
+ }
+ /**
+ Replace the given range with the given content, which may be a
+ fragment, node, or array of nodes.
+ */
+ replaceWith(from, to, content3) {
+ return this.replace(from, to, new Slice(Fragment.from(content3), 0, 0));
+ }
+ /**
+ Delete the content between the given positions.
+ */
+ delete(from, to) {
+ return this.replace(from, to, Slice.empty);
+ }
+ /**
+ Insert the given content at the given position.
+ */
+ insert(pos, content3) {
+ return this.replaceWith(pos, pos, content3);
+ }
+ /**
+ Replace a range of the document with a given slice, using
+ `from`, `to`, and the slice's
+ [`openStart`](https://prosemirror.net/docs/ref/#model.Slice.openStart) property as hints, rather
+ than fixed start and end points. This method may grow the
+ replaced area or close open nodes in the slice in order to get a
+ fit that is more in line with WYSIWYG expectations, by dropping
+ fully covered parent nodes of the replaced region when they are
+ marked [non-defining as
+ context](https://prosemirror.net/docs/ref/#model.NodeSpec.definingAsContext), or including an
+ open parent node from the slice that _is_ marked as [defining
+ its content](https://prosemirror.net/docs/ref/#model.NodeSpec.definingForContent).
+
+ This is the method, for example, to handle paste. The similar
+ [`replace`](https://prosemirror.net/docs/ref/#transform.Transform.replace) method is a more
+ primitive tool which will _not_ move the start and end of its given
+ range, and is useful in situations where you need more precise
+ control over what happens.
+ */
+ replaceRange(from, to, slice) {
+ replaceRange(this, from, to, slice);
+ return this;
+ }
+ /**
+ Replace the given range with a node, but use `from` and `to` as
+ hints, rather than precise positions. When from and to are the same
+ and are at the start or end of a parent node in which the given
+ node doesn't fit, this method may _move_ them out towards a parent
+ that does allow the given node to be placed. When the given range
+ completely covers a parent node, this method may completely replace
+ that parent node.
+ */
+ replaceRangeWith(from, to, node2) {
+ replaceRangeWith(this, from, to, node2);
+ return this;
+ }
+ /**
+ Delete the given range, expanding it to cover fully covered
+ parent nodes until a valid replace is found.
+ */
+ deleteRange(from, to) {
+ deleteRange(this, from, to);
+ return this;
+ }
+ /**
+ Split the content in the given range off from its parent, if there
+ is sibling content before or after it, and move it up the tree to
+ the depth specified by `target`. You'll probably want to use
+ [`liftTarget`](https://prosemirror.net/docs/ref/#transform.liftTarget) to compute `target`, to make
+ sure the lift is valid.
+ */
+ lift(range, target) {
+ lift(this, range, target);
+ return this;
+ }
+ /**
+ Join the blocks around the given position. If depth is 2, their
+ last and first siblings are also joined, and so on.
+ */
+ join(pos, depth = 1) {
+ join3(this, pos, depth);
+ return this;
+ }
+ /**
+ Wrap the given [range](https://prosemirror.net/docs/ref/#model.NodeRange) in the given set of wrappers.
+ The wrappers are assumed to be valid in this position, and should
+ probably be computed with [`findWrapping`](https://prosemirror.net/docs/ref/#transform.findWrapping).
+ */
+ wrap(range, wrappers) {
+ wrap2(this, range, wrappers);
+ return this;
+ }
+ /**
+ Set the type of all textblocks (partly) between `from` and `to` to
+ the given node type with the given attributes.
+ */
+ setBlockType(from, to = from, type, attrs = null) {
+ setBlockType(this, from, to, type, attrs);
+ return this;
+ }
+ /**
+ Change the type, attributes, and/or marks of the node at `pos`.
+ When `type` isn't given, the existing node type is preserved,
+ */
+ setNodeMarkup(pos, type, attrs = null, marks) {
+ setNodeMarkup(this, pos, type, attrs, marks);
+ return this;
+ }
+ /**
+ Set a single attribute on a given node to a new value.
+ The `pos` addresses the document content. Use `setDocAttribute`
+ to set attributes on the document itself.
+ */
+ setNodeAttribute(pos, attr, value) {
+ this.step(new AttrStep(pos, attr, value));
+ return this;
+ }
+ /**
+ Set a single attribute on the document to a new value.
+ */
+ setDocAttribute(attr, value) {
+ this.step(new DocAttrStep(attr, value));
+ return this;
+ }
+ /**
+ Add a mark to the node at position `pos`.
+ */
+ addNodeMark(pos, mark) {
+ this.step(new AddNodeMarkStep(pos, mark));
+ return this;
+ }
+ /**
+ Remove a mark (or a mark of the given type) from the node at
+ position `pos`.
+ */
+ removeNodeMark(pos, mark) {
+ if (!(mark instanceof Mark)) {
+ let node2 = this.doc.nodeAt(pos);
+ if (!node2)
+ throw new RangeError("No node at position " + pos);
+ mark = mark.isInSet(node2.marks);
+ if (!mark)
+ return this;
+ }
+ this.step(new RemoveNodeMarkStep(pos, mark));
+ return this;
+ }
+ /**
+ Split the node at the given position, and optionally, if `depth` is
+ greater than one, any number of nodes above that. By default, the
+ parts split off will inherit the node type of the original node.
+ This can be changed by passing an array of types and attributes to
+ use after the split.
+ */
+ split(pos, depth = 1, typesAfter) {
+ split(this, pos, depth, typesAfter);
+ return this;
+ }
+ /**
+ Add the given mark to the inline content between `from` and `to`.
+ */
+ addMark(from, to, mark) {
+ addMark(this, from, to, mark);
+ return this;
+ }
+ /**
+ Remove marks from inline nodes between `from` and `to`. When
+ `mark` is a single mark, remove precisely that mark. When it is
+ a mark type, remove all marks of that type. When it is null,
+ remove all marks of any type.
+ */
+ removeMark(from, to, mark) {
+ removeMark(this, from, to, mark);
+ return this;
+ }
+ /**
+ Removes all marks and nodes from the content of the node at
+ `pos` that don't match the given new parent node type. Accepts
+ an optional starting [content match](https://prosemirror.net/docs/ref/#model.ContentMatch) as
+ third argument.
+ */
+ clearIncompatible(pos, parentType, match) {
+ clearIncompatible(this, pos, parentType, match);
+ return this;
+ }
+ };
+
+ // node_modules/prosemirror-state/dist/index.js
+ var classesById = /* @__PURE__ */ Object.create(null);
+ var Selection = class {
+ /**
+ Initialize a selection with the head and anchor and ranges. If no
+ ranges are given, constructs a single range across `$anchor` and
+ `$head`.
+ */
+ constructor($anchor, $head, ranges) {
+ this.$anchor = $anchor;
+ this.$head = $head;
+ this.ranges = ranges || [new SelectionRange($anchor.min($head), $anchor.max($head))];
+ }
+ /**
+ The selection's anchor, as an unresolved position.
+ */
+ get anchor() {
+ return this.$anchor.pos;
+ }
+ /**
+ The selection's head.
+ */
+ get head() {
+ return this.$head.pos;
+ }
+ /**
+ The lower bound of the selection's main range.
+ */
+ get from() {
+ return this.$from.pos;
+ }
+ /**
+ The upper bound of the selection's main range.
+ */
+ get to() {
+ return this.$to.pos;
+ }
+ /**
+ The resolved lower bound of the selection's main range.
+ */
+ get $from() {
+ return this.ranges[0].$from;
+ }
+ /**
+ The resolved upper bound of the selection's main range.
+ */
+ get $to() {
+ return this.ranges[0].$to;
+ }
+ /**
+ Indicates whether the selection contains any content.
+ */
+ get empty() {
+ let ranges = this.ranges;
+ for (let i2 = 0; i2 < ranges.length; i2++)
+ if (ranges[i2].$from.pos != ranges[i2].$to.pos)
+ return false;
+ return true;
+ }
+ /**
+ Get the content of this selection as a slice.
+ */
+ content() {
+ return this.$from.doc.slice(this.from, this.to, true);
+ }
+ /**
+ Replace the selection with a slice or, if no slice is given,
+ delete the selection. Will append to the given transaction.
+ */
+ replace(tr, content3 = Slice.empty) {
+ let lastNode = content3.content.lastChild, lastParent = null;
+ for (let i2 = 0; i2 < content3.openEnd; i2++) {
+ lastParent = lastNode;
+ lastNode = lastNode.lastChild;
+ }
+ let mapFrom = tr.steps.length, ranges = this.ranges;
+ for (let i2 = 0; i2 < ranges.length; i2++) {
+ let { $from, $to } = ranges[i2], mapping = tr.mapping.slice(mapFrom);
+ tr.replaceRange(mapping.map($from.pos), mapping.map($to.pos), i2 ? Slice.empty : content3);
+ if (i2 == 0)
+ selectionToInsertionEnd(tr, mapFrom, (lastNode ? lastNode.isInline : lastParent && lastParent.isTextblock) ? -1 : 1);
+ }
+ }
+ /**
+ Replace the selection with the given node, appending the changes
+ to the given transaction.
+ */
+ replaceWith(tr, node2) {
+ let mapFrom = tr.steps.length, ranges = this.ranges;
+ for (let i2 = 0; i2 < ranges.length; i2++) {
+ let { $from, $to } = ranges[i2], mapping = tr.mapping.slice(mapFrom);
+ let from = mapping.map($from.pos), to = mapping.map($to.pos);
+ if (i2) {
+ tr.deleteRange(from, to);
+ } else {
+ tr.replaceRangeWith(from, to, node2);
+ selectionToInsertionEnd(tr, mapFrom, node2.isInline ? -1 : 1);
+ }
+ }
+ }
+ /**
+ Find a valid cursor or leaf node selection starting at the given
+ position and searching back if `dir` is negative, and forward if
+ positive. When `textOnly` is true, only consider cursor
+ selections. Will return null when no valid selection position is
+ found.
+ */
+ static findFrom($pos, dir, textOnly = false) {
+ let inner = $pos.parent.inlineContent ? new TextSelection($pos) : findSelectionIn($pos.node(0), $pos.parent, $pos.pos, $pos.index(), dir, textOnly);
+ if (inner)
+ return inner;
+ for (let depth = $pos.depth - 1; depth >= 0; depth--) {
+ let found2 = dir < 0 ? findSelectionIn($pos.node(0), $pos.node(depth), $pos.before(depth + 1), $pos.index(depth), dir, textOnly) : findSelectionIn($pos.node(0), $pos.node(depth), $pos.after(depth + 1), $pos.index(depth) + 1, dir, textOnly);
+ if (found2)
+ return found2;
+ }
+ return null;
+ }
+ /**
+ Find a valid cursor or leaf node selection near the given
+ position. Searches forward first by default, but if `bias` is
+ negative, it will search backwards first.
+ */
+ static near($pos, bias = 1) {
+ return this.findFrom($pos, bias) || this.findFrom($pos, -bias) || new AllSelection($pos.node(0));
+ }
+ /**
+ Find the cursor or leaf node selection closest to the start of
+ the given document. Will return an
+ [`AllSelection`](https://prosemirror.net/docs/ref/#state.AllSelection) if no valid position
+ exists.
+ */
+ static atStart(doc4) {
+ return findSelectionIn(doc4, doc4, 0, 0, 1) || new AllSelection(doc4);
+ }
+ /**
+ Find the cursor or leaf node selection closest to the end of the
+ given document.
+ */
+ static atEnd(doc4) {
+ return findSelectionIn(doc4, doc4, doc4.content.size, doc4.childCount, -1) || new AllSelection(doc4);
+ }
+ /**
+ Deserialize the JSON representation of a selection. Must be
+ implemented for custom classes (as a static class method).
+ */
+ static fromJSON(doc4, json) {
+ if (!json || !json.type)
+ throw new RangeError("Invalid input for Selection.fromJSON");
+ let cls = classesById[json.type];
+ if (!cls)
+ throw new RangeError(`No selection type ${json.type} defined`);
+ return cls.fromJSON(doc4, json);
+ }
+ /**
+ To be able to deserialize selections from JSON, custom selection
+ classes must register themselves with an ID string, so that they
+ can be disambiguated. Try to pick something that's unlikely to
+ clash with classes from other modules.
+ */
+ static jsonID(id, selectionClass) {
+ if (id in classesById)
+ throw new RangeError("Duplicate use of selection JSON ID " + id);
+ classesById[id] = selectionClass;
+ selectionClass.prototype.jsonID = id;
+ return selectionClass;
+ }
+ /**
+ Get a [bookmark](https://prosemirror.net/docs/ref/#state.SelectionBookmark) for this selection,
+ which is a value that can be mapped without having access to a
+ current document, and later resolved to a real selection for a
+ given document again. (This is used mostly by the history to
+ track and restore old selections.) The default implementation of
+ this method just converts the selection to a text selection and
+ returns the bookmark for that.
+ */
+ getBookmark() {
+ return TextSelection.between(this.$anchor, this.$head).getBookmark();
+ }
+ };
+ Selection.prototype.visible = true;
+ var SelectionRange = class {
+ /**
+ Create a range.
+ */
+ constructor($from, $to) {
+ this.$from = $from;
+ this.$to = $to;
+ }
+ };
+ var warnedAboutTextSelection = false;
+ function checkTextSelection($pos) {
+ if (!warnedAboutTextSelection && !$pos.parent.inlineContent) {
+ warnedAboutTextSelection = true;
+ console["warn"]("TextSelection endpoint not pointing into a node with inline content (" + $pos.parent.type.name + ")");
+ }
+ }
+ var TextSelection = class _TextSelection extends Selection {
+ /**
+ Construct a text selection between the given points.
+ */
+ constructor($anchor, $head = $anchor) {
+ checkTextSelection($anchor);
+ checkTextSelection($head);
+ super($anchor, $head);
+ }
+ /**
+ Returns a resolved position if this is a cursor selection (an
+ empty text selection), and null otherwise.
+ */
+ get $cursor() {
+ return this.$anchor.pos == this.$head.pos ? this.$head : null;
+ }
+ map(doc4, mapping) {
+ let $head = doc4.resolve(mapping.map(this.head));
+ if (!$head.parent.inlineContent)
+ return Selection.near($head);
+ let $anchor = doc4.resolve(mapping.map(this.anchor));
+ return new _TextSelection($anchor.parent.inlineContent ? $anchor : $head, $head);
+ }
+ replace(tr, content3 = Slice.empty) {
+ super.replace(tr, content3);
+ if (content3 == Slice.empty) {
+ let marks = this.$from.marksAcross(this.$to);
+ if (marks)
+ tr.ensureMarks(marks);
+ }
+ }
+ eq(other) {
+ return other instanceof _TextSelection && other.anchor == this.anchor && other.head == this.head;
+ }
+ getBookmark() {
+ return new TextBookmark(this.anchor, this.head);
+ }
+ toJSON() {
+ return { type: "text", anchor: this.anchor, head: this.head };
+ }
+ /**
+ @internal
+ */
+ static fromJSON(doc4, json) {
+ if (typeof json.anchor != "number" || typeof json.head != "number")
+ throw new RangeError("Invalid input for TextSelection.fromJSON");
+ return new _TextSelection(doc4.resolve(json.anchor), doc4.resolve(json.head));
+ }
+ /**
+ Create a text selection from non-resolved positions.
+ */
+ static create(doc4, anchor, head = anchor) {
+ let $anchor = doc4.resolve(anchor);
+ return new this($anchor, head == anchor ? $anchor : doc4.resolve(head));
+ }
+ /**
+ Return a text selection that spans the given positions or, if
+ they aren't text positions, find a text selection near them.
+ `bias` determines whether the method searches forward (default)
+ or backwards (negative number) first. Will fall back to calling
+ [`Selection.near`](https://prosemirror.net/docs/ref/#state.Selection^near) when the document
+ doesn't contain a valid text position.
+ */
+ static between($anchor, $head, bias) {
+ let dPos = $anchor.pos - $head.pos;
+ if (!bias || dPos)
+ bias = dPos >= 0 ? 1 : -1;
+ if (!$head.parent.inlineContent) {
+ let found2 = Selection.findFrom($head, bias, true) || Selection.findFrom($head, -bias, true);
+ if (found2)
+ $head = found2.$head;
+ else
+ return Selection.near($head, bias);
+ }
+ if (!$anchor.parent.inlineContent) {
+ if (dPos == 0) {
+ $anchor = $head;
+ } else {
+ $anchor = (Selection.findFrom($anchor, -bias, true) || Selection.findFrom($anchor, bias, true)).$anchor;
+ if ($anchor.pos < $head.pos != dPos < 0)
+ $anchor = $head;
+ }
+ }
+ return new _TextSelection($anchor, $head);
+ }
+ };
+ Selection.jsonID("text", TextSelection);
+ var TextBookmark = class _TextBookmark {
+ constructor(anchor, head) {
+ this.anchor = anchor;
+ this.head = head;
+ }
+ map(mapping) {
+ return new _TextBookmark(mapping.map(this.anchor), mapping.map(this.head));
+ }
+ resolve(doc4) {
+ return TextSelection.between(doc4.resolve(this.anchor), doc4.resolve(this.head));
+ }
+ };
+ var NodeSelection = class _NodeSelection extends Selection {
+ /**
+ Create a node selection. Does not verify the validity of its
+ argument.
+ */
+ constructor($pos) {
+ let node2 = $pos.nodeAfter;
+ let $end = $pos.node(0).resolve($pos.pos + node2.nodeSize);
+ super($pos, $end);
+ this.node = node2;
+ }
+ map(doc4, mapping) {
+ let { deleted, pos } = mapping.mapResult(this.anchor);
+ let $pos = doc4.resolve(pos);
+ if (deleted)
+ return Selection.near($pos);
+ return new _NodeSelection($pos);
+ }
+ content() {
+ return new Slice(Fragment.from(this.node), 0, 0);
+ }
+ eq(other) {
+ return other instanceof _NodeSelection && other.anchor == this.anchor;
+ }
+ toJSON() {
+ return { type: "node", anchor: this.anchor };
+ }
+ getBookmark() {
+ return new NodeBookmark(this.anchor);
+ }
+ /**
+ @internal
+ */
+ static fromJSON(doc4, json) {
+ if (typeof json.anchor != "number")
+ throw new RangeError("Invalid input for NodeSelection.fromJSON");
+ return new _NodeSelection(doc4.resolve(json.anchor));
+ }
+ /**
+ Create a node selection from non-resolved positions.
+ */
+ static create(doc4, from) {
+ return new _NodeSelection(doc4.resolve(from));
+ }
+ /**
+ Determines whether the given node may be selected as a node
+ selection.
+ */
+ static isSelectable(node2) {
+ return !node2.isText && node2.type.spec.selectable !== false;
+ }
+ };
+ NodeSelection.prototype.visible = false;
+ Selection.jsonID("node", NodeSelection);
+ var NodeBookmark = class _NodeBookmark {
+ constructor(anchor) {
+ this.anchor = anchor;
+ }
+ map(mapping) {
+ let { deleted, pos } = mapping.mapResult(this.anchor);
+ return deleted ? new TextBookmark(pos, pos) : new _NodeBookmark(pos);
+ }
+ resolve(doc4) {
+ let $pos = doc4.resolve(this.anchor), node2 = $pos.nodeAfter;
+ if (node2 && NodeSelection.isSelectable(node2))
+ return new NodeSelection($pos);
+ return Selection.near($pos);
+ }
+ };
+ var AllSelection = class _AllSelection extends Selection {
+ /**
+ Create an all-selection over the given document.
+ */
+ constructor(doc4) {
+ super(doc4.resolve(0), doc4.resolve(doc4.content.size));
+ }
+ replace(tr, content3 = Slice.empty) {
+ if (content3 == Slice.empty) {
+ tr.delete(0, tr.doc.content.size);
+ let sel = Selection.atStart(tr.doc);
+ if (!sel.eq(tr.selection))
+ tr.setSelection(sel);
+ } else {
+ super.replace(tr, content3);
+ }
+ }
+ toJSON() {
+ return { type: "all" };
+ }
+ /**
+ @internal
+ */
+ static fromJSON(doc4) {
+ return new _AllSelection(doc4);
+ }
+ map(doc4) {
+ return new _AllSelection(doc4);
+ }
+ eq(other) {
+ return other instanceof _AllSelection;
+ }
+ getBookmark() {
+ return AllBookmark;
+ }
+ };
+ Selection.jsonID("all", AllSelection);
+ var AllBookmark = {
+ map() {
+ return this;
+ },
+ resolve(doc4) {
+ return new AllSelection(doc4);
+ }
+ };
+ function findSelectionIn(doc4, node2, pos, index2, dir, text5 = false) {
+ if (node2.inlineContent)
+ return TextSelection.create(doc4, pos);
+ for (let i2 = index2 - (dir > 0 ? 0 : 1); dir > 0 ? i2 < node2.childCount : i2 >= 0; i2 += dir) {
+ let child = node2.child(i2);
+ if (!child.isAtom) {
+ let inner = findSelectionIn(doc4, child, pos + dir, dir < 0 ? child.childCount : 0, dir, text5);
+ if (inner)
+ return inner;
+ } else if (!text5 && NodeSelection.isSelectable(child)) {
+ return NodeSelection.create(doc4, pos - (dir < 0 ? child.nodeSize : 0));
+ }
+ pos += child.nodeSize * dir;
+ }
+ return null;
+ }
+ function selectionToInsertionEnd(tr, startLen, bias) {
+ let last = tr.steps.length - 1;
+ if (last < startLen)
+ return;
+ let step = tr.steps[last];
+ if (!(step instanceof ReplaceStep || step instanceof ReplaceAroundStep))
+ return;
+ let map5 = tr.mapping.maps[last], end;
+ map5.forEach((_from, _to, _newFrom, newTo) => {
+ if (end == null)
+ end = newTo;
+ });
+ tr.setSelection(Selection.near(tr.doc.resolve(end), bias));
+ }
+ var UPDATED_SEL = 1;
+ var UPDATED_MARKS = 2;
+ var UPDATED_SCROLL = 4;
+ var Transaction = class extends Transform {
+ /**
+ @internal
+ */
+ constructor(state) {
+ super(state.doc);
+ this.curSelectionFor = 0;
+ this.updated = 0;
+ this.meta = /* @__PURE__ */ Object.create(null);
+ this.time = Date.now();
+ this.curSelection = state.selection;
+ this.storedMarks = state.storedMarks;
+ }
+ /**
+ The transaction's current selection. This defaults to the editor
+ selection [mapped](https://prosemirror.net/docs/ref/#state.Selection.map) through the steps in the
+ transaction, but can be overwritten with
+ [`setSelection`](https://prosemirror.net/docs/ref/#state.Transaction.setSelection).
+ */
+ get selection() {
+ if (this.curSelectionFor < this.steps.length) {
+ this.curSelection = this.curSelection.map(this.doc, this.mapping.slice(this.curSelectionFor));
+ this.curSelectionFor = this.steps.length;
+ }
+ return this.curSelection;
+ }
+ /**
+ Update the transaction's current selection. Will determine the
+ selection that the editor gets when the transaction is applied.
+ */
+ setSelection(selection) {
+ if (selection.$from.doc != this.doc)
+ throw new RangeError("Selection passed to setSelection must point at the current document");
+ this.curSelection = selection;
+ this.curSelectionFor = this.steps.length;
+ this.updated = (this.updated | UPDATED_SEL) & ~UPDATED_MARKS;
+ this.storedMarks = null;
+ return this;
+ }
+ /**
+ Whether the selection was explicitly updated by this transaction.
+ */
+ get selectionSet() {
+ return (this.updated & UPDATED_SEL) > 0;
+ }
+ /**
+ Set the current stored marks.
+ */
+ setStoredMarks(marks) {
+ this.storedMarks = marks;
+ this.updated |= UPDATED_MARKS;
+ return this;
+ }
+ /**
+ Make sure the current stored marks or, if that is null, the marks
+ at the selection, match the given set of marks. Does nothing if
+ this is already the case.
+ */
+ ensureMarks(marks) {
+ if (!Mark.sameSet(this.storedMarks || this.selection.$from.marks(), marks))
+ this.setStoredMarks(marks);
+ return this;
+ }
+ /**
+ Add a mark to the set of stored marks.
+ */
+ addStoredMark(mark) {
+ return this.ensureMarks(mark.addToSet(this.storedMarks || this.selection.$head.marks()));
+ }
+ /**
+ Remove a mark or mark type from the set of stored marks.
+ */
+ removeStoredMark(mark) {
+ return this.ensureMarks(mark.removeFromSet(this.storedMarks || this.selection.$head.marks()));
+ }
+ /**
+ Whether the stored marks were explicitly set for this transaction.
+ */
+ get storedMarksSet() {
+ return (this.updated & UPDATED_MARKS) > 0;
+ }
+ /**
+ @internal
+ */
+ addStep(step, doc4) {
+ super.addStep(step, doc4);
+ this.updated = this.updated & ~UPDATED_MARKS;
+ this.storedMarks = null;
+ }
+ /**
+ Update the timestamp for the transaction.
+ */
+ setTime(time) {
+ this.time = time;
+ return this;
+ }
+ /**
+ Replace the current selection with the given slice.
+ */
+ replaceSelection(slice) {
+ this.selection.replace(this, slice);
+ return this;
+ }
+ /**
+ Replace the selection with the given node. When `inheritMarks` is
+ true and the content is inline, it inherits the marks from the
+ place where it is inserted.
+ */
+ replaceSelectionWith(node2, inheritMarks = true) {
+ let selection = this.selection;
+ if (inheritMarks)
+ node2 = node2.mark(this.storedMarks || (selection.empty ? selection.$from.marks() : selection.$from.marksAcross(selection.$to) || Mark.none));
+ selection.replaceWith(this, node2);
+ return this;
+ }
+ /**
+ Delete the selection.
+ */
+ deleteSelection() {
+ this.selection.replace(this);
+ return this;
+ }
+ /**
+ Replace the given range, or the selection if no range is given,
+ with a text node containing the given string.
+ */
+ insertText(text5, from, to) {
+ let schema = this.doc.type.schema;
+ if (from == null) {
+ if (!text5)
+ return this.deleteSelection();
+ return this.replaceSelectionWith(schema.text(text5), true);
+ } else {
+ if (to == null)
+ to = from;
+ to = to == null ? from : to;
+ if (!text5)
+ return this.deleteRange(from, to);
+ let marks = this.storedMarks;
+ if (!marks) {
+ let $from = this.doc.resolve(from);
+ marks = to == from ? $from.marks() : $from.marksAcross(this.doc.resolve(to));
+ }
+ this.replaceRangeWith(from, to, schema.text(text5, marks));
+ if (!this.selection.empty)
+ this.setSelection(Selection.near(this.selection.$to));
+ return this;
+ }
+ }
+ /**
+ Store a metadata property in this transaction, keyed either by
+ name or by plugin.
+ */
+ setMeta(key, value) {
+ this.meta[typeof key == "string" ? key : key.key] = value;
+ return this;
+ }
+ /**
+ Retrieve a metadata property for a given name or plugin.
+ */
+ getMeta(key) {
+ return this.meta[typeof key == "string" ? key : key.key];
+ }
+ /**
+ Returns true if this transaction doesn't contain any metadata,
+ and can thus safely be extended.
+ */
+ get isGeneric() {
+ for (let _3 in this.meta)
+ return false;
+ return true;
+ }
+ /**
+ Indicate that the editor should scroll the selection into view
+ when updated to the state produced by this transaction.
+ */
+ scrollIntoView() {
+ this.updated |= UPDATED_SCROLL;
+ return this;
+ }
+ /**
+ True when this transaction has had `scrollIntoView` called on it.
+ */
+ get scrolledIntoView() {
+ return (this.updated & UPDATED_SCROLL) > 0;
+ }
+ };
+ function bind(f3, self2) {
+ return !self2 || !f3 ? f3 : f3.bind(self2);
+ }
+ var FieldDesc = class {
+ constructor(name, desc, self2) {
+ this.name = name;
+ this.init = bind(desc.init, self2);
+ this.apply = bind(desc.apply, self2);
+ }
+ };
+ var baseFields = [
+ new FieldDesc("doc", {
+ init(config) {
+ return config.doc || config.schema.topNodeType.createAndFill();
+ },
+ apply(tr) {
+ return tr.doc;
+ }
+ }),
+ new FieldDesc("selection", {
+ init(config, instance) {
+ return config.selection || Selection.atStart(instance.doc);
+ },
+ apply(tr) {
+ return tr.selection;
+ }
+ }),
+ new FieldDesc("storedMarks", {
+ init(config) {
+ return config.storedMarks || null;
+ },
+ apply(tr, _marks, _old, state) {
+ return state.selection.$cursor ? tr.storedMarks : null;
+ }
+ }),
+ new FieldDesc("scrollToSelection", {
+ init() {
+ return 0;
+ },
+ apply(tr, prev) {
+ return tr.scrolledIntoView ? prev + 1 : prev;
+ }
+ })
+ ];
+ var Configuration = class {
+ constructor(schema, plugins) {
+ this.schema = schema;
+ this.plugins = [];
+ this.pluginsByKey = /* @__PURE__ */ Object.create(null);
+ this.fields = baseFields.slice();
+ if (plugins)
+ plugins.forEach((plugin) => {
+ if (this.pluginsByKey[plugin.key])
+ throw new RangeError("Adding different instances of a keyed plugin (" + plugin.key + ")");
+ this.plugins.push(plugin);
+ this.pluginsByKey[plugin.key] = plugin;
+ if (plugin.spec.state)
+ this.fields.push(new FieldDesc(plugin.key, plugin.spec.state, plugin));
+ });
+ }
+ };
+ var EditorState = class _EditorState {
+ /**
+ @internal
+ */
+ constructor(config) {
+ this.config = config;
+ }
+ /**
+ The schema of the state's document.
+ */
+ get schema() {
+ return this.config.schema;
+ }
+ /**
+ The plugins that are active in this state.
+ */
+ get plugins() {
+ return this.config.plugins;
+ }
+ /**
+ Apply the given transaction to produce a new state.
+ */
+ apply(tr) {
+ return this.applyTransaction(tr).state;
+ }
+ /**
+ @internal
+ */
+ filterTransaction(tr, ignore = -1) {
+ for (let i2 = 0; i2 < this.config.plugins.length; i2++)
+ if (i2 != ignore) {
+ let plugin = this.config.plugins[i2];
+ if (plugin.spec.filterTransaction && !plugin.spec.filterTransaction.call(plugin, tr, this))
+ return false;
+ }
+ return true;
+ }
+ /**
+ Verbose variant of [`apply`](https://prosemirror.net/docs/ref/#state.EditorState.apply) that
+ returns the precise transactions that were applied (which might
+ be influenced by the [transaction
+ hooks](https://prosemirror.net/docs/ref/#state.PluginSpec.filterTransaction) of
+ plugins) along with the new state.
+ */
+ applyTransaction(rootTr) {
+ if (!this.filterTransaction(rootTr))
+ return { state: this, transactions: [] };
+ let trs = [rootTr], newState = this.applyInner(rootTr), seen = null;
+ for (; ; ) {
+ let haveNew = false;
+ for (let i2 = 0; i2 < this.config.plugins.length; i2++) {
+ let plugin = this.config.plugins[i2];
+ if (plugin.spec.appendTransaction) {
+ let n4 = seen ? seen[i2].n : 0, oldState = seen ? seen[i2].state : this;
+ let tr = n4 < trs.length && plugin.spec.appendTransaction.call(plugin, n4 ? trs.slice(n4) : trs, oldState, newState);
+ if (tr && newState.filterTransaction(tr, i2)) {
+ tr.setMeta("appendedTransaction", rootTr);
+ if (!seen) {
+ seen = [];
+ for (let j6 = 0; j6 < this.config.plugins.length; j6++)
+ seen.push(j6 < i2 ? { state: newState, n: trs.length } : { state: this, n: 0 });
+ }
+ trs.push(tr);
+ newState = newState.applyInner(tr);
+ haveNew = true;
+ }
+ if (seen)
+ seen[i2] = { state: newState, n: trs.length };
+ }
+ }
+ if (!haveNew)
+ return { state: newState, transactions: trs };
+ }
+ }
+ /**
+ @internal
+ */
+ applyInner(tr) {
+ if (!tr.before.eq(this.doc))
+ throw new RangeError("Applying a mismatched transaction");
+ let newInstance = new _EditorState(this.config), fields = this.config.fields;
+ for (let i2 = 0; i2 < fields.length; i2++) {
+ let field = fields[i2];
+ newInstance[field.name] = field.apply(tr, this[field.name], this, newInstance);
+ }
+ return newInstance;
+ }
+ /**
+ Start a [transaction](https://prosemirror.net/docs/ref/#state.Transaction) from this state.
+ */
+ get tr() {
+ return new Transaction(this);
+ }
+ /**
+ Create a new state.
+ */
+ static create(config) {
+ let $config = new Configuration(config.doc ? config.doc.type.schema : config.schema, config.plugins);
+ let instance = new _EditorState($config);
+ for (let i2 = 0; i2 < $config.fields.length; i2++)
+ instance[$config.fields[i2].name] = $config.fields[i2].init(config, instance);
+ return instance;
+ }
+ /**
+ Create a new state based on this one, but with an adjusted set
+ of active plugins. State fields that exist in both sets of
+ plugins are kept unchanged. Those that no longer exist are
+ dropped, and those that are new are initialized using their
+ [`init`](https://prosemirror.net/docs/ref/#state.StateField.init) method, passing in the new
+ configuration object..
+ */
+ reconfigure(config) {
+ let $config = new Configuration(this.schema, config.plugins);
+ let fields = $config.fields, instance = new _EditorState($config);
+ for (let i2 = 0; i2 < fields.length; i2++) {
+ let name = fields[i2].name;
+ instance[name] = this.hasOwnProperty(name) ? this[name] : fields[i2].init(config, instance);
+ }
+ return instance;
+ }
+ /**
+ Serialize this state to JSON. If you want to serialize the state
+ of plugins, pass an object mapping property names to use in the
+ resulting JSON object to plugin objects. The argument may also be
+ a string or number, in which case it is ignored, to support the
+ way `JSON.stringify` calls `toString` methods.
+ */
+ toJSON(pluginFields) {
+ let result = { doc: this.doc.toJSON(), selection: this.selection.toJSON() };
+ if (this.storedMarks)
+ result.storedMarks = this.storedMarks.map((m3) => m3.toJSON());
+ if (pluginFields && typeof pluginFields == "object")
+ for (let prop in pluginFields) {
+ if (prop == "doc" || prop == "selection")
+ throw new RangeError("The JSON fields `doc` and `selection` are reserved");
+ let plugin = pluginFields[prop], state = plugin.spec.state;
+ if (state && state.toJSON)
+ result[prop] = state.toJSON.call(plugin, this[plugin.key]);
+ }
+ return result;
+ }
+ /**
+ Deserialize a JSON representation of a state. `config` should
+ have at least a `schema` field, and should contain array of
+ plugins to initialize the state with. `pluginFields` can be used
+ to deserialize the state of plugins, by associating plugin
+ instances with the property names they use in the JSON object.
+ */
+ static fromJSON(config, json, pluginFields) {
+ if (!json)
+ throw new RangeError("Invalid input for EditorState.fromJSON");
+ if (!config.schema)
+ throw new RangeError("Required config field 'schema' missing");
+ let $config = new Configuration(config.schema, config.plugins);
+ let instance = new _EditorState($config);
+ $config.fields.forEach((field) => {
+ if (field.name == "doc") {
+ instance.doc = Node2.fromJSON(config.schema, json.doc);
+ } else if (field.name == "selection") {
+ instance.selection = Selection.fromJSON(instance.doc, json.selection);
+ } else if (field.name == "storedMarks") {
+ if (json.storedMarks)
+ instance.storedMarks = json.storedMarks.map(config.schema.markFromJSON);
+ } else {
+ if (pluginFields)
+ for (let prop in pluginFields) {
+ let plugin = pluginFields[prop], state = plugin.spec.state;
+ if (plugin.key == field.name && state && state.fromJSON && Object.prototype.hasOwnProperty.call(json, prop)) {
+ instance[field.name] = state.fromJSON.call(plugin, config, json[prop], instance);
+ return;
+ }
+ }
+ instance[field.name] = field.init(config, instance);
+ }
+ });
+ return instance;
+ }
+ };
+ function bindProps(obj, self2, target) {
+ for (let prop in obj) {
+ let val = obj[prop];
+ if (val instanceof Function)
+ val = val.bind(self2);
+ else if (prop == "handleDOMEvents")
+ val = bindProps(val, self2, {});
+ target[prop] = val;
+ }
+ return target;
+ }
+ var Plugin = class {
+ /**
+ Create a plugin.
+ */
+ constructor(spec) {
+ this.spec = spec;
+ this.props = {};
+ if (spec.props)
+ bindProps(spec.props, this, this.props);
+ this.key = spec.key ? spec.key.key : createKey("plugin");
+ }
+ /**
+ Extract the plugin's state field from an editor state.
+ */
+ getState(state) {
+ return state[this.key];
+ }
+ };
+ var keys = /* @__PURE__ */ Object.create(null);
+ function createKey(name) {
+ if (name in keys)
+ return name + "$" + ++keys[name];
+ keys[name] = 0;
+ return name + "$";
+ }
+ var PluginKey = class {
+ /**
+ Create a plugin key.
+ */
+ constructor(name = "key") {
+ this.key = createKey(name);
+ }
+ /**
+ Get the active plugin with this key, if any, from an editor
+ state.
+ */
+ get(state) {
+ return state.config.pluginsByKey[this.key];
+ }
+ /**
+ Get the plugin's state from an editor state.
+ */
+ getState(state) {
+ return state[this.key];
+ }
+ };
+
+ // node_modules/prosemirror-view/dist/index.js
+ var domIndex = function(node2) {
+ for (var index2 = 0; ; index2++) {
+ node2 = node2.previousSibling;
+ if (!node2)
+ return index2;
+ }
+ };
+ var parentNode = function(node2) {
+ let parent = node2.assignedSlot || node2.parentNode;
+ return parent && parent.nodeType == 11 ? parent.host : parent;
+ };
+ var reusedRange = null;
+ var textRange = function(node2, from, to) {
+ let range = reusedRange || (reusedRange = document.createRange());
+ range.setEnd(node2, to == null ? node2.nodeValue.length : to);
+ range.setStart(node2, from || 0);
+ return range;
+ };
+ var clearReusedRange = function() {
+ reusedRange = null;
+ };
+ var isEquivalentPosition = function(node2, off, targetNode, targetOff) {
+ return targetNode && (scanFor(node2, off, targetNode, targetOff, -1) || scanFor(node2, off, targetNode, targetOff, 1));
+ };
+ var atomElements = /^(img|br|input|textarea|hr)$/i;
+ function scanFor(node2, off, targetNode, targetOff, dir) {
+ for (; ; ) {
+ if (node2 == targetNode && off == targetOff)
+ return true;
+ if (off == (dir < 0 ? 0 : nodeSize(node2))) {
+ let parent = node2.parentNode;
+ if (!parent || parent.nodeType != 1 || hasBlockDesc(node2) || atomElements.test(node2.nodeName) || node2.contentEditable == "false")
+ return false;
+ off = domIndex(node2) + (dir < 0 ? 0 : 1);
+ node2 = parent;
+ } else if (node2.nodeType == 1) {
+ node2 = node2.childNodes[off + (dir < 0 ? -1 : 0)];
+ if (node2.contentEditable == "false")
+ return false;
+ off = dir < 0 ? nodeSize(node2) : 0;
+ } else {
+ return false;
+ }
+ }
+ }
+ function nodeSize(node2) {
+ return node2.nodeType == 3 ? node2.nodeValue.length : node2.childNodes.length;
+ }
+ function textNodeBefore$1(node2, offset) {
+ for (; ; ) {
+ if (node2.nodeType == 3 && offset)
+ return node2;
+ if (node2.nodeType == 1 && offset > 0) {
+ if (node2.contentEditable == "false")
+ return null;
+ node2 = node2.childNodes[offset - 1];
+ offset = nodeSize(node2);
+ } else if (node2.parentNode && !hasBlockDesc(node2)) {
+ offset = domIndex(node2);
+ node2 = node2.parentNode;
+ } else {
+ return null;
+ }
+ }
+ }
+ function textNodeAfter$1(node2, offset) {
+ for (; ; ) {
+ if (node2.nodeType == 3 && offset < node2.nodeValue.length)
+ return node2;
+ if (node2.nodeType == 1 && offset < node2.childNodes.length) {
+ if (node2.contentEditable == "false")
+ return null;
+ node2 = node2.childNodes[offset];
+ offset = 0;
+ } else if (node2.parentNode && !hasBlockDesc(node2)) {
+ offset = domIndex(node2) + 1;
+ node2 = node2.parentNode;
+ } else {
+ return null;
+ }
+ }
+ }
+ function isOnEdge(node2, offset, parent) {
+ for (let atStart = offset == 0, atEnd = offset == nodeSize(node2); atStart || atEnd; ) {
+ if (node2 == parent)
+ return true;
+ let index2 = domIndex(node2);
+ node2 = node2.parentNode;
+ if (!node2)
+ return false;
+ atStart = atStart && index2 == 0;
+ atEnd = atEnd && index2 == nodeSize(node2);
+ }
+ }
+ function hasBlockDesc(dom) {
+ let desc;
+ for (let cur = dom; cur; cur = cur.parentNode)
+ if (desc = cur.pmViewDesc)
+ break;
+ return desc && desc.node && desc.node.isBlock && (desc.dom == dom || desc.contentDOM == dom);
+ }
+ var selectionCollapsed = function(domSel) {
+ return domSel.focusNode && isEquivalentPosition(domSel.focusNode, domSel.focusOffset, domSel.anchorNode, domSel.anchorOffset);
+ };
+ function keyEvent(keyCode, key) {
+ let event = document.createEvent("Event");
+ event.initEvent("keydown", true, true);
+ event.keyCode = keyCode;
+ event.key = event.code = key;
+ return event;
+ }
+ function deepActiveElement(doc4) {
+ let elt = doc4.activeElement;
+ while (elt && elt.shadowRoot)
+ elt = elt.shadowRoot.activeElement;
+ return elt;
+ }
+ function caretFromPoint(doc4, x6, y4) {
+ if (doc4.caretPositionFromPoint) {
+ try {
+ let pos = doc4.caretPositionFromPoint(x6, y4);
+ if (pos)
+ return { node: pos.offsetNode, offset: pos.offset };
+ } catch (_3) {
+ }
+ }
+ if (doc4.caretRangeFromPoint) {
+ let range = doc4.caretRangeFromPoint(x6, y4);
+ if (range)
+ return { node: range.startContainer, offset: range.startOffset };
+ }
+ }
+ var nav = typeof navigator != "undefined" ? navigator : null;
+ var doc2 = typeof document != "undefined" ? document : null;
+ var agent = nav && nav.userAgent || "";
+ var ie_edge = /Edge\/(\d+)/.exec(agent);
+ var ie_upto10 = /MSIE \d/.exec(agent);
+ var ie_11up = /Trident\/(?:[7-9]|\d{2,})\..*rv:(\d+)/.exec(agent);
+ var ie = !!(ie_upto10 || ie_11up || ie_edge);
+ var ie_version = ie_upto10 ? document.documentMode : ie_11up ? +ie_11up[1] : ie_edge ? +ie_edge[1] : 0;
+ var gecko = !ie && /gecko\/(\d+)/i.test(agent);
+ gecko && +(/Firefox\/(\d+)/.exec(agent) || [0, 0])[1];
+ var _chrome = !ie && /Chrome\/(\d+)/.exec(agent);
+ var chrome = !!_chrome;
+ var chrome_version = _chrome ? +_chrome[1] : 0;
+ var safari = !ie && !!nav && /Apple Computer/.test(nav.vendor);
+ var ios = safari && (/Mobile\/\w+/.test(agent) || !!nav && nav.maxTouchPoints > 2);
+ var mac = ios || (nav ? /Mac/.test(nav.platform) : false);
+ var windows = nav ? /Win/.test(nav.platform) : false;
+ var android = /Android \d/.test(agent);
+ var webkit = !!doc2 && "webkitFontSmoothing" in doc2.documentElement.style;
+ var webkit_version = webkit ? +(/\bAppleWebKit\/(\d+)/.exec(navigator.userAgent) || [0, 0])[1] : 0;
+ function windowRect(doc4) {
+ let vp = doc4.defaultView && doc4.defaultView.visualViewport;
+ if (vp)
+ return {
+ left: 0,
+ right: vp.width,
+ top: 0,
+ bottom: vp.height
+ };
+ return {
+ left: 0,
+ right: doc4.documentElement.clientWidth,
+ top: 0,
+ bottom: doc4.documentElement.clientHeight
+ };
+ }
+ function getSide(value, side) {
+ return typeof value == "number" ? value : value[side];
+ }
+ function clientRect(node2) {
+ let rect = node2.getBoundingClientRect();
+ let scaleX = rect.width / node2.offsetWidth || 1;
+ let scaleY = rect.height / node2.offsetHeight || 1;
+ return {
+ left: rect.left,
+ right: rect.left + node2.clientWidth * scaleX,
+ top: rect.top,
+ bottom: rect.top + node2.clientHeight * scaleY
+ };
+ }
+ function scrollRectIntoView(view, rect, startDOM) {
+ let scrollThreshold = view.someProp("scrollThreshold") || 0, scrollMargin = view.someProp("scrollMargin") || 5;
+ let doc4 = view.dom.ownerDocument;
+ for (let parent = startDOM || view.dom; ; parent = parentNode(parent)) {
+ if (!parent)
+ break;
+ if (parent.nodeType != 1)
+ continue;
+ let elt = parent;
+ let atTop = elt == doc4.body;
+ let bounding = atTop ? windowRect(doc4) : clientRect(elt);
+ let moveX = 0, moveY = 0;
+ if (rect.top < bounding.top + getSide(scrollThreshold, "top"))
+ moveY = -(bounding.top - rect.top + getSide(scrollMargin, "top"));
+ else if (rect.bottom > bounding.bottom - getSide(scrollThreshold, "bottom"))
+ moveY = rect.bottom - rect.top > bounding.bottom - bounding.top ? rect.top + getSide(scrollMargin, "top") - bounding.top : rect.bottom - bounding.bottom + getSide(scrollMargin, "bottom");
+ if (rect.left < bounding.left + getSide(scrollThreshold, "left"))
+ moveX = -(bounding.left - rect.left + getSide(scrollMargin, "left"));
+ else if (rect.right > bounding.right - getSide(scrollThreshold, "right"))
+ moveX = rect.right - bounding.right + getSide(scrollMargin, "right");
+ if (moveX || moveY) {
+ if (atTop) {
+ doc4.defaultView.scrollBy(moveX, moveY);
+ } else {
+ let startX = elt.scrollLeft, startY = elt.scrollTop;
+ if (moveY)
+ elt.scrollTop += moveY;
+ if (moveX)
+ elt.scrollLeft += moveX;
+ let dX = elt.scrollLeft - startX, dY = elt.scrollTop - startY;
+ rect = { left: rect.left - dX, top: rect.top - dY, right: rect.right - dX, bottom: rect.bottom - dY };
+ }
+ }
+ if (atTop || /^(fixed|sticky)$/.test(getComputedStyle(parent).position))
+ break;
+ }
+ }
+ function storeScrollPos(view) {
+ let rect = view.dom.getBoundingClientRect(), startY = Math.max(0, rect.top);
+ let refDOM, refTop;
+ for (let x6 = (rect.left + rect.right) / 2, y4 = startY + 1; y4 < Math.min(innerHeight, rect.bottom); y4 += 5) {
+ let dom = view.root.elementFromPoint(x6, y4);
+ if (!dom || dom == view.dom || !view.dom.contains(dom))
+ continue;
+ let localRect = dom.getBoundingClientRect();
+ if (localRect.top >= startY - 20) {
+ refDOM = dom;
+ refTop = localRect.top;
+ break;
+ }
+ }
+ return { refDOM, refTop, stack: scrollStack(view.dom) };
+ }
+ function scrollStack(dom) {
+ let stack = [], doc4 = dom.ownerDocument;
+ for (let cur = dom; cur; cur = parentNode(cur)) {
+ stack.push({ dom: cur, top: cur.scrollTop, left: cur.scrollLeft });
+ if (dom == doc4)
+ break;
+ }
+ return stack;
+ }
+ function resetScrollPos({ refDOM, refTop, stack }) {
+ let newRefTop = refDOM ? refDOM.getBoundingClientRect().top : 0;
+ restoreScrollStack(stack, newRefTop == 0 ? 0 : newRefTop - refTop);
+ }
+ function restoreScrollStack(stack, dTop) {
+ for (let i2 = 0; i2 < stack.length; i2++) {
+ let { dom, top, left } = stack[i2];
+ if (dom.scrollTop != top + dTop)
+ dom.scrollTop = top + dTop;
+ if (dom.scrollLeft != left)
+ dom.scrollLeft = left;
+ }
+ }
+ var preventScrollSupported = null;
+ function focusPreventScroll(dom) {
+ if (dom.setActive)
+ return dom.setActive();
+ if (preventScrollSupported)
+ return dom.focus(preventScrollSupported);
+ let stored = scrollStack(dom);
+ dom.focus(preventScrollSupported == null ? {
+ get preventScroll() {
+ preventScrollSupported = { preventScroll: true };
+ return true;
+ }
+ } : void 0);
+ if (!preventScrollSupported) {
+ preventScrollSupported = false;
+ restoreScrollStack(stored, 0);
+ }
+ }
+ function findOffsetInNode(node2, coords) {
+ let closest, dxClosest = 2e8, coordsClosest, offset = 0;
+ let rowBot = coords.top, rowTop = coords.top;
+ let firstBelow, coordsBelow;
+ for (let child = node2.firstChild, childIndex = 0; child; child = child.nextSibling, childIndex++) {
+ let rects;
+ if (child.nodeType == 1)
+ rects = child.getClientRects();
+ else if (child.nodeType == 3)
+ rects = textRange(child).getClientRects();
+ else
+ continue;
+ for (let i2 = 0; i2 < rects.length; i2++) {
+ let rect = rects[i2];
+ if (rect.top <= rowBot && rect.bottom >= rowTop) {
+ rowBot = Math.max(rect.bottom, rowBot);
+ rowTop = Math.min(rect.top, rowTop);
+ let dx = rect.left > coords.left ? rect.left - coords.left : rect.right < coords.left ? coords.left - rect.right : 0;
+ if (dx < dxClosest) {
+ closest = child;
+ dxClosest = dx;
+ coordsClosest = dx && closest.nodeType == 3 ? {
+ left: rect.right < coords.left ? rect.right : rect.left,
+ top: coords.top
+ } : coords;
+ if (child.nodeType == 1 && dx)
+ offset = childIndex + (coords.left >= (rect.left + rect.right) / 2 ? 1 : 0);
+ continue;
+ }
+ } else if (rect.top > coords.top && !firstBelow && rect.left <= coords.left && rect.right >= coords.left) {
+ firstBelow = child;
+ coordsBelow = { left: Math.max(rect.left, Math.min(rect.right, coords.left)), top: rect.top };
+ }
+ if (!closest && (coords.left >= rect.right && coords.top >= rect.top || coords.left >= rect.left && coords.top >= rect.bottom))
+ offset = childIndex + 1;
+ }
+ }
+ if (!closest && firstBelow) {
+ closest = firstBelow;
+ coordsClosest = coordsBelow;
+ dxClosest = 0;
+ }
+ if (closest && closest.nodeType == 3)
+ return findOffsetInText(closest, coordsClosest);
+ if (!closest || dxClosest && closest.nodeType == 1)
+ return { node: node2, offset };
+ return findOffsetInNode(closest, coordsClosest);
+ }
+ function findOffsetInText(node2, coords) {
+ let len = node2.nodeValue.length;
+ let range = document.createRange();
+ for (let i2 = 0; i2 < len; i2++) {
+ range.setEnd(node2, i2 + 1);
+ range.setStart(node2, i2);
+ let rect = singleRect(range, 1);
+ if (rect.top == rect.bottom)
+ continue;
+ if (inRect(coords, rect))
+ return { node: node2, offset: i2 + (coords.left >= (rect.left + rect.right) / 2 ? 1 : 0) };
+ }
+ return { node: node2, offset: 0 };
+ }
+ function inRect(coords, rect) {
+ return coords.left >= rect.left - 1 && coords.left <= rect.right + 1 && coords.top >= rect.top - 1 && coords.top <= rect.bottom + 1;
+ }
+ function targetKludge(dom, coords) {
+ let parent = dom.parentNode;
+ if (parent && /^li$/i.test(parent.nodeName) && coords.left < dom.getBoundingClientRect().left)
+ return parent;
+ return dom;
+ }
+ function posFromElement(view, elt, coords) {
+ let { node: node2, offset } = findOffsetInNode(elt, coords), bias = -1;
+ if (node2.nodeType == 1 && !node2.firstChild) {
+ let rect = node2.getBoundingClientRect();
+ bias = rect.left != rect.right && coords.left > (rect.left + rect.right) / 2 ? 1 : -1;
+ }
+ return view.docView.posFromDOM(node2, offset, bias);
+ }
+ function posFromCaret(view, node2, offset, coords) {
+ let outsideBlock = -1;
+ for (let cur = node2, sawBlock = false; ; ) {
+ if (cur == view.dom)
+ break;
+ let desc = view.docView.nearestDesc(cur, true);
+ if (!desc)
+ return null;
+ if (desc.dom.nodeType == 1 && (desc.node.isBlock && desc.parent && !sawBlock || !desc.contentDOM)) {
+ let rect = desc.dom.getBoundingClientRect();
+ if (desc.node.isBlock && desc.parent && !sawBlock) {
+ sawBlock = true;
+ if (rect.left > coords.left || rect.top > coords.top)
+ outsideBlock = desc.posBefore;
+ else if (rect.right < coords.left || rect.bottom < coords.top)
+ outsideBlock = desc.posAfter;
+ }
+ if (!desc.contentDOM && outsideBlock < 0 && !desc.node.isText) {
+ let before = desc.node.isBlock ? coords.top < (rect.top + rect.bottom) / 2 : coords.left < (rect.left + rect.right) / 2;
+ return before ? desc.posBefore : desc.posAfter;
+ }
+ }
+ cur = desc.dom.parentNode;
+ }
+ return outsideBlock > -1 ? outsideBlock : view.docView.posFromDOM(node2, offset, -1);
+ }
+ function elementFromPoint(element2, coords, box) {
+ let len = element2.childNodes.length;
+ if (len && box.top < box.bottom) {
+ for (let startI = Math.max(0, Math.min(len - 1, Math.floor(len * (coords.top - box.top) / (box.bottom - box.top)) - 2)), i2 = startI; ; ) {
+ let child = element2.childNodes[i2];
+ if (child.nodeType == 1) {
+ let rects = child.getClientRects();
+ for (let j6 = 0; j6 < rects.length; j6++) {
+ let rect = rects[j6];
+ if (inRect(coords, rect))
+ return elementFromPoint(child, coords, rect);
+ }
+ }
+ if ((i2 = (i2 + 1) % len) == startI)
+ break;
+ }
+ }
+ return element2;
+ }
+ function posAtCoords(view, coords) {
+ let doc4 = view.dom.ownerDocument, node2, offset = 0;
+ let caret = caretFromPoint(doc4, coords.left, coords.top);
+ if (caret)
+ ({ node: node2, offset } = caret);
+ let elt = (view.root.elementFromPoint ? view.root : doc4).elementFromPoint(coords.left, coords.top);
+ let pos;
+ if (!elt || !view.dom.contains(elt.nodeType != 1 ? elt.parentNode : elt)) {
+ let box = view.dom.getBoundingClientRect();
+ if (!inRect(coords, box))
+ return null;
+ elt = elementFromPoint(view.dom, coords, box);
+ if (!elt)
+ return null;
+ }
+ if (safari) {
+ for (let p4 = elt; node2 && p4; p4 = parentNode(p4))
+ if (p4.draggable)
+ node2 = void 0;
+ }
+ elt = targetKludge(elt, coords);
+ if (node2) {
+ if (gecko && node2.nodeType == 1) {
+ offset = Math.min(offset, node2.childNodes.length);
+ if (offset < node2.childNodes.length) {
+ let next = node2.childNodes[offset], box;
+ if (next.nodeName == "IMG" && (box = next.getBoundingClientRect()).right <= coords.left && box.bottom > coords.top)
+ offset++;
+ }
+ }
+ let prev;
+ if (webkit && offset && node2.nodeType == 1 && (prev = node2.childNodes[offset - 1]).nodeType == 1 && prev.contentEditable == "false" && prev.getBoundingClientRect().top >= coords.top)
+ offset--;
+ if (node2 == view.dom && offset == node2.childNodes.length - 1 && node2.lastChild.nodeType == 1 && coords.top > node2.lastChild.getBoundingClientRect().bottom)
+ pos = view.state.doc.content.size;
+ else if (offset == 0 || node2.nodeType != 1 || node2.childNodes[offset - 1].nodeName != "BR")
+ pos = posFromCaret(view, node2, offset, coords);
+ }
+ if (pos == null)
+ pos = posFromElement(view, elt, coords);
+ let desc = view.docView.nearestDesc(elt, true);
+ return { pos, inside: desc ? desc.posAtStart - desc.border : -1 };
+ }
+ function nonZero(rect) {
+ return rect.top < rect.bottom || rect.left < rect.right;
+ }
+ function singleRect(target, bias) {
+ let rects = target.getClientRects();
+ if (rects.length) {
+ let first = rects[bias < 0 ? 0 : rects.length - 1];
+ if (nonZero(first))
+ return first;
+ }
+ return Array.prototype.find.call(rects, nonZero) || target.getBoundingClientRect();
+ }
+ var BIDI = /[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/;
+ function coordsAtPos(view, pos, side) {
+ let { node: node2, offset, atom } = view.docView.domFromPos(pos, side < 0 ? -1 : 1);
+ let supportEmptyRange = webkit || gecko;
+ if (node2.nodeType == 3) {
+ if (supportEmptyRange && (BIDI.test(node2.nodeValue) || (side < 0 ? !offset : offset == node2.nodeValue.length))) {
+ let rect = singleRect(textRange(node2, offset, offset), side);
+ if (gecko && offset && /\s/.test(node2.nodeValue[offset - 1]) && offset < node2.nodeValue.length) {
+ let rectBefore = singleRect(textRange(node2, offset - 1, offset - 1), -1);
+ if (rectBefore.top == rect.top) {
+ let rectAfter = singleRect(textRange(node2, offset, offset + 1), -1);
+ if (rectAfter.top != rect.top)
+ return flattenV(rectAfter, rectAfter.left < rectBefore.left);
+ }
+ }
+ return rect;
+ } else {
+ let from = offset, to = offset, takeSide = side < 0 ? 1 : -1;
+ if (side < 0 && !offset) {
+ to++;
+ takeSide = -1;
+ } else if (side >= 0 && offset == node2.nodeValue.length) {
+ from--;
+ takeSide = 1;
+ } else if (side < 0) {
+ from--;
+ } else {
+ to++;
+ }
+ return flattenV(singleRect(textRange(node2, from, to), takeSide), takeSide < 0);
+ }
+ }
+ let $dom = view.state.doc.resolve(pos - (atom || 0));
+ if (!$dom.parent.inlineContent) {
+ if (atom == null && offset && (side < 0 || offset == nodeSize(node2))) {
+ let before = node2.childNodes[offset - 1];
+ if (before.nodeType == 1)
+ return flattenH(before.getBoundingClientRect(), false);
+ }
+ if (atom == null && offset < nodeSize(node2)) {
+ let after = node2.childNodes[offset];
+ if (after.nodeType == 1)
+ return flattenH(after.getBoundingClientRect(), true);
+ }
+ return flattenH(node2.getBoundingClientRect(), side >= 0);
+ }
+ if (atom == null && offset && (side < 0 || offset == nodeSize(node2))) {
+ let before = node2.childNodes[offset - 1];
+ let target = before.nodeType == 3 ? textRange(before, nodeSize(before) - (supportEmptyRange ? 0 : 1)) : before.nodeType == 1 && (before.nodeName != "BR" || !before.nextSibling) ? before : null;
+ if (target)
+ return flattenV(singleRect(target, 1), false);
+ }
+ if (atom == null && offset < nodeSize(node2)) {
+ let after = node2.childNodes[offset];
+ while (after.pmViewDesc && after.pmViewDesc.ignoreForCoords)
+ after = after.nextSibling;
+ let target = !after ? null : after.nodeType == 3 ? textRange(after, 0, supportEmptyRange ? 0 : 1) : after.nodeType == 1 ? after : null;
+ if (target)
+ return flattenV(singleRect(target, -1), true);
+ }
+ return flattenV(singleRect(node2.nodeType == 3 ? textRange(node2) : node2, -side), side >= 0);
+ }
+ function flattenV(rect, left) {
+ if (rect.width == 0)
+ return rect;
+ let x6 = left ? rect.left : rect.right;
+ return { top: rect.top, bottom: rect.bottom, left: x6, right: x6 };
+ }
+ function flattenH(rect, top) {
+ if (rect.height == 0)
+ return rect;
+ let y4 = top ? rect.top : rect.bottom;
+ return { top: y4, bottom: y4, left: rect.left, right: rect.right };
+ }
+ function withFlushedState(view, state, f3) {
+ let viewState = view.state, active = view.root.activeElement;
+ if (viewState != state)
+ view.updateState(state);
+ if (active != view.dom)
+ view.focus();
+ try {
+ return f3();
+ } finally {
+ if (viewState != state)
+ view.updateState(viewState);
+ if (active != view.dom && active)
+ active.focus();
+ }
+ }
+ function endOfTextblockVertical(view, state, dir) {
+ let sel = state.selection;
+ let $pos = dir == "up" ? sel.$from : sel.$to;
+ return withFlushedState(view, state, () => {
+ let { node: dom } = view.docView.domFromPos($pos.pos, dir == "up" ? -1 : 1);
+ for (; ; ) {
+ let nearest = view.docView.nearestDesc(dom, true);
+ if (!nearest)
+ break;
+ if (nearest.node.isBlock) {
+ dom = nearest.contentDOM || nearest.dom;
+ break;
+ }
+ dom = nearest.dom.parentNode;
+ }
+ let coords = coordsAtPos(view, $pos.pos, 1);
+ for (let child = dom.firstChild; child; child = child.nextSibling) {
+ let boxes;
+ if (child.nodeType == 1)
+ boxes = child.getClientRects();
+ else if (child.nodeType == 3)
+ boxes = textRange(child, 0, child.nodeValue.length).getClientRects();
+ else
+ continue;
+ for (let i2 = 0; i2 < boxes.length; i2++) {
+ let box = boxes[i2];
+ if (box.bottom > box.top + 1 && (dir == "up" ? coords.top - box.top > (box.bottom - coords.top) * 2 : box.bottom - coords.bottom > (coords.bottom - box.top) * 2))
+ return false;
+ }
+ }
+ return true;
+ });
+ }
+ var maybeRTL = /[\u0590-\u08ac]/;
+ function endOfTextblockHorizontal(view, state, dir) {
+ let { $head } = state.selection;
+ if (!$head.parent.isTextblock)
+ return false;
+ let offset = $head.parentOffset, atStart = !offset, atEnd = offset == $head.parent.content.size;
+ let sel = view.domSelection();
+ if (!maybeRTL.test($head.parent.textContent) || !sel.modify)
+ return dir == "left" || dir == "backward" ? atStart : atEnd;
+ return withFlushedState(view, state, () => {
+ let { focusNode: oldNode, focusOffset: oldOff, anchorNode, anchorOffset } = view.domSelectionRange();
+ let oldBidiLevel = sel.caretBidiLevel;
+ sel.modify("move", dir, "character");
+ let parentDOM = $head.depth ? view.docView.domAfterPos($head.before()) : view.dom;
+ let { focusNode: newNode, focusOffset: newOff } = view.domSelectionRange();
+ let result = newNode && !parentDOM.contains(newNode.nodeType == 1 ? newNode : newNode.parentNode) || oldNode == newNode && oldOff == newOff;
+ try {
+ sel.collapse(anchorNode, anchorOffset);
+ if (oldNode && (oldNode != anchorNode || oldOff != anchorOffset) && sel.extend)
+ sel.extend(oldNode, oldOff);
+ } catch (_3) {
+ }
+ if (oldBidiLevel != null)
+ sel.caretBidiLevel = oldBidiLevel;
+ return result;
+ });
+ }
+ var cachedState = null;
+ var cachedDir = null;
+ var cachedResult = false;
+ function endOfTextblock(view, state, dir) {
+ if (cachedState == state && cachedDir == dir)
+ return cachedResult;
+ cachedState = state;
+ cachedDir = dir;
+ return cachedResult = dir == "up" || dir == "down" ? endOfTextblockVertical(view, state, dir) : endOfTextblockHorizontal(view, state, dir);
+ }
+ var NOT_DIRTY = 0;
+ var CHILD_DIRTY = 1;
+ var CONTENT_DIRTY = 2;
+ var NODE_DIRTY = 3;
+ var ViewDesc = class {
+ constructor(parent, children, dom, contentDOM) {
+ this.parent = parent;
+ this.children = children;
+ this.dom = dom;
+ this.contentDOM = contentDOM;
+ this.dirty = NOT_DIRTY;
+ dom.pmViewDesc = this;
+ }
+ // Used to check whether a given description corresponds to a
+ // widget/mark/node.
+ matchesWidget(widget) {
+ return false;
+ }
+ matchesMark(mark) {
+ return false;
+ }
+ matchesNode(node2, outerDeco, innerDeco) {
+ return false;
+ }
+ matchesHack(nodeName) {
+ return false;
+ }
+ // When parsing in-editor content (in domchange.js), we allow
+ // descriptions to determine the parse rules that should be used to
+ // parse them.
+ parseRule() {
+ return null;
+ }
+ // Used by the editor's event handler to ignore events that come
+ // from certain descs.
+ stopEvent(event) {
+ return false;
+ }
+ // The size of the content represented by this desc.
+ get size() {
+ let size = 0;
+ for (let i2 = 0; i2 < this.children.length; i2++)
+ size += this.children[i2].size;
+ return size;
+ }
+ // For block nodes, this represents the space taken up by their
+ // start/end tokens.
+ get border() {
+ return 0;
+ }
+ destroy() {
+ this.parent = void 0;
+ if (this.dom.pmViewDesc == this)
+ this.dom.pmViewDesc = void 0;
+ for (let i2 = 0; i2 < this.children.length; i2++)
+ this.children[i2].destroy();
+ }
+ posBeforeChild(child) {
+ for (let i2 = 0, pos = this.posAtStart; ; i2++) {
+ let cur = this.children[i2];
+ if (cur == child)
+ return pos;
+ pos += cur.size;
+ }
+ }
+ get posBefore() {
+ return this.parent.posBeforeChild(this);
+ }
+ get posAtStart() {
+ return this.parent ? this.parent.posBeforeChild(this) + this.border : 0;
+ }
+ get posAfter() {
+ return this.posBefore + this.size;
+ }
+ get posAtEnd() {
+ return this.posAtStart + this.size - 2 * this.border;
+ }
+ localPosFromDOM(dom, offset, bias) {
+ if (this.contentDOM && this.contentDOM.contains(dom.nodeType == 1 ? dom : dom.parentNode)) {
+ if (bias < 0) {
+ let domBefore, desc;
+ if (dom == this.contentDOM) {
+ domBefore = dom.childNodes[offset - 1];
+ } else {
+ while (dom.parentNode != this.contentDOM)
+ dom = dom.parentNode;
+ domBefore = dom.previousSibling;
+ }
+ while (domBefore && !((desc = domBefore.pmViewDesc) && desc.parent == this))
+ domBefore = domBefore.previousSibling;
+ return domBefore ? this.posBeforeChild(desc) + desc.size : this.posAtStart;
+ } else {
+ let domAfter, desc;
+ if (dom == this.contentDOM) {
+ domAfter = dom.childNodes[offset];
+ } else {
+ while (dom.parentNode != this.contentDOM)
+ dom = dom.parentNode;
+ domAfter = dom.nextSibling;
+ }
+ while (domAfter && !((desc = domAfter.pmViewDesc) && desc.parent == this))
+ domAfter = domAfter.nextSibling;
+ return domAfter ? this.posBeforeChild(desc) : this.posAtEnd;
+ }
+ }
+ let atEnd;
+ if (dom == this.dom && this.contentDOM) {
+ atEnd = offset > domIndex(this.contentDOM);
+ } else if (this.contentDOM && this.contentDOM != this.dom && this.dom.contains(this.contentDOM)) {
+ atEnd = dom.compareDocumentPosition(this.contentDOM) & 2;
+ } else if (this.dom.firstChild) {
+ if (offset == 0)
+ for (let search2 = dom; ; search2 = search2.parentNode) {
+ if (search2 == this.dom) {
+ atEnd = false;
+ break;
+ }
+ if (search2.previousSibling)
+ break;
+ }
+ if (atEnd == null && offset == dom.childNodes.length)
+ for (let search2 = dom; ; search2 = search2.parentNode) {
+ if (search2 == this.dom) {
+ atEnd = true;
+ break;
+ }
+ if (search2.nextSibling)
+ break;
+ }
+ }
+ return (atEnd == null ? bias > 0 : atEnd) ? this.posAtEnd : this.posAtStart;
+ }
+ nearestDesc(dom, onlyNodes = false) {
+ for (let first = true, cur = dom; cur; cur = cur.parentNode) {
+ let desc = this.getDesc(cur), nodeDOM;
+ if (desc && (!onlyNodes || desc.node)) {
+ if (first && (nodeDOM = desc.nodeDOM) && !(nodeDOM.nodeType == 1 ? nodeDOM.contains(dom.nodeType == 1 ? dom : dom.parentNode) : nodeDOM == dom))
+ first = false;
+ else
+ return desc;
+ }
+ }
+ }
+ getDesc(dom) {
+ let desc = dom.pmViewDesc;
+ for (let cur = desc; cur; cur = cur.parent)
+ if (cur == this)
+ return desc;
+ }
+ posFromDOM(dom, offset, bias) {
+ for (let scan = dom; scan; scan = scan.parentNode) {
+ let desc = this.getDesc(scan);
+ if (desc)
+ return desc.localPosFromDOM(dom, offset, bias);
+ }
+ return -1;
+ }
+ // Find the desc for the node after the given pos, if any. (When a
+ // parent node overrode rendering, there might not be one.)
+ descAt(pos) {
+ for (let i2 = 0, offset = 0; i2 < this.children.length; i2++) {
+ let child = this.children[i2], end = offset + child.size;
+ if (offset == pos && end != offset) {
+ while (!child.border && child.children.length)
+ child = child.children[0];
+ return child;
+ }
+ if (pos < end)
+ return child.descAt(pos - offset - child.border);
+ offset = end;
+ }
+ }
+ domFromPos(pos, side) {
+ if (!this.contentDOM)
+ return { node: this.dom, offset: 0, atom: pos + 1 };
+ let i2 = 0, offset = 0;
+ for (let curPos = 0; i2 < this.children.length; i2++) {
+ let child = this.children[i2], end = curPos + child.size;
+ if (end > pos || child instanceof TrailingHackViewDesc) {
+ offset = pos - curPos;
+ break;
+ }
+ curPos = end;
+ }
+ if (offset)
+ return this.children[i2].domFromPos(offset - this.children[i2].border, side);
+ for (let prev; i2 && !(prev = this.children[i2 - 1]).size && prev instanceof WidgetViewDesc && prev.side >= 0; i2--) {
+ }
+ if (side <= 0) {
+ let prev, enter = true;
+ for (; ; i2--, enter = false) {
+ prev = i2 ? this.children[i2 - 1] : null;
+ if (!prev || prev.dom.parentNode == this.contentDOM)
+ break;
+ }
+ if (prev && side && enter && !prev.border && !prev.domAtom)
+ return prev.domFromPos(prev.size, side);
+ return { node: this.contentDOM, offset: prev ? domIndex(prev.dom) + 1 : 0 };
+ } else {
+ let next, enter = true;
+ for (; ; i2++, enter = false) {
+ next = i2 < this.children.length ? this.children[i2] : null;
+ if (!next || next.dom.parentNode == this.contentDOM)
+ break;
+ }
+ if (next && enter && !next.border && !next.domAtom)
+ return next.domFromPos(0, side);
+ return { node: this.contentDOM, offset: next ? domIndex(next.dom) : this.contentDOM.childNodes.length };
+ }
+ }
+ // Used to find a DOM range in a single parent for a given changed
+ // range.
+ parseRange(from, to, base2 = 0) {
+ if (this.children.length == 0)
+ return { node: this.contentDOM, from, to, fromOffset: 0, toOffset: this.contentDOM.childNodes.length };
+ let fromOffset = -1, toOffset = -1;
+ for (let offset = base2, i2 = 0; ; i2++) {
+ let child = this.children[i2], end = offset + child.size;
+ if (fromOffset == -1 && from <= end) {
+ let childBase = offset + child.border;
+ if (from >= childBase && to <= end - child.border && child.node && child.contentDOM && this.contentDOM.contains(child.contentDOM))
+ return child.parseRange(from, to, childBase);
+ from = offset;
+ for (let j6 = i2; j6 > 0; j6--) {
+ let prev = this.children[j6 - 1];
+ if (prev.size && prev.dom.parentNode == this.contentDOM && !prev.emptyChildAt(1)) {
+ fromOffset = domIndex(prev.dom) + 1;
+ break;
+ }
+ from -= prev.size;
+ }
+ if (fromOffset == -1)
+ fromOffset = 0;
+ }
+ if (fromOffset > -1 && (end > to || i2 == this.children.length - 1)) {
+ to = end;
+ for (let j6 = i2 + 1; j6 < this.children.length; j6++) {
+ let next = this.children[j6];
+ if (next.size && next.dom.parentNode == this.contentDOM && !next.emptyChildAt(-1)) {
+ toOffset = domIndex(next.dom);
+ break;
+ }
+ to += next.size;
+ }
+ if (toOffset == -1)
+ toOffset = this.contentDOM.childNodes.length;
+ break;
+ }
+ offset = end;
+ }
+ return { node: this.contentDOM, from, to, fromOffset, toOffset };
+ }
+ emptyChildAt(side) {
+ if (this.border || !this.contentDOM || !this.children.length)
+ return false;
+ let child = this.children[side < 0 ? 0 : this.children.length - 1];
+ return child.size == 0 || child.emptyChildAt(side);
+ }
+ domAfterPos(pos) {
+ let { node: node2, offset } = this.domFromPos(pos, 0);
+ if (node2.nodeType != 1 || offset == node2.childNodes.length)
+ throw new RangeError("No node after pos " + pos);
+ return node2.childNodes[offset];
+ }
+ // View descs are responsible for setting any selection that falls
+ // entirely inside of them, so that custom implementations can do
+ // custom things with the selection. Note that this falls apart when
+ // a selection starts in such a node and ends in another, in which
+ // case we just use whatever domFromPos produces as a best effort.
+ setSelection(anchor, head, root2, force = false) {
+ let from = Math.min(anchor, head), to = Math.max(anchor, head);
+ for (let i2 = 0, offset = 0; i2 < this.children.length; i2++) {
+ let child = this.children[i2], end = offset + child.size;
+ if (from > offset && to < end)
+ return child.setSelection(anchor - offset - child.border, head - offset - child.border, root2, force);
+ offset = end;
+ }
+ let anchorDOM = this.domFromPos(anchor, anchor ? -1 : 1);
+ let headDOM = head == anchor ? anchorDOM : this.domFromPos(head, head ? -1 : 1);
+ let domSel = root2.getSelection();
+ let brKludge = false;
+ if ((gecko || safari) && anchor == head) {
+ let { node: node2, offset } = anchorDOM;
+ if (node2.nodeType == 3) {
+ brKludge = !!(offset && node2.nodeValue[offset - 1] == "\n");
+ if (brKludge && offset == node2.nodeValue.length) {
+ for (let scan = node2, after; scan; scan = scan.parentNode) {
+ if (after = scan.nextSibling) {
+ if (after.nodeName == "BR")
+ anchorDOM = headDOM = { node: after.parentNode, offset: domIndex(after) + 1 };
+ break;
+ }
+ let desc = scan.pmViewDesc;
+ if (desc && desc.node && desc.node.isBlock)
+ break;
+ }
+ }
+ } else {
+ let prev = node2.childNodes[offset - 1];
+ brKludge = prev && (prev.nodeName == "BR" || prev.contentEditable == "false");
+ }
+ }
+ if (gecko && domSel.focusNode && domSel.focusNode != headDOM.node && domSel.focusNode.nodeType == 1) {
+ let after = domSel.focusNode.childNodes[domSel.focusOffset];
+ if (after && after.contentEditable == "false")
+ force = true;
+ }
+ if (!(force || brKludge && safari) && isEquivalentPosition(anchorDOM.node, anchorDOM.offset, domSel.anchorNode, domSel.anchorOffset) && isEquivalentPosition(headDOM.node, headDOM.offset, domSel.focusNode, domSel.focusOffset))
+ return;
+ let domSelExtended = false;
+ if ((domSel.extend || anchor == head) && !brKludge) {
+ domSel.collapse(anchorDOM.node, anchorDOM.offset);
+ try {
+ if (anchor != head)
+ domSel.extend(headDOM.node, headDOM.offset);
+ domSelExtended = true;
+ } catch (_3) {
+ }
+ }
+ if (!domSelExtended) {
+ if (anchor > head) {
+ let tmp = anchorDOM;
+ anchorDOM = headDOM;
+ headDOM = tmp;
+ }
+ let range = document.createRange();
+ range.setEnd(headDOM.node, headDOM.offset);
+ range.setStart(anchorDOM.node, anchorDOM.offset);
+ domSel.removeAllRanges();
+ domSel.addRange(range);
+ }
+ }
+ ignoreMutation(mutation) {
+ return !this.contentDOM && mutation.type != "selection";
+ }
+ get contentLost() {
+ return this.contentDOM && this.contentDOM != this.dom && !this.dom.contains(this.contentDOM);
+ }
+ // Remove a subtree of the element tree that has been touched
+ // by a DOM change, so that the next update will redraw it.
+ markDirty(from, to) {
+ for (let offset = 0, i2 = 0; i2 < this.children.length; i2++) {
+ let child = this.children[i2], end = offset + child.size;
+ if (offset == end ? from <= end && to >= offset : from < end && to > offset) {
+ let startInside = offset + child.border, endInside = end - child.border;
+ if (from >= startInside && to <= endInside) {
+ this.dirty = from == offset || to == end ? CONTENT_DIRTY : CHILD_DIRTY;
+ if (from == startInside && to == endInside && (child.contentLost || child.dom.parentNode != this.contentDOM))
+ child.dirty = NODE_DIRTY;
+ else
+ child.markDirty(from - startInside, to - startInside);
+ return;
+ } else {
+ child.dirty = child.dom == child.contentDOM && child.dom.parentNode == this.contentDOM && !child.children.length ? CONTENT_DIRTY : NODE_DIRTY;
+ }
+ }
+ offset = end;
+ }
+ this.dirty = CONTENT_DIRTY;
+ }
+ markParentsDirty() {
+ let level = 1;
+ for (let node2 = this.parent; node2; node2 = node2.parent, level++) {
+ let dirty = level == 1 ? CONTENT_DIRTY : CHILD_DIRTY;
+ if (node2.dirty < dirty)
+ node2.dirty = dirty;
+ }
+ }
+ get domAtom() {
+ return false;
+ }
+ get ignoreForCoords() {
+ return false;
+ }
+ isText(text5) {
+ return false;
+ }
+ };
+ var WidgetViewDesc = class extends ViewDesc {
+ constructor(parent, widget, view, pos) {
+ let self2, dom = widget.type.toDOM;
+ if (typeof dom == "function")
+ dom = dom(view, () => {
+ if (!self2)
+ return pos;
+ if (self2.parent)
+ return self2.parent.posBeforeChild(self2);
+ });
+ if (!widget.type.spec.raw) {
+ if (dom.nodeType != 1) {
+ let wrap3 = document.createElement("span");
+ wrap3.appendChild(dom);
+ dom = wrap3;
+ }
+ dom.contentEditable = "false";
+ dom.classList.add("ProseMirror-widget");
+ }
+ super(parent, [], dom, null);
+ this.widget = widget;
+ this.widget = widget;
+ self2 = this;
+ }
+ matchesWidget(widget) {
+ return this.dirty == NOT_DIRTY && widget.type.eq(this.widget.type);
+ }
+ parseRule() {
+ return { ignore: true };
+ }
+ stopEvent(event) {
+ let stop = this.widget.spec.stopEvent;
+ return stop ? stop(event) : false;
+ }
+ ignoreMutation(mutation) {
+ return mutation.type != "selection" || this.widget.spec.ignoreSelection;
+ }
+ destroy() {
+ this.widget.type.destroy(this.dom);
+ super.destroy();
+ }
+ get domAtom() {
+ return true;
+ }
+ get side() {
+ return this.widget.type.side;
+ }
+ };
+ var CompositionViewDesc = class extends ViewDesc {
+ constructor(parent, dom, textDOM, text5) {
+ super(parent, [], dom, null);
+ this.textDOM = textDOM;
+ this.text = text5;
+ }
+ get size() {
+ return this.text.length;
+ }
+ localPosFromDOM(dom, offset) {
+ if (dom != this.textDOM)
+ return this.posAtStart + (offset ? this.size : 0);
+ return this.posAtStart + offset;
+ }
+ domFromPos(pos) {
+ return { node: this.textDOM, offset: pos };
+ }
+ ignoreMutation(mut) {
+ return mut.type === "characterData" && mut.target.nodeValue == mut.oldValue;
+ }
+ };
+ var MarkViewDesc = class _MarkViewDesc extends ViewDesc {
+ constructor(parent, mark, dom, contentDOM) {
+ super(parent, [], dom, contentDOM);
+ this.mark = mark;
+ }
+ static create(parent, mark, inline, view) {
+ let custom = view.nodeViews[mark.type.name];
+ let spec = custom && custom(mark, view, inline);
+ if (!spec || !spec.dom)
+ spec = DOMSerializer.renderSpec(document, mark.type.spec.toDOM(mark, inline));
+ return new _MarkViewDesc(parent, mark, spec.dom, spec.contentDOM || spec.dom);
+ }
+ parseRule() {
+ if (this.dirty & NODE_DIRTY || this.mark.type.spec.reparseInView)
+ return null;
+ return { mark: this.mark.type.name, attrs: this.mark.attrs, contentElement: this.contentDOM };
+ }
+ matchesMark(mark) {
+ return this.dirty != NODE_DIRTY && this.mark.eq(mark);
+ }
+ markDirty(from, to) {
+ super.markDirty(from, to);
+ if (this.dirty != NOT_DIRTY) {
+ let parent = this.parent;
+ while (!parent.node)
+ parent = parent.parent;
+ if (parent.dirty < this.dirty)
+ parent.dirty = this.dirty;
+ this.dirty = NOT_DIRTY;
+ }
+ }
+ slice(from, to, view) {
+ let copy2 = _MarkViewDesc.create(this.parent, this.mark, true, view);
+ let nodes = this.children, size = this.size;
+ if (to < size)
+ nodes = replaceNodes(nodes, to, size, view);
+ if (from > 0)
+ nodes = replaceNodes(nodes, 0, from, view);
+ for (let i2 = 0; i2 < nodes.length; i2++)
+ nodes[i2].parent = copy2;
+ copy2.children = nodes;
+ return copy2;
+ }
+ };
+ var NodeViewDesc = class _NodeViewDesc extends ViewDesc {
+ constructor(parent, node2, outerDeco, innerDeco, dom, contentDOM, nodeDOM, view, pos) {
+ super(parent, [], dom, contentDOM);
+ this.node = node2;
+ this.outerDeco = outerDeco;
+ this.innerDeco = innerDeco;
+ this.nodeDOM = nodeDOM;
+ }
+ // By default, a node is rendered using the `toDOM` method from the
+ // node type spec. But client code can use the `nodeViews` spec to
+ // supply a custom node view, which can influence various aspects of
+ // the way the node works.
+ //
+ // (Using subclassing for this was intentionally decided against,
+ // since it'd require exposing a whole slew of finicky
+ // implementation details to the user code that they probably will
+ // never need.)
+ static create(parent, node2, outerDeco, innerDeco, view, pos) {
+ let custom = view.nodeViews[node2.type.name], descObj;
+ let spec = custom && custom(node2, view, () => {
+ if (!descObj)
+ return pos;
+ if (descObj.parent)
+ return descObj.parent.posBeforeChild(descObj);
+ }, outerDeco, innerDeco);
+ let dom = spec && spec.dom, contentDOM = spec && spec.contentDOM;
+ if (node2.isText) {
+ if (!dom)
+ dom = document.createTextNode(node2.text);
+ else if (dom.nodeType != 3)
+ throw new RangeError("Text must be rendered as a DOM text node");
+ } else if (!dom) {
+ ({ dom, contentDOM } = DOMSerializer.renderSpec(document, node2.type.spec.toDOM(node2)));
+ }
+ if (!contentDOM && !node2.isText && dom.nodeName != "BR") {
+ if (!dom.hasAttribute("contenteditable"))
+ dom.contentEditable = "false";
+ if (node2.type.spec.draggable)
+ dom.draggable = true;
+ }
+ let nodeDOM = dom;
+ dom = applyOuterDeco(dom, outerDeco, node2);
+ if (spec)
+ return descObj = new CustomNodeViewDesc(parent, node2, outerDeco, innerDeco, dom, contentDOM || null, nodeDOM, spec, view, pos + 1);
+ else if (node2.isText)
+ return new TextViewDesc(parent, node2, outerDeco, innerDeco, dom, nodeDOM, view);
+ else
+ return new _NodeViewDesc(parent, node2, outerDeco, innerDeco, dom, contentDOM || null, nodeDOM, view, pos + 1);
+ }
+ parseRule() {
+ if (this.node.type.spec.reparseInView)
+ return null;
+ let rule = { node: this.node.type.name, attrs: this.node.attrs };
+ if (this.node.type.whitespace == "pre")
+ rule.preserveWhitespace = "full";
+ if (!this.contentDOM) {
+ rule.getContent = () => this.node.content;
+ } else if (!this.contentLost) {
+ rule.contentElement = this.contentDOM;
+ } else {
+ for (let i2 = this.children.length - 1; i2 >= 0; i2--) {
+ let child = this.children[i2];
+ if (this.dom.contains(child.dom.parentNode)) {
+ rule.contentElement = child.dom.parentNode;
+ break;
+ }
+ }
+ if (!rule.contentElement)
+ rule.getContent = () => Fragment.empty;
+ }
+ return rule;
+ }
+ matchesNode(node2, outerDeco, innerDeco) {
+ return this.dirty == NOT_DIRTY && node2.eq(this.node) && sameOuterDeco(outerDeco, this.outerDeco) && innerDeco.eq(this.innerDeco);
+ }
+ get size() {
+ return this.node.nodeSize;
+ }
+ get border() {
+ return this.node.isLeaf ? 0 : 1;
+ }
+ // Syncs `this.children` to match `this.node.content` and the local
+ // decorations, possibly introducing nesting for marks. Then, in a
+ // separate step, syncs the DOM inside `this.contentDOM` to
+ // `this.children`.
+ updateChildren(view, pos) {
+ let inline = this.node.inlineContent, off = pos;
+ let composition = view.composing ? this.localCompositionInfo(view, pos) : null;
+ let localComposition = composition && composition.pos > -1 ? composition : null;
+ let compositionInChild = composition && composition.pos < 0;
+ let updater = new ViewTreeUpdater(this, localComposition && localComposition.node, view);
+ iterDeco(this.node, this.innerDeco, (widget, i2, insideNode) => {
+ if (widget.spec.marks)
+ updater.syncToMarks(widget.spec.marks, inline, view);
+ else if (widget.type.side >= 0 && !insideNode)
+ updater.syncToMarks(i2 == this.node.childCount ? Mark.none : this.node.child(i2).marks, inline, view);
+ updater.placeWidget(widget, view, off);
+ }, (child, outerDeco, innerDeco, i2) => {
+ updater.syncToMarks(child.marks, inline, view);
+ let compIndex;
+ if (updater.findNodeMatch(child, outerDeco, innerDeco, i2)) ;
+ else if (compositionInChild && view.state.selection.from > off && view.state.selection.to < off + child.nodeSize && (compIndex = updater.findIndexWithChild(composition.node)) > -1 && updater.updateNodeAt(child, outerDeco, innerDeco, compIndex, view)) ;
+ else if (updater.updateNextNode(child, outerDeco, innerDeco, view, i2, off)) ;
+ else {
+ updater.addNode(child, outerDeco, innerDeco, view, off);
+ }
+ off += child.nodeSize;
+ });
+ updater.syncToMarks([], inline, view);
+ if (this.node.isTextblock)
+ updater.addTextblockHacks();
+ updater.destroyRest();
+ if (updater.changed || this.dirty == CONTENT_DIRTY) {
+ if (localComposition)
+ this.protectLocalComposition(view, localComposition);
+ renderDescs(this.contentDOM, this.children, view);
+ if (ios)
+ iosHacks(this.dom);
+ }
+ }
+ localCompositionInfo(view, pos) {
+ let { from, to } = view.state.selection;
+ if (!(view.state.selection instanceof TextSelection) || from < pos || to > pos + this.node.content.size)
+ return null;
+ let textNode = view.input.compositionNode;
+ if (!textNode || !this.dom.contains(textNode.parentNode))
+ return null;
+ if (this.node.inlineContent) {
+ let text5 = textNode.nodeValue;
+ let textPos = findTextInFragment(this.node.content, text5, from - pos, to - pos);
+ return textPos < 0 ? null : { node: textNode, pos: textPos, text: text5 };
+ } else {
+ return { node: textNode, pos: -1, text: "" };
+ }
+ }
+ protectLocalComposition(view, { node: node2, pos, text: text5 }) {
+ if (this.getDesc(node2))
+ return;
+ let topNode = node2;
+ for (; ; topNode = topNode.parentNode) {
+ if (topNode.parentNode == this.contentDOM)
+ break;
+ while (topNode.previousSibling)
+ topNode.parentNode.removeChild(topNode.previousSibling);
+ while (topNode.nextSibling)
+ topNode.parentNode.removeChild(topNode.nextSibling);
+ if (topNode.pmViewDesc)
+ topNode.pmViewDesc = void 0;
+ }
+ let desc = new CompositionViewDesc(this, topNode, node2, text5);
+ view.input.compositionNodes.push(desc);
+ this.children = replaceNodes(this.children, pos, pos + text5.length, view, desc);
+ }
+ // If this desc must be updated to match the given node decoration,
+ // do so and return true.
+ update(node2, outerDeco, innerDeco, view) {
+ if (this.dirty == NODE_DIRTY || !node2.sameMarkup(this.node))
+ return false;
+ this.updateInner(node2, outerDeco, innerDeco, view);
+ return true;
+ }
+ updateInner(node2, outerDeco, innerDeco, view) {
+ this.updateOuterDeco(outerDeco);
+ this.node = node2;
+ this.innerDeco = innerDeco;
+ if (this.contentDOM)
+ this.updateChildren(view, this.posAtStart);
+ this.dirty = NOT_DIRTY;
+ }
+ updateOuterDeco(outerDeco) {
+ if (sameOuterDeco(outerDeco, this.outerDeco))
+ return;
+ let needsWrap = this.nodeDOM.nodeType != 1;
+ let oldDOM = this.dom;
+ this.dom = patchOuterDeco(this.dom, this.nodeDOM, computeOuterDeco(this.outerDeco, this.node, needsWrap), computeOuterDeco(outerDeco, this.node, needsWrap));
+ if (this.dom != oldDOM) {
+ oldDOM.pmViewDesc = void 0;
+ this.dom.pmViewDesc = this;
+ }
+ this.outerDeco = outerDeco;
+ }
+ // Mark this node as being the selected node.
+ selectNode() {
+ if (this.nodeDOM.nodeType == 1)
+ this.nodeDOM.classList.add("ProseMirror-selectednode");
+ if (this.contentDOM || !this.node.type.spec.draggable)
+ this.dom.draggable = true;
+ }
+ // Remove selected node marking from this node.
+ deselectNode() {
+ if (this.nodeDOM.nodeType == 1)
+ this.nodeDOM.classList.remove("ProseMirror-selectednode");
+ if (this.contentDOM || !this.node.type.spec.draggable)
+ this.dom.removeAttribute("draggable");
+ }
+ get domAtom() {
+ return this.node.isAtom;
+ }
+ };
+ function docViewDesc(doc4, outerDeco, innerDeco, dom, view) {
+ applyOuterDeco(dom, outerDeco, doc4);
+ let docView = new NodeViewDesc(void 0, doc4, outerDeco, innerDeco, dom, dom, dom, view, 0);
+ if (docView.contentDOM)
+ docView.updateChildren(view, 0);
+ return docView;
+ }
+ var TextViewDesc = class _TextViewDesc extends NodeViewDesc {
+ constructor(parent, node2, outerDeco, innerDeco, dom, nodeDOM, view) {
+ super(parent, node2, outerDeco, innerDeco, dom, null, nodeDOM, view, 0);
+ }
+ parseRule() {
+ let skip = this.nodeDOM.parentNode;
+ while (skip && skip != this.dom && !skip.pmIsDeco)
+ skip = skip.parentNode;
+ return { skip: skip || true };
+ }
+ update(node2, outerDeco, innerDeco, view) {
+ if (this.dirty == NODE_DIRTY || this.dirty != NOT_DIRTY && !this.inParent() || !node2.sameMarkup(this.node))
+ return false;
+ this.updateOuterDeco(outerDeco);
+ if ((this.dirty != NOT_DIRTY || node2.text != this.node.text) && node2.text != this.nodeDOM.nodeValue) {
+ this.nodeDOM.nodeValue = node2.text;
+ if (view.trackWrites == this.nodeDOM)
+ view.trackWrites = null;
+ }
+ this.node = node2;
+ this.dirty = NOT_DIRTY;
+ return true;
+ }
+ inParent() {
+ let parentDOM = this.parent.contentDOM;
+ for (let n4 = this.nodeDOM; n4; n4 = n4.parentNode)
+ if (n4 == parentDOM)
+ return true;
+ return false;
+ }
+ domFromPos(pos) {
+ return { node: this.nodeDOM, offset: pos };
+ }
+ localPosFromDOM(dom, offset, bias) {
+ if (dom == this.nodeDOM)
+ return this.posAtStart + Math.min(offset, this.node.text.length);
+ return super.localPosFromDOM(dom, offset, bias);
+ }
+ ignoreMutation(mutation) {
+ return mutation.type != "characterData" && mutation.type != "selection";
+ }
+ slice(from, to, view) {
+ let node2 = this.node.cut(from, to), dom = document.createTextNode(node2.text);
+ return new _TextViewDesc(this.parent, node2, this.outerDeco, this.innerDeco, dom, dom, view);
+ }
+ markDirty(from, to) {
+ super.markDirty(from, to);
+ if (this.dom != this.nodeDOM && (from == 0 || to == this.nodeDOM.nodeValue.length))
+ this.dirty = NODE_DIRTY;
+ }
+ get domAtom() {
+ return false;
+ }
+ isText(text5) {
+ return this.node.text == text5;
+ }
+ };
+ var TrailingHackViewDesc = class extends ViewDesc {
+ parseRule() {
+ return { ignore: true };
+ }
+ matchesHack(nodeName) {
+ return this.dirty == NOT_DIRTY && this.dom.nodeName == nodeName;
+ }
+ get domAtom() {
+ return true;
+ }
+ get ignoreForCoords() {
+ return this.dom.nodeName == "IMG";
+ }
+ };
+ var CustomNodeViewDesc = class extends NodeViewDesc {
+ constructor(parent, node2, outerDeco, innerDeco, dom, contentDOM, nodeDOM, spec, view, pos) {
+ super(parent, node2, outerDeco, innerDeco, dom, contentDOM, nodeDOM, view, pos);
+ this.spec = spec;
+ }
+ // A custom `update` method gets to decide whether the update goes
+ // through. If it does, and there's a `contentDOM` node, our logic
+ // updates the children.
+ update(node2, outerDeco, innerDeco, view) {
+ if (this.dirty == NODE_DIRTY)
+ return false;
+ if (this.spec.update) {
+ let result = this.spec.update(node2, outerDeco, innerDeco);
+ if (result)
+ this.updateInner(node2, outerDeco, innerDeco, view);
+ return result;
+ } else if (!this.contentDOM && !node2.isLeaf) {
+ return false;
+ } else {
+ return super.update(node2, outerDeco, innerDeco, view);
+ }
+ }
+ selectNode() {
+ this.spec.selectNode ? this.spec.selectNode() : super.selectNode();
+ }
+ deselectNode() {
+ this.spec.deselectNode ? this.spec.deselectNode() : super.deselectNode();
+ }
+ setSelection(anchor, head, root2, force) {
+ this.spec.setSelection ? this.spec.setSelection(anchor, head, root2) : super.setSelection(anchor, head, root2, force);
+ }
+ destroy() {
+ if (this.spec.destroy)
+ this.spec.destroy();
+ super.destroy();
+ }
+ stopEvent(event) {
+ return this.spec.stopEvent ? this.spec.stopEvent(event) : false;
+ }
+ ignoreMutation(mutation) {
+ return this.spec.ignoreMutation ? this.spec.ignoreMutation(mutation) : super.ignoreMutation(mutation);
+ }
+ };
+ function renderDescs(parentDOM, descs, view) {
+ let dom = parentDOM.firstChild, written = false;
+ for (let i2 = 0; i2 < descs.length; i2++) {
+ let desc = descs[i2], childDOM = desc.dom;
+ if (childDOM.parentNode == parentDOM) {
+ while (childDOM != dom) {
+ dom = rm(dom);
+ written = true;
+ }
+ dom = dom.nextSibling;
+ } else {
+ written = true;
+ parentDOM.insertBefore(childDOM, dom);
+ }
+ if (desc instanceof MarkViewDesc) {
+ let pos = dom ? dom.previousSibling : parentDOM.lastChild;
+ renderDescs(desc.contentDOM, desc.children, view);
+ dom = pos ? pos.nextSibling : parentDOM.firstChild;
+ }
+ }
+ while (dom) {
+ dom = rm(dom);
+ written = true;
+ }
+ if (written && view.trackWrites == parentDOM)
+ view.trackWrites = null;
+ }
+ var OuterDecoLevel = function(nodeName) {
+ if (nodeName)
+ this.nodeName = nodeName;
+ };
+ OuterDecoLevel.prototype = /* @__PURE__ */ Object.create(null);
+ var noDeco = [new OuterDecoLevel()];
+ function computeOuterDeco(outerDeco, node2, needsWrap) {
+ if (outerDeco.length == 0)
+ return noDeco;
+ let top = needsWrap ? noDeco[0] : new OuterDecoLevel(), result = [top];
+ for (let i2 = 0; i2 < outerDeco.length; i2++) {
+ let attrs = outerDeco[i2].type.attrs;
+ if (!attrs)
+ continue;
+ if (attrs.nodeName)
+ result.push(top = new OuterDecoLevel(attrs.nodeName));
+ for (let name in attrs) {
+ let val = attrs[name];
+ if (val == null)
+ continue;
+ if (needsWrap && result.length == 1)
+ result.push(top = new OuterDecoLevel(node2.isInline ? "span" : "div"));
+ if (name == "class")
+ top.class = (top.class ? top.class + " " : "") + val;
+ else if (name == "style")
+ top.style = (top.style ? top.style + ";" : "") + val;
+ else if (name != "nodeName")
+ top[name] = val;
+ }
+ }
+ return result;
+ }
+ function patchOuterDeco(outerDOM, nodeDOM, prevComputed, curComputed) {
+ if (prevComputed == noDeco && curComputed == noDeco)
+ return nodeDOM;
+ let curDOM = nodeDOM;
+ for (let i2 = 0; i2 < curComputed.length; i2++) {
+ let deco = curComputed[i2], prev = prevComputed[i2];
+ if (i2) {
+ let parent;
+ if (prev && prev.nodeName == deco.nodeName && curDOM != outerDOM && (parent = curDOM.parentNode) && parent.nodeName.toLowerCase() == deco.nodeName) {
+ curDOM = parent;
+ } else {
+ parent = document.createElement(deco.nodeName);
+ parent.pmIsDeco = true;
+ parent.appendChild(curDOM);
+ prev = noDeco[0];
+ curDOM = parent;
+ }
+ }
+ patchAttributes(curDOM, prev || noDeco[0], deco);
+ }
+ return curDOM;
+ }
+ function patchAttributes(dom, prev, cur) {
+ for (let name in prev)
+ if (name != "class" && name != "style" && name != "nodeName" && !(name in cur))
+ dom.removeAttribute(name);
+ for (let name in cur)
+ if (name != "class" && name != "style" && name != "nodeName" && cur[name] != prev[name])
+ dom.setAttribute(name, cur[name]);
+ if (prev.class != cur.class) {
+ let prevList = prev.class ? prev.class.split(" ").filter(Boolean) : [];
+ let curList = cur.class ? cur.class.split(" ").filter(Boolean) : [];
+ for (let i2 = 0; i2 < prevList.length; i2++)
+ if (curList.indexOf(prevList[i2]) == -1)
+ dom.classList.remove(prevList[i2]);
+ for (let i2 = 0; i2 < curList.length; i2++)
+ if (prevList.indexOf(curList[i2]) == -1)
+ dom.classList.add(curList[i2]);
+ if (dom.classList.length == 0)
+ dom.removeAttribute("class");
+ }
+ if (prev.style != cur.style) {
+ if (prev.style) {
+ let prop = /\s*([\w\-\xa1-\uffff]+)\s*:(?:"(?:\\.|[^"])*"|'(?:\\.|[^'])*'|\(.*?\)|[^;])*/g, m3;
+ while (m3 = prop.exec(prev.style))
+ dom.style.removeProperty(m3[1]);
+ }
+ if (cur.style)
+ dom.style.cssText += cur.style;
+ }
+ }
+ function applyOuterDeco(dom, deco, node2) {
+ return patchOuterDeco(dom, dom, noDeco, computeOuterDeco(deco, node2, dom.nodeType != 1));
+ }
+ function sameOuterDeco(a2, b4) {
+ if (a2.length != b4.length)
+ return false;
+ for (let i2 = 0; i2 < a2.length; i2++)
+ if (!a2[i2].type.eq(b4[i2].type))
+ return false;
+ return true;
+ }
+ function rm(dom) {
+ let next = dom.nextSibling;
+ dom.parentNode.removeChild(dom);
+ return next;
+ }
+ var ViewTreeUpdater = class {
+ constructor(top, lock, view) {
+ this.lock = lock;
+ this.view = view;
+ this.index = 0;
+ this.stack = [];
+ this.changed = false;
+ this.top = top;
+ this.preMatch = preMatch(top.node.content, top);
+ }
+ // Destroy and remove the children between the given indices in
+ // `this.top`.
+ destroyBetween(start, end) {
+ if (start == end)
+ return;
+ for (let i2 = start; i2 < end; i2++)
+ this.top.children[i2].destroy();
+ this.top.children.splice(start, end - start);
+ this.changed = true;
+ }
+ // Destroy all remaining children in `this.top`.
+ destroyRest() {
+ this.destroyBetween(this.index, this.top.children.length);
+ }
+ // Sync the current stack of mark descs with the given array of
+ // marks, reusing existing mark descs when possible.
+ syncToMarks(marks, inline, view) {
+ let keep = 0, depth = this.stack.length >> 1;
+ let maxKeep = Math.min(depth, marks.length);
+ while (keep < maxKeep && (keep == depth - 1 ? this.top : this.stack[keep + 1 << 1]).matchesMark(marks[keep]) && marks[keep].type.spec.spanning !== false)
+ keep++;
+ while (keep < depth) {
+ this.destroyRest();
+ this.top.dirty = NOT_DIRTY;
+ this.index = this.stack.pop();
+ this.top = this.stack.pop();
+ depth--;
+ }
+ while (depth < marks.length) {
+ this.stack.push(this.top, this.index + 1);
+ let found2 = -1;
+ for (let i2 = this.index; i2 < Math.min(this.index + 3, this.top.children.length); i2++) {
+ let next = this.top.children[i2];
+ if (next.matchesMark(marks[depth]) && !this.isLocked(next.dom)) {
+ found2 = i2;
+ break;
+ }
+ }
+ if (found2 > -1) {
+ if (found2 > this.index) {
+ this.changed = true;
+ this.destroyBetween(this.index, found2);
+ }
+ this.top = this.top.children[this.index];
+ } else {
+ let markDesc = MarkViewDesc.create(this.top, marks[depth], inline, view);
+ this.top.children.splice(this.index, 0, markDesc);
+ this.top = markDesc;
+ this.changed = true;
+ }
+ this.index = 0;
+ depth++;
+ }
+ }
+ // Try to find a node desc matching the given data. Skip over it and
+ // return true when successful.
+ findNodeMatch(node2, outerDeco, innerDeco, index2) {
+ let found2 = -1, targetDesc;
+ if (index2 >= this.preMatch.index && (targetDesc = this.preMatch.matches[index2 - this.preMatch.index]).parent == this.top && targetDesc.matchesNode(node2, outerDeco, innerDeco)) {
+ found2 = this.top.children.indexOf(targetDesc, this.index);
+ } else {
+ for (let i2 = this.index, e2 = Math.min(this.top.children.length, i2 + 5); i2 < e2; i2++) {
+ let child = this.top.children[i2];
+ if (child.matchesNode(node2, outerDeco, innerDeco) && !this.preMatch.matched.has(child)) {
+ found2 = i2;
+ break;
+ }
+ }
+ }
+ if (found2 < 0)
+ return false;
+ this.destroyBetween(this.index, found2);
+ this.index++;
+ return true;
+ }
+ updateNodeAt(node2, outerDeco, innerDeco, index2, view) {
+ let child = this.top.children[index2];
+ if (child.dirty == NODE_DIRTY && child.dom == child.contentDOM)
+ child.dirty = CONTENT_DIRTY;
+ if (!child.update(node2, outerDeco, innerDeco, view))
+ return false;
+ this.destroyBetween(this.index, index2);
+ this.index++;
+ return true;
+ }
+ findIndexWithChild(domNode) {
+ for (; ; ) {
+ let parent = domNode.parentNode;
+ if (!parent)
+ return -1;
+ if (parent == this.top.contentDOM) {
+ let desc = domNode.pmViewDesc;
+ if (desc)
+ for (let i2 = this.index; i2 < this.top.children.length; i2++) {
+ if (this.top.children[i2] == desc)
+ return i2;
+ }
+ return -1;
+ }
+ domNode = parent;
+ }
+ }
+ // Try to update the next node, if any, to the given data. Checks
+ // pre-matches to avoid overwriting nodes that could still be used.
+ updateNextNode(node2, outerDeco, innerDeco, view, index2, pos) {
+ for (let i2 = this.index; i2 < this.top.children.length; i2++) {
+ let next = this.top.children[i2];
+ if (next instanceof NodeViewDesc) {
+ let preMatch2 = this.preMatch.matched.get(next);
+ if (preMatch2 != null && preMatch2 != index2)
+ return false;
+ let nextDOM = next.dom, updated;
+ let locked = this.isLocked(nextDOM) && !(node2.isText && next.node && next.node.isText && next.nodeDOM.nodeValue == node2.text && next.dirty != NODE_DIRTY && sameOuterDeco(outerDeco, next.outerDeco));
+ if (!locked && next.update(node2, outerDeco, innerDeco, view)) {
+ this.destroyBetween(this.index, i2);
+ if (next.dom != nextDOM)
+ this.changed = true;
+ this.index++;
+ return true;
+ } else if (!locked && (updated = this.recreateWrapper(next, node2, outerDeco, innerDeco, view, pos))) {
+ this.top.children[this.index] = updated;
+ if (updated.contentDOM) {
+ updated.dirty = CONTENT_DIRTY;
+ updated.updateChildren(view, pos + 1);
+ updated.dirty = NOT_DIRTY;
+ }
+ this.changed = true;
+ this.index++;
+ return true;
+ }
+ break;
+ }
+ }
+ return false;
+ }
+ // When a node with content is replaced by a different node with
+ // identical content, move over its children.
+ recreateWrapper(next, node2, outerDeco, innerDeco, view, pos) {
+ if (next.dirty || node2.isAtom || !next.children.length || !next.node.content.eq(node2.content))
+ return null;
+ let wrapper = NodeViewDesc.create(this.top, node2, outerDeco, innerDeco, view, pos);
+ if (wrapper.contentDOM) {
+ wrapper.children = next.children;
+ next.children = [];
+ for (let ch of wrapper.children)
+ ch.parent = wrapper;
+ }
+ next.destroy();
+ return wrapper;
+ }
+ // Insert the node as a newly created node desc.
+ addNode(node2, outerDeco, innerDeco, view, pos) {
+ let desc = NodeViewDesc.create(this.top, node2, outerDeco, innerDeco, view, pos);
+ if (desc.contentDOM)
+ desc.updateChildren(view, pos + 1);
+ this.top.children.splice(this.index++, 0, desc);
+ this.changed = true;
+ }
+ placeWidget(widget, view, pos) {
+ let next = this.index < this.top.children.length ? this.top.children[this.index] : null;
+ if (next && next.matchesWidget(widget) && (widget == next.widget || !next.widget.type.toDOM.parentNode)) {
+ this.index++;
+ } else {
+ let desc = new WidgetViewDesc(this.top, widget, view, pos);
+ this.top.children.splice(this.index++, 0, desc);
+ this.changed = true;
+ }
+ }
+ // Make sure a textblock looks and behaves correctly in
+ // contentEditable.
+ addTextblockHacks() {
+ let lastChild = this.top.children[this.index - 1], parent = this.top;
+ while (lastChild instanceof MarkViewDesc) {
+ parent = lastChild;
+ lastChild = parent.children[parent.children.length - 1];
+ }
+ if (!lastChild || // Empty textblock
+ !(lastChild instanceof TextViewDesc) || /\n$/.test(lastChild.node.text) || this.view.requiresGeckoHackNode && /\s$/.test(lastChild.node.text)) {
+ if ((safari || chrome) && lastChild && lastChild.dom.contentEditable == "false")
+ this.addHackNode("IMG", parent);
+ this.addHackNode("BR", this.top);
+ }
+ }
+ addHackNode(nodeName, parent) {
+ if (parent == this.top && this.index < parent.children.length && parent.children[this.index].matchesHack(nodeName)) {
+ this.index++;
+ } else {
+ let dom = document.createElement(nodeName);
+ if (nodeName == "IMG") {
+ dom.className = "ProseMirror-separator";
+ dom.alt = "";
+ }
+ if (nodeName == "BR")
+ dom.className = "ProseMirror-trailingBreak";
+ let hack = new TrailingHackViewDesc(this.top, [], dom, null);
+ if (parent != this.top)
+ parent.children.push(hack);
+ else
+ parent.children.splice(this.index++, 0, hack);
+ this.changed = true;
+ }
+ }
+ isLocked(node2) {
+ return this.lock && (node2 == this.lock || node2.nodeType == 1 && node2.contains(this.lock.parentNode));
+ }
+ };
+ function preMatch(frag, parentDesc) {
+ let curDesc = parentDesc, descI = curDesc.children.length;
+ let fI = frag.childCount, matched = /* @__PURE__ */ new Map(), matches2 = [];
+ outer: while (fI > 0) {
+ let desc;
+ for (; ; ) {
+ if (descI) {
+ let next = curDesc.children[descI - 1];
+ if (next instanceof MarkViewDesc) {
+ curDesc = next;
+ descI = next.children.length;
+ } else {
+ desc = next;
+ descI--;
+ break;
+ }
+ } else if (curDesc == parentDesc) {
+ break outer;
+ } else {
+ descI = curDesc.parent.children.indexOf(curDesc);
+ curDesc = curDesc.parent;
+ }
+ }
+ let node2 = desc.node;
+ if (!node2)
+ continue;
+ if (node2 != frag.child(fI - 1))
+ break;
+ --fI;
+ matched.set(desc, fI);
+ matches2.push(desc);
+ }
+ return { index: fI, matched, matches: matches2.reverse() };
+ }
+ function compareSide(a2, b4) {
+ return a2.type.side - b4.type.side;
+ }
+ function iterDeco(parent, deco, onWidget, onNode) {
+ let locals = deco.locals(parent), offset = 0;
+ if (locals.length == 0) {
+ for (let i2 = 0; i2 < parent.childCount; i2++) {
+ let child = parent.child(i2);
+ onNode(child, locals, deco.forChild(offset, child), i2);
+ offset += child.nodeSize;
+ }
+ return;
+ }
+ let decoIndex = 0, active = [], restNode = null;
+ for (let parentIndex = 0; ; ) {
+ let widget, widgets;
+ while (decoIndex < locals.length && locals[decoIndex].to == offset) {
+ let next = locals[decoIndex++];
+ if (next.widget) {
+ if (!widget)
+ widget = next;
+ else
+ (widgets || (widgets = [widget])).push(next);
+ }
+ }
+ if (widget) {
+ if (widgets) {
+ widgets.sort(compareSide);
+ for (let i2 = 0; i2 < widgets.length; i2++)
+ onWidget(widgets[i2], parentIndex, !!restNode);
+ } else {
+ onWidget(widget, parentIndex, !!restNode);
+ }
+ }
+ let child, index2;
+ if (restNode) {
+ index2 = -1;
+ child = restNode;
+ restNode = null;
+ } else if (parentIndex < parent.childCount) {
+ index2 = parentIndex;
+ child = parent.child(parentIndex++);
+ } else {
+ break;
+ }
+ for (let i2 = 0; i2 < active.length; i2++)
+ if (active[i2].to <= offset)
+ active.splice(i2--, 1);
+ while (decoIndex < locals.length && locals[decoIndex].from <= offset && locals[decoIndex].to > offset)
+ active.push(locals[decoIndex++]);
+ let end = offset + child.nodeSize;
+ if (child.isText) {
+ let cutAt = end;
+ if (decoIndex < locals.length && locals[decoIndex].from < cutAt)
+ cutAt = locals[decoIndex].from;
+ for (let i2 = 0; i2 < active.length; i2++)
+ if (active[i2].to < cutAt)
+ cutAt = active[i2].to;
+ if (cutAt < end) {
+ restNode = child.cut(cutAt - offset);
+ child = child.cut(0, cutAt - offset);
+ end = cutAt;
+ index2 = -1;
+ }
+ } else {
+ while (decoIndex < locals.length && locals[decoIndex].to < end)
+ decoIndex++;
+ }
+ let outerDeco = child.isInline && !child.isLeaf ? active.filter((d6) => !d6.inline) : active.slice();
+ onNode(child, outerDeco, deco.forChild(offset, child), index2);
+ offset = end;
+ }
+ }
+ function iosHacks(dom) {
+ if (dom.nodeName == "UL" || dom.nodeName == "OL") {
+ let oldCSS = dom.style.cssText;
+ dom.style.cssText = oldCSS + "; list-style: square !important";
+ window.getComputedStyle(dom).listStyle;
+ dom.style.cssText = oldCSS;
+ }
+ }
+ function findTextInFragment(frag, text5, from, to) {
+ for (let i2 = 0, pos = 0; i2 < frag.childCount && pos <= to; ) {
+ let child = frag.child(i2++), childStart = pos;
+ pos += child.nodeSize;
+ if (!child.isText)
+ continue;
+ let str = child.text;
+ while (i2 < frag.childCount) {
+ let next = frag.child(i2++);
+ pos += next.nodeSize;
+ if (!next.isText)
+ break;
+ str += next.text;
+ }
+ if (pos >= from) {
+ if (pos >= to && str.slice(to - text5.length - childStart, to - childStart) == text5)
+ return to - text5.length;
+ let found2 = childStart < to ? str.lastIndexOf(text5, to - childStart - 1) : -1;
+ if (found2 >= 0 && found2 + text5.length + childStart >= from)
+ return childStart + found2;
+ if (from == to && str.length >= to + text5.length - childStart && str.slice(to - childStart, to - childStart + text5.length) == text5)
+ return to;
+ }
+ }
+ return -1;
+ }
+ function replaceNodes(nodes, from, to, view, replacement) {
+ let result = [];
+ for (let i2 = 0, off = 0; i2 < nodes.length; i2++) {
+ let child = nodes[i2], start = off, end = off += child.size;
+ if (start >= to || end <= from) {
+ result.push(child);
+ } else {
+ if (start < from)
+ result.push(child.slice(0, from - start, view));
+ if (replacement) {
+ result.push(replacement);
+ replacement = void 0;
+ }
+ if (end > to)
+ result.push(child.slice(to - start, child.size, view));
+ }
+ }
+ return result;
+ }
+ function selectionFromDOM(view, origin = null) {
+ let domSel = view.domSelectionRange(), doc4 = view.state.doc;
+ if (!domSel.focusNode)
+ return null;
+ let nearestDesc = view.docView.nearestDesc(domSel.focusNode), inWidget = nearestDesc && nearestDesc.size == 0;
+ let head = view.docView.posFromDOM(domSel.focusNode, domSel.focusOffset, 1);
+ if (head < 0)
+ return null;
+ let $head = doc4.resolve(head), $anchor, selection;
+ if (selectionCollapsed(domSel)) {
+ $anchor = $head;
+ while (nearestDesc && !nearestDesc.node)
+ nearestDesc = nearestDesc.parent;
+ let nearestDescNode = nearestDesc.node;
+ if (nearestDesc && nearestDescNode.isAtom && NodeSelection.isSelectable(nearestDescNode) && nearestDesc.parent && !(nearestDescNode.isInline && isOnEdge(domSel.focusNode, domSel.focusOffset, nearestDesc.dom))) {
+ let pos = nearestDesc.posBefore;
+ selection = new NodeSelection(head == pos ? $head : doc4.resolve(pos));
+ }
+ } else {
+ let anchor = view.docView.posFromDOM(domSel.anchorNode, domSel.anchorOffset, 1);
+ if (anchor < 0)
+ return null;
+ $anchor = doc4.resolve(anchor);
+ }
+ if (!selection) {
+ let bias = origin == "pointer" || view.state.selection.head < $head.pos && !inWidget ? 1 : -1;
+ selection = selectionBetween(view, $anchor, $head, bias);
+ }
+ return selection;
+ }
+ function editorOwnsSelection(view) {
+ return view.editable ? view.hasFocus() : hasSelection(view) && document.activeElement && document.activeElement.contains(view.dom);
+ }
+ function selectionToDOM(view, force = false) {
+ let sel = view.state.selection;
+ syncNodeSelection(view, sel);
+ if (!editorOwnsSelection(view))
+ return;
+ if (!force && view.input.mouseDown && view.input.mouseDown.allowDefault && chrome) {
+ let domSel = view.domSelectionRange(), curSel = view.domObserver.currentSelection;
+ if (domSel.anchorNode && curSel.anchorNode && isEquivalentPosition(domSel.anchorNode, domSel.anchorOffset, curSel.anchorNode, curSel.anchorOffset)) {
+ view.input.mouseDown.delayedSelectionSync = true;
+ view.domObserver.setCurSelection();
+ return;
+ }
+ }
+ view.domObserver.disconnectSelection();
+ if (view.cursorWrapper) {
+ selectCursorWrapper(view);
+ } else {
+ let { anchor, head } = sel, resetEditableFrom, resetEditableTo;
+ if (brokenSelectBetweenUneditable && !(sel instanceof TextSelection)) {
+ if (!sel.$from.parent.inlineContent)
+ resetEditableFrom = temporarilyEditableNear(view, sel.from);
+ if (!sel.empty && !sel.$from.parent.inlineContent)
+ resetEditableTo = temporarilyEditableNear(view, sel.to);
+ }
+ view.docView.setSelection(anchor, head, view.root, force);
+ if (brokenSelectBetweenUneditable) {
+ if (resetEditableFrom)
+ resetEditable(resetEditableFrom);
+ if (resetEditableTo)
+ resetEditable(resetEditableTo);
+ }
+ if (sel.visible) {
+ view.dom.classList.remove("ProseMirror-hideselection");
+ } else {
+ view.dom.classList.add("ProseMirror-hideselection");
+ if ("onselectionchange" in document)
+ removeClassOnSelectionChange(view);
+ }
+ }
+ view.domObserver.setCurSelection();
+ view.domObserver.connectSelection();
+ }
+ var brokenSelectBetweenUneditable = safari || chrome && chrome_version < 63;
+ function temporarilyEditableNear(view, pos) {
+ let { node: node2, offset } = view.docView.domFromPos(pos, 0);
+ let after = offset < node2.childNodes.length ? node2.childNodes[offset] : null;
+ let before = offset ? node2.childNodes[offset - 1] : null;
+ if (safari && after && after.contentEditable == "false")
+ return setEditable(after);
+ if ((!after || after.contentEditable == "false") && (!before || before.contentEditable == "false")) {
+ if (after)
+ return setEditable(after);
+ else if (before)
+ return setEditable(before);
+ }
+ }
+ function setEditable(element2) {
+ element2.contentEditable = "true";
+ if (safari && element2.draggable) {
+ element2.draggable = false;
+ element2.wasDraggable = true;
+ }
+ return element2;
+ }
+ function resetEditable(element2) {
+ element2.contentEditable = "false";
+ if (element2.wasDraggable) {
+ element2.draggable = true;
+ element2.wasDraggable = null;
+ }
+ }
+ function removeClassOnSelectionChange(view) {
+ let doc4 = view.dom.ownerDocument;
+ doc4.removeEventListener("selectionchange", view.input.hideSelectionGuard);
+ let domSel = view.domSelectionRange();
+ let node2 = domSel.anchorNode, offset = domSel.anchorOffset;
+ doc4.addEventListener("selectionchange", view.input.hideSelectionGuard = () => {
+ if (domSel.anchorNode != node2 || domSel.anchorOffset != offset) {
+ doc4.removeEventListener("selectionchange", view.input.hideSelectionGuard);
+ setTimeout(() => {
+ if (!editorOwnsSelection(view) || view.state.selection.visible)
+ view.dom.classList.remove("ProseMirror-hideselection");
+ }, 20);
+ }
+ });
+ }
+ function selectCursorWrapper(view) {
+ let domSel = view.domSelection(), range = document.createRange();
+ let node2 = view.cursorWrapper.dom, img = node2.nodeName == "IMG";
+ if (img)
+ range.setEnd(node2.parentNode, domIndex(node2) + 1);
+ else
+ range.setEnd(node2, 0);
+ range.collapse(false);
+ domSel.removeAllRanges();
+ domSel.addRange(range);
+ if (!img && !view.state.selection.visible && ie && ie_version <= 11) {
+ node2.disabled = true;
+ node2.disabled = false;
+ }
+ }
+ function syncNodeSelection(view, sel) {
+ if (sel instanceof NodeSelection) {
+ let desc = view.docView.descAt(sel.from);
+ if (desc != view.lastSelectedViewDesc) {
+ clearNodeSelection(view);
+ if (desc)
+ desc.selectNode();
+ view.lastSelectedViewDesc = desc;
+ }
+ } else {
+ clearNodeSelection(view);
+ }
+ }
+ function clearNodeSelection(view) {
+ if (view.lastSelectedViewDesc) {
+ if (view.lastSelectedViewDesc.parent)
+ view.lastSelectedViewDesc.deselectNode();
+ view.lastSelectedViewDesc = void 0;
+ }
+ }
+ function selectionBetween(view, $anchor, $head, bias) {
+ return view.someProp("createSelectionBetween", (f3) => f3(view, $anchor, $head)) || TextSelection.between($anchor, $head, bias);
+ }
+ function hasFocusAndSelection(view) {
+ if (view.editable && !view.hasFocus())
+ return false;
+ return hasSelection(view);
+ }
+ function hasSelection(view) {
+ let sel = view.domSelectionRange();
+ if (!sel.anchorNode)
+ return false;
+ try {
+ return view.dom.contains(sel.anchorNode.nodeType == 3 ? sel.anchorNode.parentNode : sel.anchorNode) && (view.editable || view.dom.contains(sel.focusNode.nodeType == 3 ? sel.focusNode.parentNode : sel.focusNode));
+ } catch (_3) {
+ return false;
+ }
+ }
+ function anchorInRightPlace(view) {
+ let anchorDOM = view.docView.domFromPos(view.state.selection.anchor, 0);
+ let domSel = view.domSelectionRange();
+ return isEquivalentPosition(anchorDOM.node, anchorDOM.offset, domSel.anchorNode, domSel.anchorOffset);
+ }
+ function moveSelectionBlock(state, dir) {
+ let { $anchor, $head } = state.selection;
+ let $side = dir > 0 ? $anchor.max($head) : $anchor.min($head);
+ let $start = !$side.parent.inlineContent ? $side : $side.depth ? state.doc.resolve(dir > 0 ? $side.after() : $side.before()) : null;
+ return $start && Selection.findFrom($start, dir);
+ }
+ function apply(view, sel) {
+ view.dispatch(view.state.tr.setSelection(sel).scrollIntoView());
+ return true;
+ }
+ function selectHorizontally(view, dir, mods) {
+ let sel = view.state.selection;
+ if (sel instanceof TextSelection) {
+ if (mods.indexOf("s") > -1) {
+ let { $head } = sel, node2 = $head.textOffset ? null : dir < 0 ? $head.nodeBefore : $head.nodeAfter;
+ if (!node2 || node2.isText || !node2.isLeaf)
+ return false;
+ let $newHead = view.state.doc.resolve($head.pos + node2.nodeSize * (dir < 0 ? -1 : 1));
+ return apply(view, new TextSelection(sel.$anchor, $newHead));
+ } else if (!sel.empty) {
+ return false;
+ } else if (view.endOfTextblock(dir > 0 ? "forward" : "backward")) {
+ let next = moveSelectionBlock(view.state, dir);
+ if (next && next instanceof NodeSelection)
+ return apply(view, next);
+ return false;
+ } else if (!(mac && mods.indexOf("m") > -1)) {
+ let $head = sel.$head, node2 = $head.textOffset ? null : dir < 0 ? $head.nodeBefore : $head.nodeAfter, desc;
+ if (!node2 || node2.isText)
+ return false;
+ let nodePos = dir < 0 ? $head.pos - node2.nodeSize : $head.pos;
+ if (!(node2.isAtom || (desc = view.docView.descAt(nodePos)) && !desc.contentDOM))
+ return false;
+ if (NodeSelection.isSelectable(node2)) {
+ return apply(view, new NodeSelection(dir < 0 ? view.state.doc.resolve($head.pos - node2.nodeSize) : $head));
+ } else if (webkit) {
+ return apply(view, new TextSelection(view.state.doc.resolve(dir < 0 ? nodePos : nodePos + node2.nodeSize)));
+ } else {
+ return false;
+ }
+ }
+ } else if (sel instanceof NodeSelection && sel.node.isInline) {
+ return apply(view, new TextSelection(dir > 0 ? sel.$to : sel.$from));
+ } else {
+ let next = moveSelectionBlock(view.state, dir);
+ if (next)
+ return apply(view, next);
+ return false;
+ }
+ }
+ function nodeLen(node2) {
+ return node2.nodeType == 3 ? node2.nodeValue.length : node2.childNodes.length;
+ }
+ function isIgnorable(dom, dir) {
+ let desc = dom.pmViewDesc;
+ return desc && desc.size == 0 && (dir < 0 || dom.nextSibling || dom.nodeName != "BR");
+ }
+ function skipIgnoredNodes(view, dir) {
+ return dir < 0 ? skipIgnoredNodesBefore(view) : skipIgnoredNodesAfter(view);
+ }
+ function skipIgnoredNodesBefore(view) {
+ let sel = view.domSelectionRange();
+ let node2 = sel.focusNode, offset = sel.focusOffset;
+ if (!node2)
+ return;
+ let moveNode, moveOffset, force = false;
+ if (gecko && node2.nodeType == 1 && offset < nodeLen(node2) && isIgnorable(node2.childNodes[offset], -1))
+ force = true;
+ for (; ; ) {
+ if (offset > 0) {
+ if (node2.nodeType != 1) {
+ break;
+ } else {
+ let before = node2.childNodes[offset - 1];
+ if (isIgnorable(before, -1)) {
+ moveNode = node2;
+ moveOffset = --offset;
+ } else if (before.nodeType == 3) {
+ node2 = before;
+ offset = node2.nodeValue.length;
+ } else
+ break;
+ }
+ } else if (isBlockNode(node2)) {
+ break;
+ } else {
+ let prev = node2.previousSibling;
+ while (prev && isIgnorable(prev, -1)) {
+ moveNode = node2.parentNode;
+ moveOffset = domIndex(prev);
+ prev = prev.previousSibling;
+ }
+ if (!prev) {
+ node2 = node2.parentNode;
+ if (node2 == view.dom)
+ break;
+ offset = 0;
+ } else {
+ node2 = prev;
+ offset = nodeLen(node2);
+ }
+ }
+ }
+ if (force)
+ setSelFocus(view, node2, offset);
+ else if (moveNode)
+ setSelFocus(view, moveNode, moveOffset);
+ }
+ function skipIgnoredNodesAfter(view) {
+ let sel = view.domSelectionRange();
+ let node2 = sel.focusNode, offset = sel.focusOffset;
+ if (!node2)
+ return;
+ let len = nodeLen(node2);
+ let moveNode, moveOffset;
+ for (; ; ) {
+ if (offset < len) {
+ if (node2.nodeType != 1)
+ break;
+ let after = node2.childNodes[offset];
+ if (isIgnorable(after, 1)) {
+ moveNode = node2;
+ moveOffset = ++offset;
+ } else
+ break;
+ } else if (isBlockNode(node2)) {
+ break;
+ } else {
+ let next = node2.nextSibling;
+ while (next && isIgnorable(next, 1)) {
+ moveNode = next.parentNode;
+ moveOffset = domIndex(next) + 1;
+ next = next.nextSibling;
+ }
+ if (!next) {
+ node2 = node2.parentNode;
+ if (node2 == view.dom)
+ break;
+ offset = len = 0;
+ } else {
+ node2 = next;
+ offset = 0;
+ len = nodeLen(node2);
+ }
+ }
+ }
+ if (moveNode)
+ setSelFocus(view, moveNode, moveOffset);
+ }
+ function isBlockNode(dom) {
+ let desc = dom.pmViewDesc;
+ return desc && desc.node && desc.node.isBlock;
+ }
+ function textNodeAfter(node2, offset) {
+ while (node2 && offset == node2.childNodes.length && !hasBlockDesc(node2)) {
+ offset = domIndex(node2) + 1;
+ node2 = node2.parentNode;
+ }
+ while (node2 && offset < node2.childNodes.length) {
+ let next = node2.childNodes[offset];
+ if (next.nodeType == 3)
+ return next;
+ if (next.nodeType == 1 && next.contentEditable == "false")
+ break;
+ node2 = next;
+ offset = 0;
+ }
+ }
+ function textNodeBefore(node2, offset) {
+ while (node2 && !offset && !hasBlockDesc(node2)) {
+ offset = domIndex(node2);
+ node2 = node2.parentNode;
+ }
+ while (node2 && offset) {
+ let next = node2.childNodes[offset - 1];
+ if (next.nodeType == 3)
+ return next;
+ if (next.nodeType == 1 && next.contentEditable == "false")
+ break;
+ node2 = next;
+ offset = node2.childNodes.length;
+ }
+ }
+ function setSelFocus(view, node2, offset) {
+ if (node2.nodeType != 3) {
+ let before, after;
+ if (after = textNodeAfter(node2, offset)) {
+ node2 = after;
+ offset = 0;
+ } else if (before = textNodeBefore(node2, offset)) {
+ node2 = before;
+ offset = before.nodeValue.length;
+ }
+ }
+ let sel = view.domSelection();
+ if (selectionCollapsed(sel)) {
+ let range = document.createRange();
+ range.setEnd(node2, offset);
+ range.setStart(node2, offset);
+ sel.removeAllRanges();
+ sel.addRange(range);
+ } else if (sel.extend) {
+ sel.extend(node2, offset);
+ }
+ view.domObserver.setCurSelection();
+ let { state } = view;
+ setTimeout(() => {
+ if (view.state == state)
+ selectionToDOM(view);
+ }, 50);
+ }
+ function findDirection(view, pos) {
+ let $pos = view.state.doc.resolve(pos);
+ if (!(chrome || windows) && $pos.parent.inlineContent) {
+ let coords = view.coordsAtPos(pos);
+ if (pos > $pos.start()) {
+ let before = view.coordsAtPos(pos - 1);
+ let mid = (before.top + before.bottom) / 2;
+ if (mid > coords.top && mid < coords.bottom && Math.abs(before.left - coords.left) > 1)
+ return before.left < coords.left ? "ltr" : "rtl";
+ }
+ if (pos < $pos.end()) {
+ let after = view.coordsAtPos(pos + 1);
+ let mid = (after.top + after.bottom) / 2;
+ if (mid > coords.top && mid < coords.bottom && Math.abs(after.left - coords.left) > 1)
+ return after.left > coords.left ? "ltr" : "rtl";
+ }
+ }
+ let computed = getComputedStyle(view.dom).direction;
+ return computed == "rtl" ? "rtl" : "ltr";
+ }
+ function selectVertically(view, dir, mods) {
+ let sel = view.state.selection;
+ if (sel instanceof TextSelection && !sel.empty || mods.indexOf("s") > -1)
+ return false;
+ if (mac && mods.indexOf("m") > -1)
+ return false;
+ let { $from, $to } = sel;
+ if (!$from.parent.inlineContent || view.endOfTextblock(dir < 0 ? "up" : "down")) {
+ let next = moveSelectionBlock(view.state, dir);
+ if (next && next instanceof NodeSelection)
+ return apply(view, next);
+ }
+ if (!$from.parent.inlineContent) {
+ let side = dir < 0 ? $from : $to;
+ let beyond = sel instanceof AllSelection ? Selection.near(side, dir) : Selection.findFrom(side, dir);
+ return beyond ? apply(view, beyond) : false;
+ }
+ return false;
+ }
+ function stopNativeHorizontalDelete(view, dir) {
+ if (!(view.state.selection instanceof TextSelection))
+ return true;
+ let { $head, $anchor, empty: empty3 } = view.state.selection;
+ if (!$head.sameParent($anchor))
+ return true;
+ if (!empty3)
+ return false;
+ if (view.endOfTextblock(dir > 0 ? "forward" : "backward"))
+ return true;
+ let nextNode = !$head.textOffset && (dir < 0 ? $head.nodeBefore : $head.nodeAfter);
+ if (nextNode && !nextNode.isText) {
+ let tr = view.state.tr;
+ if (dir < 0)
+ tr.delete($head.pos - nextNode.nodeSize, $head.pos);
+ else
+ tr.delete($head.pos, $head.pos + nextNode.nodeSize);
+ view.dispatch(tr);
+ return true;
+ }
+ return false;
+ }
+ function switchEditable(view, node2, state) {
+ view.domObserver.stop();
+ node2.contentEditable = state;
+ view.domObserver.start();
+ }
+ function safariDownArrowBug(view) {
+ if (!safari || view.state.selection.$head.parentOffset > 0)
+ return false;
+ let { focusNode, focusOffset } = view.domSelectionRange();
+ if (focusNode && focusNode.nodeType == 1 && focusOffset == 0 && focusNode.firstChild && focusNode.firstChild.contentEditable == "false") {
+ let child = focusNode.firstChild;
+ switchEditable(view, child, "true");
+ setTimeout(() => switchEditable(view, child, "false"), 20);
+ }
+ return false;
+ }
+ function getMods(event) {
+ let result = "";
+ if (event.ctrlKey)
+ result += "c";
+ if (event.metaKey)
+ result += "m";
+ if (event.altKey)
+ result += "a";
+ if (event.shiftKey)
+ result += "s";
+ return result;
+ }
+ function captureKeyDown(view, event) {
+ let code3 = event.keyCode, mods = getMods(event);
+ if (code3 == 8 || mac && code3 == 72 && mods == "c") {
+ return stopNativeHorizontalDelete(view, -1) || skipIgnoredNodes(view, -1);
+ } else if (code3 == 46 && !event.shiftKey || mac && code3 == 68 && mods == "c") {
+ return stopNativeHorizontalDelete(view, 1) || skipIgnoredNodes(view, 1);
+ } else if (code3 == 13 || code3 == 27) {
+ return true;
+ } else if (code3 == 37 || mac && code3 == 66 && mods == "c") {
+ let dir = code3 == 37 ? findDirection(view, view.state.selection.from) == "ltr" ? -1 : 1 : -1;
+ return selectHorizontally(view, dir, mods) || skipIgnoredNodes(view, dir);
+ } else if (code3 == 39 || mac && code3 == 70 && mods == "c") {
+ let dir = code3 == 39 ? findDirection(view, view.state.selection.from) == "ltr" ? 1 : -1 : 1;
+ return selectHorizontally(view, dir, mods) || skipIgnoredNodes(view, dir);
+ } else if (code3 == 38 || mac && code3 == 80 && mods == "c") {
+ return selectVertically(view, -1, mods) || skipIgnoredNodes(view, -1);
+ } else if (code3 == 40 || mac && code3 == 78 && mods == "c") {
+ return safariDownArrowBug(view) || selectVertically(view, 1, mods) || skipIgnoredNodes(view, 1);
+ } else if (mods == (mac ? "m" : "c") && (code3 == 66 || code3 == 73 || code3 == 89 || code3 == 90)) {
+ return true;
+ }
+ return false;
+ }
+ function serializeForClipboard(view, slice) {
+ view.someProp("transformCopied", (f3) => {
+ slice = f3(slice, view);
+ });
+ let context = [], { content: content3, openStart, openEnd } = slice;
+ while (openStart > 1 && openEnd > 1 && content3.childCount == 1 && content3.firstChild.childCount == 1) {
+ openStart--;
+ openEnd--;
+ let node2 = content3.firstChild;
+ context.push(node2.type.name, node2.attrs != node2.type.defaultAttrs ? node2.attrs : null);
+ content3 = node2.content;
+ }
+ let serializer = view.someProp("clipboardSerializer") || DOMSerializer.fromSchema(view.state.schema);
+ let doc4 = detachedDoc(), wrap3 = doc4.createElement("div");
+ wrap3.appendChild(serializer.serializeFragment(content3, { document: doc4 }));
+ let firstChild = wrap3.firstChild, needsWrap, wrappers = 0;
+ while (firstChild && firstChild.nodeType == 1 && (needsWrap = wrapMap[firstChild.nodeName.toLowerCase()])) {
+ for (let i2 = needsWrap.length - 1; i2 >= 0; i2--) {
+ let wrapper = doc4.createElement(needsWrap[i2]);
+ while (wrap3.firstChild)
+ wrapper.appendChild(wrap3.firstChild);
+ wrap3.appendChild(wrapper);
+ wrappers++;
+ }
+ firstChild = wrap3.firstChild;
+ }
+ if (firstChild && firstChild.nodeType == 1)
+ firstChild.setAttribute("data-pm-slice", `${openStart} ${openEnd}${wrappers ? ` -${wrappers}` : ""} ${JSON.stringify(context)}`);
+ let text5 = view.someProp("clipboardTextSerializer", (f3) => f3(slice, view)) || slice.content.textBetween(0, slice.content.size, "\n\n");
+ return { dom: wrap3, text: text5, slice };
+ }
+ function parseFromClipboard(view, text5, html3, plainText, $context) {
+ let inCode = $context.parent.type.spec.code;
+ let dom, slice;
+ if (!html3 && !text5)
+ return null;
+ let asText = text5 && (plainText || inCode || !html3);
+ if (asText) {
+ view.someProp("transformPastedText", (f3) => {
+ text5 = f3(text5, inCode || plainText, view);
+ });
+ if (inCode)
+ return text5 ? new Slice(Fragment.from(view.state.schema.text(text5.replace(/\r\n?/g, "\n"))), 0, 0) : Slice.empty;
+ let parsed = view.someProp("clipboardTextParser", (f3) => f3(text5, $context, plainText, view));
+ if (parsed) {
+ slice = parsed;
+ } else {
+ let marks = $context.marks();
+ let { schema } = view.state, serializer = DOMSerializer.fromSchema(schema);
+ dom = document.createElement("div");
+ text5.split(/(?:\r\n?|\n)+/).forEach((block) => {
+ let p4 = dom.appendChild(document.createElement("p"));
+ if (block)
+ p4.appendChild(serializer.serializeNode(schema.text(block, marks)));
+ });
+ }
+ } else {
+ view.someProp("transformPastedHTML", (f3) => {
+ html3 = f3(html3, view);
+ });
+ dom = readHTML(html3);
+ if (webkit)
+ restoreReplacedSpaces(dom);
+ }
+ let contextNode = dom && dom.querySelector("[data-pm-slice]");
+ let sliceData = contextNode && /^(\d+) (\d+)(?: -(\d+))? (.*)/.exec(contextNode.getAttribute("data-pm-slice") || "");
+ if (sliceData && sliceData[3])
+ for (let i2 = +sliceData[3]; i2 > 0; i2--) {
+ let child = dom.firstChild;
+ while (child && child.nodeType != 1)
+ child = child.nextSibling;
+ if (!child)
+ break;
+ dom = child;
+ }
+ if (!slice) {
+ let parser = view.someProp("clipboardParser") || view.someProp("domParser") || DOMParser.fromSchema(view.state.schema);
+ slice = parser.parseSlice(dom, {
+ preserveWhitespace: !!(asText || sliceData),
+ context: $context,
+ ruleFromNode(dom2) {
+ if (dom2.nodeName == "BR" && !dom2.nextSibling && dom2.parentNode && !inlineParents.test(dom2.parentNode.nodeName))
+ return { ignore: true };
+ return null;
+ }
+ });
+ }
+ if (sliceData) {
+ slice = addContext(closeSlice(slice, +sliceData[1], +sliceData[2]), sliceData[4]);
+ } else {
+ slice = Slice.maxOpen(normalizeSiblings(slice.content, $context), true);
+ if (slice.openStart || slice.openEnd) {
+ let openStart = 0, openEnd = 0;
+ for (let node2 = slice.content.firstChild; openStart < slice.openStart && !node2.type.spec.isolating; openStart++, node2 = node2.firstChild) {
+ }
+ for (let node2 = slice.content.lastChild; openEnd < slice.openEnd && !node2.type.spec.isolating; openEnd++, node2 = node2.lastChild) {
+ }
+ slice = closeSlice(slice, openStart, openEnd);
+ }
+ }
+ view.someProp("transformPasted", (f3) => {
+ slice = f3(slice, view);
+ });
+ return slice;
+ }
+ var inlineParents = /^(a|abbr|acronym|b|cite|code|del|em|i|ins|kbd|label|output|q|ruby|s|samp|span|strong|sub|sup|time|u|tt|var)$/i;
+ function normalizeSiblings(fragment, $context) {
+ if (fragment.childCount < 2)
+ return fragment;
+ for (let d6 = $context.depth; d6 >= 0; d6--) {
+ let parent = $context.node(d6);
+ let match = parent.contentMatchAt($context.index(d6));
+ let lastWrap, result = [];
+ fragment.forEach((node2) => {
+ if (!result)
+ return;
+ let wrap3 = match.findWrapping(node2.type), inLast;
+ if (!wrap3)
+ return result = null;
+ if (inLast = result.length && lastWrap.length && addToSibling(wrap3, lastWrap, node2, result[result.length - 1], 0)) {
+ result[result.length - 1] = inLast;
+ } else {
+ if (result.length)
+ result[result.length - 1] = closeRight(result[result.length - 1], lastWrap.length);
+ let wrapped = withWrappers(node2, wrap3);
+ result.push(wrapped);
+ match = match.matchType(wrapped.type);
+ lastWrap = wrap3;
+ }
+ });
+ if (result)
+ return Fragment.from(result);
+ }
+ return fragment;
+ }
+ function withWrappers(node2, wrap3, from = 0) {
+ for (let i2 = wrap3.length - 1; i2 >= from; i2--)
+ node2 = wrap3[i2].create(null, Fragment.from(node2));
+ return node2;
+ }
+ function addToSibling(wrap3, lastWrap, node2, sibling, depth) {
+ if (depth < wrap3.length && depth < lastWrap.length && wrap3[depth] == lastWrap[depth]) {
+ let inner = addToSibling(wrap3, lastWrap, node2, sibling.lastChild, depth + 1);
+ if (inner)
+ return sibling.copy(sibling.content.replaceChild(sibling.childCount - 1, inner));
+ let match = sibling.contentMatchAt(sibling.childCount);
+ if (match.matchType(depth == wrap3.length - 1 ? node2.type : wrap3[depth + 1]))
+ return sibling.copy(sibling.content.append(Fragment.from(withWrappers(node2, wrap3, depth + 1))));
+ }
+ }
+ function closeRight(node2, depth) {
+ if (depth == 0)
+ return node2;
+ let fragment = node2.content.replaceChild(node2.childCount - 1, closeRight(node2.lastChild, depth - 1));
+ let fill = node2.contentMatchAt(node2.childCount).fillBefore(Fragment.empty, true);
+ return node2.copy(fragment.append(fill));
+ }
+ function closeRange(fragment, side, from, to, depth, openEnd) {
+ let node2 = side < 0 ? fragment.firstChild : fragment.lastChild, inner = node2.content;
+ if (fragment.childCount > 1)
+ openEnd = 0;
+ if (depth < to - 1)
+ inner = closeRange(inner, side, from, to, depth + 1, openEnd);
+ if (depth >= from)
+ inner = side < 0 ? node2.contentMatchAt(0).fillBefore(inner, openEnd <= depth).append(inner) : inner.append(node2.contentMatchAt(node2.childCount).fillBefore(Fragment.empty, true));
+ return fragment.replaceChild(side < 0 ? 0 : fragment.childCount - 1, node2.copy(inner));
+ }
+ function closeSlice(slice, openStart, openEnd) {
+ if (openStart < slice.openStart)
+ slice = new Slice(closeRange(slice.content, -1, openStart, slice.openStart, 0, slice.openEnd), openStart, slice.openEnd);
+ if (openEnd < slice.openEnd)
+ slice = new Slice(closeRange(slice.content, 1, openEnd, slice.openEnd, 0, 0), slice.openStart, openEnd);
+ return slice;
+ }
+ var wrapMap = {
+ thead: ["table"],
+ tbody: ["table"],
+ tfoot: ["table"],
+ caption: ["table"],
+ colgroup: ["table"],
+ col: ["table", "colgroup"],
+ tr: ["table", "tbody"],
+ td: ["table", "tbody", "tr"],
+ th: ["table", "tbody", "tr"]
+ };
+ var _detachedDoc = null;
+ function detachedDoc() {
+ return _detachedDoc || (_detachedDoc = document.implementation.createHTMLDocument("title"));
+ }
+ function readHTML(html3) {
+ let metas = /^(\s*]*>)*/.exec(html3);
+ if (metas)
+ html3 = html3.slice(metas[0].length);
+ let elt = detachedDoc().createElement("div");
+ let firstTag = /<([a-z][^>\s]+)/i.exec(html3), wrap3;
+ if (wrap3 = firstTag && wrapMap[firstTag[1].toLowerCase()])
+ html3 = wrap3.map((n4) => "<" + n4 + ">").join("") + html3 + wrap3.map((n4) => "").reverse().join("");
+ elt.innerHTML = html3;
+ if (wrap3)
+ for (let i2 = 0; i2 < wrap3.length; i2++)
+ elt = elt.querySelector(wrap3[i2]) || elt;
+ return elt;
+ }
+ function restoreReplacedSpaces(dom) {
+ let nodes = dom.querySelectorAll(chrome ? "span:not([class]):not([style])" : "span.Apple-converted-space");
+ for (let i2 = 0; i2 < nodes.length; i2++) {
+ let node2 = nodes[i2];
+ if (node2.childNodes.length == 1 && node2.textContent == "\xA0" && node2.parentNode)
+ node2.parentNode.replaceChild(dom.ownerDocument.createTextNode(" "), node2);
+ }
+ }
+ function addContext(slice, context) {
+ if (!slice.size)
+ return slice;
+ let schema = slice.content.firstChild.type.schema, array;
+ try {
+ array = JSON.parse(context);
+ } catch (e2) {
+ return slice;
+ }
+ let { content: content3, openStart, openEnd } = slice;
+ for (let i2 = array.length - 2; i2 >= 0; i2 -= 2) {
+ let type = schema.nodes[array[i2]];
+ if (!type || type.hasRequiredAttrs())
+ break;
+ content3 = Fragment.from(type.create(array[i2 + 1], content3));
+ openStart++;
+ openEnd++;
+ }
+ return new Slice(content3, openStart, openEnd);
+ }
+ var handlers = {};
+ var editHandlers = {};
+ var passiveHandlers = { touchstart: true, touchmove: true };
+ var InputState = class {
+ constructor() {
+ this.shiftKey = false;
+ this.mouseDown = null;
+ this.lastKeyCode = null;
+ this.lastKeyCodeTime = 0;
+ this.lastClick = { time: 0, x: 0, y: 0, type: "" };
+ this.lastSelectionOrigin = null;
+ this.lastSelectionTime = 0;
+ this.lastIOSEnter = 0;
+ this.lastIOSEnterFallbackTimeout = -1;
+ this.lastFocus = 0;
+ this.lastTouch = 0;
+ this.lastAndroidDelete = 0;
+ this.composing = false;
+ this.compositionNode = null;
+ this.composingTimeout = -1;
+ this.compositionNodes = [];
+ this.compositionEndedAt = -2e8;
+ this.compositionID = 1;
+ this.compositionPendingChanges = 0;
+ this.domChangeCount = 0;
+ this.eventHandlers = /* @__PURE__ */ Object.create(null);
+ this.hideSelectionGuard = null;
+ }
+ };
+ function initInput(view) {
+ for (let event in handlers) {
+ let handler = handlers[event];
+ view.dom.addEventListener(event, view.input.eventHandlers[event] = (event2) => {
+ if (eventBelongsToView(view, event2) && !runCustomHandler(view, event2) && (view.editable || !(event2.type in editHandlers)))
+ handler(view, event2);
+ }, passiveHandlers[event] ? { passive: true } : void 0);
+ }
+ if (safari)
+ view.dom.addEventListener("input", () => null);
+ ensureListeners(view);
+ }
+ function setSelectionOrigin(view, origin) {
+ view.input.lastSelectionOrigin = origin;
+ view.input.lastSelectionTime = Date.now();
+ }
+ function destroyInput(view) {
+ view.domObserver.stop();
+ for (let type in view.input.eventHandlers)
+ view.dom.removeEventListener(type, view.input.eventHandlers[type]);
+ clearTimeout(view.input.composingTimeout);
+ clearTimeout(view.input.lastIOSEnterFallbackTimeout);
+ }
+ function ensureListeners(view) {
+ view.someProp("handleDOMEvents", (currentHandlers) => {
+ for (let type in currentHandlers)
+ if (!view.input.eventHandlers[type])
+ view.dom.addEventListener(type, view.input.eventHandlers[type] = (event) => runCustomHandler(view, event));
+ });
+ }
+ function runCustomHandler(view, event) {
+ return view.someProp("handleDOMEvents", (handlers2) => {
+ let handler = handlers2[event.type];
+ return handler ? handler(view, event) || event.defaultPrevented : false;
+ });
+ }
+ function eventBelongsToView(view, event) {
+ if (!event.bubbles)
+ return true;
+ if (event.defaultPrevented)
+ return false;
+ for (let node2 = event.target; node2 != view.dom; node2 = node2.parentNode)
+ if (!node2 || node2.nodeType == 11 || node2.pmViewDesc && node2.pmViewDesc.stopEvent(event))
+ return false;
+ return true;
+ }
+ function dispatchEvent2(view, event) {
+ if (!runCustomHandler(view, event) && handlers[event.type] && (view.editable || !(event.type in editHandlers)))
+ handlers[event.type](view, event);
+ }
+ editHandlers.keydown = (view, _event) => {
+ let event = _event;
+ view.input.shiftKey = event.keyCode == 16 || event.shiftKey;
+ if (inOrNearComposition(view, event))
+ return;
+ view.input.lastKeyCode = event.keyCode;
+ view.input.lastKeyCodeTime = Date.now();
+ if (android && chrome && event.keyCode == 13)
+ return;
+ if (event.keyCode != 229)
+ view.domObserver.forceFlush();
+ if (ios && event.keyCode == 13 && !event.ctrlKey && !event.altKey && !event.metaKey) {
+ let now = Date.now();
+ view.input.lastIOSEnter = now;
+ view.input.lastIOSEnterFallbackTimeout = setTimeout(() => {
+ if (view.input.lastIOSEnter == now) {
+ view.someProp("handleKeyDown", (f3) => f3(view, keyEvent(13, "Enter")));
+ view.input.lastIOSEnter = 0;
+ }
+ }, 200);
+ } else if (view.someProp("handleKeyDown", (f3) => f3(view, event)) || captureKeyDown(view, event)) {
+ event.preventDefault();
+ } else {
+ setSelectionOrigin(view, "key");
+ }
+ };
+ editHandlers.keyup = (view, event) => {
+ if (event.keyCode == 16)
+ view.input.shiftKey = false;
+ };
+ editHandlers.keypress = (view, _event) => {
+ let event = _event;
+ if (inOrNearComposition(view, event) || !event.charCode || event.ctrlKey && !event.altKey || mac && event.metaKey)
+ return;
+ if (view.someProp("handleKeyPress", (f3) => f3(view, event))) {
+ event.preventDefault();
+ return;
+ }
+ let sel = view.state.selection;
+ if (!(sel instanceof TextSelection) || !sel.$from.sameParent(sel.$to)) {
+ let text5 = String.fromCharCode(event.charCode);
+ if (!/[\r\n]/.test(text5) && !view.someProp("handleTextInput", (f3) => f3(view, sel.$from.pos, sel.$to.pos, text5)))
+ view.dispatch(view.state.tr.insertText(text5).scrollIntoView());
+ event.preventDefault();
+ }
+ };
+ function eventCoords(event) {
+ return { left: event.clientX, top: event.clientY };
+ }
+ function isNear(event, click) {
+ let dx = click.x - event.clientX, dy = click.y - event.clientY;
+ return dx * dx + dy * dy < 100;
+ }
+ function runHandlerOnContext(view, propName, pos, inside, event) {
+ if (inside == -1)
+ return false;
+ let $pos = view.state.doc.resolve(inside);
+ for (let i2 = $pos.depth + 1; i2 > 0; i2--) {
+ if (view.someProp(propName, (f3) => i2 > $pos.depth ? f3(view, pos, $pos.nodeAfter, $pos.before(i2), event, true) : f3(view, pos, $pos.node(i2), $pos.before(i2), event, false)))
+ return true;
+ }
+ return false;
+ }
+ function updateSelection(view, selection, origin) {
+ if (!view.focused)
+ view.focus();
+ let tr = view.state.tr.setSelection(selection);
+ if (origin == "pointer")
+ tr.setMeta("pointer", true);
+ view.dispatch(tr);
+ }
+ function selectClickedLeaf(view, inside) {
+ if (inside == -1)
+ return false;
+ let $pos = view.state.doc.resolve(inside), node2 = $pos.nodeAfter;
+ if (node2 && node2.isAtom && NodeSelection.isSelectable(node2)) {
+ updateSelection(view, new NodeSelection($pos), "pointer");
+ return true;
+ }
+ return false;
+ }
+ function selectClickedNode(view, inside) {
+ if (inside == -1)
+ return false;
+ let sel = view.state.selection, selectedNode, selectAt;
+ if (sel instanceof NodeSelection)
+ selectedNode = sel.node;
+ let $pos = view.state.doc.resolve(inside);
+ for (let i2 = $pos.depth + 1; i2 > 0; i2--) {
+ let node2 = i2 > $pos.depth ? $pos.nodeAfter : $pos.node(i2);
+ if (NodeSelection.isSelectable(node2)) {
+ if (selectedNode && sel.$from.depth > 0 && i2 >= sel.$from.depth && $pos.before(sel.$from.depth + 1) == sel.$from.pos)
+ selectAt = $pos.before(sel.$from.depth);
+ else
+ selectAt = $pos.before(i2);
+ break;
+ }
+ }
+ if (selectAt != null) {
+ updateSelection(view, NodeSelection.create(view.state.doc, selectAt), "pointer");
+ return true;
+ } else {
+ return false;
+ }
+ }
+ function handleSingleClick(view, pos, inside, event, selectNode) {
+ return runHandlerOnContext(view, "handleClickOn", pos, inside, event) || view.someProp("handleClick", (f3) => f3(view, pos, event)) || (selectNode ? selectClickedNode(view, inside) : selectClickedLeaf(view, inside));
+ }
+ function handleDoubleClick(view, pos, inside, event) {
+ return runHandlerOnContext(view, "handleDoubleClickOn", pos, inside, event) || view.someProp("handleDoubleClick", (f3) => f3(view, pos, event));
+ }
+ function handleTripleClick(view, pos, inside, event) {
+ return runHandlerOnContext(view, "handleTripleClickOn", pos, inside, event) || view.someProp("handleTripleClick", (f3) => f3(view, pos, event)) || defaultTripleClick(view, inside, event);
+ }
+ function defaultTripleClick(view, inside, event) {
+ if (event.button != 0)
+ return false;
+ let doc4 = view.state.doc;
+ if (inside == -1) {
+ if (doc4.inlineContent) {
+ updateSelection(view, TextSelection.create(doc4, 0, doc4.content.size), "pointer");
+ return true;
+ }
+ return false;
+ }
+ let $pos = doc4.resolve(inside);
+ for (let i2 = $pos.depth + 1; i2 > 0; i2--) {
+ let node2 = i2 > $pos.depth ? $pos.nodeAfter : $pos.node(i2);
+ let nodePos = $pos.before(i2);
+ if (node2.inlineContent)
+ updateSelection(view, TextSelection.create(doc4, nodePos + 1, nodePos + 1 + node2.content.size), "pointer");
+ else if (NodeSelection.isSelectable(node2))
+ updateSelection(view, NodeSelection.create(doc4, nodePos), "pointer");
+ else
+ continue;
+ return true;
+ }
+ }
+ function forceDOMFlush(view) {
+ return endComposition(view);
+ }
+ var selectNodeModifier = mac ? "metaKey" : "ctrlKey";
+ handlers.mousedown = (view, _event) => {
+ let event = _event;
+ view.input.shiftKey = event.shiftKey;
+ let flushed = forceDOMFlush(view);
+ let now = Date.now(), type = "singleClick";
+ if (now - view.input.lastClick.time < 500 && isNear(event, view.input.lastClick) && !event[selectNodeModifier]) {
+ if (view.input.lastClick.type == "singleClick")
+ type = "doubleClick";
+ else if (view.input.lastClick.type == "doubleClick")
+ type = "tripleClick";
+ }
+ view.input.lastClick = { time: now, x: event.clientX, y: event.clientY, type };
+ let pos = view.posAtCoords(eventCoords(event));
+ if (!pos)
+ return;
+ if (type == "singleClick") {
+ if (view.input.mouseDown)
+ view.input.mouseDown.done();
+ view.input.mouseDown = new MouseDown(view, pos, event, !!flushed);
+ } else if ((type == "doubleClick" ? handleDoubleClick : handleTripleClick)(view, pos.pos, pos.inside, event)) {
+ event.preventDefault();
+ } else {
+ setSelectionOrigin(view, "pointer");
+ }
+ };
+ var MouseDown = class {
+ constructor(view, pos, event, flushed) {
+ this.view = view;
+ this.pos = pos;
+ this.event = event;
+ this.flushed = flushed;
+ this.delayedSelectionSync = false;
+ this.mightDrag = null;
+ this.startDoc = view.state.doc;
+ this.selectNode = !!event[selectNodeModifier];
+ this.allowDefault = event.shiftKey;
+ let targetNode, targetPos;
+ if (pos.inside > -1) {
+ targetNode = view.state.doc.nodeAt(pos.inside);
+ targetPos = pos.inside;
+ } else {
+ let $pos = view.state.doc.resolve(pos.pos);
+ targetNode = $pos.parent;
+ targetPos = $pos.depth ? $pos.before() : 0;
+ }
+ const target = flushed ? null : event.target;
+ const targetDesc = target ? view.docView.nearestDesc(target, true) : null;
+ this.target = targetDesc ? targetDesc.dom : null;
+ let { selection } = view.state;
+ if (event.button == 0 && targetNode.type.spec.draggable && targetNode.type.spec.selectable !== false || selection instanceof NodeSelection && selection.from <= targetPos && selection.to > targetPos)
+ this.mightDrag = {
+ node: targetNode,
+ pos: targetPos,
+ addAttr: !!(this.target && !this.target.draggable),
+ setUneditable: !!(this.target && gecko && !this.target.hasAttribute("contentEditable"))
+ };
+ if (this.target && this.mightDrag && (this.mightDrag.addAttr || this.mightDrag.setUneditable)) {
+ this.view.domObserver.stop();
+ if (this.mightDrag.addAttr)
+ this.target.draggable = true;
+ if (this.mightDrag.setUneditable)
+ setTimeout(() => {
+ if (this.view.input.mouseDown == this)
+ this.target.setAttribute("contentEditable", "false");
+ }, 20);
+ this.view.domObserver.start();
+ }
+ view.root.addEventListener("mouseup", this.up = this.up.bind(this));
+ view.root.addEventListener("mousemove", this.move = this.move.bind(this));
+ setSelectionOrigin(view, "pointer");
+ }
+ done() {
+ this.view.root.removeEventListener("mouseup", this.up);
+ this.view.root.removeEventListener("mousemove", this.move);
+ if (this.mightDrag && this.target) {
+ this.view.domObserver.stop();
+ if (this.mightDrag.addAttr)
+ this.target.removeAttribute("draggable");
+ if (this.mightDrag.setUneditable)
+ this.target.removeAttribute("contentEditable");
+ this.view.domObserver.start();
+ }
+ if (this.delayedSelectionSync)
+ setTimeout(() => selectionToDOM(this.view));
+ this.view.input.mouseDown = null;
+ }
+ up(event) {
+ this.done();
+ if (!this.view.dom.contains(event.target))
+ return;
+ let pos = this.pos;
+ if (this.view.state.doc != this.startDoc)
+ pos = this.view.posAtCoords(eventCoords(event));
+ this.updateAllowDefault(event);
+ if (this.allowDefault || !pos) {
+ setSelectionOrigin(this.view, "pointer");
+ } else if (handleSingleClick(this.view, pos.pos, pos.inside, event, this.selectNode)) {
+ event.preventDefault();
+ } else if (event.button == 0 && (this.flushed || // Safari ignores clicks on draggable elements
+ safari && this.mightDrag && !this.mightDrag.node.isAtom || // Chrome will sometimes treat a node selection as a
+ // cursor, but still report that the node is selected
+ // when asked through getSelection. You'll then get a
+ // situation where clicking at the point where that
+ // (hidden) cursor is doesn't change the selection, and
+ // thus doesn't get a reaction from ProseMirror. This
+ // works around that.
+ chrome && !this.view.state.selection.visible && Math.min(Math.abs(pos.pos - this.view.state.selection.from), Math.abs(pos.pos - this.view.state.selection.to)) <= 2)) {
+ updateSelection(this.view, Selection.near(this.view.state.doc.resolve(pos.pos)), "pointer");
+ event.preventDefault();
+ } else {
+ setSelectionOrigin(this.view, "pointer");
+ }
+ }
+ move(event) {
+ this.updateAllowDefault(event);
+ setSelectionOrigin(this.view, "pointer");
+ if (event.buttons == 0)
+ this.done();
+ }
+ updateAllowDefault(event) {
+ if (!this.allowDefault && (Math.abs(this.event.x - event.clientX) > 4 || Math.abs(this.event.y - event.clientY) > 4))
+ this.allowDefault = true;
+ }
+ };
+ handlers.touchstart = (view) => {
+ view.input.lastTouch = Date.now();
+ forceDOMFlush(view);
+ setSelectionOrigin(view, "pointer");
+ };
+ handlers.touchmove = (view) => {
+ view.input.lastTouch = Date.now();
+ setSelectionOrigin(view, "pointer");
+ };
+ handlers.contextmenu = (view) => forceDOMFlush(view);
+ function inOrNearComposition(view, event) {
+ if (view.composing)
+ return true;
+ if (safari && Math.abs(event.timeStamp - view.input.compositionEndedAt) < 500) {
+ view.input.compositionEndedAt = -2e8;
+ return true;
+ }
+ return false;
+ }
+ var timeoutComposition = android ? 5e3 : -1;
+ editHandlers.compositionstart = editHandlers.compositionupdate = (view) => {
+ if (!view.composing) {
+ view.domObserver.flush();
+ let { state } = view, $pos = state.selection.$from;
+ if (state.selection.empty && (state.storedMarks || !$pos.textOffset && $pos.parentOffset && $pos.nodeBefore.marks.some((m3) => m3.type.spec.inclusive === false))) {
+ view.markCursor = view.state.storedMarks || $pos.marks();
+ endComposition(view, true);
+ view.markCursor = null;
+ } else {
+ endComposition(view);
+ if (gecko && state.selection.empty && $pos.parentOffset && !$pos.textOffset && $pos.nodeBefore.marks.length) {
+ let sel = view.domSelectionRange();
+ for (let node2 = sel.focusNode, offset = sel.focusOffset; node2 && node2.nodeType == 1 && offset != 0; ) {
+ let before = offset < 0 ? node2.lastChild : node2.childNodes[offset - 1];
+ if (!before)
+ break;
+ if (before.nodeType == 3) {
+ view.domSelection().collapse(before, before.nodeValue.length);
+ break;
+ } else {
+ node2 = before;
+ offset = -1;
+ }
+ }
+ }
+ }
+ view.input.composing = true;
+ }
+ scheduleComposeEnd(view, timeoutComposition);
+ };
+ editHandlers.compositionend = (view, event) => {
+ if (view.composing) {
+ view.input.composing = false;
+ view.input.compositionEndedAt = event.timeStamp;
+ view.input.compositionPendingChanges = view.domObserver.pendingRecords().length ? view.input.compositionID : 0;
+ view.input.compositionNode = null;
+ if (view.input.compositionPendingChanges)
+ Promise.resolve().then(() => view.domObserver.flush());
+ view.input.compositionID++;
+ scheduleComposeEnd(view, 20);
+ }
+ };
+ function scheduleComposeEnd(view, delay) {
+ clearTimeout(view.input.composingTimeout);
+ if (delay > -1)
+ view.input.composingTimeout = setTimeout(() => endComposition(view), delay);
+ }
+ function clearComposition(view) {
+ if (view.composing) {
+ view.input.composing = false;
+ view.input.compositionEndedAt = timestampFromCustomEvent();
+ }
+ while (view.input.compositionNodes.length > 0)
+ view.input.compositionNodes.pop().markParentsDirty();
+ }
+ function findCompositionNode(view) {
+ let sel = view.domSelectionRange();
+ if (!sel.focusNode)
+ return null;
+ let textBefore = textNodeBefore$1(sel.focusNode, sel.focusOffset);
+ let textAfter = textNodeAfter$1(sel.focusNode, sel.focusOffset);
+ if (textBefore && textAfter && textBefore != textAfter) {
+ let descAfter = textAfter.pmViewDesc;
+ if (!descAfter || !descAfter.isText(textAfter.nodeValue)) {
+ return textAfter;
+ } else if (view.input.compositionNode == textAfter) {
+ let descBefore = textBefore.pmViewDesc;
+ if (!(!descBefore || !descBefore.isText(textBefore.nodeValue)))
+ return textAfter;
+ }
+ }
+ return textBefore || textAfter;
+ }
+ function timestampFromCustomEvent() {
+ let event = document.createEvent("Event");
+ event.initEvent("event", true, true);
+ return event.timeStamp;
+ }
+ function endComposition(view, forceUpdate = false) {
+ if (android && view.domObserver.flushingSoon >= 0)
+ return;
+ view.domObserver.forceFlush();
+ clearComposition(view);
+ if (forceUpdate || view.docView && view.docView.dirty) {
+ let sel = selectionFromDOM(view);
+ if (sel && !sel.eq(view.state.selection))
+ view.dispatch(view.state.tr.setSelection(sel));
+ else
+ view.updateState(view.state);
+ return true;
+ }
+ return false;
+ }
+ function captureCopy(view, dom) {
+ if (!view.dom.parentNode)
+ return;
+ let wrap3 = view.dom.parentNode.appendChild(document.createElement("div"));
+ wrap3.appendChild(dom);
+ wrap3.style.cssText = "position: fixed; left: -10000px; top: 10px";
+ let sel = getSelection(), range = document.createRange();
+ range.selectNodeContents(dom);
+ view.dom.blur();
+ sel.removeAllRanges();
+ sel.addRange(range);
+ setTimeout(() => {
+ if (wrap3.parentNode)
+ wrap3.parentNode.removeChild(wrap3);
+ view.focus();
+ }, 50);
+ }
+ var brokenClipboardAPI = ie && ie_version < 15 || ios && webkit_version < 604;
+ handlers.copy = editHandlers.cut = (view, _event) => {
+ let event = _event;
+ let sel = view.state.selection, cut = event.type == "cut";
+ if (sel.empty)
+ return;
+ let data = brokenClipboardAPI ? null : event.clipboardData;
+ let slice = sel.content(), { dom, text: text5 } = serializeForClipboard(view, slice);
+ if (data) {
+ event.preventDefault();
+ data.clearData();
+ data.setData("text/html", dom.innerHTML);
+ data.setData("text/plain", text5);
+ } else {
+ captureCopy(view, dom);
+ }
+ if (cut)
+ view.dispatch(view.state.tr.deleteSelection().scrollIntoView().setMeta("uiEvent", "cut"));
+ };
+ function sliceSingleNode(slice) {
+ return slice.openStart == 0 && slice.openEnd == 0 && slice.content.childCount == 1 ? slice.content.firstChild : null;
+ }
+ function capturePaste(view, event) {
+ if (!view.dom.parentNode)
+ return;
+ let plainText = view.input.shiftKey || view.state.selection.$from.parent.type.spec.code;
+ let target = view.dom.parentNode.appendChild(document.createElement(plainText ? "textarea" : "div"));
+ if (!plainText)
+ target.contentEditable = "true";
+ target.style.cssText = "position: fixed; left: -10000px; top: 10px";
+ target.focus();
+ let plain = view.input.shiftKey && view.input.lastKeyCode != 45;
+ setTimeout(() => {
+ view.focus();
+ if (target.parentNode)
+ target.parentNode.removeChild(target);
+ if (plainText)
+ doPaste(view, target.value, null, plain, event);
+ else
+ doPaste(view, target.textContent, target.innerHTML, plain, event);
+ }, 50);
+ }
+ function doPaste(view, text5, html3, preferPlain, event) {
+ let slice = parseFromClipboard(view, text5, html3, preferPlain, view.state.selection.$from);
+ if (view.someProp("handlePaste", (f3) => f3(view, event, slice || Slice.empty)))
+ return true;
+ if (!slice)
+ return false;
+ let singleNode = sliceSingleNode(slice);
+ let tr = singleNode ? view.state.tr.replaceSelectionWith(singleNode, preferPlain) : view.state.tr.replaceSelection(slice);
+ view.dispatch(tr.scrollIntoView().setMeta("paste", true).setMeta("uiEvent", "paste"));
+ return true;
+ }
+ function getText(clipboardData) {
+ let text5 = clipboardData.getData("text/plain") || clipboardData.getData("Text");
+ if (text5)
+ return text5;
+ let uris = clipboardData.getData("text/uri-list");
+ return uris ? uris.replace(/\r?\n/g, " ") : "";
+ }
+ editHandlers.paste = (view, _event) => {
+ let event = _event;
+ if (view.composing && !android)
+ return;
+ let data = brokenClipboardAPI ? null : event.clipboardData;
+ let plain = view.input.shiftKey && view.input.lastKeyCode != 45;
+ if (data && doPaste(view, getText(data), data.getData("text/html"), plain, event))
+ event.preventDefault();
+ else
+ capturePaste(view, event);
+ };
+ var Dragging = class {
+ constructor(slice, move, node2) {
+ this.slice = slice;
+ this.move = move;
+ this.node = node2;
+ }
+ };
+ var dragCopyModifier = mac ? "altKey" : "ctrlKey";
+ handlers.dragstart = (view, _event) => {
+ let event = _event;
+ let mouseDown = view.input.mouseDown;
+ if (mouseDown)
+ mouseDown.done();
+ if (!event.dataTransfer)
+ return;
+ let sel = view.state.selection;
+ let pos = sel.empty ? null : view.posAtCoords(eventCoords(event));
+ let node2;
+ if (pos && pos.pos >= sel.from && pos.pos <= (sel instanceof NodeSelection ? sel.to - 1 : sel.to)) ;
+ else if (mouseDown && mouseDown.mightDrag) {
+ node2 = NodeSelection.create(view.state.doc, mouseDown.mightDrag.pos);
+ } else if (event.target && event.target.nodeType == 1) {
+ let desc = view.docView.nearestDesc(event.target, true);
+ if (desc && desc.node.type.spec.draggable && desc != view.docView)
+ node2 = NodeSelection.create(view.state.doc, desc.posBefore);
+ }
+ let draggedSlice = (node2 || view.state.selection).content();
+ let { dom, text: text5, slice } = serializeForClipboard(view, draggedSlice);
+ event.dataTransfer.clearData();
+ event.dataTransfer.setData(brokenClipboardAPI ? "Text" : "text/html", dom.innerHTML);
+ event.dataTransfer.effectAllowed = "copyMove";
+ if (!brokenClipboardAPI)
+ event.dataTransfer.setData("text/plain", text5);
+ view.dragging = new Dragging(slice, !event[dragCopyModifier], node2);
+ };
+ handlers.dragend = (view) => {
+ let dragging = view.dragging;
+ window.setTimeout(() => {
+ if (view.dragging == dragging)
+ view.dragging = null;
+ }, 50);
+ };
+ editHandlers.dragover = editHandlers.dragenter = (_3, e2) => e2.preventDefault();
+ editHandlers.drop = (view, _event) => {
+ let event = _event;
+ let dragging = view.dragging;
+ view.dragging = null;
+ if (!event.dataTransfer)
+ return;
+ let eventPos = view.posAtCoords(eventCoords(event));
+ if (!eventPos)
+ return;
+ let $mouse = view.state.doc.resolve(eventPos.pos);
+ let slice = dragging && dragging.slice;
+ if (slice) {
+ view.someProp("transformPasted", (f3) => {
+ slice = f3(slice, view);
+ });
+ } else {
+ slice = parseFromClipboard(view, getText(event.dataTransfer), brokenClipboardAPI ? null : event.dataTransfer.getData("text/html"), false, $mouse);
+ }
+ let move = !!(dragging && !event[dragCopyModifier]);
+ if (view.someProp("handleDrop", (f3) => f3(view, event, slice || Slice.empty, move))) {
+ event.preventDefault();
+ return;
+ }
+ if (!slice)
+ return;
+ event.preventDefault();
+ let insertPos = slice ? dropPoint(view.state.doc, $mouse.pos, slice) : $mouse.pos;
+ if (insertPos == null)
+ insertPos = $mouse.pos;
+ let tr = view.state.tr;
+ if (move) {
+ let { node: node2 } = dragging;
+ if (node2)
+ node2.replace(tr);
+ else
+ tr.deleteSelection();
+ }
+ let pos = tr.mapping.map(insertPos);
+ let isNode = slice.openStart == 0 && slice.openEnd == 0 && slice.content.childCount == 1;
+ let beforeInsert = tr.doc;
+ if (isNode)
+ tr.replaceRangeWith(pos, pos, slice.content.firstChild);
+ else
+ tr.replaceRange(pos, pos, slice);
+ if (tr.doc.eq(beforeInsert))
+ return;
+ let $pos = tr.doc.resolve(pos);
+ if (isNode && NodeSelection.isSelectable(slice.content.firstChild) && $pos.nodeAfter && $pos.nodeAfter.sameMarkup(slice.content.firstChild)) {
+ tr.setSelection(new NodeSelection($pos));
+ } else {
+ let end = tr.mapping.map(insertPos);
+ tr.mapping.maps[tr.mapping.maps.length - 1].forEach((_from, _to, _newFrom, newTo) => end = newTo);
+ tr.setSelection(selectionBetween(view, $pos, tr.doc.resolve(end)));
+ }
+ view.focus();
+ view.dispatch(tr.setMeta("uiEvent", "drop"));
+ };
+ handlers.focus = (view) => {
+ view.input.lastFocus = Date.now();
+ if (!view.focused) {
+ view.domObserver.stop();
+ view.dom.classList.add("ProseMirror-focused");
+ view.domObserver.start();
+ view.focused = true;
+ setTimeout(() => {
+ if (view.docView && view.hasFocus() && !view.domObserver.currentSelection.eq(view.domSelectionRange()))
+ selectionToDOM(view);
+ }, 20);
+ }
+ };
+ handlers.blur = (view, _event) => {
+ let event = _event;
+ if (view.focused) {
+ view.domObserver.stop();
+ view.dom.classList.remove("ProseMirror-focused");
+ view.domObserver.start();
+ if (event.relatedTarget && view.dom.contains(event.relatedTarget))
+ view.domObserver.currentSelection.clear();
+ view.focused = false;
+ }
+ };
+ handlers.beforeinput = (view, _event) => {
+ let event = _event;
+ if (chrome && android && event.inputType == "deleteContentBackward") {
+ view.domObserver.flushSoon();
+ let { domChangeCount } = view.input;
+ setTimeout(() => {
+ if (view.input.domChangeCount != domChangeCount)
+ return;
+ view.dom.blur();
+ view.focus();
+ if (view.someProp("handleKeyDown", (f3) => f3(view, keyEvent(8, "Backspace"))))
+ return;
+ let { $cursor } = view.state.selection;
+ if ($cursor && $cursor.pos > 0)
+ view.dispatch(view.state.tr.delete($cursor.pos - 1, $cursor.pos).scrollIntoView());
+ }, 50);
+ }
+ };
+ for (let prop in editHandlers)
+ handlers[prop] = editHandlers[prop];
+ function compareObjs(a2, b4) {
+ if (a2 == b4)
+ return true;
+ for (let p4 in a2)
+ if (a2[p4] !== b4[p4])
+ return false;
+ for (let p4 in b4)
+ if (!(p4 in a2))
+ return false;
+ return true;
+ }
+ var WidgetType = class _WidgetType {
+ constructor(toDOM, spec) {
+ this.toDOM = toDOM;
+ this.spec = spec || noSpec;
+ this.side = this.spec.side || 0;
+ }
+ map(mapping, span, offset, oldOffset) {
+ let { pos, deleted } = mapping.mapResult(span.from + oldOffset, this.side < 0 ? -1 : 1);
+ return deleted ? null : new Decoration(pos - offset, pos - offset, this);
+ }
+ valid() {
+ return true;
+ }
+ eq(other) {
+ return this == other || other instanceof _WidgetType && (this.spec.key && this.spec.key == other.spec.key || this.toDOM == other.toDOM && compareObjs(this.spec, other.spec));
+ }
+ destroy(node2) {
+ if (this.spec.destroy)
+ this.spec.destroy(node2);
+ }
+ };
+ var InlineType = class _InlineType {
+ constructor(attrs, spec) {
+ this.attrs = attrs;
+ this.spec = spec || noSpec;
+ }
+ map(mapping, span, offset, oldOffset) {
+ let from = mapping.map(span.from + oldOffset, this.spec.inclusiveStart ? -1 : 1) - offset;
+ let to = mapping.map(span.to + oldOffset, this.spec.inclusiveEnd ? 1 : -1) - offset;
+ return from >= to ? null : new Decoration(from, to, this);
+ }
+ valid(_3, span) {
+ return span.from < span.to;
+ }
+ eq(other) {
+ return this == other || other instanceof _InlineType && compareObjs(this.attrs, other.attrs) && compareObjs(this.spec, other.spec);
+ }
+ static is(span) {
+ return span.type instanceof _InlineType;
+ }
+ destroy() {
+ }
+ };
+ var NodeType2 = class _NodeType {
+ constructor(attrs, spec) {
+ this.attrs = attrs;
+ this.spec = spec || noSpec;
+ }
+ map(mapping, span, offset, oldOffset) {
+ let from = mapping.mapResult(span.from + oldOffset, 1);
+ if (from.deleted)
+ return null;
+ let to = mapping.mapResult(span.to + oldOffset, -1);
+ if (to.deleted || to.pos <= from.pos)
+ return null;
+ return new Decoration(from.pos - offset, to.pos - offset, this);
+ }
+ valid(node2, span) {
+ let { index: index2, offset } = node2.content.findIndex(span.from), child;
+ return offset == span.from && !(child = node2.child(index2)).isText && offset + child.nodeSize == span.to;
+ }
+ eq(other) {
+ return this == other || other instanceof _NodeType && compareObjs(this.attrs, other.attrs) && compareObjs(this.spec, other.spec);
+ }
+ destroy() {
+ }
+ };
+ var Decoration = class _Decoration {
+ /**
+ @internal
+ */
+ constructor(from, to, type) {
+ this.from = from;
+ this.to = to;
+ this.type = type;
+ }
+ /**
+ @internal
+ */
+ copy(from, to) {
+ return new _Decoration(from, to, this.type);
+ }
+ /**
+ @internal
+ */
+ eq(other, offset = 0) {
+ return this.type.eq(other.type) && this.from + offset == other.from && this.to + offset == other.to;
+ }
+ /**
+ @internal
+ */
+ map(mapping, offset, oldOffset) {
+ return this.type.map(mapping, this, offset, oldOffset);
+ }
+ /**
+ Creates a widget decoration, which is a DOM node that's shown in
+ the document at the given position. It is recommended that you
+ delay rendering the widget by passing a function that will be
+ called when the widget is actually drawn in a view, but you can
+ also directly pass a DOM node. `getPos` can be used to find the
+ widget's current document position.
+ */
+ static widget(pos, toDOM, spec) {
+ return new _Decoration(pos, pos, new WidgetType(toDOM, spec));
+ }
+ /**
+ Creates an inline decoration, which adds the given attributes to
+ each inline node between `from` and `to`.
+ */
+ static inline(from, to, attrs, spec) {
+ return new _Decoration(from, to, new InlineType(attrs, spec));
+ }
+ /**
+ Creates a node decoration. `from` and `to` should point precisely
+ before and after a node in the document. That node, and only that
+ node, will receive the given attributes.
+ */
+ static node(from, to, attrs, spec) {
+ return new _Decoration(from, to, new NodeType2(attrs, spec));
+ }
+ /**
+ The spec provided when creating this decoration. Can be useful
+ if you've stored extra information in that object.
+ */
+ get spec() {
+ return this.type.spec;
+ }
+ /**
+ @internal
+ */
+ get inline() {
+ return this.type instanceof InlineType;
+ }
+ /**
+ @internal
+ */
+ get widget() {
+ return this.type instanceof WidgetType;
+ }
+ };
+ var none = [];
+ var noSpec = {};
+ var DecorationSet = class _DecorationSet {
+ /**
+ @internal
+ */
+ constructor(local, children) {
+ this.local = local.length ? local : none;
+ this.children = children.length ? children : none;
+ }
+ /**
+ Create a set of decorations, using the structure of the given
+ document. This will consume (modify) the `decorations` array, so
+ you must make a copy if you want need to preserve that.
+ */
+ static create(doc4, decorations) {
+ return decorations.length ? buildTree(decorations, doc4, 0, noSpec) : empty2;
+ }
+ /**
+ Find all decorations in this set which touch the given range
+ (including decorations that start or end directly at the
+ boundaries) and match the given predicate on their spec. When
+ `start` and `end` are omitted, all decorations in the set are
+ considered. When `predicate` isn't given, all decorations are
+ assumed to match.
+ */
+ find(start, end, predicate) {
+ let result = [];
+ this.findInner(start == null ? 0 : start, end == null ? 1e9 : end, result, 0, predicate);
+ return result;
+ }
+ findInner(start, end, result, offset, predicate) {
+ for (let i2 = 0; i2 < this.local.length; i2++) {
+ let span = this.local[i2];
+ if (span.from <= end && span.to >= start && (!predicate || predicate(span.spec)))
+ result.push(span.copy(span.from + offset, span.to + offset));
+ }
+ for (let i2 = 0; i2 < this.children.length; i2 += 3) {
+ if (this.children[i2] < end && this.children[i2 + 1] > start) {
+ let childOff = this.children[i2] + 1;
+ this.children[i2 + 2].findInner(start - childOff, end - childOff, result, offset + childOff, predicate);
+ }
+ }
+ }
+ /**
+ Map the set of decorations in response to a change in the
+ document.
+ */
+ map(mapping, doc4, options2) {
+ if (this == empty2 || mapping.maps.length == 0)
+ return this;
+ return this.mapInner(mapping, doc4, 0, 0, options2 || noSpec);
+ }
+ /**
+ @internal
+ */
+ mapInner(mapping, node2, offset, oldOffset, options2) {
+ let newLocal;
+ for (let i2 = 0; i2 < this.local.length; i2++) {
+ let mapped = this.local[i2].map(mapping, offset, oldOffset);
+ if (mapped && mapped.type.valid(node2, mapped))
+ (newLocal || (newLocal = [])).push(mapped);
+ else if (options2.onRemove)
+ options2.onRemove(this.local[i2].spec);
+ }
+ if (this.children.length)
+ return mapChildren(this.children, newLocal || [], mapping, node2, offset, oldOffset, options2);
+ else
+ return newLocal ? new _DecorationSet(newLocal.sort(byPos), none) : empty2;
+ }
+ /**
+ Add the given array of decorations to the ones in the set,
+ producing a new set. Consumes the `decorations` array. Needs
+ access to the current document to create the appropriate tree
+ structure.
+ */
+ add(doc4, decorations) {
+ if (!decorations.length)
+ return this;
+ if (this == empty2)
+ return _DecorationSet.create(doc4, decorations);
+ return this.addInner(doc4, decorations, 0);
+ }
+ addInner(doc4, decorations, offset) {
+ let children, childIndex = 0;
+ doc4.forEach((childNode, childOffset) => {
+ let baseOffset = childOffset + offset, found2;
+ if (!(found2 = takeSpansForNode(decorations, childNode, baseOffset)))
+ return;
+ if (!children)
+ children = this.children.slice();
+ while (childIndex < children.length && children[childIndex] < childOffset)
+ childIndex += 3;
+ if (children[childIndex] == childOffset)
+ children[childIndex + 2] = children[childIndex + 2].addInner(childNode, found2, baseOffset + 1);
+ else
+ children.splice(childIndex, 0, childOffset, childOffset + childNode.nodeSize, buildTree(found2, childNode, baseOffset + 1, noSpec));
+ childIndex += 3;
+ });
+ let local = moveSpans(childIndex ? withoutNulls(decorations) : decorations, -offset);
+ for (let i2 = 0; i2 < local.length; i2++)
+ if (!local[i2].type.valid(doc4, local[i2]))
+ local.splice(i2--, 1);
+ return new _DecorationSet(local.length ? this.local.concat(local).sort(byPos) : this.local, children || this.children);
+ }
+ /**
+ Create a new set that contains the decorations in this set, minus
+ the ones in the given array.
+ */
+ remove(decorations) {
+ if (decorations.length == 0 || this == empty2)
+ return this;
+ return this.removeInner(decorations, 0);
+ }
+ removeInner(decorations, offset) {
+ let children = this.children, local = this.local;
+ for (let i2 = 0; i2 < children.length; i2 += 3) {
+ let found2;
+ let from = children[i2] + offset, to = children[i2 + 1] + offset;
+ for (let j6 = 0, span; j6 < decorations.length; j6++)
+ if (span = decorations[j6]) {
+ if (span.from > from && span.to < to) {
+ decorations[j6] = null;
+ (found2 || (found2 = [])).push(span);
+ }
+ }
+ if (!found2)
+ continue;
+ if (children == this.children)
+ children = this.children.slice();
+ let removed = children[i2 + 2].removeInner(found2, from + 1);
+ if (removed != empty2) {
+ children[i2 + 2] = removed;
+ } else {
+ children.splice(i2, 3);
+ i2 -= 3;
+ }
+ }
+ if (local.length) {
+ for (let i2 = 0, span; i2 < decorations.length; i2++)
+ if (span = decorations[i2]) {
+ for (let j6 = 0; j6 < local.length; j6++)
+ if (local[j6].eq(span, offset)) {
+ if (local == this.local)
+ local = this.local.slice();
+ local.splice(j6--, 1);
+ }
+ }
+ }
+ if (children == this.children && local == this.local)
+ return this;
+ return local.length || children.length ? new _DecorationSet(local, children) : empty2;
+ }
+ forChild(offset, node2) {
+ if (this == empty2)
+ return this;
+ if (node2.isLeaf)
+ return _DecorationSet.empty;
+ let child, local;
+ for (let i2 = 0; i2 < this.children.length; i2 += 3)
+ if (this.children[i2] >= offset) {
+ if (this.children[i2] == offset)
+ child = this.children[i2 + 2];
+ break;
+ }
+ let start = offset + 1, end = start + node2.content.size;
+ for (let i2 = 0; i2 < this.local.length; i2++) {
+ let dec = this.local[i2];
+ if (dec.from < end && dec.to > start && dec.type instanceof InlineType) {
+ let from = Math.max(start, dec.from) - start, to = Math.min(end, dec.to) - start;
+ if (from < to)
+ (local || (local = [])).push(dec.copy(from, to));
+ }
+ }
+ if (local) {
+ let localSet = new _DecorationSet(local.sort(byPos), none);
+ return child ? new DecorationGroup([localSet, child]) : localSet;
+ }
+ return child || empty2;
+ }
+ /**
+ @internal
+ */
+ eq(other) {
+ if (this == other)
+ return true;
+ if (!(other instanceof _DecorationSet) || this.local.length != other.local.length || this.children.length != other.children.length)
+ return false;
+ for (let i2 = 0; i2 < this.local.length; i2++)
+ if (!this.local[i2].eq(other.local[i2]))
+ return false;
+ for (let i2 = 0; i2 < this.children.length; i2 += 3)
+ if (this.children[i2] != other.children[i2] || this.children[i2 + 1] != other.children[i2 + 1] || !this.children[i2 + 2].eq(other.children[i2 + 2]))
+ return false;
+ return true;
+ }
+ /**
+ @internal
+ */
+ locals(node2) {
+ return removeOverlap(this.localsInner(node2));
+ }
+ /**
+ @internal
+ */
+ localsInner(node2) {
+ if (this == empty2)
+ return none;
+ if (node2.inlineContent || !this.local.some(InlineType.is))
+ return this.local;
+ let result = [];
+ for (let i2 = 0; i2 < this.local.length; i2++) {
+ if (!(this.local[i2].type instanceof InlineType))
+ result.push(this.local[i2]);
+ }
+ return result;
+ }
+ };
+ DecorationSet.empty = new DecorationSet([], []);
+ DecorationSet.removeOverlap = removeOverlap;
+ var empty2 = DecorationSet.empty;
+ var DecorationGroup = class _DecorationGroup {
+ constructor(members) {
+ this.members = members;
+ }
+ map(mapping, doc4) {
+ const mappedDecos = this.members.map((member) => member.map(mapping, doc4, noSpec));
+ return _DecorationGroup.from(mappedDecos);
+ }
+ forChild(offset, child) {
+ if (child.isLeaf)
+ return DecorationSet.empty;
+ let found2 = [];
+ for (let i2 = 0; i2 < this.members.length; i2++) {
+ let result = this.members[i2].forChild(offset, child);
+ if (result == empty2)
+ continue;
+ if (result instanceof _DecorationGroup)
+ found2 = found2.concat(result.members);
+ else
+ found2.push(result);
+ }
+ return _DecorationGroup.from(found2);
+ }
+ eq(other) {
+ if (!(other instanceof _DecorationGroup) || other.members.length != this.members.length)
+ return false;
+ for (let i2 = 0; i2 < this.members.length; i2++)
+ if (!this.members[i2].eq(other.members[i2]))
+ return false;
+ return true;
+ }
+ locals(node2) {
+ let result, sorted = true;
+ for (let i2 = 0; i2 < this.members.length; i2++) {
+ let locals = this.members[i2].localsInner(node2);
+ if (!locals.length)
+ continue;
+ if (!result) {
+ result = locals;
+ } else {
+ if (sorted) {
+ result = result.slice();
+ sorted = false;
+ }
+ for (let j6 = 0; j6 < locals.length; j6++)
+ result.push(locals[j6]);
+ }
+ }
+ return result ? removeOverlap(sorted ? result : result.sort(byPos)) : none;
+ }
+ // Create a group for the given array of decoration sets, or return
+ // a single set when possible.
+ static from(members) {
+ switch (members.length) {
+ case 0:
+ return empty2;
+ case 1:
+ return members[0];
+ default:
+ return new _DecorationGroup(members.every((m3) => m3 instanceof DecorationSet) ? members : members.reduce((r3, m3) => r3.concat(m3 instanceof DecorationSet ? m3 : m3.members), []));
+ }
+ }
+ };
+ function mapChildren(oldChildren, newLocal, mapping, node2, offset, oldOffset, options2) {
+ let children = oldChildren.slice();
+ for (let i2 = 0, baseOffset = oldOffset; i2 < mapping.maps.length; i2++) {
+ let moved = 0;
+ mapping.maps[i2].forEach((oldStart, oldEnd, newStart, newEnd) => {
+ let dSize = newEnd - newStart - (oldEnd - oldStart);
+ for (let i3 = 0; i3 < children.length; i3 += 3) {
+ let end = children[i3 + 1];
+ if (end < 0 || oldStart > end + baseOffset - moved)
+ continue;
+ let start = children[i3] + baseOffset - moved;
+ if (oldEnd >= start) {
+ children[i3 + 1] = oldStart <= start ? -2 : -1;
+ } else if (oldStart >= baseOffset && dSize) {
+ children[i3] += dSize;
+ children[i3 + 1] += dSize;
+ }
+ }
+ moved += dSize;
+ });
+ baseOffset = mapping.maps[i2].map(baseOffset, -1);
+ }
+ let mustRebuild = false;
+ for (let i2 = 0; i2 < children.length; i2 += 3)
+ if (children[i2 + 1] < 0) {
+ if (children[i2 + 1] == -2) {
+ mustRebuild = true;
+ children[i2 + 1] = -1;
+ continue;
+ }
+ let from = mapping.map(oldChildren[i2] + oldOffset), fromLocal = from - offset;
+ if (fromLocal < 0 || fromLocal >= node2.content.size) {
+ mustRebuild = true;
+ continue;
+ }
+ let to = mapping.map(oldChildren[i2 + 1] + oldOffset, -1), toLocal = to - offset;
+ let { index: index2, offset: childOffset } = node2.content.findIndex(fromLocal);
+ let childNode = node2.maybeChild(index2);
+ if (childNode && childOffset == fromLocal && childOffset + childNode.nodeSize == toLocal) {
+ let mapped = children[i2 + 2].mapInner(mapping, childNode, from + 1, oldChildren[i2] + oldOffset + 1, options2);
+ if (mapped != empty2) {
+ children[i2] = fromLocal;
+ children[i2 + 1] = toLocal;
+ children[i2 + 2] = mapped;
+ } else {
+ children[i2 + 1] = -2;
+ mustRebuild = true;
+ }
+ } else {
+ mustRebuild = true;
+ }
+ }
+ if (mustRebuild) {
+ let decorations = mapAndGatherRemainingDecorations(children, oldChildren, newLocal, mapping, offset, oldOffset, options2);
+ let built = buildTree(decorations, node2, 0, options2);
+ newLocal = built.local;
+ for (let i2 = 0; i2 < children.length; i2 += 3)
+ if (children[i2 + 1] < 0) {
+ children.splice(i2, 3);
+ i2 -= 3;
+ }
+ for (let i2 = 0, j6 = 0; i2 < built.children.length; i2 += 3) {
+ let from = built.children[i2];
+ while (j6 < children.length && children[j6] < from)
+ j6 += 3;
+ children.splice(j6, 0, built.children[i2], built.children[i2 + 1], built.children[i2 + 2]);
+ }
+ }
+ return new DecorationSet(newLocal.sort(byPos), children);
+ }
+ function moveSpans(spans, offset) {
+ if (!offset || !spans.length)
+ return spans;
+ let result = [];
+ for (let i2 = 0; i2 < spans.length; i2++) {
+ let span = spans[i2];
+ result.push(new Decoration(span.from + offset, span.to + offset, span.type));
+ }
+ return result;
+ }
+ function mapAndGatherRemainingDecorations(children, oldChildren, decorations, mapping, offset, oldOffset, options2) {
+ function gather(set, oldOffset2) {
+ for (let i2 = 0; i2 < set.local.length; i2++) {
+ let mapped = set.local[i2].map(mapping, offset, oldOffset2);
+ if (mapped)
+ decorations.push(mapped);
+ else if (options2.onRemove)
+ options2.onRemove(set.local[i2].spec);
+ }
+ for (let i2 = 0; i2 < set.children.length; i2 += 3)
+ gather(set.children[i2 + 2], set.children[i2] + oldOffset2 + 1);
+ }
+ for (let i2 = 0; i2 < children.length; i2 += 3)
+ if (children[i2 + 1] == -1)
+ gather(children[i2 + 2], oldChildren[i2] + oldOffset + 1);
+ return decorations;
+ }
+ function takeSpansForNode(spans, node2, offset) {
+ if (node2.isLeaf)
+ return null;
+ let end = offset + node2.nodeSize, found2 = null;
+ for (let i2 = 0, span; i2 < spans.length; i2++) {
+ if ((span = spans[i2]) && span.from > offset && span.to < end) {
+ (found2 || (found2 = [])).push(span);
+ spans[i2] = null;
+ }
+ }
+ return found2;
+ }
+ function withoutNulls(array) {
+ let result = [];
+ for (let i2 = 0; i2 < array.length; i2++)
+ if (array[i2] != null)
+ result.push(array[i2]);
+ return result;
+ }
+ function buildTree(spans, node2, offset, options2) {
+ let children = [], hasNulls = false;
+ node2.forEach((childNode, localStart) => {
+ let found2 = takeSpansForNode(spans, childNode, localStart + offset);
+ if (found2) {
+ hasNulls = true;
+ let subtree = buildTree(found2, childNode, offset + localStart + 1, options2);
+ if (subtree != empty2)
+ children.push(localStart, localStart + childNode.nodeSize, subtree);
+ }
+ });
+ let locals = moveSpans(hasNulls ? withoutNulls(spans) : spans, -offset).sort(byPos);
+ for (let i2 = 0; i2 < locals.length; i2++)
+ if (!locals[i2].type.valid(node2, locals[i2])) {
+ if (options2.onRemove)
+ options2.onRemove(locals[i2].spec);
+ locals.splice(i2--, 1);
+ }
+ return locals.length || children.length ? new DecorationSet(locals, children) : empty2;
+ }
+ function byPos(a2, b4) {
+ return a2.from - b4.from || a2.to - b4.to;
+ }
+ function removeOverlap(spans) {
+ let working = spans;
+ for (let i2 = 0; i2 < working.length - 1; i2++) {
+ let span = working[i2];
+ if (span.from != span.to)
+ for (let j6 = i2 + 1; j6 < working.length; j6++) {
+ let next = working[j6];
+ if (next.from == span.from) {
+ if (next.to != span.to) {
+ if (working == spans)
+ working = spans.slice();
+ working[j6] = next.copy(next.from, span.to);
+ insertAhead(working, j6 + 1, next.copy(span.to, next.to));
+ }
+ continue;
+ } else {
+ if (next.from < span.to) {
+ if (working == spans)
+ working = spans.slice();
+ working[i2] = span.copy(span.from, next.from);
+ insertAhead(working, j6, span.copy(next.from, span.to));
+ }
+ break;
+ }
+ }
+ }
+ return working;
+ }
+ function insertAhead(array, i2, deco) {
+ while (i2 < array.length && byPos(deco, array[i2]) > 0)
+ i2++;
+ array.splice(i2, 0, deco);
+ }
+ function viewDecorations(view) {
+ let found2 = [];
+ view.someProp("decorations", (f3) => {
+ let result = f3(view.state);
+ if (result && result != empty2)
+ found2.push(result);
+ });
+ if (view.cursorWrapper)
+ found2.push(DecorationSet.create(view.state.doc, [view.cursorWrapper.deco]));
+ return DecorationGroup.from(found2);
+ }
+ var observeOptions = {
+ childList: true,
+ characterData: true,
+ characterDataOldValue: true,
+ attributes: true,
+ attributeOldValue: true,
+ subtree: true
+ };
+ var useCharData = ie && ie_version <= 11;
+ var SelectionState = class {
+ constructor() {
+ this.anchorNode = null;
+ this.anchorOffset = 0;
+ this.focusNode = null;
+ this.focusOffset = 0;
+ }
+ set(sel) {
+ this.anchorNode = sel.anchorNode;
+ this.anchorOffset = sel.anchorOffset;
+ this.focusNode = sel.focusNode;
+ this.focusOffset = sel.focusOffset;
+ }
+ clear() {
+ this.anchorNode = this.focusNode = null;
+ }
+ eq(sel) {
+ return sel.anchorNode == this.anchorNode && sel.anchorOffset == this.anchorOffset && sel.focusNode == this.focusNode && sel.focusOffset == this.focusOffset;
+ }
+ };
+ var DOMObserver = class {
+ constructor(view, handleDOMChange) {
+ this.view = view;
+ this.handleDOMChange = handleDOMChange;
+ this.queue = [];
+ this.flushingSoon = -1;
+ this.observer = null;
+ this.currentSelection = new SelectionState();
+ this.onCharData = null;
+ this.suppressingSelectionUpdates = false;
+ this.observer = window.MutationObserver && new window.MutationObserver((mutations) => {
+ for (let i2 = 0; i2 < mutations.length; i2++)
+ this.queue.push(mutations[i2]);
+ if (ie && ie_version <= 11 && mutations.some((m3) => m3.type == "childList" && m3.removedNodes.length || m3.type == "characterData" && m3.oldValue.length > m3.target.nodeValue.length))
+ this.flushSoon();
+ else
+ this.flush();
+ });
+ if (useCharData) {
+ this.onCharData = (e2) => {
+ this.queue.push({ target: e2.target, type: "characterData", oldValue: e2.prevValue });
+ this.flushSoon();
+ };
+ }
+ this.onSelectionChange = this.onSelectionChange.bind(this);
+ }
+ flushSoon() {
+ if (this.flushingSoon < 0)
+ this.flushingSoon = window.setTimeout(() => {
+ this.flushingSoon = -1;
+ this.flush();
+ }, 20);
+ }
+ forceFlush() {
+ if (this.flushingSoon > -1) {
+ window.clearTimeout(this.flushingSoon);
+ this.flushingSoon = -1;
+ this.flush();
+ }
+ }
+ start() {
+ if (this.observer) {
+ this.observer.takeRecords();
+ this.observer.observe(this.view.dom, observeOptions);
+ }
+ if (this.onCharData)
+ this.view.dom.addEventListener("DOMCharacterDataModified", this.onCharData);
+ this.connectSelection();
+ }
+ stop() {
+ if (this.observer) {
+ let take = this.observer.takeRecords();
+ if (take.length) {
+ for (let i2 = 0; i2 < take.length; i2++)
+ this.queue.push(take[i2]);
+ window.setTimeout(() => this.flush(), 20);
+ }
+ this.observer.disconnect();
+ }
+ if (this.onCharData)
+ this.view.dom.removeEventListener("DOMCharacterDataModified", this.onCharData);
+ this.disconnectSelection();
+ }
+ connectSelection() {
+ this.view.dom.ownerDocument.addEventListener("selectionchange", this.onSelectionChange);
+ }
+ disconnectSelection() {
+ this.view.dom.ownerDocument.removeEventListener("selectionchange", this.onSelectionChange);
+ }
+ suppressSelectionUpdates() {
+ this.suppressingSelectionUpdates = true;
+ setTimeout(() => this.suppressingSelectionUpdates = false, 50);
+ }
+ onSelectionChange() {
+ if (!hasFocusAndSelection(this.view))
+ return;
+ if (this.suppressingSelectionUpdates)
+ return selectionToDOM(this.view);
+ if (ie && ie_version <= 11 && !this.view.state.selection.empty) {
+ let sel = this.view.domSelectionRange();
+ if (sel.focusNode && isEquivalentPosition(sel.focusNode, sel.focusOffset, sel.anchorNode, sel.anchorOffset))
+ return this.flushSoon();
+ }
+ this.flush();
+ }
+ setCurSelection() {
+ this.currentSelection.set(this.view.domSelectionRange());
+ }
+ ignoreSelectionChange(sel) {
+ if (!sel.focusNode)
+ return true;
+ let ancestors = /* @__PURE__ */ new Set(), container;
+ for (let scan = sel.focusNode; scan; scan = parentNode(scan))
+ ancestors.add(scan);
+ for (let scan = sel.anchorNode; scan; scan = parentNode(scan))
+ if (ancestors.has(scan)) {
+ container = scan;
+ break;
+ }
+ let desc = container && this.view.docView.nearestDesc(container);
+ if (desc && desc.ignoreMutation({
+ type: "selection",
+ target: container.nodeType == 3 ? container.parentNode : container
+ })) {
+ this.setCurSelection();
+ return true;
+ }
+ }
+ pendingRecords() {
+ if (this.observer)
+ for (let mut of this.observer.takeRecords())
+ this.queue.push(mut);
+ return this.queue;
+ }
+ flush() {
+ let { view } = this;
+ if (!view.docView || this.flushingSoon > -1)
+ return;
+ let mutations = this.pendingRecords();
+ if (mutations.length)
+ this.queue = [];
+ let sel = view.domSelectionRange();
+ let newSel = !this.suppressingSelectionUpdates && !this.currentSelection.eq(sel) && hasFocusAndSelection(view) && !this.ignoreSelectionChange(sel);
+ let from = -1, to = -1, typeOver = false, added = [];
+ if (view.editable) {
+ for (let i2 = 0; i2 < mutations.length; i2++) {
+ let result = this.registerMutation(mutations[i2], added);
+ if (result) {
+ from = from < 0 ? result.from : Math.min(result.from, from);
+ to = to < 0 ? result.to : Math.max(result.to, to);
+ if (result.typeOver)
+ typeOver = true;
+ }
+ }
+ }
+ if (gecko && added.length > 1) {
+ let brs = added.filter((n4) => n4.nodeName == "BR");
+ if (brs.length == 2) {
+ let a2 = brs[0], b4 = brs[1];
+ if (a2.parentNode && a2.parentNode.parentNode == b4.parentNode)
+ b4.remove();
+ else
+ a2.remove();
+ }
+ }
+ let readSel = null;
+ if (from < 0 && newSel && view.input.lastFocus > Date.now() - 200 && Math.max(view.input.lastTouch, view.input.lastClick.time) < Date.now() - 300 && selectionCollapsed(sel) && (readSel = selectionFromDOM(view)) && readSel.eq(Selection.near(view.state.doc.resolve(0), 1))) {
+ view.input.lastFocus = 0;
+ selectionToDOM(view);
+ this.currentSelection.set(sel);
+ view.scrollToSelection();
+ } else if (from > -1 || newSel) {
+ if (from > -1) {
+ view.docView.markDirty(from, to);
+ checkCSS(view);
+ }
+ this.handleDOMChange(from, to, typeOver, added);
+ if (view.docView && view.docView.dirty)
+ view.updateState(view.state);
+ else if (!this.currentSelection.eq(sel))
+ selectionToDOM(view);
+ this.currentSelection.set(sel);
+ }
+ }
+ registerMutation(mut, added) {
+ if (added.indexOf(mut.target) > -1)
+ return null;
+ let desc = this.view.docView.nearestDesc(mut.target);
+ if (mut.type == "attributes" && (desc == this.view.docView || mut.attributeName == "contenteditable" || // Firefox sometimes fires spurious events for null/empty styles
+ mut.attributeName == "style" && !mut.oldValue && !mut.target.getAttribute("style")))
+ return null;
+ if (!desc || desc.ignoreMutation(mut))
+ return null;
+ if (mut.type == "childList") {
+ for (let i2 = 0; i2 < mut.addedNodes.length; i2++)
+ added.push(mut.addedNodes[i2]);
+ if (desc.contentDOM && desc.contentDOM != desc.dom && !desc.contentDOM.contains(mut.target))
+ return { from: desc.posBefore, to: desc.posAfter };
+ let prev = mut.previousSibling, next = mut.nextSibling;
+ if (ie && ie_version <= 11 && mut.addedNodes.length) {
+ for (let i2 = 0; i2 < mut.addedNodes.length; i2++) {
+ let { previousSibling, nextSibling } = mut.addedNodes[i2];
+ if (!previousSibling || Array.prototype.indexOf.call(mut.addedNodes, previousSibling) < 0)
+ prev = previousSibling;
+ if (!nextSibling || Array.prototype.indexOf.call(mut.addedNodes, nextSibling) < 0)
+ next = nextSibling;
+ }
+ }
+ let fromOffset = prev && prev.parentNode == mut.target ? domIndex(prev) + 1 : 0;
+ let from = desc.localPosFromDOM(mut.target, fromOffset, -1);
+ let toOffset = next && next.parentNode == mut.target ? domIndex(next) : mut.target.childNodes.length;
+ let to = desc.localPosFromDOM(mut.target, toOffset, 1);
+ return { from, to };
+ } else if (mut.type == "attributes") {
+ return { from: desc.posAtStart - desc.border, to: desc.posAtEnd + desc.border };
+ } else {
+ return {
+ from: desc.posAtStart,
+ to: desc.posAtEnd,
+ // An event was generated for a text change that didn't change
+ // any text. Mark the dom change to fall back to assuming the
+ // selection was typed over with an identical value if it can't
+ // find another change.
+ typeOver: mut.target.nodeValue == mut.oldValue
+ };
+ }
+ }
+ };
+ var cssChecked = /* @__PURE__ */ new WeakMap();
+ var cssCheckWarned = false;
+ function checkCSS(view) {
+ if (cssChecked.has(view))
+ return;
+ cssChecked.set(view, null);
+ if (["normal", "nowrap", "pre-line"].indexOf(getComputedStyle(view.dom).whiteSpace) !== -1) {
+ view.requiresGeckoHackNode = gecko;
+ if (cssCheckWarned)
+ return;
+ console["warn"]("ProseMirror expects the CSS white-space property to be set, preferably to 'pre-wrap'. It is recommended to load style/prosemirror.css from the prosemirror-view package.");
+ cssCheckWarned = true;
+ }
+ }
+ function rangeToSelectionRange(view, range) {
+ let anchorNode = range.startContainer, anchorOffset = range.startOffset;
+ let focusNode = range.endContainer, focusOffset = range.endOffset;
+ let currentAnchor = view.domAtPos(view.state.selection.anchor);
+ if (isEquivalentPosition(currentAnchor.node, currentAnchor.offset, focusNode, focusOffset))
+ [anchorNode, anchorOffset, focusNode, focusOffset] = [focusNode, focusOffset, anchorNode, anchorOffset];
+ return { anchorNode, anchorOffset, focusNode, focusOffset };
+ }
+ function safariShadowSelectionRange(view, selection) {
+ if (selection.getComposedRanges) {
+ let range = selection.getComposedRanges(view.root)[0];
+ if (range)
+ return rangeToSelectionRange(view, range);
+ }
+ let found2;
+ function read(event) {
+ event.preventDefault();
+ event.stopImmediatePropagation();
+ found2 = event.getTargetRanges()[0];
+ }
+ view.dom.addEventListener("beforeinput", read, true);
+ document.execCommand("indent");
+ view.dom.removeEventListener("beforeinput", read, true);
+ return found2 ? rangeToSelectionRange(view, found2) : null;
+ }
+ function parseBetween(view, from_, to_) {
+ let { node: parent, fromOffset, toOffset, from, to } = view.docView.parseRange(from_, to_);
+ let domSel = view.domSelectionRange();
+ let find;
+ let anchor = domSel.anchorNode;
+ if (anchor && view.dom.contains(anchor.nodeType == 1 ? anchor : anchor.parentNode)) {
+ find = [{ node: anchor, offset: domSel.anchorOffset }];
+ if (!selectionCollapsed(domSel))
+ find.push({ node: domSel.focusNode, offset: domSel.focusOffset });
+ }
+ if (chrome && view.input.lastKeyCode === 8) {
+ for (let off = toOffset; off > fromOffset; off--) {
+ let node2 = parent.childNodes[off - 1], desc = node2.pmViewDesc;
+ if (node2.nodeName == "BR" && !desc) {
+ toOffset = off;
+ break;
+ }
+ if (!desc || desc.size)
+ break;
+ }
+ }
+ let startDoc = view.state.doc;
+ let parser = view.someProp("domParser") || DOMParser.fromSchema(view.state.schema);
+ let $from = startDoc.resolve(from);
+ let sel = null, doc4 = parser.parse(parent, {
+ topNode: $from.parent,
+ topMatch: $from.parent.contentMatchAt($from.index()),
+ topOpen: true,
+ from: fromOffset,
+ to: toOffset,
+ preserveWhitespace: $from.parent.type.whitespace == "pre" ? "full" : true,
+ findPositions: find,
+ ruleFromNode,
+ context: $from
+ });
+ if (find && find[0].pos != null) {
+ let anchor2 = find[0].pos, head = find[1] && find[1].pos;
+ if (head == null)
+ head = anchor2;
+ sel = { anchor: anchor2 + from, head: head + from };
+ }
+ return { doc: doc4, sel, from, to };
+ }
+ function ruleFromNode(dom) {
+ let desc = dom.pmViewDesc;
+ if (desc) {
+ return desc.parseRule();
+ } else if (dom.nodeName == "BR" && dom.parentNode) {
+ if (safari && /^(ul|ol)$/i.test(dom.parentNode.nodeName)) {
+ let skip = document.createElement("div");
+ skip.appendChild(document.createElement("li"));
+ return { skip };
+ } else if (dom.parentNode.lastChild == dom || safari && /^(tr|table)$/i.test(dom.parentNode.nodeName)) {
+ return { ignore: true };
+ }
+ } else if (dom.nodeName == "IMG" && dom.getAttribute("mark-placeholder")) {
+ return { ignore: true };
+ }
+ return null;
+ }
+ var isInline = /^(a|abbr|acronym|b|bd[io]|big|br|button|cite|code|data(list)?|del|dfn|em|i|ins|kbd|label|map|mark|meter|output|q|ruby|s|samp|small|span|strong|su[bp]|time|u|tt|var)$/i;
+ function readDOMChange(view, from, to, typeOver, addedNodes) {
+ let compositionID = view.input.compositionPendingChanges || (view.composing ? view.input.compositionID : 0);
+ view.input.compositionPendingChanges = 0;
+ if (from < 0) {
+ let origin = view.input.lastSelectionTime > Date.now() - 50 ? view.input.lastSelectionOrigin : null;
+ let newSel = selectionFromDOM(view, origin);
+ if (newSel && !view.state.selection.eq(newSel)) {
+ if (chrome && android && view.input.lastKeyCode === 13 && Date.now() - 100 < view.input.lastKeyCodeTime && view.someProp("handleKeyDown", (f3) => f3(view, keyEvent(13, "Enter"))))
+ return;
+ let tr2 = view.state.tr.setSelection(newSel);
+ if (origin == "pointer")
+ tr2.setMeta("pointer", true);
+ else if (origin == "key")
+ tr2.scrollIntoView();
+ if (compositionID)
+ tr2.setMeta("composition", compositionID);
+ view.dispatch(tr2);
+ }
+ return;
+ }
+ let $before = view.state.doc.resolve(from);
+ let shared = $before.sharedDepth(to);
+ from = $before.before(shared + 1);
+ to = view.state.doc.resolve(to).after(shared + 1);
+ let sel = view.state.selection;
+ let parse2 = parseBetween(view, from, to);
+ let doc4 = view.state.doc, compare = doc4.slice(parse2.from, parse2.to);
+ let preferredPos, preferredSide;
+ if (view.input.lastKeyCode === 8 && Date.now() - 100 < view.input.lastKeyCodeTime) {
+ preferredPos = view.state.selection.to;
+ preferredSide = "end";
+ } else {
+ preferredPos = view.state.selection.from;
+ preferredSide = "start";
+ }
+ view.input.lastKeyCode = null;
+ let change = findDiff(compare.content, parse2.doc.content, parse2.from, preferredPos, preferredSide);
+ if ((ios && view.input.lastIOSEnter > Date.now() - 225 || android) && addedNodes.some((n4) => n4.nodeType == 1 && !isInline.test(n4.nodeName)) && (!change || change.endA >= change.endB) && view.someProp("handleKeyDown", (f3) => f3(view, keyEvent(13, "Enter")))) {
+ view.input.lastIOSEnter = 0;
+ return;
+ }
+ if (!change) {
+ if (typeOver && sel instanceof TextSelection && !sel.empty && sel.$head.sameParent(sel.$anchor) && !view.composing && !(parse2.sel && parse2.sel.anchor != parse2.sel.head)) {
+ change = { start: sel.from, endA: sel.to, endB: sel.to };
+ } else {
+ if (parse2.sel) {
+ let sel2 = resolveSelection(view, view.state.doc, parse2.sel);
+ if (sel2 && !sel2.eq(view.state.selection)) {
+ let tr2 = view.state.tr.setSelection(sel2);
+ if (compositionID)
+ tr2.setMeta("composition", compositionID);
+ view.dispatch(tr2);
+ }
+ }
+ return;
+ }
+ }
+ view.input.domChangeCount++;
+ if (view.state.selection.from < view.state.selection.to && change.start == change.endB && view.state.selection instanceof TextSelection) {
+ if (change.start > view.state.selection.from && change.start <= view.state.selection.from + 2 && view.state.selection.from >= parse2.from) {
+ change.start = view.state.selection.from;
+ } else if (change.endA < view.state.selection.to && change.endA >= view.state.selection.to - 2 && view.state.selection.to <= parse2.to) {
+ change.endB += view.state.selection.to - change.endA;
+ change.endA = view.state.selection.to;
+ }
+ }
+ if (ie && ie_version <= 11 && change.endB == change.start + 1 && change.endA == change.start && change.start > parse2.from && parse2.doc.textBetween(change.start - parse2.from - 1, change.start - parse2.from + 1) == " \xA0") {
+ change.start--;
+ change.endA--;
+ change.endB--;
+ }
+ let $from = parse2.doc.resolveNoCache(change.start - parse2.from);
+ let $to = parse2.doc.resolveNoCache(change.endB - parse2.from);
+ let $fromA = doc4.resolve(change.start);
+ let inlineChange = $from.sameParent($to) && $from.parent.inlineContent && $fromA.end() >= change.endA;
+ let nextSel;
+ if ((ios && view.input.lastIOSEnter > Date.now() - 225 && (!inlineChange || addedNodes.some((n4) => n4.nodeName == "DIV" || n4.nodeName == "P")) || !inlineChange && $from.pos < parse2.doc.content.size && !$from.sameParent($to) && (nextSel = Selection.findFrom(parse2.doc.resolve($from.pos + 1), 1, true)) && nextSel.head == $to.pos) && view.someProp("handleKeyDown", (f3) => f3(view, keyEvent(13, "Enter")))) {
+ view.input.lastIOSEnter = 0;
+ return;
+ }
+ if (view.state.selection.anchor > change.start && looksLikeBackspace(doc4, change.start, change.endA, $from, $to) && view.someProp("handleKeyDown", (f3) => f3(view, keyEvent(8, "Backspace")))) {
+ if (android && chrome)
+ view.domObserver.suppressSelectionUpdates();
+ return;
+ }
+ if (chrome && android && change.endB == change.start)
+ view.input.lastAndroidDelete = Date.now();
+ if (android && !inlineChange && $from.start() != $to.start() && $to.parentOffset == 0 && $from.depth == $to.depth && parse2.sel && parse2.sel.anchor == parse2.sel.head && parse2.sel.head == change.endA) {
+ change.endB -= 2;
+ $to = parse2.doc.resolveNoCache(change.endB - parse2.from);
+ setTimeout(() => {
+ view.someProp("handleKeyDown", function(f3) {
+ return f3(view, keyEvent(13, "Enter"));
+ });
+ }, 20);
+ }
+ let chFrom = change.start, chTo = change.endA;
+ let tr, storedMarks, markChange;
+ if (inlineChange) {
+ if ($from.pos == $to.pos) {
+ if (ie && ie_version <= 11 && $from.parentOffset == 0) {
+ view.domObserver.suppressSelectionUpdates();
+ setTimeout(() => selectionToDOM(view), 20);
+ }
+ tr = view.state.tr.delete(chFrom, chTo);
+ storedMarks = doc4.resolve(change.start).marksAcross(doc4.resolve(change.endA));
+ } else if (
+ // Adding or removing a mark
+ change.endA == change.endB && (markChange = isMarkChange($from.parent.content.cut($from.parentOffset, $to.parentOffset), $fromA.parent.content.cut($fromA.parentOffset, change.endA - $fromA.start())))
+ ) {
+ tr = view.state.tr;
+ if (markChange.type == "add")
+ tr.addMark(chFrom, chTo, markChange.mark);
+ else
+ tr.removeMark(chFrom, chTo, markChange.mark);
+ } else if ($from.parent.child($from.index()).isText && $from.index() == $to.index() - ($to.textOffset ? 0 : 1)) {
+ let text5 = $from.parent.textBetween($from.parentOffset, $to.parentOffset);
+ if (view.someProp("handleTextInput", (f3) => f3(view, chFrom, chTo, text5)))
+ return;
+ tr = view.state.tr.insertText(text5, chFrom, chTo);
+ }
+ }
+ if (!tr)
+ tr = view.state.tr.replace(chFrom, chTo, parse2.doc.slice(change.start - parse2.from, change.endB - parse2.from));
+ if (parse2.sel) {
+ let sel2 = resolveSelection(view, tr.doc, parse2.sel);
+ if (sel2 && !(chrome && android && view.composing && sel2.empty && (change.start != change.endB || view.input.lastAndroidDelete < Date.now() - 100) && (sel2.head == chFrom || sel2.head == tr.mapping.map(chTo) - 1) || ie && sel2.empty && sel2.head == chFrom))
+ tr.setSelection(sel2);
+ }
+ if (storedMarks)
+ tr.ensureMarks(storedMarks);
+ if (compositionID)
+ tr.setMeta("composition", compositionID);
+ view.dispatch(tr.scrollIntoView());
+ }
+ function resolveSelection(view, doc4, parsedSel) {
+ if (Math.max(parsedSel.anchor, parsedSel.head) > doc4.content.size)
+ return null;
+ return selectionBetween(view, doc4.resolve(parsedSel.anchor), doc4.resolve(parsedSel.head));
+ }
+ function isMarkChange(cur, prev) {
+ let curMarks = cur.firstChild.marks, prevMarks = prev.firstChild.marks;
+ let added = curMarks, removed = prevMarks, type, mark, update;
+ for (let i2 = 0; i2 < prevMarks.length; i2++)
+ added = prevMarks[i2].removeFromSet(added);
+ for (let i2 = 0; i2 < curMarks.length; i2++)
+ removed = curMarks[i2].removeFromSet(removed);
+ if (added.length == 1 && removed.length == 0) {
+ mark = added[0];
+ type = "add";
+ update = (node2) => node2.mark(mark.addToSet(node2.marks));
+ } else if (added.length == 0 && removed.length == 1) {
+ mark = removed[0];
+ type = "remove";
+ update = (node2) => node2.mark(mark.removeFromSet(node2.marks));
+ } else {
+ return null;
+ }
+ let updated = [];
+ for (let i2 = 0; i2 < prev.childCount; i2++)
+ updated.push(update(prev.child(i2)));
+ if (Fragment.from(updated).eq(cur))
+ return { mark, type };
+ }
+ function looksLikeBackspace(old, start, end, $newStart, $newEnd) {
+ if (
+ // The content must have shrunk
+ end - start <= $newEnd.pos - $newStart.pos || // newEnd must point directly at or after the end of the block that newStart points into
+ skipClosingAndOpening($newStart, true, false) < $newEnd.pos
+ )
+ return false;
+ let $start = old.resolve(start);
+ if (!$newStart.parent.isTextblock) {
+ let after = $start.nodeAfter;
+ return after != null && end == start + after.nodeSize;
+ }
+ if ($start.parentOffset < $start.parent.content.size || !$start.parent.isTextblock)
+ return false;
+ let $next = old.resolve(skipClosingAndOpening($start, true, true));
+ if (!$next.parent.isTextblock || $next.pos > end || skipClosingAndOpening($next, true, false) < end)
+ return false;
+ return $newStart.parent.content.cut($newStart.parentOffset).eq($next.parent.content);
+ }
+ function skipClosingAndOpening($pos, fromEnd, mayOpen) {
+ let depth = $pos.depth, end = fromEnd ? $pos.end() : $pos.pos;
+ while (depth > 0 && (fromEnd || $pos.indexAfter(depth) == $pos.node(depth).childCount)) {
+ depth--;
+ end++;
+ fromEnd = false;
+ }
+ if (mayOpen) {
+ let next = $pos.node(depth).maybeChild($pos.indexAfter(depth));
+ while (next && !next.isLeaf) {
+ next = next.firstChild;
+ end++;
+ }
+ }
+ return end;
+ }
+ function findDiff(a2, b4, pos, preferredPos, preferredSide) {
+ let start = a2.findDiffStart(b4, pos);
+ if (start == null)
+ return null;
+ let { a: endA, b: endB } = a2.findDiffEnd(b4, pos + a2.size, pos + b4.size);
+ if (preferredSide == "end") {
+ let adjust = Math.max(0, start - Math.min(endA, endB));
+ preferredPos -= endA + adjust - start;
+ }
+ if (endA < start && a2.size < b4.size) {
+ let move = preferredPos <= start && preferredPos >= endA ? start - preferredPos : 0;
+ start -= move;
+ if (start && start < b4.size && isSurrogatePair(b4.textBetween(start - 1, start + 1)))
+ start += move ? 1 : -1;
+ endB = start + (endB - endA);
+ endA = start;
+ } else if (endB < start) {
+ let move = preferredPos <= start && preferredPos >= endB ? start - preferredPos : 0;
+ start -= move;
+ if (start && start < a2.size && isSurrogatePair(a2.textBetween(start - 1, start + 1)))
+ start += move ? 1 : -1;
+ endA = start + (endA - endB);
+ endB = start;
+ }
+ return { start, endA, endB };
+ }
+ function isSurrogatePair(str) {
+ if (str.length != 2)
+ return false;
+ let a2 = str.charCodeAt(0), b4 = str.charCodeAt(1);
+ return a2 >= 56320 && a2 <= 57343 && b4 >= 55296 && b4 <= 56319;
+ }
+ var EditorView = class {
+ /**
+ Create a view. `place` may be a DOM node that the editor should
+ be appended to, a function that will place it into the document,
+ or an object whose `mount` property holds the node to use as the
+ document container. If it is `null`, the editor will not be
+ added to the document.
+ */
+ constructor(place, props) {
+ this._root = null;
+ this.focused = false;
+ this.trackWrites = null;
+ this.mounted = false;
+ this.markCursor = null;
+ this.cursorWrapper = null;
+ this.lastSelectedViewDesc = void 0;
+ this.input = new InputState();
+ this.prevDirectPlugins = [];
+ this.pluginViews = [];
+ this.requiresGeckoHackNode = false;
+ this.dragging = null;
+ this._props = props;
+ this.state = props.state;
+ this.directPlugins = props.plugins || [];
+ this.directPlugins.forEach(checkStateComponent);
+ this.dispatch = this.dispatch.bind(this);
+ this.dom = place && place.mount || document.createElement("div");
+ if (place) {
+ if (place.appendChild)
+ place.appendChild(this.dom);
+ else if (typeof place == "function")
+ place(this.dom);
+ else if (place.mount)
+ this.mounted = true;
+ }
+ this.editable = getEditable(this);
+ updateCursorWrapper(this);
+ this.nodeViews = buildNodeViews(this);
+ this.docView = docViewDesc(this.state.doc, computeDocDeco(this), viewDecorations(this), this.dom, this);
+ this.domObserver = new DOMObserver(this, (from, to, typeOver, added) => readDOMChange(this, from, to, typeOver, added));
+ this.domObserver.start();
+ initInput(this);
+ this.updatePluginViews();
+ }
+ /**
+ Holds `true` when a
+ [composition](https://w3c.github.io/uievents/#events-compositionevents)
+ is active.
+ */
+ get composing() {
+ return this.input.composing;
+ }
+ /**
+ The view's current [props](https://prosemirror.net/docs/ref/#view.EditorProps).
+ */
+ get props() {
+ if (this._props.state != this.state) {
+ let prev = this._props;
+ this._props = {};
+ for (let name in prev)
+ this._props[name] = prev[name];
+ this._props.state = this.state;
+ }
+ return this._props;
+ }
+ /**
+ Update the view's props. Will immediately cause an update to
+ the DOM.
+ */
+ update(props) {
+ if (props.handleDOMEvents != this._props.handleDOMEvents)
+ ensureListeners(this);
+ let prevProps = this._props;
+ this._props = props;
+ if (props.plugins) {
+ props.plugins.forEach(checkStateComponent);
+ this.directPlugins = props.plugins;
+ }
+ this.updateStateInner(props.state, prevProps);
+ }
+ /**
+ Update the view by updating existing props object with the object
+ given as argument. Equivalent to `view.update(Object.assign({},
+ view.props, props))`.
+ */
+ setProps(props) {
+ let updated = {};
+ for (let name in this._props)
+ updated[name] = this._props[name];
+ updated.state = this.state;
+ for (let name in props)
+ updated[name] = props[name];
+ this.update(updated);
+ }
+ /**
+ Update the editor's `state` prop, without touching any of the
+ other props.
+ */
+ updateState(state) {
+ this.updateStateInner(state, this._props);
+ }
+ updateStateInner(state, prevProps) {
+ var _a;
+ let prev = this.state, redraw = false, updateSel = false;
+ if (state.storedMarks && this.composing) {
+ clearComposition(this);
+ updateSel = true;
+ }
+ this.state = state;
+ let pluginsChanged = prev.plugins != state.plugins || this._props.plugins != prevProps.plugins;
+ if (pluginsChanged || this._props.plugins != prevProps.plugins || this._props.nodeViews != prevProps.nodeViews) {
+ let nodeViews = buildNodeViews(this);
+ if (changedNodeViews(nodeViews, this.nodeViews)) {
+ this.nodeViews = nodeViews;
+ redraw = true;
+ }
+ }
+ if (pluginsChanged || prevProps.handleDOMEvents != this._props.handleDOMEvents) {
+ ensureListeners(this);
+ }
+ this.editable = getEditable(this);
+ updateCursorWrapper(this);
+ let innerDeco = viewDecorations(this), outerDeco = computeDocDeco(this);
+ let scroll = prev.plugins != state.plugins && !prev.doc.eq(state.doc) ? "reset" : state.scrollToSelection > prev.scrollToSelection ? "to selection" : "preserve";
+ let updateDoc = redraw || !this.docView.matchesNode(state.doc, outerDeco, innerDeco);
+ if (updateDoc || !state.selection.eq(prev.selection))
+ updateSel = true;
+ let oldScrollPos = scroll == "preserve" && updateSel && this.dom.style.overflowAnchor == null && storeScrollPos(this);
+ if (updateSel) {
+ this.domObserver.stop();
+ let forceSelUpdate = updateDoc && (ie || chrome) && !this.composing && !prev.selection.empty && !state.selection.empty && selectionContextChanged(prev.selection, state.selection);
+ if (updateDoc) {
+ let chromeKludge = chrome ? this.trackWrites = this.domSelectionRange().focusNode : null;
+ if (this.composing)
+ this.input.compositionNode = findCompositionNode(this);
+ if (redraw || !this.docView.update(state.doc, outerDeco, innerDeco, this)) {
+ this.docView.updateOuterDeco(outerDeco);
+ this.docView.destroy();
+ this.docView = docViewDesc(state.doc, outerDeco, innerDeco, this.dom, this);
+ }
+ if (chromeKludge && !this.trackWrites)
+ forceSelUpdate = true;
+ }
+ if (forceSelUpdate || !(this.input.mouseDown && this.domObserver.currentSelection.eq(this.domSelectionRange()) && anchorInRightPlace(this))) {
+ selectionToDOM(this, forceSelUpdate);
+ } else {
+ syncNodeSelection(this, state.selection);
+ this.domObserver.setCurSelection();
+ }
+ this.domObserver.start();
+ }
+ this.updatePluginViews(prev);
+ if (((_a = this.dragging) === null || _a === void 0 ? void 0 : _a.node) && !prev.doc.eq(state.doc))
+ this.updateDraggedNode(this.dragging, prev);
+ if (scroll == "reset") {
+ this.dom.scrollTop = 0;
+ } else if (scroll == "to selection") {
+ this.scrollToSelection();
+ } else if (oldScrollPos) {
+ resetScrollPos(oldScrollPos);
+ }
+ }
+ /**
+ @internal
+ */
+ scrollToSelection() {
+ let startDOM = this.domSelectionRange().focusNode;
+ if (this.someProp("handleScrollToSelection", (f3) => f3(this))) ;
+ else if (this.state.selection instanceof NodeSelection) {
+ let target = this.docView.domAfterPos(this.state.selection.from);
+ if (target.nodeType == 1)
+ scrollRectIntoView(this, target.getBoundingClientRect(), startDOM);
+ } else {
+ scrollRectIntoView(this, this.coordsAtPos(this.state.selection.head, 1), startDOM);
+ }
+ }
+ destroyPluginViews() {
+ let view;
+ while (view = this.pluginViews.pop())
+ if (view.destroy)
+ view.destroy();
+ }
+ updatePluginViews(prevState) {
+ if (!prevState || prevState.plugins != this.state.plugins || this.directPlugins != this.prevDirectPlugins) {
+ this.prevDirectPlugins = this.directPlugins;
+ this.destroyPluginViews();
+ for (let i2 = 0; i2 < this.directPlugins.length; i2++) {
+ let plugin = this.directPlugins[i2];
+ if (plugin.spec.view)
+ this.pluginViews.push(plugin.spec.view(this));
+ }
+ for (let i2 = 0; i2 < this.state.plugins.length; i2++) {
+ let plugin = this.state.plugins[i2];
+ if (plugin.spec.view)
+ this.pluginViews.push(plugin.spec.view(this));
+ }
+ } else {
+ for (let i2 = 0; i2 < this.pluginViews.length; i2++) {
+ let pluginView = this.pluginViews[i2];
+ if (pluginView.update)
+ pluginView.update(this, prevState);
+ }
+ }
+ }
+ updateDraggedNode(dragging, prev) {
+ let sel = dragging.node, found2 = -1;
+ if (this.state.doc.nodeAt(sel.from) == sel.node) {
+ found2 = sel.from;
+ } else {
+ let movedPos = sel.from + (this.state.doc.content.size - prev.doc.content.size);
+ let moved = movedPos > 0 && this.state.doc.nodeAt(movedPos);
+ if (moved == sel.node)
+ found2 = movedPos;
+ }
+ this.dragging = new Dragging(dragging.slice, dragging.move, found2 < 0 ? void 0 : NodeSelection.create(this.state.doc, found2));
+ }
+ someProp(propName, f3) {
+ let prop = this._props && this._props[propName], value;
+ if (prop != null && (value = f3 ? f3(prop) : prop))
+ return value;
+ for (let i2 = 0; i2 < this.directPlugins.length; i2++) {
+ let prop2 = this.directPlugins[i2].props[propName];
+ if (prop2 != null && (value = f3 ? f3(prop2) : prop2))
+ return value;
+ }
+ let plugins = this.state.plugins;
+ if (plugins)
+ for (let i2 = 0; i2 < plugins.length; i2++) {
+ let prop2 = plugins[i2].props[propName];
+ if (prop2 != null && (value = f3 ? f3(prop2) : prop2))
+ return value;
+ }
+ }
+ /**
+ Query whether the view has focus.
+ */
+ hasFocus() {
+ if (ie) {
+ let node2 = this.root.activeElement;
+ if (node2 == this.dom)
+ return true;
+ if (!node2 || !this.dom.contains(node2))
+ return false;
+ while (node2 && this.dom != node2 && this.dom.contains(node2)) {
+ if (node2.contentEditable == "false")
+ return false;
+ node2 = node2.parentElement;
+ }
+ return true;
+ }
+ return this.root.activeElement == this.dom;
+ }
+ /**
+ Focus the editor.
+ */
+ focus() {
+ this.domObserver.stop();
+ if (this.editable)
+ focusPreventScroll(this.dom);
+ selectionToDOM(this);
+ this.domObserver.start();
+ }
+ /**
+ Get the document root in which the editor exists. This will
+ usually be the top-level `document`, but might be a [shadow
+ DOM](https://developer.mozilla.org/en-US/docs/Web/Web_Components/Shadow_DOM)
+ root if the editor is inside one.
+ */
+ get root() {
+ let cached = this._root;
+ if (cached == null)
+ for (let search2 = this.dom.parentNode; search2; search2 = search2.parentNode) {
+ if (search2.nodeType == 9 || search2.nodeType == 11 && search2.host) {
+ if (!search2.getSelection)
+ Object.getPrototypeOf(search2).getSelection = () => search2.ownerDocument.getSelection();
+ return this._root = search2;
+ }
+ }
+ return cached || document;
+ }
+ /**
+ When an existing editor view is moved to a new document or
+ shadow tree, call this to make it recompute its root.
+ */
+ updateRoot() {
+ this._root = null;
+ }
+ /**
+ Given a pair of viewport coordinates, return the document
+ position that corresponds to them. May return null if the given
+ coordinates aren't inside of the editor. When an object is
+ returned, its `pos` property is the position nearest to the
+ coordinates, and its `inside` property holds the position of the
+ inner node that the position falls inside of, or -1 if it is at
+ the top level, not in any node.
+ */
+ posAtCoords(coords) {
+ return posAtCoords(this, coords);
+ }
+ /**
+ Returns the viewport rectangle at a given document position.
+ `left` and `right` will be the same number, as this returns a
+ flat cursor-ish rectangle. If the position is between two things
+ that aren't directly adjacent, `side` determines which element
+ is used. When < 0, the element before the position is used,
+ otherwise the element after.
+ */
+ coordsAtPos(pos, side = 1) {
+ return coordsAtPos(this, pos, side);
+ }
+ /**
+ Find the DOM position that corresponds to the given document
+ position. When `side` is negative, find the position as close as
+ possible to the content before the position. When positive,
+ prefer positions close to the content after the position. When
+ zero, prefer as shallow a position as possible.
+
+ Note that you should **not** mutate the editor's internal DOM,
+ only inspect it (and even that is usually not necessary).
+ */
+ domAtPos(pos, side = 0) {
+ return this.docView.domFromPos(pos, side);
+ }
+ /**
+ Find the DOM node that represents the document node after the
+ given position. May return `null` when the position doesn't point
+ in front of a node or if the node is inside an opaque node view.
+
+ This is intended to be able to call things like
+ `getBoundingClientRect` on that DOM node. Do **not** mutate the
+ editor DOM directly, or add styling this way, since that will be
+ immediately overriden by the editor as it redraws the node.
+ */
+ nodeDOM(pos) {
+ let desc = this.docView.descAt(pos);
+ return desc ? desc.nodeDOM : null;
+ }
+ /**
+ Find the document position that corresponds to a given DOM
+ position. (Whenever possible, it is preferable to inspect the
+ document structure directly, rather than poking around in the
+ DOM, but sometimes—for example when interpreting an event
+ target—you don't have a choice.)
+
+ The `bias` parameter can be used to influence which side of a DOM
+ node to use when the position is inside a leaf node.
+ */
+ posAtDOM(node2, offset, bias = -1) {
+ let pos = this.docView.posFromDOM(node2, offset, bias);
+ if (pos == null)
+ throw new RangeError("DOM position not inside the editor");
+ return pos;
+ }
+ /**
+ Find out whether the selection is at the end of a textblock when
+ moving in a given direction. When, for example, given `"left"`,
+ it will return true if moving left from the current cursor
+ position would leave that position's parent textblock. Will apply
+ to the view's current state by default, but it is possible to
+ pass a different state.
+ */
+ endOfTextblock(dir, state) {
+ return endOfTextblock(this, state || this.state, dir);
+ }
+ /**
+ Run the editor's paste logic with the given HTML string. The
+ `event`, if given, will be passed to the
+ [`handlePaste`](https://prosemirror.net/docs/ref/#view.EditorProps.handlePaste) hook.
+ */
+ pasteHTML(html3, event) {
+ return doPaste(this, "", html3, false, event || new ClipboardEvent("paste"));
+ }
+ /**
+ Run the editor's paste logic with the given plain-text input.
+ */
+ pasteText(text5, event) {
+ return doPaste(this, text5, null, true, event || new ClipboardEvent("paste"));
+ }
+ /**
+ Removes the editor from the DOM and destroys all [node
+ views](https://prosemirror.net/docs/ref/#view.NodeView).
+ */
+ destroy() {
+ if (!this.docView)
+ return;
+ destroyInput(this);
+ this.destroyPluginViews();
+ if (this.mounted) {
+ this.docView.update(this.state.doc, [], viewDecorations(this), this);
+ this.dom.textContent = "";
+ } else if (this.dom.parentNode) {
+ this.dom.parentNode.removeChild(this.dom);
+ }
+ this.docView.destroy();
+ this.docView = null;
+ clearReusedRange();
+ }
+ /**
+ This is true when the view has been
+ [destroyed](https://prosemirror.net/docs/ref/#view.EditorView.destroy) (and thus should not be
+ used anymore).
+ */
+ get isDestroyed() {
+ return this.docView == null;
+ }
+ /**
+ Used for testing.
+ */
+ dispatchEvent(event) {
+ return dispatchEvent2(this, event);
+ }
+ /**
+ Dispatch a transaction. Will call
+ [`dispatchTransaction`](https://prosemirror.net/docs/ref/#view.DirectEditorProps.dispatchTransaction)
+ when given, and otherwise defaults to applying the transaction to
+ the current state and calling
+ [`updateState`](https://prosemirror.net/docs/ref/#view.EditorView.updateState) with the result.
+ This method is bound to the view instance, so that it can be
+ easily passed around.
+ */
+ dispatch(tr) {
+ let dispatchTransaction = this._props.dispatchTransaction;
+ if (dispatchTransaction)
+ dispatchTransaction.call(this, tr);
+ else
+ this.updateState(this.state.apply(tr));
+ }
+ /**
+ @internal
+ */
+ domSelectionRange() {
+ let sel = this.domSelection();
+ return safari && this.root.nodeType === 11 && deepActiveElement(this.dom.ownerDocument) == this.dom && safariShadowSelectionRange(this, sel) || sel;
+ }
+ /**
+ @internal
+ */
+ domSelection() {
+ return this.root.getSelection();
+ }
+ };
+ function computeDocDeco(view) {
+ let attrs = /* @__PURE__ */ Object.create(null);
+ attrs.class = "ProseMirror";
+ attrs.contenteditable = String(view.editable);
+ view.someProp("attributes", (value) => {
+ if (typeof value == "function")
+ value = value(view.state);
+ if (value)
+ for (let attr in value) {
+ if (attr == "class")
+ attrs.class += " " + value[attr];
+ else if (attr == "style")
+ attrs.style = (attrs.style ? attrs.style + ";" : "") + value[attr];
+ else if (!attrs[attr] && attr != "contenteditable" && attr != "nodeName")
+ attrs[attr] = String(value[attr]);
+ }
+ });
+ if (!attrs.translate)
+ attrs.translate = "no";
+ return [Decoration.node(0, view.state.doc.content.size, attrs)];
+ }
+ function updateCursorWrapper(view) {
+ if (view.markCursor) {
+ let dom = document.createElement("img");
+ dom.className = "ProseMirror-separator";
+ dom.setAttribute("mark-placeholder", "true");
+ dom.setAttribute("alt", "");
+ view.cursorWrapper = { dom, deco: Decoration.widget(view.state.selection.head, dom, { raw: true, marks: view.markCursor }) };
+ } else {
+ view.cursorWrapper = null;
+ }
+ }
+ function getEditable(view) {
+ return !view.someProp("editable", (value) => value(view.state) === false);
+ }
+ function selectionContextChanged(sel1, sel2) {
+ let depth = Math.min(sel1.$anchor.sharedDepth(sel1.head), sel2.$anchor.sharedDepth(sel2.head));
+ return sel1.$anchor.start(depth) != sel2.$anchor.start(depth);
+ }
+ function buildNodeViews(view) {
+ let result = /* @__PURE__ */ Object.create(null);
+ function add(obj) {
+ for (let prop in obj)
+ if (!Object.prototype.hasOwnProperty.call(result, prop))
+ result[prop] = obj[prop];
+ }
+ view.someProp("nodeViews", add);
+ view.someProp("markViews", add);
+ return result;
+ }
+ function changedNodeViews(a2, b4) {
+ let nA = 0, nB = 0;
+ for (let prop in a2) {
+ if (a2[prop] != b4[prop])
+ return true;
+ nA++;
+ }
+ for (let _3 in b4)
+ nB++;
+ return nA != nB;
+ }
+ function checkStateComponent(plugin) {
+ if (plugin.spec.state || plugin.spec.filterTransaction || plugin.spec.appendTransaction)
+ throw new RangeError("Plugins passed directly to the view must not have a state component");
+ }
+
+ // node_modules/prosemirror-inputrules/dist/index.js
+ var InputRule = class {
+ // :: (RegExp, union)
+ /**
+ Create an input rule. The rule applies when the user typed
+ something and the text directly in front of the cursor matches
+ `match`, which should end with `$`.
+
+ The `handler` can be a string, in which case the matched text, or
+ the first matched group in the regexp, is replaced by that
+ string.
+
+ Or a it can be a function, which will be called with the match
+ array produced by
+ [`RegExp.exec`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/RegExp/exec),
+ as well as the start and end of the matched range, and which can
+ return a [transaction](https://prosemirror.net/docs/ref/#state.Transaction) that describes the
+ rule's effect, or null to indicate the input was not handled.
+ */
+ constructor(match, handler, options2 = {}) {
+ this.match = match;
+ this.match = match;
+ this.handler = typeof handler == "string" ? stringHandler(handler) : handler;
+ this.undoable = options2.undoable !== false;
+ this.inCode = options2.inCode || false;
+ }
+ };
+ function stringHandler(string3) {
+ return function(state, match, start, end) {
+ let insert = string3;
+ if (match[1]) {
+ let offset = match[0].lastIndexOf(match[1]);
+ insert += match[0].slice(offset + match[1].length);
+ start += offset;
+ let cutOff = start - end;
+ if (cutOff > 0) {
+ insert = match[0].slice(offset - cutOff, offset) + insert;
+ start = end;
+ }
+ }
+ return state.tr.insertText(insert, start, end);
+ };
+ }
+ var undoInputRule = (state, dispatch) => {
+ let plugins = state.plugins;
+ for (let i2 = 0; i2 < plugins.length; i2++) {
+ let plugin = plugins[i2], undoable;
+ if (plugin.spec.isInputRules && (undoable = plugin.getState(state))) {
+ if (dispatch) {
+ let tr = state.tr, toUndo = undoable.transform;
+ for (let j6 = toUndo.steps.length - 1; j6 >= 0; j6--)
+ tr.step(toUndo.steps[j6].invert(toUndo.docs[j6]));
+ if (undoable.text) {
+ let marks = tr.doc.resolve(undoable.from).marks();
+ tr.replaceWith(undoable.from, undoable.to, state.schema.text(undoable.text, marks));
+ } else {
+ tr.delete(undoable.from, undoable.to);
+ }
+ dispatch(tr);
+ }
+ return true;
+ }
+ }
+ return false;
+ };
+ var emDash = new InputRule(/--$/, "\u2014");
+ var ellipsis = new InputRule(/\.\.\.$/, "\u2026");
+ var openDoubleQuote = new InputRule(/(?:^|[\s\{\[\(\<'"\u2018\u201C])(")$/, "\u201C");
+ var closeDoubleQuote = new InputRule(/"$/, "\u201D");
+ var openSingleQuote = new InputRule(/(?:^|[\s\{\[\(\<'"\u2018\u201C])(')$/, "\u2018");
+ var closeSingleQuote = new InputRule(/'$/, "\u2019");
+ function wrappingInputRule(regexp, nodeType, getAttrs = null, joinPredicate) {
+ return new InputRule(regexp, (state, match, start, end) => {
+ let attrs = getAttrs instanceof Function ? getAttrs(match) : getAttrs;
+ let tr = state.tr.delete(start, end);
+ let $start = tr.doc.resolve(start), range = $start.blockRange(), wrapping = range && findWrapping(range, nodeType, attrs);
+ if (!wrapping)
+ return null;
+ tr.wrap(range, wrapping);
+ let before = tr.doc.resolve(start - 1).nodeBefore;
+ if (before && before.type == nodeType && canJoin(tr.doc, start - 1) && (!joinPredicate || joinPredicate(match, before)))
+ tr.join(start - 1);
+ return tr;
+ });
+ }
+ function textblockTypeInputRule(regexp, nodeType, getAttrs = null) {
+ return new InputRule(regexp, (state, match, start, end) => {
+ let $start = state.doc.resolve(start);
+ let attrs = getAttrs instanceof Function ? getAttrs(match) : getAttrs;
+ if (!$start.node(-1).canReplaceWith($start.index(-1), $start.indexAfter(-1), nodeType))
+ return null;
+ return state.tr.delete(start, end).setBlockType(start, start, nodeType, attrs);
+ });
+ }
+
+ // node_modules/@milkdown/prose/lib/index.js
+ var nav2 = typeof navigator != "undefined" ? navigator : null;
+ var doc3 = typeof document != "undefined" ? document : null;
+ var agent2 = nav2 && nav2.userAgent || "";
+ var ie_edge2 = /Edge\/(\d+)/.exec(agent2);
+ var ie_upto102 = /MSIE \d/.exec(agent2);
+ var ie_11up2 = /Trident\/(?:[7-9]|\d{2,})\..*rv:(\d+)/.exec(agent2);
+ var ie2 = !!(ie_upto102 || ie_11up2 || ie_edge2);
+ var ie_version2 = ie_upto102 ? document.documentMode : ie_11up2 ? +ie_11up2[1] : ie_edge2 ? +ie_edge2[1] : 0;
+ var gecko2 = !ie2 && /gecko\/(\d+)/i.test(agent2);
+ var gecko_version = gecko2 && +(/Firefox\/(\d+)/.exec(agent2) || [0, 0])[1];
+ var _chrome2 = !ie2 && /Chrome\/(\d+)/.exec(agent2);
+ var chrome2 = !!_chrome2;
+ var chrome_version2 = _chrome2 ? +_chrome2[1] : 0;
+ var safari2 = !ie2 && !!nav2 && /Apple Computer/.test(nav2.vendor);
+ var ios2 = safari2 && (/Mobile\/\w+/.test(agent2) || !!nav2 && nav2.maxTouchPoints > 2);
+ var mac2 = ios2 || (nav2 ? /Mac/.test(nav2.platform) : false);
+ var android2 = /Android \d/.test(agent2);
+ var webkit2 = !!doc3 && "webkitFontSmoothing" in doc3.documentElement.style;
+ var webkit_version2 = webkit2 ? +(/\bAppleWebKit\/(\d+)/.exec(navigator.userAgent) || [0, 0])[1] : 0;
+ var browser = /* @__PURE__ */ Object.freeze({
+ __proto__: null,
+ android: android2,
+ chrome: chrome2,
+ chrome_version: chrome_version2,
+ gecko: gecko2,
+ gecko_version,
+ ie: ie2,
+ ie_version: ie_version2,
+ ios: ios2,
+ mac: mac2,
+ safari: safari2,
+ webkit: webkit2,
+ webkit_version: webkit_version2
+ });
+ function run(view, from, to, text5, rules, plugin) {
+ if (view.composing)
+ return false;
+ const state = view.state;
+ const $from = state.doc.resolve(from);
+ if ($from.parent.type.spec.code)
+ return false;
+ const textBefore = $from.parent.textBetween(Math.max(0, $from.parentOffset - 500), $from.parentOffset, void 0, "\uFFFC") + text5;
+ for (let i2 = 0; i2 < rules.length; i2++) {
+ const match = rules[i2].match.exec(textBefore);
+ const tr = match && match[0] && rules[i2].handler(state, match, from - (match[0].length - text5.length), to);
+ if (!tr)
+ continue;
+ view.dispatch(tr.setMeta(plugin, { transform: tr, from, to, text: text5 }));
+ return true;
+ }
+ return false;
+ }
+ var customInputRulesKey = new PluginKey("MILKDOWN_CUSTOM_INPUTRULES");
+ function customInputRules({ rules }) {
+ const plugin = new Plugin({
+ key: customInputRulesKey,
+ isInputRules: true,
+ state: {
+ init() {
+ return null;
+ },
+ apply(tr, prev) {
+ const stored = tr.getMeta(this);
+ if (stored)
+ return stored;
+ return tr.selectionSet || tr.docChanged ? null : prev;
+ }
+ },
+ props: {
+ handleTextInput(view, from, to, text5) {
+ return run(view, from, to, text5, rules, plugin);
+ },
+ handleDOMEvents: {
+ compositionend: (view) => {
+ setTimeout(() => {
+ const { $cursor } = view.state.selection;
+ if ($cursor)
+ run(view, $cursor.pos, $cursor.pos, "", rules, plugin);
+ });
+ return false;
+ }
+ },
+ handleKeyDown(view, event) {
+ if (event.key !== "Enter")
+ return false;
+ const { $cursor } = view.state.selection;
+ if ($cursor)
+ return run(view, $cursor.pos, $cursor.pos, "\n", rules, plugin);
+ return false;
+ }
+ }
+ });
+ return plugin;
+ }
+ function markRule(regexp, markType, options2 = {}) {
+ return new InputRule(regexp, (state, match, start, end) => {
+ var _a, _b, _c, _d;
+ const { tr } = state;
+ const matchLength = match.length;
+ let group = match[matchLength - 1];
+ let fullMatch = match[0];
+ let initialStoredMarks = [];
+ let markEnd = end;
+ const captured = {
+ group,
+ fullMatch,
+ start,
+ end
+ };
+ const result = (_a = options2.updateCaptured) == null ? void 0 : _a.call(options2, captured);
+ Object.assign(captured, result);
+ ({ group, fullMatch, start, end } = captured);
+ if (fullMatch === null)
+ return null;
+ if ((group == null ? void 0 : group.trim()) === "")
+ return null;
+ if (group) {
+ const startSpaces = fullMatch.search(/\S/);
+ const textStart = start + fullMatch.indexOf(group);
+ const textEnd = textStart + group.length;
+ initialStoredMarks = (_b = tr.storedMarks) != null ? _b : [];
+ if (textEnd < end)
+ tr.delete(textEnd, end);
+ if (textStart > start)
+ tr.delete(start + startSpaces, textStart);
+ markEnd = start + startSpaces + group.length;
+ const attrs = (_c = options2.getAttr) == null ? void 0 : _c.call(options2, match);
+ tr.addMark(start, markEnd, markType.create(attrs));
+ tr.setStoredMarks(initialStoredMarks);
+ (_d = options2.beforeDispatch) == null ? void 0 : _d.call(options2, { match, start, end, tr });
+ }
+ return tr;
+ });
+ }
+ function cloneTr(tr) {
+ return Object.assign(Object.create(tr), tr).setTime(Date.now());
+ }
+ function equalNodeType(nodeType, node2) {
+ return Array.isArray(nodeType) && nodeType.includes(node2.type) || node2.type === nodeType;
+ }
+ function findParentNodeClosestToPos(predicate) {
+ return ($pos) => {
+ for (let i2 = $pos.depth; i2 > 0; i2--) {
+ const node2 = $pos.node(i2);
+ if (predicate(node2)) {
+ return {
+ pos: i2 > 0 ? $pos.before(i2) : 0,
+ start: $pos.start(i2),
+ depth: i2,
+ node: node2
+ };
+ }
+ }
+ return void 0;
+ };
+ }
+ function findParentNode(predicate) {
+ return (selection) => {
+ return findParentNodeClosestToPos(predicate)(selection.$from);
+ };
+ }
+ function findSelectedNodeOfType(selection, nodeType) {
+ if (!(selection instanceof NodeSelection))
+ return;
+ const { node: node2, $from } = selection;
+ if (equalNodeType(nodeType, node2))
+ return { node: node2, pos: $from.pos, start: $from.start($from.depth), depth: $from.depth };
+ return void 0;
+ }
+
+ // node_modules/prosemirror-commands/dist/index.js
+ var deleteSelection = (state, dispatch) => {
+ if (state.selection.empty)
+ return false;
+ if (dispatch)
+ dispatch(state.tr.deleteSelection().scrollIntoView());
+ return true;
+ };
+ function atBlockStart(state, view) {
+ let { $cursor } = state.selection;
+ if (!$cursor || (view ? !view.endOfTextblock("backward", state) : $cursor.parentOffset > 0))
+ return null;
+ return $cursor;
+ }
+ var joinBackward = (state, dispatch, view) => {
+ let $cursor = atBlockStart(state, view);
+ if (!$cursor)
+ return false;
+ let $cut = findCutBefore($cursor);
+ if (!$cut) {
+ let range = $cursor.blockRange(), target = range && liftTarget(range);
+ if (target == null)
+ return false;
+ if (dispatch)
+ dispatch(state.tr.lift(range, target).scrollIntoView());
+ return true;
+ }
+ let before = $cut.nodeBefore;
+ if (!before.type.spec.isolating && deleteBarrier(state, $cut, dispatch))
+ return true;
+ if ($cursor.parent.content.size == 0 && (textblockAt(before, "end") || NodeSelection.isSelectable(before))) {
+ let delStep = replaceStep(state.doc, $cursor.before(), $cursor.after(), Slice.empty);
+ if (delStep && delStep.slice.size < delStep.to - delStep.from) {
+ if (dispatch) {
+ let tr = state.tr.step(delStep);
+ tr.setSelection(textblockAt(before, "end") ? Selection.findFrom(tr.doc.resolve(tr.mapping.map($cut.pos, -1)), -1) : NodeSelection.create(tr.doc, $cut.pos - before.nodeSize));
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ }
+ }
+ if (before.isAtom && $cut.depth == $cursor.depth - 1) {
+ if (dispatch)
+ dispatch(state.tr.delete($cut.pos - before.nodeSize, $cut.pos).scrollIntoView());
+ return true;
+ }
+ return false;
+ };
+ function textblockAt(node2, side, only = false) {
+ for (let scan = node2; scan; scan = side == "start" ? scan.firstChild : scan.lastChild) {
+ if (scan.isTextblock)
+ return true;
+ if (only && scan.childCount != 1)
+ return false;
+ }
+ return false;
+ }
+ var selectNodeBackward = (state, dispatch, view) => {
+ let { $head, empty: empty3 } = state.selection, $cut = $head;
+ if (!empty3)
+ return false;
+ if ($head.parent.isTextblock) {
+ if (view ? !view.endOfTextblock("backward", state) : $head.parentOffset > 0)
+ return false;
+ $cut = findCutBefore($head);
+ }
+ let node2 = $cut && $cut.nodeBefore;
+ if (!node2 || !NodeSelection.isSelectable(node2))
+ return false;
+ if (dispatch)
+ dispatch(state.tr.setSelection(NodeSelection.create(state.doc, $cut.pos - node2.nodeSize)).scrollIntoView());
+ return true;
+ };
+ function findCutBefore($pos) {
+ if (!$pos.parent.type.spec.isolating)
+ for (let i2 = $pos.depth - 1; i2 >= 0; i2--) {
+ if ($pos.index(i2) > 0)
+ return $pos.doc.resolve($pos.before(i2 + 1));
+ if ($pos.node(i2).type.spec.isolating)
+ break;
+ }
+ return null;
+ }
+ function atBlockEnd(state, view) {
+ let { $cursor } = state.selection;
+ if (!$cursor || (view ? !view.endOfTextblock("forward", state) : $cursor.parentOffset < $cursor.parent.content.size))
+ return null;
+ return $cursor;
+ }
+ var joinForward = (state, dispatch, view) => {
+ let $cursor = atBlockEnd(state, view);
+ if (!$cursor)
+ return false;
+ let $cut = findCutAfter($cursor);
+ if (!$cut)
+ return false;
+ let after = $cut.nodeAfter;
+ if (deleteBarrier(state, $cut, dispatch))
+ return true;
+ if ($cursor.parent.content.size == 0 && (textblockAt(after, "start") || NodeSelection.isSelectable(after))) {
+ let delStep = replaceStep(state.doc, $cursor.before(), $cursor.after(), Slice.empty);
+ if (delStep && delStep.slice.size < delStep.to - delStep.from) {
+ if (dispatch) {
+ let tr = state.tr.step(delStep);
+ tr.setSelection(textblockAt(after, "start") ? Selection.findFrom(tr.doc.resolve(tr.mapping.map($cut.pos)), 1) : NodeSelection.create(tr.doc, tr.mapping.map($cut.pos)));
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ }
+ }
+ if (after.isAtom && $cut.depth == $cursor.depth - 1) {
+ if (dispatch)
+ dispatch(state.tr.delete($cut.pos, $cut.pos + after.nodeSize).scrollIntoView());
+ return true;
+ }
+ return false;
+ };
+ var selectNodeForward = (state, dispatch, view) => {
+ let { $head, empty: empty3 } = state.selection, $cut = $head;
+ if (!empty3)
+ return false;
+ if ($head.parent.isTextblock) {
+ if (view ? !view.endOfTextblock("forward", state) : $head.parentOffset < $head.parent.content.size)
+ return false;
+ $cut = findCutAfter($head);
+ }
+ let node2 = $cut && $cut.nodeAfter;
+ if (!node2 || !NodeSelection.isSelectable(node2))
+ return false;
+ if (dispatch)
+ dispatch(state.tr.setSelection(NodeSelection.create(state.doc, $cut.pos)).scrollIntoView());
+ return true;
+ };
+ function findCutAfter($pos) {
+ if (!$pos.parent.type.spec.isolating)
+ for (let i2 = $pos.depth - 1; i2 >= 0; i2--) {
+ let parent = $pos.node(i2);
+ if ($pos.index(i2) + 1 < parent.childCount)
+ return $pos.doc.resolve($pos.after(i2 + 1));
+ if (parent.type.spec.isolating)
+ break;
+ }
+ return null;
+ }
+ var newlineInCode = (state, dispatch) => {
+ let { $head, $anchor } = state.selection;
+ if (!$head.parent.type.spec.code || !$head.sameParent($anchor))
+ return false;
+ if (dispatch)
+ dispatch(state.tr.insertText("\n").scrollIntoView());
+ return true;
+ };
+ function defaultBlockAt(match) {
+ for (let i2 = 0; i2 < match.edgeCount; i2++) {
+ let { type } = match.edge(i2);
+ if (type.isTextblock && !type.hasRequiredAttrs())
+ return type;
+ }
+ return null;
+ }
+ var exitCode = (state, dispatch) => {
+ let { $head, $anchor } = state.selection;
+ if (!$head.parent.type.spec.code || !$head.sameParent($anchor))
+ return false;
+ let above = $head.node(-1), after = $head.indexAfter(-1), type = defaultBlockAt(above.contentMatchAt(after));
+ if (!type || !above.canReplaceWith(after, after, type))
+ return false;
+ if (dispatch) {
+ let pos = $head.after(), tr = state.tr.replaceWith(pos, pos, type.createAndFill());
+ tr.setSelection(Selection.near(tr.doc.resolve(pos), 1));
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ };
+ var createParagraphNear = (state, dispatch) => {
+ let sel = state.selection, { $from, $to } = sel;
+ if (sel instanceof AllSelection || $from.parent.inlineContent || $to.parent.inlineContent)
+ return false;
+ let type = defaultBlockAt($to.parent.contentMatchAt($to.indexAfter()));
+ if (!type || !type.isTextblock)
+ return false;
+ if (dispatch) {
+ let side = (!$from.parentOffset && $to.index() < $to.parent.childCount ? $from : $to).pos;
+ let tr = state.tr.insert(side, type.createAndFill());
+ tr.setSelection(TextSelection.create(tr.doc, side + 1));
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ };
+ var liftEmptyBlock = (state, dispatch) => {
+ let { $cursor } = state.selection;
+ if (!$cursor || $cursor.parent.content.size)
+ return false;
+ if ($cursor.depth > 1 && $cursor.after() != $cursor.end(-1)) {
+ let before = $cursor.before();
+ if (canSplit(state.doc, before)) {
+ if (dispatch)
+ dispatch(state.tr.split(before).scrollIntoView());
+ return true;
+ }
+ }
+ let range = $cursor.blockRange(), target = range && liftTarget(range);
+ if (target == null)
+ return false;
+ if (dispatch)
+ dispatch(state.tr.lift(range, target).scrollIntoView());
+ return true;
+ };
+ function splitBlockAs(splitNode) {
+ return (state, dispatch) => {
+ let { $from, $to } = state.selection;
+ if (state.selection instanceof NodeSelection && state.selection.node.isBlock) {
+ if (!$from.parentOffset || !canSplit(state.doc, $from.pos))
+ return false;
+ if (dispatch)
+ dispatch(state.tr.split($from.pos).scrollIntoView());
+ return true;
+ }
+ if (!$from.parent.isBlock)
+ return false;
+ if (dispatch) {
+ let atEnd = $to.parentOffset == $to.parent.content.size;
+ let tr = state.tr;
+ if (state.selection instanceof TextSelection || state.selection instanceof AllSelection)
+ tr.deleteSelection();
+ let deflt = $from.depth == 0 ? null : defaultBlockAt($from.node(-1).contentMatchAt($from.indexAfter(-1)));
+ let splitType = splitNode && splitNode($to.parent, atEnd);
+ let types = splitType ? [splitType] : atEnd && deflt ? [{ type: deflt }] : void 0;
+ let can = canSplit(tr.doc, tr.mapping.map($from.pos), 1, types);
+ if (!types && !can && canSplit(tr.doc, tr.mapping.map($from.pos), 1, deflt ? [{ type: deflt }] : void 0)) {
+ if (deflt)
+ types = [{ type: deflt }];
+ can = true;
+ }
+ if (can) {
+ tr.split(tr.mapping.map($from.pos), 1, types);
+ if (!atEnd && !$from.parentOffset && $from.parent.type != deflt) {
+ let first = tr.mapping.map($from.before()), $first = tr.doc.resolve(first);
+ if (deflt && $from.node(-1).canReplaceWith($first.index(), $first.index() + 1, deflt))
+ tr.setNodeMarkup(tr.mapping.map($from.before()), deflt);
+ }
+ }
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ };
+ }
+ var splitBlock = splitBlockAs();
+ var selectAll = (state, dispatch) => {
+ if (dispatch)
+ dispatch(state.tr.setSelection(new AllSelection(state.doc)));
+ return true;
+ };
+ function joinMaybeClear(state, $pos, dispatch) {
+ let before = $pos.nodeBefore, after = $pos.nodeAfter, index2 = $pos.index();
+ if (!before || !after || !before.type.compatibleContent(after.type))
+ return false;
+ if (!before.content.size && $pos.parent.canReplace(index2 - 1, index2)) {
+ if (dispatch)
+ dispatch(state.tr.delete($pos.pos - before.nodeSize, $pos.pos).scrollIntoView());
+ return true;
+ }
+ if (!$pos.parent.canReplace(index2, index2 + 1) || !(after.isTextblock || canJoin(state.doc, $pos.pos)))
+ return false;
+ if (dispatch)
+ dispatch(state.tr.clearIncompatible($pos.pos, before.type, before.contentMatchAt(before.childCount)).join($pos.pos).scrollIntoView());
+ return true;
+ }
+ function deleteBarrier(state, $cut, dispatch) {
+ let before = $cut.nodeBefore, after = $cut.nodeAfter, conn, match;
+ if (before.type.spec.isolating || after.type.spec.isolating)
+ return false;
+ if (joinMaybeClear(state, $cut, dispatch))
+ return true;
+ let canDelAfter = $cut.parent.canReplace($cut.index(), $cut.index() + 1);
+ if (canDelAfter && (conn = (match = before.contentMatchAt(before.childCount)).findWrapping(after.type)) && match.matchType(conn[0] || after.type).validEnd) {
+ if (dispatch) {
+ let end = $cut.pos + after.nodeSize, wrap3 = Fragment.empty;
+ for (let i2 = conn.length - 1; i2 >= 0; i2--)
+ wrap3 = Fragment.from(conn[i2].create(null, wrap3));
+ wrap3 = Fragment.from(before.copy(wrap3));
+ let tr = state.tr.step(new ReplaceAroundStep($cut.pos - 1, end, $cut.pos, end, new Slice(wrap3, 1, 0), conn.length, true));
+ let joinAt = end + 2 * conn.length;
+ if (canJoin(tr.doc, joinAt))
+ tr.join(joinAt);
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ }
+ let selAfter = Selection.findFrom($cut, 1);
+ let range = selAfter && selAfter.$from.blockRange(selAfter.$to), target = range && liftTarget(range);
+ if (target != null && target >= $cut.depth) {
+ if (dispatch)
+ dispatch(state.tr.lift(range, target).scrollIntoView());
+ return true;
+ }
+ if (canDelAfter && textblockAt(after, "start", true) && textblockAt(before, "end")) {
+ let at4 = before, wrap3 = [];
+ for (; ; ) {
+ wrap3.push(at4);
+ if (at4.isTextblock)
+ break;
+ at4 = at4.lastChild;
+ }
+ let afterText = after, afterDepth = 1;
+ for (; !afterText.isTextblock; afterText = afterText.firstChild)
+ afterDepth++;
+ if (at4.canReplace(at4.childCount, at4.childCount, afterText.content)) {
+ if (dispatch) {
+ let end = Fragment.empty;
+ for (let i2 = wrap3.length - 1; i2 >= 0; i2--)
+ end = Fragment.from(wrap3[i2].copy(end));
+ let tr = state.tr.step(new ReplaceAroundStep($cut.pos - wrap3.length, $cut.pos + after.nodeSize, $cut.pos + afterDepth, $cut.pos + after.nodeSize - afterDepth, new Slice(end, wrap3.length, 0), 0, true));
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ }
+ }
+ return false;
+ }
+ function selectTextblockSide(side) {
+ return function(state, dispatch) {
+ let sel = state.selection, $pos = side < 0 ? sel.$from : sel.$to;
+ let depth = $pos.depth;
+ while ($pos.node(depth).isInline) {
+ if (!depth)
+ return false;
+ depth--;
+ }
+ if (!$pos.node(depth).isTextblock)
+ return false;
+ if (dispatch)
+ dispatch(state.tr.setSelection(TextSelection.create(state.doc, side < 0 ? $pos.start(depth) : $pos.end(depth))));
+ return true;
+ };
+ }
+ var selectTextblockStart = selectTextblockSide(-1);
+ var selectTextblockEnd = selectTextblockSide(1);
+ function wrapIn(nodeType, attrs = null) {
+ return function(state, dispatch) {
+ let { $from, $to } = state.selection;
+ let range = $from.blockRange($to), wrapping = range && findWrapping(range, nodeType, attrs);
+ if (!wrapping)
+ return false;
+ if (dispatch)
+ dispatch(state.tr.wrap(range, wrapping).scrollIntoView());
+ return true;
+ };
+ }
+ function setBlockType2(nodeType, attrs = null) {
+ return function(state, dispatch) {
+ let applicable = false;
+ for (let i2 = 0; i2 < state.selection.ranges.length && !applicable; i2++) {
+ let { $from: { pos: from }, $to: { pos: to } } = state.selection.ranges[i2];
+ state.doc.nodesBetween(from, to, (node2, pos) => {
+ if (applicable)
+ return false;
+ if (!node2.isTextblock || node2.hasMarkup(nodeType, attrs))
+ return;
+ if (node2.type == nodeType) {
+ applicable = true;
+ } else {
+ let $pos = state.doc.resolve(pos), index2 = $pos.index();
+ applicable = $pos.parent.canReplaceWith(index2, index2 + 1, nodeType);
+ }
+ });
+ }
+ if (!applicable)
+ return false;
+ if (dispatch) {
+ let tr = state.tr;
+ for (let i2 = 0; i2 < state.selection.ranges.length; i2++) {
+ let { $from: { pos: from }, $to: { pos: to } } = state.selection.ranges[i2];
+ tr.setBlockType(from, to, nodeType, attrs);
+ }
+ dispatch(tr.scrollIntoView());
+ }
+ return true;
+ };
+ }
+ function markApplies(doc4, ranges, type) {
+ for (let i2 = 0; i2 < ranges.length; i2++) {
+ let { $from, $to } = ranges[i2];
+ let can = $from.depth == 0 ? doc4.inlineContent && doc4.type.allowsMarkType(type) : false;
+ doc4.nodesBetween($from.pos, $to.pos, (node2) => {
+ if (can)
+ return false;
+ can = node2.inlineContent && node2.type.allowsMarkType(type);
+ });
+ if (can)
+ return true;
+ }
+ return false;
+ }
+ function toggleMark(markType, attrs = null) {
+ return function(state, dispatch) {
+ let { empty: empty3, $cursor, ranges } = state.selection;
+ if (empty3 && !$cursor || !markApplies(state.doc, ranges, markType))
+ return false;
+ if (dispatch) {
+ if ($cursor) {
+ if (markType.isInSet(state.storedMarks || $cursor.marks()))
+ dispatch(state.tr.removeStoredMark(markType));
+ else
+ dispatch(state.tr.addStoredMark(markType.create(attrs)));
+ } else {
+ let has = false, tr = state.tr;
+ for (let i2 = 0; !has && i2 < ranges.length; i2++) {
+ let { $from, $to } = ranges[i2];
+ has = state.doc.rangeHasMark($from.pos, $to.pos, markType);
+ }
+ for (let i2 = 0; i2 < ranges.length; i2++) {
+ let { $from, $to } = ranges[i2];
+ if (has) {
+ tr.removeMark($from.pos, $to.pos, markType);
+ } else {
+ let from = $from.pos, to = $to.pos, start = $from.nodeAfter, end = $to.nodeBefore;
+ let spaceStart = start && start.isText ? /^\s*/.exec(start.text)[0].length : 0;
+ let spaceEnd = end && end.isText ? /\s*$/.exec(end.text)[0].length : 0;
+ if (from + spaceStart < to) {
+ from += spaceStart;
+ to -= spaceEnd;
+ }
+ tr.addMark(from, to, markType.create(attrs));
+ }
+ }
+ dispatch(tr.scrollIntoView());
+ }
+ }
+ return true;
+ };
+ }
+ function chainCommands(...commands) {
+ return function(state, dispatch, view) {
+ for (let i2 = 0; i2 < commands.length; i2++)
+ if (commands[i2](state, dispatch, view))
+ return true;
+ return false;
+ };
+ }
+ var backspace = chainCommands(deleteSelection, joinBackward, selectNodeBackward);
+ var del = chainCommands(deleteSelection, joinForward, selectNodeForward);
+ var pcBaseKeymap = {
+ "Enter": chainCommands(newlineInCode, createParagraphNear, liftEmptyBlock, splitBlock),
+ "Mod-Enter": exitCode,
+ "Backspace": backspace,
+ "Mod-Backspace": backspace,
+ "Shift-Backspace": backspace,
+ "Delete": del,
+ "Mod-Delete": del,
+ "Mod-a": selectAll
+ };
+ var macBaseKeymap = {
+ "Ctrl-h": pcBaseKeymap["Backspace"],
+ "Alt-Backspace": pcBaseKeymap["Mod-Backspace"],
+ "Ctrl-d": pcBaseKeymap["Delete"],
+ "Ctrl-Alt-Backspace": pcBaseKeymap["Mod-Delete"],
+ "Alt-Delete": pcBaseKeymap["Mod-Delete"],
+ "Alt-d": pcBaseKeymap["Mod-Delete"],
+ "Ctrl-a": selectTextblockStart,
+ "Ctrl-e": selectTextblockEnd
+ };
+ for (let key in pcBaseKeymap)
+ macBaseKeymap[key] = pcBaseKeymap[key];
+ var mac3 = typeof navigator != "undefined" ? /Mac|iP(hone|[oa]d)/.test(navigator.platform) : typeof os != "undefined" && os.platform ? os.platform() == "darwin" : false;
+ var baseKeymap = mac3 ? macBaseKeymap : pcBaseKeymap;
+
+ // node_modules/w3c-keyname/index.js
+ var base = {
+ 8: "Backspace",
+ 9: "Tab",
+ 10: "Enter",
+ 12: "NumLock",
+ 13: "Enter",
+ 16: "Shift",
+ 17: "Control",
+ 18: "Alt",
+ 20: "CapsLock",
+ 27: "Escape",
+ 32: " ",
+ 33: "PageUp",
+ 34: "PageDown",
+ 35: "End",
+ 36: "Home",
+ 37: "ArrowLeft",
+ 38: "ArrowUp",
+ 39: "ArrowRight",
+ 40: "ArrowDown",
+ 44: "PrintScreen",
+ 45: "Insert",
+ 46: "Delete",
+ 59: ";",
+ 61: "=",
+ 91: "Meta",
+ 92: "Meta",
+ 106: "*",
+ 107: "+",
+ 108: ",",
+ 109: "-",
+ 110: ".",
+ 111: "/",
+ 144: "NumLock",
+ 145: "ScrollLock",
+ 160: "Shift",
+ 161: "Shift",
+ 162: "Control",
+ 163: "Control",
+ 164: "Alt",
+ 165: "Alt",
+ 173: "-",
+ 186: ";",
+ 187: "=",
+ 188: ",",
+ 189: "-",
+ 190: ".",
+ 191: "/",
+ 192: "`",
+ 219: "[",
+ 220: "\\",
+ 221: "]",
+ 222: "'"
+ };
+ var shift = {
+ 48: ")",
+ 49: "!",
+ 50: "@",
+ 51: "#",
+ 52: "$",
+ 53: "%",
+ 54: "^",
+ 55: "&",
+ 56: "*",
+ 57: "(",
+ 59: ":",
+ 61: "+",
+ 173: "_",
+ 186: ":",
+ 187: "+",
+ 188: "<",
+ 189: "_",
+ 190: ">",
+ 191: "?",
+ 192: "~",
+ 219: "{",
+ 220: "|",
+ 221: "}",
+ 222: '"'
+ };
+ var mac4 = typeof navigator != "undefined" && /Mac/.test(navigator.platform);
+ var ie3 = typeof navigator != "undefined" && /MSIE \d|Trident\/(?:[7-9]|\d{2,})\..*rv:(\d+)/.exec(navigator.userAgent);
+ for (i2 = 0; i2 < 10; i2++) base[48 + i2] = base[96 + i2] = String(i2);
+ var i2;
+ for (i2 = 1; i2 <= 24; i2++) base[i2 + 111] = "F" + i2;
+ var i2;
+ for (i2 = 65; i2 <= 90; i2++) {
+ base[i2] = String.fromCharCode(i2 + 32);
+ shift[i2] = String.fromCharCode(i2);
+ }
+ var i2;
+ for (code3 in base) if (!shift.hasOwnProperty(code3)) shift[code3] = base[code3];
+ var code3;
+ function keyName(event) {
+ var ignoreKey = mac4 && event.metaKey && event.shiftKey && !event.ctrlKey && !event.altKey || ie3 && event.shiftKey && event.key && event.key.length == 1 || event.key == "Unidentified";
+ var name = !ignoreKey && event.key || (event.shiftKey ? shift : base)[event.keyCode] || event.key || "Unidentified";
+ if (name == "Esc") name = "Escape";
+ if (name == "Del") name = "Delete";
+ if (name == "Left") name = "ArrowLeft";
+ if (name == "Up") name = "ArrowUp";
+ if (name == "Right") name = "ArrowRight";
+ if (name == "Down") name = "ArrowDown";
+ return name;
+ }
+
+ // node_modules/prosemirror-keymap/dist/index.js
+ var mac5 = typeof navigator != "undefined" ? /Mac|iP(hone|[oa]d)/.test(navigator.platform) : false;
+ function normalizeKeyName(name) {
+ let parts = name.split(/-(?!$)/), result = parts[parts.length - 1];
+ if (result == "Space")
+ result = " ";
+ let alt, ctrl, shift2, meta;
+ for (let i2 = 0; i2 < parts.length - 1; i2++) {
+ let mod = parts[i2];
+ if (/^(cmd|meta|m)$/i.test(mod))
+ meta = true;
+ else if (/^a(lt)?$/i.test(mod))
+ alt = true;
+ else if (/^(c|ctrl|control)$/i.test(mod))
+ ctrl = true;
+ else if (/^s(hift)?$/i.test(mod))
+ shift2 = true;
+ else if (/^mod$/i.test(mod)) {
+ if (mac5)
+ meta = true;
+ else
+ ctrl = true;
+ } else
+ throw new Error("Unrecognized modifier name: " + mod);
+ }
+ if (alt)
+ result = "Alt-" + result;
+ if (ctrl)
+ result = "Ctrl-" + result;
+ if (meta)
+ result = "Meta-" + result;
+ if (shift2)
+ result = "Shift-" + result;
+ return result;
+ }
+ function normalize2(map5) {
+ let copy2 = /* @__PURE__ */ Object.create(null);
+ for (let prop in map5)
+ copy2[normalizeKeyName(prop)] = map5[prop];
+ return copy2;
+ }
+ function modifiers(name, event, shift2 = true) {
+ if (event.altKey)
+ name = "Alt-" + name;
+ if (event.ctrlKey)
+ name = "Ctrl-" + name;
+ if (event.metaKey)
+ name = "Meta-" + name;
+ if (shift2 && event.shiftKey)
+ name = "Shift-" + name;
+ return name;
+ }
+ function keymap(bindings) {
+ return new Plugin({ props: { handleKeyDown: keydownHandler(bindings) } });
+ }
+ function keydownHandler(bindings) {
+ let map5 = normalize2(bindings);
+ return function(view, event) {
+ let name = keyName(event), baseName, direct = map5[modifiers(name, event)];
+ if (direct && direct(view.state, view.dispatch, view))
+ return true;
+ if (name.length == 1 && name != " ") {
+ if (event.shiftKey) {
+ let noShift = map5[modifiers(name, event, false)];
+ if (noShift && noShift(view.state, view.dispatch, view))
+ return true;
+ }
+ if ((event.shiftKey || event.altKey || event.metaKey || name.charCodeAt(0) > 127) && (baseName = base[event.keyCode]) && baseName != name) {
+ let fromCode = map5[modifiers(baseName, event)];
+ if (fromCode && fromCode(view.state, view.dispatch, view))
+ return true;
+ }
+ }
+ return false;
+ };
+ }
+
+ // node_modules/@milkdown/core/lib/index.es.js
+ var ve = (e2, t2, r3) => {
+ if (!t2.has(e2))
+ throw TypeError("Cannot " + r3);
+ };
+ var s = (e2, t2, r3) => (ve(e2, t2, "read from private field"), r3 ? r3.call(e2) : t2.get(e2));
+ var d4 = (e2, t2, r3) => {
+ if (t2.has(e2))
+ throw TypeError("Cannot add the same private member more than once");
+ t2 instanceof WeakSet ? t2.add(e2) : t2.set(e2, r3);
+ };
+ var c3 = (e2, t2, r3, i2) => (ve(e2, t2, "write to private field"), i2 ? i2.call(e2, r3) : t2.set(e2, r3), r3);
+ function k3(e2, t2) {
+ return e2.meta = __spreadValues({
+ package: "@milkdown/core",
+ group: "System"
+ }, t2), e2;
+ }
+ var De = {
+ strong: (e2, t2, r3, i2) => {
+ const n4 = e2.marker || r3.options.strong || "*", a2 = r3.enter("strong"), h5 = r3.createTracker(i2);
+ let m3 = h5.move(n4 + n4);
+ return m3 += h5.move(
+ r3.containerPhrasing(e2, __spreadValues({
+ before: m3,
+ after: n4
+ }, h5.current()))
+ ), m3 += h5.move(n4 + n4), a2(), m3;
+ },
+ emphasis: (e2, t2, r3, i2) => {
+ const n4 = e2.marker || r3.options.emphasis || "*", a2 = r3.enter("emphasis"), h5 = r3.createTracker(i2);
+ let m3 = h5.move(n4);
+ return m3 += h5.move(
+ r3.containerPhrasing(e2, __spreadValues({
+ before: m3,
+ after: n4
+ }, h5.current()))
+ ), m3 += h5.move(n4), a2(), m3;
+ }
+ };
+ var L3 = K("ConfigReady");
+ function ot(e2) {
+ const t2 = (r3) => (r3.record(L3), async () => (await e2(r3), r3.done(L3), () => {
+ r3.clearTimer(L3);
+ }));
+ return k3(t2, {
+ displayName: "Config"
+ }), t2;
+ }
+ var M4 = K("InitReady");
+ var G3 = H([], "initTimer");
+ var ke = H({}, "editor");
+ var ue = H([], "inputRules");
+ var N2 = H([], "prosePlugins");
+ var pe = H([], "remarkPlugins");
+ var fe = H([], "nodeView");
+ var ye = H([], "markView");
+ var P3 = H(unified().use(remarkParse).use(remarkStringify), "remark");
+ var Q2 = H({
+ handlers: De
+ }, "remarkStringifyOptions");
+ function at(e2) {
+ const t2 = (r3) => (r3.inject(ke, e2).inject(N2, []).inject(pe, []).inject(ue, []).inject(fe, []).inject(ye, []).inject(Q2, {
+ handlers: De
+ }).inject(P3, unified().use(remarkParse).use(remarkStringify)).inject(G3, [L3]).record(M4), async () => {
+ await r3.waitTimers(G3);
+ const i2 = r3.get(Q2);
+ return r3.set(P3, unified().use(remarkParse).use(remarkStringify, i2)), r3.done(M4), () => {
+ r3.remove(ke).remove(N2).remove(pe).remove(ue).remove(fe).remove(ye).remove(Q2).remove(P3).remove(G3).clearTimer(M4);
+ };
+ });
+ return k3(t2, {
+ displayName: "Init"
+ }), t2;
+ }
+ var R3 = K("SchemaReady");
+ var U3 = H([], "schemaTimer");
+ var b2 = H({}, "schema");
+ var X = H([], "nodes");
+ var Z2 = H([], "marks");
+ function Te(e2) {
+ var t2;
+ return __spreadProps(__spreadValues({}, e2), {
+ parseDOM: (t2 = e2.parseDOM) == null ? void 0 : t2.map((r3) => __spreadValues({ priority: e2.priority }, r3))
+ });
+ }
+ var Ee = (e2) => (e2.inject(b2, {}).inject(X, []).inject(Z2, []).inject(U3, [M4]).record(R3), async () => {
+ await e2.waitTimers(U3);
+ const t2 = e2.get(P3), i2 = e2.get(pe).reduce((m3, f3) => m3.use(f3.plugin, f3.options), t2);
+ e2.set(P3, i2);
+ const n4 = Object.fromEntries(e2.get(X).map(([m3, f3]) => [m3, Te(f3)])), a2 = Object.fromEntries(e2.get(Z2).map(([m3, f3]) => [m3, Te(f3)])), h5 = new Schema({ nodes: n4, marks: a2 });
+ return e2.set(b2, h5), e2.done(R3), () => {
+ e2.remove(b2).remove(X).remove(Z2).remove(U3).clearTimer(R3);
+ };
+ });
+ k3(Ee, {
+ displayName: "Schema"
+ });
+ var W2 = K("ParserReady");
+ var Ie = () => {
+ throw p();
+ };
+ var Y = H(Ie, "parser");
+ var x4 = H([], "parserTimer");
+ var Ve = (e2) => (e2.inject(Y, Ie).inject(x4, [R3]).record(W2), async () => {
+ await e2.waitTimers(x4);
+ const t2 = e2.get(P3), r3 = e2.get(b2);
+ return e2.set(Y, H2.create(r3, t2)), e2.done(W2), () => {
+ e2.remove(Y).remove(x4).clearTimer(W2);
+ };
+ });
+ k3(Ve, {
+ displayName: "Parser"
+ });
+ var $ = K("SerializerReady");
+ var ee = H([], "serializerTimer");
+ var Me = () => {
+ throw p();
+ };
+ var te = H(Me, "serializer");
+ var Ne = (e2) => (e2.inject(te, Me).inject(ee, [R3]).record($), async () => {
+ await e2.waitTimers(ee);
+ const t2 = e2.get(P3), r3 = e2.get(b2);
+ return e2.set(te, K2.create(r3, t2)), e2.done($), () => {
+ e2.remove(te).remove(ee).clearTimer($);
+ };
+ });
+ k3(Ne, {
+ displayName: "Serializer"
+ });
+ var re = H("", "defaultValue");
+ var V2 = H({}, "editorState");
+ var se = H((e2) => e2, "stateOptions");
+ var ie4 = H([], "editorStateTimer");
+ var q4 = K("EditorStateReady");
+ function ct(e2, t2, r3) {
+ if (typeof e2 == "string")
+ return t2(e2);
+ if (e2.type === "html")
+ return DOMParser.fromSchema(r3).parse(e2.dom);
+ if (e2.type === "json")
+ return Node2.fromJSON(r3, e2.value);
+ throw l(e2);
+ }
+ var mt = new PluginKey("MILKDOWN_STATE_TRACKER");
+ function dt(e2) {
+ const t2 = chainCommands(
+ undoInputRule,
+ deleteSelection,
+ joinBackward,
+ selectNodeBackward
+ );
+ return e2.Backspace = t2, e2;
+ }
+ var _e = (e2) => (e2.inject(re, "").inject(V2, {}).inject(se, (t2) => t2).inject(ie4, [W2, $, J3]).record(q4), async () => {
+ await e2.waitTimers(ie4);
+ const t2 = e2.get(b2), r3 = e2.get(Y), i2 = e2.get(ue), n4 = e2.get(se), a2 = e2.get(N2), h5 = e2.get(re), m3 = ct(h5, r3, t2), f3 = [
+ ...a2,
+ new Plugin({
+ key: mt,
+ state: {
+ init: () => {
+ },
+ apply: (Be2, F4, ft2, Le2) => {
+ e2.set(V2, Le2);
+ }
+ }
+ }),
+ customInputRules({ rules: i2 }),
+ keymap(dt(baseKeymap))
+ ];
+ e2.set(N2, f3);
+ const B3 = n4({
+ schema: t2,
+ doc: m3,
+ plugins: f3
+ }), l5 = EditorState.create(B3);
+ return e2.set(V2, l5), e2.done(q4), () => {
+ e2.remove(re).remove(V2).remove(se).remove(ie4).clearTimer(q4);
+ };
+ });
+ k3(_e, {
+ displayName: "EditorState"
+ });
+ var ne = K("EditorViewReady");
+ var H3 = H({}, "editorView");
+ var oe = H([], "editorViewTimer");
+ var ae = H({}, "editorViewOptions");
+ var ce = H(null, "root");
+ var we = H(null, "rootDOM");
+ var ge = H({}, "rootAttrs");
+ function ht(e2, t2) {
+ const r3 = document.createElement("div");
+ r3.className = "milkdown", e2.appendChild(r3), t2.set(we, r3);
+ const i2 = t2.get(ge);
+ return Object.entries(i2).forEach(([n4, a2]) => r3.setAttribute(n4, a2)), r3;
+ }
+ function lt(e2) {
+ e2.classList.add("editor"), e2.setAttribute("role", "textbox");
+ }
+ var ut = new PluginKey("MILKDOWN_VIEW_CLEAR");
+ var ze = (e2) => (e2.inject(ce, document.body).inject(H3, {}).inject(ae, {}).inject(we, null).inject(ge, {}).inject(oe, [q4]).record(ne), async () => {
+ await e2.wait(M4);
+ const t2 = e2.get(ce) || document.body, r3 = typeof t2 == "string" ? document.querySelector(t2) : t2;
+ e2.update(N2, (f3) => [
+ new Plugin({
+ key: ut,
+ view: (B3) => {
+ const l5 = r3 ? ht(r3, e2) : void 0;
+ return (() => {
+ if (l5 && r3) {
+ const F4 = B3.dom;
+ r3.replaceChild(l5, F4), l5.appendChild(F4);
+ }
+ })(), {
+ destroy: () => {
+ l5 != null && l5.parentNode && (l5 == null || l5.parentNode.replaceChild(B3.dom, l5)), l5 == null || l5.remove();
+ }
+ };
+ }
+ }),
+ ...f3
+ ]), await e2.waitTimers(oe);
+ const i2 = e2.get(V2), n4 = e2.get(ae), a2 = Object.fromEntries(e2.get(fe)), h5 = Object.fromEntries(e2.get(ye)), m3 = new EditorView(r3, __spreadValues({
+ state: i2,
+ nodeViews: a2,
+ markViews: h5
+ }, n4));
+ return lt(m3.dom), e2.set(H3, m3), e2.done(ne), () => {
+ m3 == null || m3.destroy(), e2.remove(ce).remove(H3).remove(ae).remove(we).remove(ge).remove(oe).clearTimer(ne);
+ };
+ });
+ k3(ze, {
+ displayName: "EditorView"
+ });
+ var T3;
+ var g4;
+ var Ke = class {
+ constructor() {
+ d4(this, T3, void 0);
+ d4(this, g4, void 0);
+ c3(this, T3, new G()), c3(this, g4, null), this.setCtx = (t2) => {
+ c3(this, g4, t2);
+ };
+ }
+ get ctx() {
+ return s(this, g4);
+ }
+ /// Register a command into the manager.
+ create(t2, r3) {
+ const i2 = t2.create(s(this, T3).sliceMap);
+ return i2.set(r3), i2;
+ }
+ get(t2) {
+ return s(this, T3).get(t2).get();
+ }
+ remove(t2) {
+ return s(this, T3).remove(t2);
+ }
+ call(t2, r3) {
+ if (s(this, g4) == null)
+ throw y();
+ const n4 = this.get(t2)(r3), a2 = s(this, g4).get(H3);
+ return n4(a2.state, a2.dispatch, a2);
+ }
+ };
+ T3 = /* @__PURE__ */ new WeakMap(), g4 = /* @__PURE__ */ new WeakMap();
+ function Et(e2 = "cmdKey") {
+ return H(() => () => false, e2);
+ }
+ var je = H(new Ke(), "commands");
+ var me = H([R3], "commandsTimer");
+ var J3 = K("CommandsReady");
+ var Ae = (e2) => {
+ const t2 = new Ke();
+ return t2.setCtx(e2), e2.inject(je, t2).inject(me, [R3]).record(J3), async () => (await e2.waitTimers(me), e2.done(J3), () => {
+ e2.remove(je).remove(me).clearTimer(J3);
+ });
+ };
+ k3(Ae, {
+ displayName: "Commands"
+ });
+ var j3;
+ var p3;
+ var y3;
+ var D2;
+ var _2;
+ var z3;
+ var u3;
+ var w4;
+ var O2;
+ var K3;
+ var S5;
+ var E3;
+ var A3;
+ var C3;
+ var I2;
+ var Ce = class Ce2 {
+ constructor() {
+ d4(this, j3, void 0);
+ d4(this, p3, void 0);
+ d4(this, y3, void 0);
+ d4(this, D2, void 0);
+ d4(this, _2, void 0);
+ d4(this, z3, void 0);
+ d4(this, u3, void 0);
+ d4(this, w4, void 0);
+ d4(this, O2, void 0);
+ d4(this, K3, void 0);
+ d4(this, S5, void 0);
+ d4(this, E3, void 0);
+ d4(this, A3, void 0);
+ d4(this, C3, void 0);
+ d4(this, I2, void 0);
+ c3(this, j3, false), c3(this, p3, "Idle"), c3(this, y3, []), c3(this, D2, () => {
+ }), c3(this, _2, new G()), c3(this, z3, new J()), c3(this, u3, /* @__PURE__ */ new Map()), c3(this, w4, /* @__PURE__ */ new Map()), c3(this, O2, new U(s(this, _2), s(this, z3))), c3(this, K3, () => {
+ const t2 = ot(async (i2) => {
+ await Promise.all(s(this, y3).map((n4) => n4(i2)));
+ }), r3 = [
+ Ee,
+ Ve,
+ Ne,
+ Ae,
+ _e,
+ ze,
+ at(this),
+ t2
+ ];
+ s(this, S5).call(this, r3, s(this, w4));
+ }), c3(this, S5, (t2, r3) => {
+ t2.forEach((i2) => {
+ const n4 = s(this, O2).produce(s(this, j3) ? i2.meta : void 0), a2 = i2(n4);
+ r3.set(i2, { ctx: n4, handler: a2, cleanup: void 0 });
+ });
+ }), c3(this, E3, (t2, r3 = false) => Promise.all(
+ [t2].flat().map((i2) => {
+ const n4 = s(this, u3).get(i2), a2 = n4 == null ? void 0 : n4.cleanup;
+ return r3 ? s(this, u3).delete(i2) : s(this, u3).set(i2, { ctx: void 0, handler: void 0, cleanup: void 0 }), typeof a2 == "function" ? a2() : a2;
+ })
+ )), c3(this, A3, async () => {
+ await Promise.all([...s(this, w4).entries()].map(([t2, { cleanup: r3 }]) => typeof r3 == "function" ? r3() : r3)), s(this, w4).clear();
+ }), c3(this, C3, (t2) => {
+ c3(this, p3, t2), s(this, D2).call(this, t2);
+ }), c3(this, I2, (t2) => [...t2.entries()].map(async ([r3, i2]) => {
+ const { ctx: n4, handler: a2 } = i2;
+ if (!a2)
+ return;
+ const h5 = await a2();
+ t2.set(r3, { ctx: n4, handler: a2, cleanup: h5 });
+ })), this.enableInspector = (t2 = true) => (c3(this, j3, t2), this), this.onStatusChange = (t2) => (c3(this, D2, t2), this), this.config = (t2) => (s(this, y3).push(t2), this), this.removeConfig = (t2) => (c3(this, y3, s(this, y3).filter((r3) => r3 !== t2)), this), this.use = (t2) => {
+ const r3 = [t2].flat();
+ return r3.flat().forEach((i2) => {
+ s(this, u3).set(i2, {
+ ctx: void 0,
+ handler: void 0,
+ cleanup: void 0
+ });
+ }), s(this, p3) === "Created" && s(this, S5).call(this, r3, s(this, u3)), this;
+ }, this.remove = async (t2) => s(this, p3) === "OnCreate" ? (console.warn("[Milkdown]: You are trying to remove plugins when the editor is creating, this is not recommended, please check your code."), new Promise((r3) => {
+ setTimeout(() => {
+ r3(this.remove(t2));
+ }, 50);
+ })) : (await s(this, E3).call(this, [t2].flat(), true), this), this.create = async () => s(this, p3) === "OnCreate" ? this : (s(this, p3) === "Created" && await this.destroy(), s(this, C3).call(this, "OnCreate"), s(this, K3).call(this), s(this, S5).call(this, [...s(this, u3).keys()], s(this, u3)), await Promise.all(
+ [
+ s(this, I2).call(this, s(this, w4)),
+ s(this, I2).call(this, s(this, u3))
+ ].flat()
+ ), s(this, C3).call(this, "Created"), this), this.destroy = async (t2 = false) => s(this, p3) === "Destroyed" || s(this, p3) === "OnDestroy" ? this : s(this, p3) === "OnCreate" ? new Promise((r3) => {
+ setTimeout(() => {
+ r3(this.destroy(t2));
+ }, 50);
+ }) : (t2 && c3(this, y3, []), s(this, C3).call(this, "OnDestroy"), await s(this, E3).call(this, [...s(this, u3).keys()], t2), await s(this, A3).call(this), s(this, C3).call(this, "Destroyed"), this), this.action = (t2) => t2(s(this, O2)), this.inspect = () => s(this, j3) ? [...s(this, w4).values(), ...s(this, u3).values()].map(({ ctx: t2 }) => {
+ var r3;
+ return (r3 = t2 == null ? void 0 : t2.inspector) == null ? void 0 : r3.read();
+ }).filter((t2) => !!t2) : (console.warn("[Milkdown]: You are trying to collect inspection when inspector is disabled, please enable inspector by `editor.enableInspector()` first."), []);
+ }
+ /// Create a new editor instance.
+ static make() {
+ return new Ce2();
+ }
+ /// Get the ctx of the editor.
+ get ctx() {
+ return s(this, O2);
+ }
+ /// Get the status of the editor.
+ get status() {
+ return s(this, p3);
+ }
+ };
+ j3 = /* @__PURE__ */ new WeakMap(), p3 = /* @__PURE__ */ new WeakMap(), y3 = /* @__PURE__ */ new WeakMap(), D2 = /* @__PURE__ */ new WeakMap(), _2 = /* @__PURE__ */ new WeakMap(), z3 = /* @__PURE__ */ new WeakMap(), u3 = /* @__PURE__ */ new WeakMap(), w4 = /* @__PURE__ */ new WeakMap(), O2 = /* @__PURE__ */ new WeakMap(), K3 = /* @__PURE__ */ new WeakMap(), S5 = /* @__PURE__ */ new WeakMap(), E3 = /* @__PURE__ */ new WeakMap(), A3 = /* @__PURE__ */ new WeakMap(), C3 = /* @__PURE__ */ new WeakMap(), I2 = /* @__PURE__ */ new WeakMap();
+ var Oe = Ce;
+
+ // node_modules/atomico/src/ref.js
+ var _current, _listeners;
+ var Ref = class {
+ /**
+ * @param {T} current
+ */
+ constructor(current) {
+ /**
+ * @type {T}
+ */
+ __privateAdd(this, _current);
+ __privateAdd(this, _listeners, /* @__PURE__ */ new Set());
+ __privateSet(this, _current, current);
+ }
+ /**
+ * @return {T}
+ */
+ get current() {
+ return __privateGet(this, _current);
+ }
+ /**
+ * @param {T} value
+ */
+ set current(value) {
+ if (__privateGet(this, _current) != value) {
+ __privateSet(this, _current, value);
+ __privateGet(this, _listeners).forEach((fn) => fn(value));
+ }
+ }
+ /**
+ * @type {import("hooks").Ref["on"]}
+ */
+ on(fn) {
+ __privateGet(this, _listeners).add(fn);
+ return () => __privateGet(this, _listeners).delete(fn);
+ }
+ };
+ _current = new WeakMap();
+ _listeners = new WeakMap();
+ var createRef = (value) => new Ref(value);
+
+ // node_modules/atomico/src/hooks/create-hooks.js
+ var ID = Symbol.for("atomico.hooks");
+ globalThis[ID] = globalThis[ID] || {};
+ var SCOPE = globalThis[ID];
+ var IdSuspense = Symbol.for("Atomico.suspense");
+ var IdEffect = Symbol.for("Atomico.effect");
+ var IdLayoutEffect = Symbol.for("Atomico.layoutEffect");
+ var IdInsertionEffect = Symbol.for("Atomico.insertionEffect");
+ var useHook = (render, effect, tag) => {
+ const { i: i2, hooks } = SCOPE.c;
+ const hook = hooks[i2] = hooks[i2] || {};
+ hook.value = render(hook.value);
+ hook.effect = effect;
+ hook.tag = tag;
+ SCOPE.c.i++;
+ return hooks[i2].value;
+ };
+ var useRef = (current) => useHook((ref = createRef(current)) => ref);
+ var useHost = () => useHook((ref = createRef(SCOPE.c.host)) => ref);
+ var createHooks = (update, host, id = 0) => {
+ let hooks = {};
+ let suspense = false;
+ const isSuspense = () => suspense;
+ const cleanEffectsByType = (tag, unmounted) => {
+ for (const index2 in hooks) {
+ const hook = hooks[index2];
+ if (hook.effect && hook.tag === tag) {
+ hook.value = hook.effect(hook.value, unmounted);
+ }
+ }
+ };
+ const load = (callback) => {
+ SCOPE.c = { host, hooks, update, i: 0, id };
+ let value;
+ try {
+ suspense = false;
+ value = callback();
+ } catch (e2) {
+ if (e2 !== IdSuspense) throw e2;
+ suspense = true;
+ } finally {
+ SCOPE.c = null;
+ }
+ return value;
+ };
+ const cleanEffects = (unmounted) => {
+ cleanEffectsByType(IdInsertionEffect, unmounted);
+ return () => {
+ cleanEffectsByType(IdLayoutEffect, unmounted);
+ return () => {
+ cleanEffectsByType(IdEffect, unmounted);
+ };
+ };
+ };
+ return { load, cleanEffects, isSuspense };
+ };
+
+ // node_modules/atomico/src/utils.js
+ var SymbolFor = Symbol.for;
+ function isEqualArray(before, after) {
+ const length = before.length;
+ if (length !== after.length) return false;
+ for (let i2 = 0; i2 < length; i2++) {
+ let beforeValue = before[i2];
+ let afterValue = after[i2];
+ if (beforeValue !== afterValue) return false;
+ }
+ return true;
+ }
+ var isFunction = (value) => typeof value == "function";
+ var isObject = (value) => typeof value == "object";
+ var { isArray } = Array;
+ var isHydrate = (node2, styleOnly) => (styleOnly ? node2 instanceof HTMLStyleElement : true) && "hydrate" in ((node2 == null ? void 0 : node2.dataset) || {});
+ function flat(list4, callback) {
+ let last;
+ const reduce = (list5) => {
+ let { length } = list5;
+ for (let i2 = 0; i2 < length; i2++) {
+ const value = list5[i2];
+ if (value && Array.isArray(value)) {
+ reduce(value);
+ } else {
+ const type = typeof value;
+ if (value == null || type === "function" || type === "boolean") {
+ continue;
+ } else if (type === "string" || type === "number") {
+ if (last == null) last = "";
+ last += value;
+ } else {
+ if (last != null) {
+ callback(last);
+ last = null;
+ }
+ callback(value);
+ }
+ }
+ }
+ };
+ reduce(list4);
+ if (last != null) callback(last);
+ }
+ var addListener = (target, type, handler) => {
+ target.addEventListener(type, handler);
+ return () => target.removeEventListener(type, handler);
+ };
+
+ // node_modules/atomico/src/element/errors.js
+ var Error2 = class {
+ /**
+ *
+ * @param {HTMLElement} target
+ * @param {string} message
+ * @param {string} value
+ */
+ constructor(target, message, value) {
+ this.message = message;
+ this.target = target;
+ this.value = value;
+ }
+ };
+ var PropError = class extends Error2 {
+ };
+ var ParseError = class extends Error2 {
+ };
+
+ // node_modules/atomico/src/element/set-prototype.js
+ var CUSTOM_TYPE_NAME = "Custom";
+ var Any = null;
+ var TRUE_VALUES = { true: 1, "": 1, 1: 1 };
+ function setPrototype(prototype, prop, schema, attrs, values) {
+ const {
+ type,
+ reflect,
+ event,
+ value: defaultValue,
+ attr = getAttr(prop)
+ } = (schema == null ? void 0 : schema.name) != CUSTOM_TYPE_NAME && isObject(schema) && schema != Any ? schema : { type: schema };
+ const isCustomType = (type == null ? void 0 : type.name) === CUSTOM_TYPE_NAME && type.map;
+ const withDefaultValue = defaultValue != null ? type == Function || !isFunction(defaultValue) ? () => defaultValue : defaultValue : null;
+ Object.defineProperty(prototype, prop, {
+ configurable: true,
+ /**
+ * @this {import("dom").AtomicoThisInternal}
+ * @param {any} newValue
+ */
+ set(newValue) {
+ const oldValue = this[prop];
+ if (withDefaultValue && type != Boolean && newValue == null) {
+ newValue = withDefaultValue();
+ }
+ const { error, value } = (isCustomType ? mapValue : filterValue)(
+ type,
+ newValue
+ );
+ if (error && value != null) {
+ throw new PropError(
+ this,
+ `The value defined for prop '${prop}' must be of type '${type.name}'`,
+ value
+ );
+ }
+ if (oldValue == value) return;
+ this._props[prop] = value == null ? void 0 : value;
+ this.update();
+ event && dispatchEvent3(this, event);
+ this.updated.then(() => {
+ if (reflect) {
+ this._ignoreAttr = attr;
+ reflectValue(this, type, attr, this[prop]);
+ this._ignoreAttr = null;
+ }
+ });
+ },
+ /**
+ * @this {import("dom").AtomicoThisInternal}
+ */
+ get() {
+ return this._props[prop];
+ }
+ });
+ if (withDefaultValue) values[prop] = withDefaultValue();
+ attrs[attr] = { prop, type };
+ }
+ var dispatchEvent3 = (node2, _a) => {
+ var _b = _a, { type, base: base2 = CustomEvent } = _b, eventInit = __objRest(_b, ["type", "base"]);
+ return node2.dispatchEvent(new base2(type, eventInit));
+ };
+ var getAttr = (prop) => prop.replace(/([A-Z])/g, "-$1").toLowerCase();
+ var reflectValue = (host, type, attr, value) => value == null || type == Boolean && !value ? host.removeAttribute(attr) : host.setAttribute(
+ attr,
+ (type == null ? void 0 : type.name) === CUSTOM_TYPE_NAME && (type == null ? void 0 : type.serialize) ? type == null ? void 0 : type.serialize(value) : isObject(value) ? JSON.stringify(value) : type == Boolean ? "" : value
+ );
+ var transformValue = (type, value) => type == Boolean ? !!TRUE_VALUES[value] : type == Number ? Number(value) : type == String ? value : type == Array || type == Object ? JSON.parse(value) : type.name == CUSTOM_TYPE_NAME ? value : (
+ // TODO: If when defining reflect the prop can also be of type string?
+ new type(value)
+ );
+ var mapValue = ({ map: map5 }, value) => {
+ try {
+ return { value: map5(value), error: false };
+ } catch (e2) {
+ return { value, error: true };
+ }
+ };
+ var filterValue = (type, value) => type == null || value == null ? { value, error: false } : type != String && value === "" ? { value: void 0, error: false } : type == Object || type == Array || type == Symbol ? {
+ value,
+ error: {}.toString.call(value) !== `[object ${type.name}]`
+ } : value instanceof type ? {
+ value,
+ error: type == Number && Number.isNaN(value.valueOf())
+ } : type == String || type == Number || type == Boolean ? {
+ value,
+ error: type == Number ? typeof value != "number" ? true : Number.isNaN(value) : type == String ? typeof value != "string" : typeof value != "boolean"
+ } : { value, error: true };
+
+ // node_modules/atomico/src/element/custom-element.js
+ var ID2 = 0;
+ var getHydrateId = (node2) => {
+ var _a;
+ const id = ((_a = (node2 == null ? void 0 : node2.dataset) || {}) == null ? void 0 : _a.hydrate) || "";
+ if (id) {
+ return id;
+ } else {
+ return "c" + ID2++;
+ }
+ };
+ var c4 = (component, options2 = HTMLElement) => {
+ const attrs = {};
+ const values = {};
+ const withBase = "prototype" in options2 && options2.prototype instanceof Element;
+ const base2 = withBase ? options2 : "base" in options2 ? options2.base : HTMLElement;
+ const { props, styles } = withBase ? component : options2;
+ class AtomicoElement extends base2 {
+ constructor() {
+ super();
+ this._setup();
+ this._render = () => component(__spreadValues({}, this._props));
+ for (const prop in values) this[prop] = values[prop];
+ }
+ /**
+ * @returns {import("core").Sheets[]}
+ */
+ static get styles() {
+ return [super.styles, styles];
+ }
+ async _setup() {
+ if (this._props) return;
+ this._props = {};
+ let mountParentNode;
+ let unmountParentNode;
+ this.mounted = new Promise(
+ (resolve) => this.mount = () => {
+ resolve();
+ if (mountParentNode != this.parentNode) {
+ if (unmountParentNode != mountParentNode) {
+ this.unmounted.then(this.update);
+ } else {
+ this.update();
+ }
+ }
+ mountParentNode = this.parentNode;
+ }
+ );
+ this.unmounted = new Promise(
+ (resolve) => this.unmount = () => {
+ resolve();
+ if (mountParentNode != this.parentNode || !this.isConnected) {
+ hooks.cleanEffects(true)()();
+ unmountParentNode = this.parentNode;
+ mountParentNode = null;
+ }
+ }
+ );
+ this.symbolId = this.symbolId || Symbol();
+ this.symbolIdParent = Symbol();
+ const hooks = createHooks(
+ () => this.update(),
+ this,
+ getHydrateId(this)
+ );
+ let prevent;
+ let firstRender = true;
+ const hydrate = isHydrate(this);
+ this.update = () => {
+ if (!prevent) {
+ prevent = true;
+ this.updated = (this.updated || this.mounted).then(() => {
+ try {
+ const result = hooks.load(this._render);
+ const cleanUseLayoutEffects = hooks.cleanEffects();
+ result && //@ts-ignore
+ result.render(this, this.symbolId, hydrate);
+ prevent = false;
+ if (firstRender && !hooks.isSuspense()) {
+ firstRender = false;
+ !hydrate && applyStyles(this);
+ }
+ return cleanUseLayoutEffects();
+ } finally {
+ prevent = false;
+ }
+ }).then(
+ /**
+ * @param {import("internal/hooks.js").CleanUseEffects} [cleanUseEffect]
+ */
+ (cleanUseEffect) => {
+ cleanUseEffect && cleanUseEffect();
+ }
+ );
+ }
+ return this.updated;
+ };
+ this.update();
+ }
+ connectedCallback() {
+ this.mount();
+ super.connectedCallback && super.connectedCallback();
+ }
+ disconnectedCallback() {
+ super.disconnectedCallback && super.disconnectedCallback();
+ this.unmount();
+ }
+ /**
+ * @this {import("dom").AtomicoThisInternal}
+ * @param {string} attr
+ * @param {(string|null)} oldValue
+ * @param {(string|null)} value
+ */
+ attributeChangedCallback(attr, oldValue, value) {
+ if (attrs[attr]) {
+ if (attr === this._ignoreAttr || oldValue === value) return;
+ const { prop, type } = attrs[attr];
+ try {
+ this[prop] = transformValue(type, value);
+ } catch (e2) {
+ throw new ParseError(
+ this,
+ `The value defined as attr '${attr}' cannot be parsed by type '${type.name}'`,
+ value
+ );
+ }
+ } else {
+ super.attributeChangedCallback(attr, oldValue, value);
+ }
+ }
+ static get props() {
+ return __spreadValues(__spreadValues({}, super.props), props);
+ }
+ static get observedAttributes() {
+ const superAttrs = super.observedAttributes || [];
+ for (const prop in props) {
+ setPrototype(this.prototype, prop, props[prop], attrs, values);
+ }
+ return Object.keys(attrs).concat(superAttrs);
+ }
+ }
+ return AtomicoElement;
+ };
+ function applyStyles(host) {
+ const { styles } = host.constructor;
+ const { shadowRoot } = host;
+ if (shadowRoot && styles.length) {
+ const sheets = [];
+ flat(styles, (value) => {
+ if (value) {
+ if (value instanceof Element) {
+ shadowRoot.appendChild(value.cloneNode(true));
+ } else {
+ sheets.push(value);
+ }
+ }
+ });
+ if (sheets.length) shadowRoot.adoptedStyleSheets = sheets;
+ }
+ }
+
+ // node_modules/atomico/src/hooks/use-effect.js
+ var createEffect = (type) => (currentEffect, currentArgs) => {
+ useHook(
+ /**
+ * Clean the effect hook
+ * @type {import("internal/hooks.js").CollectorEffect}
+ */
+ ([collector, args] = []) => {
+ if (args || !args) {
+ if (args && isEqualArray(args, currentArgs)) {
+ collector = collector || true;
+ } else {
+ isFunction(collector) && collector();
+ collector = null;
+ }
+ }
+ return [collector, currentArgs];
+ },
+ /**
+ * @returns {any}
+ */
+ ([collector, args], unmounted) => {
+ if (unmounted) {
+ isFunction(collector) && collector();
+ return [];
+ } else {
+ return [collector ? collector : currentEffect(), args];
+ }
+ },
+ type
+ );
+ };
+ var useLayoutEffect = createEffect(IdLayoutEffect);
+ var useEffect = createEffect(IdEffect);
+ var useInsertionEffect = createEffect(IdInsertionEffect);
+
+ // node_modules/atomico/src/options.js
+ var ID3 = SymbolFor("atomico/options");
+ globalThis[ID3] = globalThis[ID3] || {
+ sheet: !!document.adoptedStyleSheets
+ };
+ var options = globalThis[ID3];
+
+ // node_modules/atomico/src/loaded.js
+ var DOMLoaded = new Promise((resolve) => {
+ if (!options.ssr) {
+ if (document.readyState === "loading") {
+ addListener(document, "DOMContentLoaded", resolve);
+ } else {
+ resolve();
+ }
+ }
+ });
+
+ // node_modules/atomico/src/render.js
+ var VAL_FROM_PROPS = {
+ checked: 1,
+ value: 1,
+ selected: 1
+ };
+ var PROPS_AS_ATTRS = {
+ list: 1,
+ type: 1,
+ size: 1,
+ form: 1,
+ width: 1,
+ height: 1,
+ src: 1,
+ href: 1,
+ slot: 1
+ };
+ var INTERNAL_PROPS = {
+ shadowDom: 1,
+ staticNode: 1,
+ cloneNode: 1,
+ children: 1,
+ key: 1
+ };
+ var EMPTY_PROPS = {};
+ var EMPTY_CHILDREN = [];
+ var Mark2 = class extends Text {
+ };
+ var ID4 = SymbolFor("atomico/id");
+ var TYPE = SymbolFor("atomico/type");
+ var TYPE_NODE = SymbolFor("atomico/ref");
+ var TYPE_VNODE = SymbolFor("atomico/vnode");
+ var Fragment2 = () => {
+ };
+ function RENDER(node2, id, hydrate) {
+ return diff(this, node2, id, hydrate);
+ }
+ var h2 = (type, p4, ...args) => {
+ const props = p4 || EMPTY_PROPS;
+ let { children } = props;
+ children = children != null ? children : args.length ? args : EMPTY_CHILDREN;
+ if (type === Fragment2) {
+ return children;
+ }
+ const raw = type ? type instanceof Node ? 1 : (
+ //@ts-ignore
+ type.prototype instanceof HTMLElement && 2
+ ) : 0;
+ if (raw === false && type instanceof Function) {
+ return type(
+ children != EMPTY_CHILDREN ? __spreadValues({ children }, props) : props
+ );
+ }
+ const render = options.render || RENDER;
+ const vnode = {
+ [TYPE]: TYPE_VNODE,
+ type,
+ props,
+ children,
+ key: props.key,
+ // key for lists by keys
+ // define if the node declares its shadowDom
+ shadow: props.shadowDom,
+ // allows renderings to run only once
+ static: props.staticNode,
+ // defines whether the type is a childNode `1` or a constructor `2`
+ raw,
+ // defines whether to use the second parameter for document.createElement
+ is: props.is,
+ // clone the node if it comes from a reference
+ clone: props.cloneNode,
+ render
+ };
+ return vnode;
+ };
+ function diff(newVnode, node2, id = ID4, hydrate, isSvg) {
+ let isNewNode;
+ if (node2 && node2[id] && node2[id].vnode == newVnode || newVnode[TYPE] != TYPE_VNODE)
+ return node2;
+ if (newVnode || !node2) {
+ isSvg = isSvg || newVnode.type == "svg";
+ isNewNode = newVnode.type != "host" && (newVnode.raw == 1 ? (node2 && newVnode.clone ? node2[TYPE_NODE] : node2) != newVnode.type : newVnode.raw == 2 ? !(node2 instanceof newVnode.type) : node2 ? node2[TYPE_NODE] || node2.localName != newVnode.type : !node2);
+ if (isNewNode && newVnode.type != null) {
+ if (newVnode.raw == 1 && newVnode.clone) {
+ hydrate = true;
+ node2 = newVnode.type.cloneNode(true);
+ node2[TYPE_NODE] = newVnode.type;
+ } else {
+ node2 = newVnode.raw == 1 ? newVnode.type : newVnode.raw == 2 ? new newVnode.type() : isSvg ? document.createElementNS(
+ "http://www.w3.org/2000/svg",
+ newVnode.type
+ ) : document.createElement(
+ newVnode.type,
+ newVnode.is ? { is: newVnode.is } : void 0
+ );
+ }
+ }
+ }
+ const oldVNodeStore = node2[id] ? node2[id] : EMPTY_PROPS;
+ const { vnode = EMPTY_PROPS, cycle = 0 } = oldVNodeStore;
+ let { fragment, handlers: handlers2 } = oldVNodeStore;
+ const { children = EMPTY_CHILDREN, props = EMPTY_PROPS } = vnode;
+ handlers2 = isNewNode ? {} : handlers2 || {};
+ if (newVnode.static && !isNewNode) return node2;
+ newVnode.shadow && !node2.shadowRoot && // @ts-ignore
+ node2.attachShadow(__spreadValues({ mode: "open" }, newVnode.shadow));
+ newVnode.props != props && diffProps(node2, props, newVnode.props, handlers2, isSvg);
+ if (newVnode.children !== children) {
+ const nextParent = newVnode.shadow ? node2.shadowRoot : node2;
+ fragment = renderChildren(
+ newVnode.children,
+ /**
+ * @todo for hydration use attribute and send childNodes
+ */
+ fragment,
+ nextParent,
+ id,
+ // add support to foreignObject, children will escape from svg
+ !cycle && hydrate,
+ isSvg && newVnode.type == "foreignObject" ? false : isSvg
+ );
+ }
+ node2[id] = { vnode: newVnode, handlers: handlers2, fragment, cycle: cycle + 1 };
+ return node2;
+ }
+ function createFragment(parent, hydrate) {
+ const markStart = new Mark2("");
+ const markEnd = new Mark2("");
+ let node2;
+ parent[hydrate ? "prepend" : "append"](markStart);
+ if (hydrate) {
+ let { lastElementChild } = parent;
+ while (lastElementChild) {
+ const { previousElementSibling } = lastElementChild;
+ if (isHydrate(lastElementChild, true) && !isHydrate(previousElementSibling, true)) {
+ node2 = lastElementChild;
+ break;
+ }
+ lastElementChild = previousElementSibling;
+ }
+ }
+ if (node2) {
+ node2.before(markEnd);
+ } else {
+ parent.append(markEnd);
+ }
+ return {
+ markStart,
+ markEnd
+ };
+ }
+ function renderChildren(children, fragment, parent, id, hydrate, isSvg) {
+ children = children == null ? null : isArray(children) ? children : [children];
+ const nextFragment = fragment || createFragment(parent, hydrate);
+ const { markStart, markEnd, keyes } = nextFragment;
+ let nextKeyes;
+ const removeNodes = keyes && /* @__PURE__ */ new Set();
+ let currentNode = markStart;
+ children && flat(children, (child) => {
+ if (typeof child == "object" && !child[TYPE]) {
+ return;
+ }
+ const key = child[TYPE] && child.key;
+ const childKey = keyes && key != null && keyes.get(key);
+ if (currentNode != markEnd && currentNode === childKey) {
+ removeNodes.delete(currentNode);
+ } else {
+ currentNode = currentNode == markEnd ? markEnd : currentNode.nextSibling;
+ }
+ const childNode = keyes ? childKey : currentNode;
+ let nextChildNode = childNode;
+ if (!child[TYPE]) {
+ const text5 = child + "";
+ if (!(nextChildNode instanceof Text) || nextChildNode instanceof Mark2) {
+ nextChildNode = new Text(text5);
+ } else if (nextChildNode.data != text5) {
+ nextChildNode.data = text5;
+ }
+ } else {
+ nextChildNode = diff(child, childNode, id, hydrate, isSvg);
+ }
+ if (nextChildNode != currentNode) {
+ keyes && removeNodes.delete(nextChildNode);
+ if (!childNode || keyes) {
+ parent.insertBefore(nextChildNode, currentNode);
+ keyes && currentNode != markEnd && removeNodes.add(currentNode);
+ } else if (childNode == markEnd) {
+ parent.insertBefore(nextChildNode, markEnd);
+ } else {
+ parent.replaceChild(nextChildNode, childNode);
+ currentNode = nextChildNode;
+ }
+ }
+ if (key != null) {
+ nextKeyes = nextKeyes || /* @__PURE__ */ new Map();
+ nextKeyes.set(key, nextChildNode);
+ }
+ });
+ currentNode = currentNode == markEnd ? markEnd : currentNode.nextSibling;
+ if (fragment && currentNode != markEnd) {
+ while (currentNode != markEnd) {
+ const nodeToRemove = currentNode;
+ currentNode = currentNode.nextSibling;
+ nodeToRemove.remove();
+ }
+ }
+ removeNodes && removeNodes.forEach((node2) => node2.remove());
+ nextFragment.keyes = nextKeyes;
+ return nextFragment;
+ }
+ function diffProps(node2, props, nextProps, handlers2, isSvg) {
+ for (const key in props) {
+ !(key in nextProps) && setProperty(node2, key, props[key], null, isSvg, handlers2);
+ }
+ for (const key in nextProps) {
+ setProperty(node2, key, props[key], nextProps[key], isSvg, handlers2);
+ }
+ }
+ function setProperty(node2, key, prevValue, nextValue, isSvg, handlers2) {
+ key = key == "class" && !isSvg ? "className" : key;
+ prevValue = prevValue == null ? null : prevValue;
+ nextValue = nextValue == null ? null : nextValue;
+ if (key in node2 && VAL_FROM_PROPS[key]) {
+ prevValue = node2[key];
+ }
+ if (nextValue === prevValue || INTERNAL_PROPS[key] || key[0] == "_") return;
+ if (node2.localName === "slot" && key === "assignNode" && "assign" in node2) {
+ node2.assign(nextValue);
+ } else if (key[0] == "o" && key[1] == "n" && (isFunction(nextValue) || isFunction(prevValue))) {
+ setEvent(node2, key.slice(2), nextValue, handlers2);
+ } else if (key == "ref") {
+ if (nextValue) {
+ if (isFunction(nextValue)) {
+ nextValue(node2);
+ } else {
+ nextValue.current = node2;
+ }
+ }
+ } else if (key == "style") {
+ const { style: style2 } = node2;
+ prevValue = prevValue || "";
+ nextValue = nextValue || "";
+ const prevIsObject = isObject(prevValue);
+ const nextIsObject = isObject(nextValue);
+ if (prevIsObject) {
+ for (const key2 in prevValue) {
+ if (nextIsObject) {
+ !(key2 in nextValue) && setPropertyStyle(style2, key2, null);
+ } else {
+ break;
+ }
+ }
+ }
+ if (nextIsObject) {
+ for (const key2 in nextValue) {
+ const value = nextValue[key2];
+ if (prevIsObject && prevValue[key2] === value) continue;
+ setPropertyStyle(style2, key2, value);
+ }
+ } else {
+ style2.cssText = nextValue;
+ }
+ } else {
+ const attr = key[0] == "$" ? key.slice(1) : key;
+ if (attr === key && (!isSvg && !PROPS_AS_ATTRS[key] && key in node2 || isFunction(nextValue) || isFunction(prevValue))) {
+ node2[key] = nextValue == null ? "" : nextValue;
+ } else if (nextValue == null) {
+ node2.removeAttribute(attr);
+ } else {
+ node2.setAttribute(
+ attr,
+ isObject(nextValue) ? JSON.stringify(nextValue) : nextValue
+ );
+ }
+ }
+ }
+ function setEvent(node2, type, nextHandler, handlers2) {
+ if (!handlers2.handleEvent) {
+ handlers2.handleEvent = (event) => handlers2[event.type].call(node2, event);
+ }
+ if (nextHandler) {
+ if (!handlers2[type]) {
+ const options2 = nextHandler.capture || nextHandler.once || nextHandler.passive ? Object.assign({}, nextHandler) : null;
+ node2.addEventListener(type, handlers2, options2);
+ }
+ handlers2[type] = nextHandler;
+ } else {
+ if (handlers2[type]) {
+ node2.removeEventListener(type, handlers2);
+ delete handlers2[type];
+ }
+ }
+ }
+ function setPropertyStyle(style2, key, value) {
+ let method = "setProperty";
+ if (value == null) {
+ method = "removeProperty";
+ value = null;
+ }
+ if (~key.indexOf("-")) {
+ style2[method](key, value);
+ } else {
+ style2[key] = value;
+ }
+ }
+
+ // node_modules/atomico/src/context.js
+ var CONTEXT_TEMPLATE = h2("host", { style: "display: contents" });
+ var CONTEXT_VALUE = "value";
+ var useProvider = (id, value) => {
+ const host = useHost();
+ const ref = useRef();
+ useInsertionEffect(
+ () => addListener(
+ host.current,
+ "ConnectContext",
+ /**
+ * @param {CustomEvent} event
+ */
+ (event) => {
+ const target = event.composedPath().at(0);
+ if (target !== event.currentTarget && id === event.detail.id) {
+ event.stopPropagation();
+ event.detail.connect(ref);
+ }
+ }
+ ),
+ [id]
+ );
+ ref.current = value;
+ };
+ var createContext = (value) => {
+ const Context = c4(
+ ({ value: value2 }) => {
+ useProvider(Context, value2);
+ return CONTEXT_TEMPLATE;
+ },
+ {
+ props: {
+ value: {
+ type: Object,
+ value: () => value
+ }
+ }
+ }
+ );
+ Context[CONTEXT_VALUE] = value;
+ return Context;
+ };
+
+ // node_modules/atomico/src/hooks/custom-hooks/use-suspense.js
+ var SuspenseContext = createContext({
+ /**
+ *
+ * @param {string} type
+ * @param {string} id
+ */
+ dispatch(type, id) {
+ }
+ });
+
+ // node_modules/atomico/src/css.js
+ var SHEETS = {};
+ function css(template2, ...args) {
+ const cssText = (template2.raw || template2).reduce(
+ (cssText2, part, i2) => cssText2 + part + (args[i2] || ""),
+ ""
+ );
+ return SHEETS[cssText] = SHEETS[cssText] || createSheet(cssText);
+ }
+ function createSheet(cssText) {
+ if (options.sheet) {
+ const sheet = new CSSStyleSheet();
+ sheet.replaceSync(cssText);
+ return sheet;
+ } else {
+ const sheet = document.createElement("style");
+ sheet.textContent = cssText;
+ return sheet;
+ }
+ }
+
+ // node_modules/atomico/html.js
+ var MODE_SLASH = 0;
+ var MODE_TEXT = 1;
+ var MODE_WHITESPACE = 2;
+ var MODE_TAGNAME = 3;
+ var MODE_COMMENT = 4;
+ var MODE_PROP_SET = 5;
+ var MODE_PROP_APPEND = 6;
+ var CHILD_APPEND = 0;
+ var CHILD_RECURSE = 2;
+ var TAG_SET = 3;
+ var PROPS_ASSIGN = 4;
+ var PROP_SET = MODE_PROP_SET;
+ var PROP_APPEND = MODE_PROP_APPEND;
+ var evaluate = (h5, built, fields, args) => {
+ let tmp;
+ built[0] = 0;
+ for (let i2 = 1; i2 < built.length; i2++) {
+ const type = built[i2++];
+ const value = built[i2] ? (built[0] |= type ? 1 : 2, fields[built[i2++]]) : built[++i2];
+ if (type === TAG_SET) {
+ args[0] = value;
+ } else if (type === PROPS_ASSIGN) {
+ args[1] = Object.assign(args[1] || {}, value);
+ } else if (type === PROP_SET) {
+ (args[1] = args[1] || {})[built[++i2]] = value;
+ } else if (type === PROP_APPEND) {
+ args[1][built[++i2]] += value + "";
+ } else if (type) {
+ tmp = h5.apply(value, evaluate(h5, value, fields, ["", null]));
+ args.push(tmp);
+ if (value[0]) {
+ built[0] |= 2;
+ } else {
+ built[i2 - 2] = CHILD_APPEND;
+ built[i2] = tmp;
+ }
+ } else {
+ args.push(value);
+ }
+ }
+ return args;
+ };
+ var build = function(statics) {
+ let mode = MODE_TEXT;
+ let buffer = "";
+ let quote = "";
+ let current = [0];
+ let char, propName;
+ const commit = (field) => {
+ if (mode === MODE_TEXT && (field || (buffer = buffer.replace(/^\s*\n\s*|\s*\n\s*$/g, "")))) {
+ {
+ current.push(CHILD_APPEND, field, buffer);
+ }
+ } else if (mode === MODE_TAGNAME && (field || buffer)) {
+ {
+ current.push(TAG_SET, field, buffer);
+ }
+ mode = MODE_WHITESPACE;
+ } else if (mode === MODE_WHITESPACE && buffer === "..." && field) {
+ {
+ current.push(PROPS_ASSIGN, field, 0);
+ }
+ } else if (mode === MODE_WHITESPACE && buffer && !field) {
+ {
+ current.push(PROP_SET, 0, true, buffer);
+ }
+ } else if (mode >= MODE_PROP_SET) {
+ {
+ if (buffer || !field && mode === MODE_PROP_SET) {
+ current.push(mode, 0, buffer, propName);
+ mode = MODE_PROP_APPEND;
+ }
+ if (field) {
+ current.push(mode, field, 0, propName);
+ mode = MODE_PROP_APPEND;
+ }
+ }
+ }
+ buffer = "";
+ };
+ for (let i2 = 0; i2 < statics.length; i2++) {
+ if (i2) {
+ if (mode === MODE_TEXT) {
+ commit();
+ }
+ commit(i2);
+ }
+ for (let j6 = 0; j6 < statics[i2].length; j6++) {
+ char = statics[i2][j6];
+ if (mode === MODE_TEXT) {
+ if (char === "<") {
+ commit();
+ {
+ current = [current];
+ }
+ mode = MODE_TAGNAME;
+ } else {
+ buffer += char;
+ }
+ } else if (mode === MODE_COMMENT) {
+ if (buffer === "--" && char === ">") {
+ mode = MODE_TEXT;
+ buffer = "";
+ } else {
+ buffer = char + buffer[0];
+ }
+ } else if (quote) {
+ if (char === quote) {
+ quote = "";
+ } else {
+ buffer += char;
+ }
+ } else if (char === '"' || char === "'") {
+ quote = char;
+ } else if (char === ">") {
+ commit();
+ mode = MODE_TEXT;
+ } else if (!mode) ;
+ else if (char === "=") {
+ mode = MODE_PROP_SET;
+ propName = buffer;
+ buffer = "";
+ } else if (char === "/" && (mode < MODE_PROP_SET || statics[i2][j6 + 1] === ">")) {
+ commit();
+ if (mode === MODE_TAGNAME) {
+ current = current[0];
+ }
+ mode = current;
+ {
+ (current = current[0]).push(CHILD_RECURSE, 0, mode);
+ }
+ mode = MODE_SLASH;
+ } else if (char === " " || char === " " || char === "\n" || char === "\r") {
+ commit();
+ mode = MODE_WHITESPACE;
+ } else {
+ buffer += char;
+ }
+ if (mode === MODE_TAGNAME && buffer === "!--") {
+ mode = MODE_COMMENT;
+ current = current[0];
+ }
+ }
+ }
+ commit();
+ return current;
+ };
+ var CACHE = /* @__PURE__ */ new Map();
+ function html2(statics) {
+ let tmp = CACHE;
+ tmp = evaluate(
+ h2,
+ tmp.get(statics) || (tmp.set(statics, tmp = build(statics)), tmp),
+ arguments,
+ []
+ );
+ return tmp.length > 1 ? tmp : tmp[0];
+ }
+
+ // node_modules/@milkdown/utils/node_modules/nanoid/index.browser.js
+ var random = (bytes) => crypto.getRandomValues(new Uint8Array(bytes));
+ var customRandom = (alphabet, defaultSize, getRandom) => {
+ let mask = (2 << Math.log(alphabet.length - 1) / Math.LN2) - 1;
+ let step = -~(1.6 * mask * defaultSize / alphabet.length);
+ return (size = defaultSize) => {
+ let id = "";
+ while (true) {
+ let bytes = getRandom(step);
+ let j6 = step;
+ while (j6--) {
+ id += alphabet[bytes[j6] & mask] || "";
+ if (id.length === size) return id;
+ }
+ }
+ };
+ };
+ var customAlphabet = (alphabet, size = 21) => customRandom(alphabet, size, random);
+
+ // node_modules/@milkdown/utils/lib/index.es.js
+ var J4 = customAlphabet("abcedfghicklmn", 10);
+ function re2(n4, o2) {
+ const r3 = Et(n4), t2 = (e2) => async () => {
+ t2.key = r3, await e2.wait(J3);
+ const a2 = o2(e2);
+ return e2.get(je).create(r3, a2), t2.run = (s2) => e2.get(je).call(n4, s2), () => {
+ e2.get(je).remove(r3);
+ };
+ };
+ return t2;
+ }
+ function oe2(n4) {
+ const o2 = (r3) => async () => {
+ await r3.wait(R3);
+ const t2 = n4(r3);
+ return r3.update(ue, (e2) => [...e2, t2]), o2.inputRule = t2, () => {
+ r3.update(ue, (e2) => e2.filter((a2) => a2 !== t2));
+ };
+ };
+ return o2;
+ }
+ function Q3(n4, o2) {
+ const r3 = (t2) => async () => {
+ const e2 = o2(t2);
+ return t2.update(Z2, (a2) => [...a2.filter((s2) => s2[0] !== n4), [n4, e2]]), r3.id = n4, r3.schema = e2, () => {
+ t2.update(Z2, (a2) => a2.filter(([s2]) => s2 !== n4));
+ };
+ };
+ return r3.type = (t2) => {
+ const e2 = t2.get(b2).marks[n4];
+ if (!e2)
+ throw x(n4);
+ return e2;
+ }, r3;
+ }
+ function W3(n4, o2) {
+ const r3 = (t2) => async () => {
+ const e2 = o2(t2);
+ return t2.update(X, (a2) => [...a2.filter((s2) => s2[0] !== n4), [n4, e2]]), r3.id = n4, r3.schema = e2, () => {
+ t2.update(X, (a2) => a2.filter(([s2]) => s2 !== n4));
+ };
+ };
+ return r3.type = (t2) => {
+ const e2 = t2.get(b2).nodes[n4];
+ if (!e2)
+ throw M(n4);
+ return e2;
+ }, r3;
+ }
+ function ue2(n4) {
+ let o2;
+ const r3 = (t2) => async () => (await t2.wait(R3), o2 = n4(t2), t2.update(N2, (e2) => [...e2, o2]), () => {
+ t2.update(N2, (e2) => e2.filter((a2) => a2 !== o2));
+ });
+ return r3.plugin = () => o2, r3.key = () => o2.spec.key, r3;
+ }
+ function X2(n4) {
+ const o2 = (r3) => async () => {
+ await r3.wait(R3);
+ const t2 = n4(r3), e2 = keymap(t2);
+ return r3.update(N2, (a2) => [...a2, e2]), o2.keymap = t2, () => {
+ r3.update(N2, (a2) => a2.filter((s2) => s2 !== e2));
+ };
+ };
+ return o2;
+ }
+ function le(n4, o2) {
+ const r3 = (t2) => async () => {
+ await t2.wait(R3);
+ const e2 = o2(t2);
+ return n4.type(t2) instanceof NodeType ? t2.update(fe, (a2) => [...a2, [n4.id, e2]]) : t2.update(ye, (a2) => [...a2, [n4.id, e2]]), r3.view = e2, r3.type = n4, () => {
+ n4.type(t2) instanceof NodeType ? t2.update(fe, (a2) => a2.filter((s2) => s2[0] !== n4.id)) : t2.update(ye, (a2) => a2.filter((s2) => s2[0] !== n4.id));
+ };
+ };
+ return r3;
+ }
+ function h3(n4, o2) {
+ const r3 = H(n4, o2), t2 = (e2) => (e2.inject(r3), () => () => {
+ e2.remove(r3);
+ });
+ return t2.key = r3, t2;
+ }
+ function fe2(n4, o2) {
+ const r3 = h3(o2, n4), t2 = W3(n4, (a2) => a2.get(r3.key)(a2)), e2 = [r3, t2];
+ return e2.id = t2.id, e2.node = t2, e2.type = (a2) => t2.type(a2), e2.schema = t2.schema, e2.ctx = r3, e2.key = r3.key, e2.extendSchema = (a2) => (s2) => () => {
+ const i2 = s2.get(r3.key), c6 = a2(i2)(s2);
+ s2.update(X, (m3) => [...m3.filter((S8) => S8[0] !== n4), [n4, c6]]), e2.schema = c6;
+ }, e2;
+ }
+ function ye2(n4, o2) {
+ const r3 = h3(o2, n4), t2 = Q3(n4, (a2) => a2.get(r3.key)(a2)), e2 = [r3, t2];
+ return e2.id = t2.id, e2.mark = t2, e2.type = t2.type, e2.schema = t2.schema, e2.ctx = r3, e2.key = r3.key, e2.extendSchema = (a2) => (s2) => () => {
+ const i2 = s2.get(r3.key), c6 = a2(i2)(s2);
+ s2.update(Z2, (m3) => [...m3.filter((S8) => S8[0] !== n4), [n4, c6]]), e2.schema = c6;
+ }, e2;
+ }
+ function ge2(n4, o2) {
+ const r3 = Object.fromEntries(Object.entries(o2).map(([s2, { shortcuts: i2 }]) => [s2, i2])), t2 = h3(r3, `${n4}Keymap`), e2 = X2((s2) => {
+ const i2 = s2.get(t2.key), u4 = Object.entries(o2).flatMap(([c6, { command: m3 }]) => [i2[c6]].flat().map((V4) => [V4, m3(s2)]));
+ return Object.fromEntries(u4);
+ }), a2 = [t2, e2];
+ return a2.ctx = t2, a2.shortcuts = e2, a2.key = t2.key, a2.keymap = e2.keymap, a2;
+ }
+ var he = (n4, o2 = () => ({})) => h3(o2, `${n4}Attr`);
+ var we2 = (n4, o2 = () => ({})) => h3(o2, `${n4}Attr`);
+ function ke2(n4, o2, r3) {
+ const t2 = h3(r3 != null ? r3 : {}, n4), e2 = (s2) => async () => {
+ await s2.wait(M4);
+ const u4 = {
+ plugin: o2(s2),
+ options: s2.get(t2.key)
+ };
+ return s2.update(pe, (c6) => [...c6, u4]), () => {
+ s2.update(pe, (c6) => c6.filter((m3) => m3 !== u4));
+ };
+ }, a2 = [t2, e2];
+ return a2.id = n4, a2.plugin = e2, a2.options = t2, a2;
+ }
+
+ // node_modules/escape-string-regexp/index.js
+ function escapeStringRegexp(string3) {
+ if (typeof string3 !== "string") {
+ throw new TypeError("Expected a string");
+ }
+ return string3.replace(/[|\\{}()[\]^$+*?.]/g, "\\$&").replace(/-/g, "\\x2d");
+ }
+
+ // node_modules/@sindresorhus/transliterate/replacements.js
+ var replacements = [
+ // German umlauts
+ ["\xDF", "ss"],
+ ["\u1E9E", "Ss"],
+ ["\xE4", "ae"],
+ ["\xC4", "Ae"],
+ ["\xF6", "oe"],
+ ["\xD6", "Oe"],
+ ["\xFC", "ue"],
+ ["\xDC", "Ue"],
+ // Latin
+ ["\xC0", "A"],
+ ["\xC1", "A"],
+ ["\xC2", "A"],
+ ["\xC3", "A"],
+ ["\xC4", "Ae"],
+ ["\xC5", "A"],
+ ["\xC6", "AE"],
+ ["\xC7", "C"],
+ ["\xC8", "E"],
+ ["\xC9", "E"],
+ ["\xCA", "E"],
+ ["\xCB", "E"],
+ ["\xCC", "I"],
+ ["\xCD", "I"],
+ ["\xCE", "I"],
+ ["\xCF", "I"],
+ ["\xD0", "D"],
+ ["\xD1", "N"],
+ ["\xD2", "O"],
+ ["\xD3", "O"],
+ ["\xD4", "O"],
+ ["\xD5", "O"],
+ ["\xD6", "Oe"],
+ ["\u0150", "O"],
+ ["\xD8", "O"],
+ ["\xD9", "U"],
+ ["\xDA", "U"],
+ ["\xDB", "U"],
+ ["\xDC", "Ue"],
+ ["\u0170", "U"],
+ ["\xDD", "Y"],
+ ["\xDE", "TH"],
+ ["\xDF", "ss"],
+ ["\xE0", "a"],
+ ["\xE1", "a"],
+ ["\xE2", "a"],
+ ["\xE3", "a"],
+ ["\xE4", "ae"],
+ ["\xE5", "a"],
+ ["\xE6", "ae"],
+ ["\xE7", "c"],
+ ["\xE8", "e"],
+ ["\xE9", "e"],
+ ["\xEA", "e"],
+ ["\xEB", "e"],
+ ["\xEC", "i"],
+ ["\xED", "i"],
+ ["\xEE", "i"],
+ ["\xEF", "i"],
+ ["\xF0", "d"],
+ ["\xF1", "n"],
+ ["\xF2", "o"],
+ ["\xF3", "o"],
+ ["\xF4", "o"],
+ ["\xF5", "o"],
+ ["\xF6", "oe"],
+ ["\u0151", "o"],
+ ["\xF8", "o"],
+ ["\xF9", "u"],
+ ["\xFA", "u"],
+ ["\xFB", "u"],
+ ["\xFC", "ue"],
+ ["\u0171", "u"],
+ ["\xFD", "y"],
+ ["\xFE", "th"],
+ ["\xFF", "y"],
+ ["\u1E9E", "SS"],
+ // Vietnamese
+ ["\xE0", "a"],
+ ["\xC0", "A"],
+ ["\xE1", "a"],
+ ["\xC1", "A"],
+ ["\xE2", "a"],
+ ["\xC2", "A"],
+ ["\xE3", "a"],
+ ["\xC3", "A"],
+ ["\xE8", "e"],
+ ["\xC8", "E"],
+ ["\xE9", "e"],
+ ["\xC9", "E"],
+ ["\xEA", "e"],
+ ["\xCA", "E"],
+ ["\xEC", "i"],
+ ["\xCC", "I"],
+ ["\xED", "i"],
+ ["\xCD", "I"],
+ ["\xF2", "o"],
+ ["\xD2", "O"],
+ ["\xF3", "o"],
+ ["\xD3", "O"],
+ ["\xF4", "o"],
+ ["\xD4", "O"],
+ ["\xF5", "o"],
+ ["\xD5", "O"],
+ ["\xF9", "u"],
+ ["\xD9", "U"],
+ ["\xFA", "u"],
+ ["\xDA", "U"],
+ ["\xFD", "y"],
+ ["\xDD", "Y"],
+ ["\u0103", "a"],
+ ["\u0102", "A"],
+ ["\u0110", "D"],
+ ["\u0111", "d"],
+ ["\u0129", "i"],
+ ["\u0128", "I"],
+ ["\u0169", "u"],
+ ["\u0168", "U"],
+ ["\u01A1", "o"],
+ ["\u01A0", "O"],
+ ["\u01B0", "u"],
+ ["\u01AF", "U"],
+ ["\u1EA1", "a"],
+ ["\u1EA0", "A"],
+ ["\u1EA3", "a"],
+ ["\u1EA2", "A"],
+ ["\u1EA5", "a"],
+ ["\u1EA4", "A"],
+ ["\u1EA7", "a"],
+ ["\u1EA6", "A"],
+ ["\u1EA9", "a"],
+ ["\u1EA8", "A"],
+ ["\u1EAB", "a"],
+ ["\u1EAA", "A"],
+ ["\u1EAD", "a"],
+ ["\u1EAC", "A"],
+ ["\u1EAF", "a"],
+ ["\u1EAE", "A"],
+ ["\u1EB1", "a"],
+ ["\u1EB0", "A"],
+ ["\u1EB3", "a"],
+ ["\u1EB2", "A"],
+ ["\u1EB5", "a"],
+ ["\u1EB4", "A"],
+ ["\u1EB7", "a"],
+ ["\u1EB6", "A"],
+ ["\u1EB9", "e"],
+ ["\u1EB8", "E"],
+ ["\u1EBB", "e"],
+ ["\u1EBA", "E"],
+ ["\u1EBD", "e"],
+ ["\u1EBC", "E"],
+ ["\u1EBF", "e"],
+ ["\u1EBE", "E"],
+ ["\u1EC1", "e"],
+ ["\u1EC0", "E"],
+ ["\u1EC3", "e"],
+ ["\u1EC2", "E"],
+ ["\u1EC5", "e"],
+ ["\u1EC4", "E"],
+ ["\u1EC7", "e"],
+ ["\u1EC6", "E"],
+ ["\u1EC9", "i"],
+ ["\u1EC8", "I"],
+ ["\u1ECB", "i"],
+ ["\u1ECA", "I"],
+ ["\u1ECD", "o"],
+ ["\u1ECC", "O"],
+ ["\u1ECF", "o"],
+ ["\u1ECE", "O"],
+ ["\u1ED1", "o"],
+ ["\u1ED0", "O"],
+ ["\u1ED3", "o"],
+ ["\u1ED2", "O"],
+ ["\u1ED5", "o"],
+ ["\u1ED4", "O"],
+ ["\u1ED7", "o"],
+ ["\u1ED6", "O"],
+ ["\u1ED9", "o"],
+ ["\u1ED8", "O"],
+ ["\u1EDB", "o"],
+ ["\u1EDA", "O"],
+ ["\u1EDD", "o"],
+ ["\u1EDC", "O"],
+ ["\u1EDF", "o"],
+ ["\u1EDE", "O"],
+ ["\u1EE1", "o"],
+ ["\u1EE0", "O"],
+ ["\u1EE3", "o"],
+ ["\u1EE2", "O"],
+ ["\u1EE5", "u"],
+ ["\u1EE4", "U"],
+ ["\u1EE7", "u"],
+ ["\u1EE6", "U"],
+ ["\u1EE9", "u"],
+ ["\u1EE8", "U"],
+ ["\u1EEB", "u"],
+ ["\u1EEA", "U"],
+ ["\u1EED", "u"],
+ ["\u1EEC", "U"],
+ ["\u1EEF", "u"],
+ ["\u1EEE", "U"],
+ ["\u1EF1", "u"],
+ ["\u1EF0", "U"],
+ ["\u1EF3", "y"],
+ ["\u1EF2", "Y"],
+ ["\u1EF5", "y"],
+ ["\u1EF4", "Y"],
+ ["\u1EF7", "y"],
+ ["\u1EF6", "Y"],
+ ["\u1EF9", "y"],
+ ["\u1EF8", "Y"],
+ // Arabic
+ ["\u0621", "e"],
+ ["\u0622", "a"],
+ ["\u0623", "a"],
+ ["\u0624", "w"],
+ ["\u0625", "i"],
+ ["\u0626", "y"],
+ ["\u0627", "a"],
+ ["\u0628", "b"],
+ ["\u0629", "t"],
+ ["\u062A", "t"],
+ ["\u062B", "th"],
+ ["\u062C", "j"],
+ ["\u062D", "h"],
+ ["\u062E", "kh"],
+ ["\u062F", "d"],
+ ["\u0630", "dh"],
+ ["\u0631", "r"],
+ ["\u0632", "z"],
+ ["\u0633", "s"],
+ ["\u0634", "sh"],
+ ["\u0635", "s"],
+ ["\u0636", "d"],
+ ["\u0637", "t"],
+ ["\u0638", "z"],
+ ["\u0639", "e"],
+ ["\u063A", "gh"],
+ ["\u0640", "_"],
+ ["\u0641", "f"],
+ ["\u0642", "q"],
+ ["\u0643", "k"],
+ ["\u0644", "l"],
+ ["\u0645", "m"],
+ ["\u0646", "n"],
+ ["\u0647", "h"],
+ ["\u0648", "w"],
+ ["\u0649", "a"],
+ ["\u064A", "y"],
+ ["\u064E\u200E", "a"],
+ ["\u064F", "u"],
+ ["\u0650\u200E", "i"],
+ ["\u0660", "0"],
+ ["\u0661", "1"],
+ ["\u0662", "2"],
+ ["\u0663", "3"],
+ ["\u0664", "4"],
+ ["\u0665", "5"],
+ ["\u0666", "6"],
+ ["\u0667", "7"],
+ ["\u0668", "8"],
+ ["\u0669", "9"],
+ // Persian / Farsi
+ ["\u0686", "ch"],
+ ["\u06A9", "k"],
+ ["\u06AF", "g"],
+ ["\u067E", "p"],
+ ["\u0698", "zh"],
+ ["\u06CC", "y"],
+ ["\u06F0", "0"],
+ ["\u06F1", "1"],
+ ["\u06F2", "2"],
+ ["\u06F3", "3"],
+ ["\u06F4", "4"],
+ ["\u06F5", "5"],
+ ["\u06F6", "6"],
+ ["\u06F7", "7"],
+ ["\u06F8", "8"],
+ ["\u06F9", "9"],
+ // Pashto
+ ["\u067C", "p"],
+ ["\u0681", "z"],
+ ["\u0685", "c"],
+ ["\u0689", "d"],
+ ["\uFEAB", "d"],
+ ["\uFEAD", "r"],
+ ["\u0693", "r"],
+ ["\uFEAF", "z"],
+ ["\u0696", "g"],
+ ["\u069A", "x"],
+ ["\u06AB", "g"],
+ ["\u06BC", "n"],
+ ["\u06C0", "e"],
+ ["\u06D0", "e"],
+ ["\u06CD", "ai"],
+ // Urdu
+ ["\u0679", "t"],
+ ["\u0688", "d"],
+ ["\u0691", "r"],
+ ["\u06BA", "n"],
+ ["\u06C1", "h"],
+ ["\u06BE", "h"],
+ ["\u06D2", "e"],
+ // Russian
+ ["\u0410", "A"],
+ ["\u0430", "a"],
+ ["\u0411", "B"],
+ ["\u0431", "b"],
+ ["\u0412", "V"],
+ ["\u0432", "v"],
+ ["\u0413", "G"],
+ ["\u0433", "g"],
+ ["\u0414", "D"],
+ ["\u0434", "d"],
+ ["\u044A\u0435", "ye"],
+ ["\u042A\u0435", "Ye"],
+ ["\u044A\u0415", "yE"],
+ ["\u042A\u0415", "YE"],
+ ["\u0415", "E"],
+ ["\u0435", "e"],
+ ["\u0401", "Yo"],
+ ["\u0451", "yo"],
+ ["\u0416", "Zh"],
+ ["\u0436", "zh"],
+ ["\u0417", "Z"],
+ ["\u0437", "z"],
+ ["\u0418", "I"],
+ ["\u0438", "i"],
+ ["\u044B\u0439", "iy"],
+ ["\u042B\u0439", "Iy"],
+ ["\u042B\u0419", "IY"],
+ ["\u044B\u0419", "iY"],
+ ["\u0419", "Y"],
+ ["\u0439", "y"],
+ ["\u041A", "K"],
+ ["\u043A", "k"],
+ ["\u041B", "L"],
+ ["\u043B", "l"],
+ ["\u041C", "M"],
+ ["\u043C", "m"],
+ ["\u041D", "N"],
+ ["\u043D", "n"],
+ ["\u041E", "O"],
+ ["\u043E", "o"],
+ ["\u041F", "P"],
+ ["\u043F", "p"],
+ ["\u0420", "R"],
+ ["\u0440", "r"],
+ ["\u0421", "S"],
+ ["\u0441", "s"],
+ ["\u0422", "T"],
+ ["\u0442", "t"],
+ ["\u0423", "U"],
+ ["\u0443", "u"],
+ ["\u0424", "F"],
+ ["\u0444", "f"],
+ ["\u0425", "Kh"],
+ ["\u0445", "kh"],
+ ["\u0426", "Ts"],
+ ["\u0446", "ts"],
+ ["\u0427", "Ch"],
+ ["\u0447", "ch"],
+ ["\u0428", "Sh"],
+ ["\u0448", "sh"],
+ ["\u0429", "Sch"],
+ ["\u0449", "sch"],
+ ["\u042A", ""],
+ ["\u044A", ""],
+ ["\u042B", "Y"],
+ ["\u044B", "y"],
+ ["\u042C", ""],
+ ["\u044C", ""],
+ ["\u042D", "E"],
+ ["\u044D", "e"],
+ ["\u042E", "Yu"],
+ ["\u044E", "yu"],
+ ["\u042F", "Ya"],
+ ["\u044F", "ya"],
+ // Romanian
+ ["\u0103", "a"],
+ ["\u0102", "A"],
+ ["\u0219", "s"],
+ ["\u0218", "S"],
+ ["\u021B", "t"],
+ ["\u021A", "T"],
+ ["\u0163", "t"],
+ ["\u0162", "T"],
+ // Turkish
+ ["\u015F", "s"],
+ ["\u015E", "S"],
+ ["\xE7", "c"],
+ ["\xC7", "C"],
+ ["\u011F", "g"],
+ ["\u011E", "G"],
+ ["\u0131", "i"],
+ ["\u0130", "I"],
+ // Armenian
+ ["\u0561", "a"],
+ ["\u0531", "A"],
+ ["\u0562", "b"],
+ ["\u0532", "B"],
+ ["\u0563", "g"],
+ ["\u0533", "G"],
+ ["\u0564", "d"],
+ ["\u0534", "D"],
+ ["\u0565", "ye"],
+ ["\u0535", "Ye"],
+ ["\u0566", "z"],
+ ["\u0536", "Z"],
+ ["\u0567", "e"],
+ ["\u0537", "E"],
+ ["\u0568", "y"],
+ ["\u0538", "Y"],
+ ["\u0569", "t"],
+ ["\u0539", "T"],
+ ["\u056A", "zh"],
+ ["\u053A", "Zh"],
+ ["\u056B", "i"],
+ ["\u053B", "I"],
+ ["\u056C", "l"],
+ ["\u053C", "L"],
+ ["\u056D", "kh"],
+ ["\u053D", "Kh"],
+ ["\u056E", "ts"],
+ ["\u053E", "Ts"],
+ ["\u056F", "k"],
+ ["\u053F", "K"],
+ ["\u0570", "h"],
+ ["\u0540", "H"],
+ ["\u0571", "dz"],
+ ["\u0541", "Dz"],
+ ["\u0572", "gh"],
+ ["\u0542", "Gh"],
+ ["\u0573", "tch"],
+ ["\u0543", "Tch"],
+ ["\u0574", "m"],
+ ["\u0544", "M"],
+ ["\u0575", "y"],
+ ["\u0545", "Y"],
+ ["\u0576", "n"],
+ ["\u0546", "N"],
+ ["\u0577", "sh"],
+ ["\u0547", "Sh"],
+ ["\u0578", "vo"],
+ ["\u0548", "Vo"],
+ ["\u0579", "ch"],
+ ["\u0549", "Ch"],
+ ["\u057A", "p"],
+ ["\u054A", "P"],
+ ["\u057B", "j"],
+ ["\u054B", "J"],
+ ["\u057C", "r"],
+ ["\u054C", "R"],
+ ["\u057D", "s"],
+ ["\u054D", "S"],
+ ["\u057E", "v"],
+ ["\u054E", "V"],
+ ["\u057F", "t"],
+ ["\u054F", "T"],
+ ["\u0580", "r"],
+ ["\u0550", "R"],
+ ["\u0581", "c"],
+ ["\u0551", "C"],
+ ["\u0578\u0582", "u"],
+ ["\u0548\u0552", "U"],
+ ["\u0548\u0582", "U"],
+ ["\u0583", "p"],
+ ["\u0553", "P"],
+ ["\u0584", "q"],
+ ["\u0554", "Q"],
+ ["\u0585", "o"],
+ ["\u0555", "O"],
+ ["\u0586", "f"],
+ ["\u0556", "F"],
+ ["\u0587", "yev"],
+ // Georgian
+ ["\u10D0", "a"],
+ ["\u10D1", "b"],
+ ["\u10D2", "g"],
+ ["\u10D3", "d"],
+ ["\u10D4", "e"],
+ ["\u10D5", "v"],
+ ["\u10D6", "z"],
+ ["\u10D7", "t"],
+ ["\u10D8", "i"],
+ ["\u10D9", "k"],
+ ["\u10DA", "l"],
+ ["\u10DB", "m"],
+ ["\u10DC", "n"],
+ ["\u10DD", "o"],
+ ["\u10DE", "p"],
+ ["\u10DF", "zh"],
+ ["\u10E0", "r"],
+ ["\u10E1", "s"],
+ ["\u10E2", "t"],
+ ["\u10E3", "u"],
+ ["\u10E4", "ph"],
+ ["\u10E5", "q"],
+ ["\u10E6", "gh"],
+ ["\u10E7", "k"],
+ ["\u10E8", "sh"],
+ ["\u10E9", "ch"],
+ ["\u10EA", "ts"],
+ ["\u10EB", "dz"],
+ ["\u10EC", "ts"],
+ ["\u10ED", "tch"],
+ ["\u10EE", "kh"],
+ ["\u10EF", "j"],
+ ["\u10F0", "h"],
+ // Czech
+ ["\u010D", "c"],
+ ["\u010F", "d"],
+ ["\u011B", "e"],
+ ["\u0148", "n"],
+ ["\u0159", "r"],
+ ["\u0161", "s"],
+ ["\u0165", "t"],
+ ["\u016F", "u"],
+ ["\u017E", "z"],
+ ["\u010C", "C"],
+ ["\u010E", "D"],
+ ["\u011A", "E"],
+ ["\u0147", "N"],
+ ["\u0158", "R"],
+ ["\u0160", "S"],
+ ["\u0164", "T"],
+ ["\u016E", "U"],
+ ["\u017D", "Z"],
+ // Dhivehi
+ ["\u0780", "h"],
+ ["\u0781", "sh"],
+ ["\u0782", "n"],
+ ["\u0783", "r"],
+ ["\u0784", "b"],
+ ["\u0785", "lh"],
+ ["\u0786", "k"],
+ ["\u0787", "a"],
+ ["\u0788", "v"],
+ ["\u0789", "m"],
+ ["\u078A", "f"],
+ ["\u078B", "dh"],
+ ["\u078C", "th"],
+ ["\u078D", "l"],
+ ["\u078E", "g"],
+ ["\u078F", "gn"],
+ ["\u0790", "s"],
+ ["\u0791", "d"],
+ ["\u0792", "z"],
+ ["\u0793", "t"],
+ ["\u0794", "y"],
+ ["\u0795", "p"],
+ ["\u0796", "j"],
+ ["\u0797", "ch"],
+ ["\u0798", "tt"],
+ ["\u0799", "hh"],
+ ["\u079A", "kh"],
+ ["\u079B", "th"],
+ ["\u079C", "z"],
+ ["\u079D", "sh"],
+ ["\u079E", "s"],
+ ["\u079F", "d"],
+ ["\u07A0", "t"],
+ ["\u07A1", "z"],
+ ["\u07A2", "a"],
+ ["\u07A3", "gh"],
+ ["\u07A4", "q"],
+ ["\u07A5", "w"],
+ ["\u07A6", "a"],
+ ["\u07A7", "aa"],
+ ["\u07A8", "i"],
+ ["\u07A9", "ee"],
+ ["\u07AA", "u"],
+ ["\u07AB", "oo"],
+ ["\u07AC", "e"],
+ ["\u07AD", "ey"],
+ ["\u07AE", "o"],
+ ["\u07AF", "oa"],
+ ["\u07B0", ""],
+ // Greek
+ ["\u03B1", "a"],
+ ["\u03B2", "v"],
+ ["\u03B3", "g"],
+ ["\u03B4", "d"],
+ ["\u03B5", "e"],
+ ["\u03B6", "z"],
+ ["\u03B7", "i"],
+ ["\u03B8", "th"],
+ ["\u03B9", "i"],
+ ["\u03BA", "k"],
+ ["\u03BB", "l"],
+ ["\u03BC", "m"],
+ ["\u03BD", "n"],
+ ["\u03BE", "ks"],
+ ["\u03BF", "o"],
+ ["\u03C0", "p"],
+ ["\u03C1", "r"],
+ ["\u03C3", "s"],
+ ["\u03C4", "t"],
+ ["\u03C5", "y"],
+ ["\u03C6", "f"],
+ ["\u03C7", "x"],
+ ["\u03C8", "ps"],
+ ["\u03C9", "o"],
+ ["\u03AC", "a"],
+ ["\u03AD", "e"],
+ ["\u03AF", "i"],
+ ["\u03CC", "o"],
+ ["\u03CD", "y"],
+ ["\u03AE", "i"],
+ ["\u03CE", "o"],
+ ["\u03C2", "s"],
+ ["\u03CA", "i"],
+ ["\u03B0", "y"],
+ ["\u03CB", "y"],
+ ["\u0390", "i"],
+ ["\u0391", "A"],
+ ["\u0392", "B"],
+ ["\u0393", "G"],
+ ["\u0394", "D"],
+ ["\u0395", "E"],
+ ["\u0396", "Z"],
+ ["\u0397", "I"],
+ ["\u0398", "TH"],
+ ["\u0399", "I"],
+ ["\u039A", "K"],
+ ["\u039B", "L"],
+ ["\u039C", "M"],
+ ["\u039D", "N"],
+ ["\u039E", "KS"],
+ ["\u039F", "O"],
+ ["\u03A0", "P"],
+ ["\u03A1", "R"],
+ ["\u03A3", "S"],
+ ["\u03A4", "T"],
+ ["\u03A5", "Y"],
+ ["\u03A6", "F"],
+ ["\u03A7", "X"],
+ ["\u03A8", "PS"],
+ ["\u03A9", "O"],
+ ["\u0386", "A"],
+ ["\u0388", "E"],
+ ["\u038A", "I"],
+ ["\u038C", "O"],
+ ["\u038E", "Y"],
+ ["\u0389", "I"],
+ ["\u038F", "O"],
+ ["\u03AA", "I"],
+ ["\u03AB", "Y"],
+ // Disabled as it conflicts with German and Latin.
+ // Hungarian
+ // ['ä', 'a'],
+ // ['Ä', 'A'],
+ // ['ö', 'o'],
+ // ['Ö', 'O'],
+ // ['ü', 'u'],
+ // ['Ü', 'U'],
+ // ['ű', 'u'],
+ // ['Ű', 'U'],
+ // Latvian
+ ["\u0101", "a"],
+ ["\u0113", "e"],
+ ["\u0123", "g"],
+ ["\u012B", "i"],
+ ["\u0137", "k"],
+ ["\u013C", "l"],
+ ["\u0146", "n"],
+ ["\u016B", "u"],
+ ["\u0100", "A"],
+ ["\u0112", "E"],
+ ["\u0122", "G"],
+ ["\u012A", "I"],
+ ["\u0136", "K"],
+ ["\u013B", "L"],
+ ["\u0145", "N"],
+ ["\u016A", "U"],
+ ["\u010D", "c"],
+ ["\u0161", "s"],
+ ["\u017E", "z"],
+ ["\u010C", "C"],
+ ["\u0160", "S"],
+ ["\u017D", "Z"],
+ // Lithuanian
+ ["\u0105", "a"],
+ ["\u010D", "c"],
+ ["\u0119", "e"],
+ ["\u0117", "e"],
+ ["\u012F", "i"],
+ ["\u0161", "s"],
+ ["\u0173", "u"],
+ ["\u016B", "u"],
+ ["\u017E", "z"],
+ ["\u0104", "A"],
+ ["\u010C", "C"],
+ ["\u0118", "E"],
+ ["\u0116", "E"],
+ ["\u012E", "I"],
+ ["\u0160", "S"],
+ ["\u0172", "U"],
+ ["\u016A", "U"],
+ // Macedonian
+ ["\u040C", "Kj"],
+ ["\u045C", "kj"],
+ ["\u0409", "Lj"],
+ ["\u0459", "lj"],
+ ["\u040A", "Nj"],
+ ["\u045A", "nj"],
+ ["\u0422\u0441", "Ts"],
+ ["\u0442\u0441", "ts"],
+ // Polish
+ ["\u0105", "a"],
+ ["\u0107", "c"],
+ ["\u0119", "e"],
+ ["\u0142", "l"],
+ ["\u0144", "n"],
+ ["\u015B", "s"],
+ ["\u017A", "z"],
+ ["\u017C", "z"],
+ ["\u0104", "A"],
+ ["\u0106", "C"],
+ ["\u0118", "E"],
+ ["\u0141", "L"],
+ ["\u0143", "N"],
+ ["\u015A", "S"],
+ ["\u0179", "Z"],
+ ["\u017B", "Z"],
+ // Disabled as it conflicts with Vietnamese.
+ // Serbian
+ // ['љ', 'lj'],
+ // ['њ', 'nj'],
+ // ['Љ', 'Lj'],
+ // ['Њ', 'Nj'],
+ // ['đ', 'dj'],
+ // ['Đ', 'Dj'],
+ // ['ђ', 'dj'],
+ // ['ј', 'j'],
+ // ['ћ', 'c'],
+ // ['џ', 'dz'],
+ // ['Ђ', 'Dj'],
+ // ['Ј', 'j'],
+ // ['Ћ', 'C'],
+ // ['Џ', 'Dz'],
+ // Disabled as it conflicts with German and Latin.
+ // Slovak
+ // ['ä', 'a'],
+ // ['Ä', 'A'],
+ // ['ľ', 'l'],
+ // ['ĺ', 'l'],
+ // ['ŕ', 'r'],
+ // ['Ľ', 'L'],
+ // ['Ĺ', 'L'],
+ // ['Ŕ', 'R'],
+ // Disabled as it conflicts with German and Latin.
+ // Swedish
+ // ['å', 'o'],
+ // ['Å', 'o'],
+ // ['ä', 'a'],
+ // ['Ä', 'A'],
+ // ['ë', 'e'],
+ // ['Ë', 'E'],
+ // ['ö', 'o'],
+ // ['Ö', 'O'],
+ // Ukrainian
+ ["\u0404", "Ye"],
+ ["\u0406", "I"],
+ ["\u0407", "Yi"],
+ ["\u0490", "G"],
+ ["\u0454", "ye"],
+ ["\u0456", "i"],
+ ["\u0457", "yi"],
+ ["\u0491", "g"],
+ // Dutch
+ ["\u0132", "IJ"],
+ ["\u0133", "ij"],
+ // Danish
+ // ['Æ', 'Ae'],
+ // ['Ø', 'Oe'],
+ // ['Å', 'Aa'],
+ // ['æ', 'ae'],
+ // ['ø', 'oe'],
+ // ['å', 'aa']
+ // Currencies
+ ["\xA2", "c"],
+ ["\xA5", "Y"],
+ ["\u07FF", "b"],
+ ["\u09F3", "t"],
+ ["\u0AF1", "Bo"],
+ ["\u0E3F", "B"],
+ ["\u20A0", "CE"],
+ ["\u20A1", "C"],
+ ["\u20A2", "Cr"],
+ ["\u20A3", "F"],
+ ["\u20A5", "m"],
+ ["\u20A6", "N"],
+ ["\u20A7", "Pt"],
+ ["\u20A8", "Rs"],
+ ["\u20A9", "W"],
+ ["\u20AB", "s"],
+ ["\u20AC", "E"],
+ ["\u20AD", "K"],
+ ["\u20AE", "T"],
+ ["\u20AF", "Dp"],
+ ["\u20B0", "S"],
+ ["\u20B1", "P"],
+ ["\u20B2", "G"],
+ ["\u20B3", "A"],
+ ["\u20B4", "S"],
+ ["\u20B5", "C"],
+ ["\u20B6", "tt"],
+ ["\u20B7", "S"],
+ ["\u20B8", "T"],
+ ["\u20B9", "R"],
+ ["\u20BA", "L"],
+ ["\u20BD", "P"],
+ ["\u20BF", "B"],
+ ["\uFE69", "$"],
+ ["\uFFE0", "c"],
+ ["\uFFE5", "Y"],
+ ["\uFFE6", "W"],
+ // Latin
+ ["\u{1D400}", "A"],
+ ["\u{1D401}", "B"],
+ ["\u{1D402}", "C"],
+ ["\u{1D403}", "D"],
+ ["\u{1D404}", "E"],
+ ["\u{1D405}", "F"],
+ ["\u{1D406}", "G"],
+ ["\u{1D407}", "H"],
+ ["\u{1D408}", "I"],
+ ["\u{1D409}", "J"],
+ ["\u{1D40A}", "K"],
+ ["\u{1D40B}", "L"],
+ ["\u{1D40C}", "M"],
+ ["\u{1D40D}", "N"],
+ ["\u{1D40E}", "O"],
+ ["\u{1D40F}", "P"],
+ ["\u{1D410}", "Q"],
+ ["\u{1D411}", "R"],
+ ["\u{1D412}", "S"],
+ ["\u{1D413}", "T"],
+ ["\u{1D414}", "U"],
+ ["\u{1D415}", "V"],
+ ["\u{1D416}", "W"],
+ ["\u{1D417}", "X"],
+ ["\u{1D418}", "Y"],
+ ["\u{1D419}", "Z"],
+ ["\u{1D41A}", "a"],
+ ["\u{1D41B}", "b"],
+ ["\u{1D41C}", "c"],
+ ["\u{1D41D}", "d"],
+ ["\u{1D41E}", "e"],
+ ["\u{1D41F}", "f"],
+ ["\u{1D420}", "g"],
+ ["\u{1D421}", "h"],
+ ["\u{1D422}", "i"],
+ ["\u{1D423}", "j"],
+ ["\u{1D424}", "k"],
+ ["\u{1D425}", "l"],
+ ["\u{1D426}", "m"],
+ ["\u{1D427}", "n"],
+ ["\u{1D428}", "o"],
+ ["\u{1D429}", "p"],
+ ["\u{1D42A}", "q"],
+ ["\u{1D42B}", "r"],
+ ["\u{1D42C}", "s"],
+ ["\u{1D42D}", "t"],
+ ["\u{1D42E}", "u"],
+ ["\u{1D42F}", "v"],
+ ["\u{1D430}", "w"],
+ ["\u{1D431}", "x"],
+ ["\u{1D432}", "y"],
+ ["\u{1D433}", "z"],
+ ["\u{1D434}", "A"],
+ ["\u{1D435}", "B"],
+ ["\u{1D436}", "C"],
+ ["\u{1D437}", "D"],
+ ["\u{1D438}", "E"],
+ ["\u{1D439}", "F"],
+ ["\u{1D43A}", "G"],
+ ["\u{1D43B}", "H"],
+ ["\u{1D43C}", "I"],
+ ["\u{1D43D}", "J"],
+ ["\u{1D43E}", "K"],
+ ["\u{1D43F}", "L"],
+ ["\u{1D440}", "M"],
+ ["\u{1D441}", "N"],
+ ["\u{1D442}", "O"],
+ ["\u{1D443}", "P"],
+ ["\u{1D444}", "Q"],
+ ["\u{1D445}", "R"],
+ ["\u{1D446}", "S"],
+ ["\u{1D447}", "T"],
+ ["\u{1D448}", "U"],
+ ["\u{1D449}", "V"],
+ ["\u{1D44A}", "W"],
+ ["\u{1D44B}", "X"],
+ ["\u{1D44C}", "Y"],
+ ["\u{1D44D}", "Z"],
+ ["\u{1D44E}", "a"],
+ ["\u{1D44F}", "b"],
+ ["\u{1D450}", "c"],
+ ["\u{1D451}", "d"],
+ ["\u{1D452}", "e"],
+ ["\u{1D453}", "f"],
+ ["\u{1D454}", "g"],
+ ["\u{1D456}", "i"],
+ ["\u{1D457}", "j"],
+ ["\u{1D458}", "k"],
+ ["\u{1D459}", "l"],
+ ["\u{1D45A}", "m"],
+ ["\u{1D45B}", "n"],
+ ["\u{1D45C}", "o"],
+ ["\u{1D45D}", "p"],
+ ["\u{1D45E}", "q"],
+ ["\u{1D45F}", "r"],
+ ["\u{1D460}", "s"],
+ ["\u{1D461}", "t"],
+ ["\u{1D462}", "u"],
+ ["\u{1D463}", "v"],
+ ["\u{1D464}", "w"],
+ ["\u{1D465}", "x"],
+ ["\u{1D466}", "y"],
+ ["\u{1D467}", "z"],
+ ["\u{1D468}", "A"],
+ ["\u{1D469}", "B"],
+ ["\u{1D46A}", "C"],
+ ["\u{1D46B}", "D"],
+ ["\u{1D46C}", "E"],
+ ["\u{1D46D}", "F"],
+ ["\u{1D46E}", "G"],
+ ["\u{1D46F}", "H"],
+ ["\u{1D470}", "I"],
+ ["\u{1D471}", "J"],
+ ["\u{1D472}", "K"],
+ ["\u{1D473}", "L"],
+ ["\u{1D474}", "M"],
+ ["\u{1D475}", "N"],
+ ["\u{1D476}", "O"],
+ ["\u{1D477}", "P"],
+ ["\u{1D478}", "Q"],
+ ["\u{1D479}", "R"],
+ ["\u{1D47A}", "S"],
+ ["\u{1D47B}", "T"],
+ ["\u{1D47C}", "U"],
+ ["\u{1D47D}", "V"],
+ ["\u{1D47E}", "W"],
+ ["\u{1D47F}", "X"],
+ ["\u{1D480}", "Y"],
+ ["\u{1D481}", "Z"],
+ ["\u{1D482}", "a"],
+ ["\u{1D483}", "b"],
+ ["\u{1D484}", "c"],
+ ["\u{1D485}", "d"],
+ ["\u{1D486}", "e"],
+ ["\u{1D487}", "f"],
+ ["\u{1D488}", "g"],
+ ["\u{1D489}", "h"],
+ ["\u{1D48A}", "i"],
+ ["\u{1D48B}", "j"],
+ ["\u{1D48C}", "k"],
+ ["\u{1D48D}", "l"],
+ ["\u{1D48E}", "m"],
+ ["\u{1D48F}", "n"],
+ ["\u{1D490}", "o"],
+ ["\u{1D491}", "p"],
+ ["\u{1D492}", "q"],
+ ["\u{1D493}", "r"],
+ ["\u{1D494}", "s"],
+ ["\u{1D495}", "t"],
+ ["\u{1D496}", "u"],
+ ["\u{1D497}", "v"],
+ ["\u{1D498}", "w"],
+ ["\u{1D499}", "x"],
+ ["\u{1D49A}", "y"],
+ ["\u{1D49B}", "z"],
+ ["\u{1D49C}", "A"],
+ ["\u{1D49E}", "C"],
+ ["\u{1D49F}", "D"],
+ ["\u{1D4A2}", "g"],
+ ["\u{1D4A5}", "J"],
+ ["\u{1D4A6}", "K"],
+ ["\u{1D4A9}", "N"],
+ ["\u{1D4AA}", "O"],
+ ["\u{1D4AB}", "P"],
+ ["\u{1D4AC}", "Q"],
+ ["\u{1D4AE}", "S"],
+ ["\u{1D4AF}", "T"],
+ ["\u{1D4B0}", "U"],
+ ["\u{1D4B1}", "V"],
+ ["\u{1D4B2}", "W"],
+ ["\u{1D4B3}", "X"],
+ ["\u{1D4B4}", "Y"],
+ ["\u{1D4B5}", "Z"],
+ ["\u{1D4B6}", "a"],
+ ["\u{1D4B7}", "b"],
+ ["\u{1D4B8}", "c"],
+ ["\u{1D4B9}", "d"],
+ ["\u{1D4BB}", "f"],
+ ["\u{1D4BD}", "h"],
+ ["\u{1D4BE}", "i"],
+ ["\u{1D4BF}", "j"],
+ ["\u{1D4C0}", "h"],
+ ["\u{1D4C1}", "l"],
+ ["\u{1D4C2}", "m"],
+ ["\u{1D4C3}", "n"],
+ ["\u{1D4C5}", "p"],
+ ["\u{1D4C6}", "q"],
+ ["\u{1D4C7}", "r"],
+ ["\u{1D4C8}", "s"],
+ ["\u{1D4C9}", "t"],
+ ["\u{1D4CA}", "u"],
+ ["\u{1D4CB}", "v"],
+ ["\u{1D4CC}", "w"],
+ ["\u{1D4CD}", "x"],
+ ["\u{1D4CE}", "y"],
+ ["\u{1D4CF}", "z"],
+ ["\u{1D4D0}", "A"],
+ ["\u{1D4D1}", "B"],
+ ["\u{1D4D2}", "C"],
+ ["\u{1D4D3}", "D"],
+ ["\u{1D4D4}", "E"],
+ ["\u{1D4D5}", "F"],
+ ["\u{1D4D6}", "G"],
+ ["\u{1D4D7}", "H"],
+ ["\u{1D4D8}", "I"],
+ ["\u{1D4D9}", "J"],
+ ["\u{1D4DA}", "K"],
+ ["\u{1D4DB}", "L"],
+ ["\u{1D4DC}", "M"],
+ ["\u{1D4DD}", "N"],
+ ["\u{1D4DE}", "O"],
+ ["\u{1D4DF}", "P"],
+ ["\u{1D4E0}", "Q"],
+ ["\u{1D4E1}", "R"],
+ ["\u{1D4E2}", "S"],
+ ["\u{1D4E3}", "T"],
+ ["\u{1D4E4}", "U"],
+ ["\u{1D4E5}", "V"],
+ ["\u{1D4E6}", "W"],
+ ["\u{1D4E7}", "X"],
+ ["\u{1D4E8}", "Y"],
+ ["\u{1D4E9}", "Z"],
+ ["\u{1D4EA}", "a"],
+ ["\u{1D4EB}", "b"],
+ ["\u{1D4EC}", "c"],
+ ["\u{1D4ED}", "d"],
+ ["\u{1D4EE}", "e"],
+ ["\u{1D4EF}", "f"],
+ ["\u{1D4F0}", "g"],
+ ["\u{1D4F1}", "h"],
+ ["\u{1D4F2}", "i"],
+ ["\u{1D4F3}", "j"],
+ ["\u{1D4F4}", "k"],
+ ["\u{1D4F5}", "l"],
+ ["\u{1D4F6}", "m"],
+ ["\u{1D4F7}", "n"],
+ ["\u{1D4F8}", "o"],
+ ["\u{1D4F9}", "p"],
+ ["\u{1D4FA}", "q"],
+ ["\u{1D4FB}", "r"],
+ ["\u{1D4FC}", "s"],
+ ["\u{1D4FD}", "t"],
+ ["\u{1D4FE}", "u"],
+ ["\u{1D4FF}", "v"],
+ ["\u{1D500}", "w"],
+ ["\u{1D501}", "x"],
+ ["\u{1D502}", "y"],
+ ["\u{1D503}", "z"],
+ ["\u{1D504}", "A"],
+ ["\u{1D505}", "B"],
+ ["\u{1D507}", "D"],
+ ["\u{1D508}", "E"],
+ ["\u{1D509}", "F"],
+ ["\u{1D50A}", "G"],
+ ["\u{1D50D}", "J"],
+ ["\u{1D50E}", "K"],
+ ["\u{1D50F}", "L"],
+ ["\u{1D510}", "M"],
+ ["\u{1D511}", "N"],
+ ["\u{1D512}", "O"],
+ ["\u{1D513}", "P"],
+ ["\u{1D514}", "Q"],
+ ["\u{1D516}", "S"],
+ ["\u{1D517}", "T"],
+ ["\u{1D518}", "U"],
+ ["\u{1D519}", "V"],
+ ["\u{1D51A}", "W"],
+ ["\u{1D51B}", "X"],
+ ["\u{1D51C}", "Y"],
+ ["\u{1D51E}", "a"],
+ ["\u{1D51F}", "b"],
+ ["\u{1D520}", "c"],
+ ["\u{1D521}", "d"],
+ ["\u{1D522}", "e"],
+ ["\u{1D523}", "f"],
+ ["\u{1D524}", "g"],
+ ["\u{1D525}", "h"],
+ ["\u{1D526}", "i"],
+ ["\u{1D527}", "j"],
+ ["\u{1D528}", "k"],
+ ["\u{1D529}", "l"],
+ ["\u{1D52A}", "m"],
+ ["\u{1D52B}", "n"],
+ ["\u{1D52C}", "o"],
+ ["\u{1D52D}", "p"],
+ ["\u{1D52E}", "q"],
+ ["\u{1D52F}", "r"],
+ ["\u{1D530}", "s"],
+ ["\u{1D531}", "t"],
+ ["\u{1D532}", "u"],
+ ["\u{1D533}", "v"],
+ ["\u{1D534}", "w"],
+ ["\u{1D535}", "x"],
+ ["\u{1D536}", "y"],
+ ["\u{1D537}", "z"],
+ ["\u{1D538}", "A"],
+ ["\u{1D539}", "B"],
+ ["\u{1D53B}", "D"],
+ ["\u{1D53C}", "E"],
+ ["\u{1D53D}", "F"],
+ ["\u{1D53E}", "G"],
+ ["\u{1D540}", "I"],
+ ["\u{1D541}", "J"],
+ ["\u{1D542}", "K"],
+ ["\u{1D543}", "L"],
+ ["\u{1D544}", "M"],
+ ["\u{1D546}", "N"],
+ ["\u{1D54A}", "S"],
+ ["\u{1D54B}", "T"],
+ ["\u{1D54C}", "U"],
+ ["\u{1D54D}", "V"],
+ ["\u{1D54E}", "W"],
+ ["\u{1D54F}", "X"],
+ ["\u{1D550}", "Y"],
+ ["\u{1D552}", "a"],
+ ["\u{1D553}", "b"],
+ ["\u{1D554}", "c"],
+ ["\u{1D555}", "d"],
+ ["\u{1D556}", "e"],
+ ["\u{1D557}", "f"],
+ ["\u{1D558}", "g"],
+ ["\u{1D559}", "h"],
+ ["\u{1D55A}", "i"],
+ ["\u{1D55B}", "j"],
+ ["\u{1D55C}", "k"],
+ ["\u{1D55D}", "l"],
+ ["\u{1D55E}", "m"],
+ ["\u{1D55F}", "n"],
+ ["\u{1D560}", "o"],
+ ["\u{1D561}", "p"],
+ ["\u{1D562}", "q"],
+ ["\u{1D563}", "r"],
+ ["\u{1D564}", "s"],
+ ["\u{1D565}", "t"],
+ ["\u{1D566}", "u"],
+ ["\u{1D567}", "v"],
+ ["\u{1D568}", "w"],
+ ["\u{1D569}", "x"],
+ ["\u{1D56A}", "y"],
+ ["\u{1D56B}", "z"],
+ ["\u{1D56C}", "A"],
+ ["\u{1D56D}", "B"],
+ ["\u{1D56E}", "C"],
+ ["\u{1D56F}", "D"],
+ ["\u{1D570}", "E"],
+ ["\u{1D571}", "F"],
+ ["\u{1D572}", "G"],
+ ["\u{1D573}", "H"],
+ ["\u{1D574}", "I"],
+ ["\u{1D575}", "J"],
+ ["\u{1D576}", "K"],
+ ["\u{1D577}", "L"],
+ ["\u{1D578}", "M"],
+ ["\u{1D579}", "N"],
+ ["\u{1D57A}", "O"],
+ ["\u{1D57B}", "P"],
+ ["\u{1D57C}", "Q"],
+ ["\u{1D57D}", "R"],
+ ["\u{1D57E}", "S"],
+ ["\u{1D57F}", "T"],
+ ["\u{1D580}", "U"],
+ ["\u{1D581}", "V"],
+ ["\u{1D582}", "W"],
+ ["\u{1D583}", "X"],
+ ["\u{1D584}", "Y"],
+ ["\u{1D585}", "Z"],
+ ["\u{1D586}", "a"],
+ ["\u{1D587}", "b"],
+ ["\u{1D588}", "c"],
+ ["\u{1D589}", "d"],
+ ["\u{1D58A}", "e"],
+ ["\u{1D58B}", "f"],
+ ["\u{1D58C}", "g"],
+ ["\u{1D58D}", "h"],
+ ["\u{1D58E}", "i"],
+ ["\u{1D58F}", "j"],
+ ["\u{1D590}", "k"],
+ ["\u{1D591}", "l"],
+ ["\u{1D592}", "m"],
+ ["\u{1D593}", "n"],
+ ["\u{1D594}", "o"],
+ ["\u{1D595}", "p"],
+ ["\u{1D596}", "q"],
+ ["\u{1D597}", "r"],
+ ["\u{1D598}", "s"],
+ ["\u{1D599}", "t"],
+ ["\u{1D59A}", "u"],
+ ["\u{1D59B}", "v"],
+ ["\u{1D59C}", "w"],
+ ["\u{1D59D}", "x"],
+ ["\u{1D59E}", "y"],
+ ["\u{1D59F}", "z"],
+ ["\u{1D5A0}", "A"],
+ ["\u{1D5A1}", "B"],
+ ["\u{1D5A2}", "C"],
+ ["\u{1D5A3}", "D"],
+ ["\u{1D5A4}", "E"],
+ ["\u{1D5A5}", "F"],
+ ["\u{1D5A6}", "G"],
+ ["\u{1D5A7}", "H"],
+ ["\u{1D5A8}", "I"],
+ ["\u{1D5A9}", "J"],
+ ["\u{1D5AA}", "K"],
+ ["\u{1D5AB}", "L"],
+ ["\u{1D5AC}", "M"],
+ ["\u{1D5AD}", "N"],
+ ["\u{1D5AE}", "O"],
+ ["\u{1D5AF}", "P"],
+ ["\u{1D5B0}", "Q"],
+ ["\u{1D5B1}", "R"],
+ ["\u{1D5B2}", "S"],
+ ["\u{1D5B3}", "T"],
+ ["\u{1D5B4}", "U"],
+ ["\u{1D5B5}", "V"],
+ ["\u{1D5B6}", "W"],
+ ["\u{1D5B7}", "X"],
+ ["\u{1D5B8}", "Y"],
+ ["\u{1D5B9}", "Z"],
+ ["\u{1D5BA}", "a"],
+ ["\u{1D5BB}", "b"],
+ ["\u{1D5BC}", "c"],
+ ["\u{1D5BD}", "d"],
+ ["\u{1D5BE}", "e"],
+ ["\u{1D5BF}", "f"],
+ ["\u{1D5C0}", "g"],
+ ["\u{1D5C1}", "h"],
+ ["\u{1D5C2}", "i"],
+ ["\u{1D5C3}", "j"],
+ ["\u{1D5C4}", "k"],
+ ["\u{1D5C5}", "l"],
+ ["\u{1D5C6}", "m"],
+ ["\u{1D5C7}", "n"],
+ ["\u{1D5C8}", "o"],
+ ["\u{1D5C9}", "p"],
+ ["\u{1D5CA}", "q"],
+ ["\u{1D5CB}", "r"],
+ ["\u{1D5CC}", "s"],
+ ["\u{1D5CD}", "t"],
+ ["\u{1D5CE}", "u"],
+ ["\u{1D5CF}", "v"],
+ ["\u{1D5D0}", "w"],
+ ["\u{1D5D1}", "x"],
+ ["\u{1D5D2}", "y"],
+ ["\u{1D5D3}", "z"],
+ ["\u{1D5D4}", "A"],
+ ["\u{1D5D5}", "B"],
+ ["\u{1D5D6}", "C"],
+ ["\u{1D5D7}", "D"],
+ ["\u{1D5D8}", "E"],
+ ["\u{1D5D9}", "F"],
+ ["\u{1D5DA}", "G"],
+ ["\u{1D5DB}", "H"],
+ ["\u{1D5DC}", "I"],
+ ["\u{1D5DD}", "J"],
+ ["\u{1D5DE}", "K"],
+ ["\u{1D5DF}", "L"],
+ ["\u{1D5E0}", "M"],
+ ["\u{1D5E1}", "N"],
+ ["\u{1D5E2}", "O"],
+ ["\u{1D5E3}", "P"],
+ ["\u{1D5E4}", "Q"],
+ ["\u{1D5E5}", "R"],
+ ["\u{1D5E6}", "S"],
+ ["\u{1D5E7}", "T"],
+ ["\u{1D5E8}", "U"],
+ ["\u{1D5E9}", "V"],
+ ["\u{1D5EA}", "W"],
+ ["\u{1D5EB}", "X"],
+ ["\u{1D5EC}", "Y"],
+ ["\u{1D5ED}", "Z"],
+ ["\u{1D5EE}", "a"],
+ ["\u{1D5EF}", "b"],
+ ["\u{1D5F0}", "c"],
+ ["\u{1D5F1}", "d"],
+ ["\u{1D5F2}", "e"],
+ ["\u{1D5F3}", "f"],
+ ["\u{1D5F4}", "g"],
+ ["\u{1D5F5}", "h"],
+ ["\u{1D5F6}", "i"],
+ ["\u{1D5F7}", "j"],
+ ["\u{1D5F8}", "k"],
+ ["\u{1D5F9}", "l"],
+ ["\u{1D5FA}", "m"],
+ ["\u{1D5FB}", "n"],
+ ["\u{1D5FC}", "o"],
+ ["\u{1D5FD}", "p"],
+ ["\u{1D5FE}", "q"],
+ ["\u{1D5FF}", "r"],
+ ["\u{1D600}", "s"],
+ ["\u{1D601}", "t"],
+ ["\u{1D602}", "u"],
+ ["\u{1D603}", "v"],
+ ["\u{1D604}", "w"],
+ ["\u{1D605}", "x"],
+ ["\u{1D606}", "y"],
+ ["\u{1D607}", "z"],
+ ["\u{1D608}", "A"],
+ ["\u{1D609}", "B"],
+ ["\u{1D60A}", "C"],
+ ["\u{1D60B}", "D"],
+ ["\u{1D60C}", "E"],
+ ["\u{1D60D}", "F"],
+ ["\u{1D60E}", "G"],
+ ["\u{1D60F}", "H"],
+ ["\u{1D610}", "I"],
+ ["\u{1D611}", "J"],
+ ["\u{1D612}", "K"],
+ ["\u{1D613}", "L"],
+ ["\u{1D614}", "M"],
+ ["\u{1D615}", "N"],
+ ["\u{1D616}", "O"],
+ ["\u{1D617}", "P"],
+ ["\u{1D618}", "Q"],
+ ["\u{1D619}", "R"],
+ ["\u{1D61A}", "S"],
+ ["\u{1D61B}", "T"],
+ ["\u{1D61C}", "U"],
+ ["\u{1D61D}", "V"],
+ ["\u{1D61E}", "W"],
+ ["\u{1D61F}", "X"],
+ ["\u{1D620}", "Y"],
+ ["\u{1D621}", "Z"],
+ ["\u{1D622}", "a"],
+ ["\u{1D623}", "b"],
+ ["\u{1D624}", "c"],
+ ["\u{1D625}", "d"],
+ ["\u{1D626}", "e"],
+ ["\u{1D627}", "f"],
+ ["\u{1D628}", "g"],
+ ["\u{1D629}", "h"],
+ ["\u{1D62A}", "i"],
+ ["\u{1D62B}", "j"],
+ ["\u{1D62C}", "k"],
+ ["\u{1D62D}", "l"],
+ ["\u{1D62E}", "m"],
+ ["\u{1D62F}", "n"],
+ ["\u{1D630}", "o"],
+ ["\u{1D631}", "p"],
+ ["\u{1D632}", "q"],
+ ["\u{1D633}", "r"],
+ ["\u{1D634}", "s"],
+ ["\u{1D635}", "t"],
+ ["\u{1D636}", "u"],
+ ["\u{1D637}", "v"],
+ ["\u{1D638}", "w"],
+ ["\u{1D639}", "x"],
+ ["\u{1D63A}", "y"],
+ ["\u{1D63B}", "z"],
+ ["\u{1D63C}", "A"],
+ ["\u{1D63D}", "B"],
+ ["\u{1D63E}", "C"],
+ ["\u{1D63F}", "D"],
+ ["\u{1D640}", "E"],
+ ["\u{1D641}", "F"],
+ ["\u{1D642}", "G"],
+ ["\u{1D643}", "H"],
+ ["\u{1D644}", "I"],
+ ["\u{1D645}", "J"],
+ ["\u{1D646}", "K"],
+ ["\u{1D647}", "L"],
+ ["\u{1D648}", "M"],
+ ["\u{1D649}", "N"],
+ ["\u{1D64A}", "O"],
+ ["\u{1D64B}", "P"],
+ ["\u{1D64C}", "Q"],
+ ["\u{1D64D}", "R"],
+ ["\u{1D64E}", "S"],
+ ["\u{1D64F}", "T"],
+ ["\u{1D650}", "U"],
+ ["\u{1D651}", "V"],
+ ["\u{1D652}", "W"],
+ ["\u{1D653}", "X"],
+ ["\u{1D654}", "Y"],
+ ["\u{1D655}", "Z"],
+ ["\u{1D656}", "a"],
+ ["\u{1D657}", "b"],
+ ["\u{1D658}", "c"],
+ ["\u{1D659}", "d"],
+ ["\u{1D65A}", "e"],
+ ["\u{1D65B}", "f"],
+ ["\u{1D65C}", "g"],
+ ["\u{1D65D}", "h"],
+ ["\u{1D65E}", "i"],
+ ["\u{1D65F}", "j"],
+ ["\u{1D660}", "k"],
+ ["\u{1D661}", "l"],
+ ["\u{1D662}", "m"],
+ ["\u{1D663}", "n"],
+ ["\u{1D664}", "o"],
+ ["\u{1D665}", "p"],
+ ["\u{1D666}", "q"],
+ ["\u{1D667}", "r"],
+ ["\u{1D668}", "s"],
+ ["\u{1D669}", "t"],
+ ["\u{1D66A}", "u"],
+ ["\u{1D66B}", "v"],
+ ["\u{1D66C}", "w"],
+ ["\u{1D66D}", "x"],
+ ["\u{1D66E}", "y"],
+ ["\u{1D66F}", "z"],
+ ["\u{1D670}", "A"],
+ ["\u{1D671}", "B"],
+ ["\u{1D672}", "C"],
+ ["\u{1D673}", "D"],
+ ["\u{1D674}", "E"],
+ ["\u{1D675}", "F"],
+ ["\u{1D676}", "G"],
+ ["\u{1D677}", "H"],
+ ["\u{1D678}", "I"],
+ ["\u{1D679}", "J"],
+ ["\u{1D67A}", "K"],
+ ["\u{1D67B}", "L"],
+ ["\u{1D67C}", "M"],
+ ["\u{1D67D}", "N"],
+ ["\u{1D67E}", "O"],
+ ["\u{1D67F}", "P"],
+ ["\u{1D680}", "Q"],
+ ["\u{1D681}", "R"],
+ ["\u{1D682}", "S"],
+ ["\u{1D683}", "T"],
+ ["\u{1D684}", "U"],
+ ["\u{1D685}", "V"],
+ ["\u{1D686}", "W"],
+ ["\u{1D687}", "X"],
+ ["\u{1D688}", "Y"],
+ ["\u{1D689}", "Z"],
+ ["\u{1D68A}", "a"],
+ ["\u{1D68B}", "b"],
+ ["\u{1D68C}", "c"],
+ ["\u{1D68D}", "d"],
+ ["\u{1D68E}", "e"],
+ ["\u{1D68F}", "f"],
+ ["\u{1D690}", "g"],
+ ["\u{1D691}", "h"],
+ ["\u{1D692}", "i"],
+ ["\u{1D693}", "j"],
+ ["\u{1D694}", "k"],
+ ["\u{1D695}", "l"],
+ ["\u{1D696}", "m"],
+ ["\u{1D697}", "n"],
+ ["\u{1D698}", "o"],
+ ["\u{1D699}", "p"],
+ ["\u{1D69A}", "q"],
+ ["\u{1D69B}", "r"],
+ ["\u{1D69C}", "s"],
+ ["\u{1D69D}", "t"],
+ ["\u{1D69E}", "u"],
+ ["\u{1D69F}", "v"],
+ ["\u{1D6A0}", "w"],
+ ["\u{1D6A1}", "x"],
+ ["\u{1D6A2}", "y"],
+ ["\u{1D6A3}", "z"],
+ // Dotless letters
+ ["\u{1D6A4}", "l"],
+ ["\u{1D6A5}", "j"],
+ // Greek
+ ["\u{1D6E2}", "A"],
+ ["\u{1D6E3}", "B"],
+ ["\u{1D6E4}", "G"],
+ ["\u{1D6E5}", "D"],
+ ["\u{1D6E6}", "E"],
+ ["\u{1D6E7}", "Z"],
+ ["\u{1D6E8}", "I"],
+ ["\u{1D6E9}", "TH"],
+ ["\u{1D6EA}", "I"],
+ ["\u{1D6EB}", "K"],
+ ["\u{1D6EC}", "L"],
+ ["\u{1D6ED}", "M"],
+ ["\u{1D6EE}", "N"],
+ ["\u{1D6EF}", "KS"],
+ ["\u{1D6F0}", "O"],
+ ["\u{1D6F1}", "P"],
+ ["\u{1D6F2}", "R"],
+ ["\u{1D6F3}", "TH"],
+ ["\u{1D6F4}", "S"],
+ ["\u{1D6F5}", "T"],
+ ["\u{1D6F6}", "Y"],
+ ["\u{1D6F7}", "F"],
+ ["\u{1D6F8}", "x"],
+ ["\u{1D6F9}", "PS"],
+ ["\u{1D6FA}", "O"],
+ ["\u{1D6FB}", "D"],
+ ["\u{1D6FC}", "a"],
+ ["\u{1D6FD}", "b"],
+ ["\u{1D6FE}", "g"],
+ ["\u{1D6FF}", "d"],
+ ["\u{1D700}", "e"],
+ ["\u{1D701}", "z"],
+ ["\u{1D702}", "i"],
+ ["\u{1D703}", "th"],
+ ["\u{1D704}", "i"],
+ ["\u{1D705}", "k"],
+ ["\u{1D706}", "l"],
+ ["\u{1D707}", "m"],
+ ["\u{1D708}", "n"],
+ ["\u{1D709}", "ks"],
+ ["\u{1D70A}", "o"],
+ ["\u{1D70B}", "p"],
+ ["\u{1D70C}", "r"],
+ ["\u{1D70D}", "s"],
+ ["\u{1D70E}", "s"],
+ ["\u{1D70F}", "t"],
+ ["\u{1D710}", "y"],
+ ["\u{1D711}", "f"],
+ ["\u{1D712}", "x"],
+ ["\u{1D713}", "ps"],
+ ["\u{1D714}", "o"],
+ ["\u{1D715}", "d"],
+ ["\u{1D716}", "E"],
+ ["\u{1D717}", "TH"],
+ ["\u{1D718}", "K"],
+ ["\u{1D719}", "f"],
+ ["\u{1D71A}", "r"],
+ ["\u{1D71B}", "p"],
+ ["\u{1D71C}", "A"],
+ ["\u{1D71D}", "V"],
+ ["\u{1D71E}", "G"],
+ ["\u{1D71F}", "D"],
+ ["\u{1D720}", "E"],
+ ["\u{1D721}", "Z"],
+ ["\u{1D722}", "I"],
+ ["\u{1D723}", "TH"],
+ ["\u{1D724}", "I"],
+ ["\u{1D725}", "K"],
+ ["\u{1D726}", "L"],
+ ["\u{1D727}", "M"],
+ ["\u{1D728}", "N"],
+ ["\u{1D729}", "KS"],
+ ["\u{1D72A}", "O"],
+ ["\u{1D72B}", "P"],
+ ["\u{1D72C}", "S"],
+ ["\u{1D72D}", "TH"],
+ ["\u{1D72E}", "S"],
+ ["\u{1D72F}", "T"],
+ ["\u{1D730}", "Y"],
+ ["\u{1D731}", "F"],
+ ["\u{1D732}", "X"],
+ ["\u{1D733}", "PS"],
+ ["\u{1D734}", "O"],
+ ["\u{1D735}", "D"],
+ ["\u{1D736}", "a"],
+ ["\u{1D737}", "v"],
+ ["\u{1D738}", "g"],
+ ["\u{1D739}", "d"],
+ ["\u{1D73A}", "e"],
+ ["\u{1D73B}", "z"],
+ ["\u{1D73C}", "i"],
+ ["\u{1D73D}", "th"],
+ ["\u{1D73E}", "i"],
+ ["\u{1D73F}", "k"],
+ ["\u{1D740}", "l"],
+ ["\u{1D741}", "m"],
+ ["\u{1D742}", "n"],
+ ["\u{1D743}", "ks"],
+ ["\u{1D744}", "o"],
+ ["\u{1D745}", "p"],
+ ["\u{1D746}", "r"],
+ ["\u{1D747}", "s"],
+ ["\u{1D748}", "s"],
+ ["\u{1D749}", "t"],
+ ["\u{1D74A}", "y"],
+ ["\u{1D74B}", "f"],
+ ["\u{1D74C}", "x"],
+ ["\u{1D74D}", "ps"],
+ ["\u{1D74E}", "o"],
+ ["\u{1D74F}", "a"],
+ ["\u{1D750}", "e"],
+ ["\u{1D751}", "i"],
+ ["\u{1D752}", "k"],
+ ["\u{1D753}", "f"],
+ ["\u{1D754}", "r"],
+ ["\u{1D755}", "p"],
+ ["\u{1D756}", "A"],
+ ["\u{1D757}", "B"],
+ ["\u{1D758}", "G"],
+ ["\u{1D759}", "D"],
+ ["\u{1D75A}", "E"],
+ ["\u{1D75B}", "Z"],
+ ["\u{1D75C}", "I"],
+ ["\u{1D75D}", "TH"],
+ ["\u{1D75E}", "I"],
+ ["\u{1D75F}", "K"],
+ ["\u{1D760}", "L"],
+ ["\u{1D761}", "M"],
+ ["\u{1D762}", "N"],
+ ["\u{1D763}", "KS"],
+ ["\u{1D764}", "O"],
+ ["\u{1D765}", "P"],
+ ["\u{1D766}", "R"],
+ ["\u{1D767}", "TH"],
+ ["\u{1D768}", "S"],
+ ["\u{1D769}", "T"],
+ ["\u{1D76A}", "Y"],
+ ["\u{1D76B}", "F"],
+ ["\u{1D76C}", "X"],
+ ["\u{1D76D}", "PS"],
+ ["\u{1D76E}", "O"],
+ ["\u{1D76F}", "D"],
+ ["\u{1D770}", "a"],
+ ["\u{1D771}", "v"],
+ ["\u{1D772}", "g"],
+ ["\u{1D773}", "d"],
+ ["\u{1D774}", "e"],
+ ["\u{1D775}", "z"],
+ ["\u{1D776}", "i"],
+ ["\u{1D777}", "th"],
+ ["\u{1D778}", "i"],
+ ["\u{1D779}", "k"],
+ ["\u{1D77A}", "l"],
+ ["\u{1D77B}", "m"],
+ ["\u{1D77C}", "n"],
+ ["\u{1D77D}", "ks"],
+ ["\u{1D77E}", "o"],
+ ["\u{1D77F}", "p"],
+ ["\u{1D780}", "r"],
+ ["\u{1D781}", "s"],
+ ["\u{1D782}", "s"],
+ ["\u{1D783}", "t"],
+ ["\u{1D784}", "y"],
+ ["\u{1D785}", "f"],
+ ["\u{1D786}", "x"],
+ ["\u{1D787}", "ps"],
+ ["\u{1D788}", "o"],
+ ["\u{1D789}", "a"],
+ ["\u{1D78A}", "e"],
+ ["\u{1D78B}", "i"],
+ ["\u{1D78C}", "k"],
+ ["\u{1D78D}", "f"],
+ ["\u{1D78E}", "r"],
+ ["\u{1D78F}", "p"],
+ ["\u{1D790}", "A"],
+ ["\u{1D791}", "V"],
+ ["\u{1D792}", "G"],
+ ["\u{1D793}", "D"],
+ ["\u{1D794}", "E"],
+ ["\u{1D795}", "Z"],
+ ["\u{1D796}", "I"],
+ ["\u{1D797}", "TH"],
+ ["\u{1D798}", "I"],
+ ["\u{1D799}", "K"],
+ ["\u{1D79A}", "L"],
+ ["\u{1D79B}", "M"],
+ ["\u{1D79C}", "N"],
+ ["\u{1D79D}", "KS"],
+ ["\u{1D79E}", "O"],
+ ["\u{1D79F}", "P"],
+ ["\u{1D7A0}", "S"],
+ ["\u{1D7A1}", "TH"],
+ ["\u{1D7A2}", "S"],
+ ["\u{1D7A3}", "T"],
+ ["\u{1D7A4}", "Y"],
+ ["\u{1D7A5}", "F"],
+ ["\u{1D7A6}", "X"],
+ ["\u{1D7A7}", "PS"],
+ ["\u{1D7A8}", "O"],
+ ["\u{1D7A9}", "D"],
+ ["\u{1D7AA}", "av"],
+ ["\u{1D7AB}", "g"],
+ ["\u{1D7AC}", "d"],
+ ["\u{1D7AD}", "e"],
+ ["\u{1D7AE}", "z"],
+ ["\u{1D7AF}", "i"],
+ ["\u{1D7B0}", "i"],
+ ["\u{1D7B1}", "th"],
+ ["\u{1D7B2}", "i"],
+ ["\u{1D7B3}", "k"],
+ ["\u{1D7B4}", "l"],
+ ["\u{1D7B5}", "m"],
+ ["\u{1D7B6}", "n"],
+ ["\u{1D7B7}", "ks"],
+ ["\u{1D7B8}", "o"],
+ ["\u{1D7B9}", "p"],
+ ["\u{1D7BA}", "r"],
+ ["\u{1D7BB}", "s"],
+ ["\u{1D7BC}", "s"],
+ ["\u{1D7BD}", "t"],
+ ["\u{1D7BE}", "y"],
+ ["\u{1D7BF}", "f"],
+ ["\u{1D7C0}", "x"],
+ ["\u{1D7C1}", "ps"],
+ ["\u{1D7C2}", "o"],
+ ["\u{1D7C3}", "a"],
+ ["\u{1D7C4}", "e"],
+ ["\u{1D7C5}", "i"],
+ ["\u{1D7C6}", "k"],
+ ["\u{1D7C7}", "f"],
+ ["\u{1D7C8}", "r"],
+ ["\u{1D7C9}", "p"],
+ ["\u{1D7CA}", "F"],
+ ["\u{1D7CB}", "f"],
+ ["\u249C", "(a)"],
+ ["\u249D", "(b)"],
+ ["\u249E", "(c)"],
+ ["\u249F", "(d)"],
+ ["\u24A0", "(e)"],
+ ["\u24A1", "(f)"],
+ ["\u24A2", "(g)"],
+ ["\u24A3", "(h)"],
+ ["\u24A4", "(i)"],
+ ["\u24A5", "(j)"],
+ ["\u24A6", "(k)"],
+ ["\u24A7", "(l)"],
+ ["\u24A8", "(m)"],
+ ["\u24A9", "(n)"],
+ ["\u24AA", "(o)"],
+ ["\u24AB", "(p)"],
+ ["\u24AC", "(q)"],
+ ["\u24AD", "(r)"],
+ ["\u24AE", "(s)"],
+ ["\u24AF", "(t)"],
+ ["\u24B0", "(u)"],
+ ["\u24B1", "(v)"],
+ ["\u24B2", "(w)"],
+ ["\u24B3", "(x)"],
+ ["\u24B4", "(y)"],
+ ["\u24B5", "(z)"],
+ ["\u24B6", "(A)"],
+ ["\u24B7", "(B)"],
+ ["\u24B8", "(C)"],
+ ["\u24B9", "(D)"],
+ ["\u24BA", "(E)"],
+ ["\u24BB", "(F)"],
+ ["\u24BC", "(G)"],
+ ["\u24BD", "(H)"],
+ ["\u24BE", "(I)"],
+ ["\u24BF", "(J)"],
+ ["\u24C0", "(K)"],
+ ["\u24C1", "(L)"],
+ ["\u24C3", "(N)"],
+ ["\u24C4", "(O)"],
+ ["\u24C5", "(P)"],
+ ["\u24C6", "(Q)"],
+ ["\u24C7", "(R)"],
+ ["\u24C8", "(S)"],
+ ["\u24C9", "(T)"],
+ ["\u24CA", "(U)"],
+ ["\u24CB", "(V)"],
+ ["\u24CC", "(W)"],
+ ["\u24CD", "(X)"],
+ ["\u24CE", "(Y)"],
+ ["\u24CF", "(Z)"],
+ ["\u24D0", "(a)"],
+ ["\u24D1", "(b)"],
+ ["\u24D2", "(b)"],
+ ["\u24D3", "(c)"],
+ ["\u24D4", "(e)"],
+ ["\u24D5", "(f)"],
+ ["\u24D6", "(g)"],
+ ["\u24D7", "(h)"],
+ ["\u24D8", "(i)"],
+ ["\u24D9", "(j)"],
+ ["\u24DA", "(k)"],
+ ["\u24DB", "(l)"],
+ ["\u24DC", "(m)"],
+ ["\u24DD", "(n)"],
+ ["\u24DE", "(o)"],
+ ["\u24DF", "(p)"],
+ ["\u24E0", "(q)"],
+ ["\u24E1", "(r)"],
+ ["\u24E2", "(s)"],
+ ["\u24E3", "(t)"],
+ ["\u24E4", "(u)"],
+ ["\u24E5", "(v)"],
+ ["\u24E6", "(w)"],
+ ["\u24E7", "(x)"],
+ ["\u24E8", "(y)"],
+ ["\u24E9", "(z)"],
+ // Maltese
+ ["\u010A", "C"],
+ ["\u010B", "c"],
+ ["\u0120", "G"],
+ ["\u0121", "g"],
+ ["\u0126", "H"],
+ ["\u0127", "h"],
+ ["\u017B", "Z"],
+ ["\u017C", "z"],
+ // Numbers
+ ["\u{1D7CE}", "0"],
+ ["\u{1D7CF}", "1"],
+ ["\u{1D7D0}", "2"],
+ ["\u{1D7D1}", "3"],
+ ["\u{1D7D2}", "4"],
+ ["\u{1D7D3}", "5"],
+ ["\u{1D7D4}", "6"],
+ ["\u{1D7D5}", "7"],
+ ["\u{1D7D6}", "8"],
+ ["\u{1D7D7}", "9"],
+ ["\u{1D7D8}", "0"],
+ ["\u{1D7D9}", "1"],
+ ["\u{1D7DA}", "2"],
+ ["\u{1D7DB}", "3"],
+ ["\u{1D7DC}", "4"],
+ ["\u{1D7DD}", "5"],
+ ["\u{1D7DE}", "6"],
+ ["\u{1D7DF}", "7"],
+ ["\u{1D7E0}", "8"],
+ ["\u{1D7E1}", "9"],
+ ["\u{1D7E2}", "0"],
+ ["\u{1D7E3}", "1"],
+ ["\u{1D7E4}", "2"],
+ ["\u{1D7E5}", "3"],
+ ["\u{1D7E6}", "4"],
+ ["\u{1D7E7}", "5"],
+ ["\u{1D7E8}", "6"],
+ ["\u{1D7E9}", "7"],
+ ["\u{1D7EA}", "8"],
+ ["\u{1D7EB}", "9"],
+ ["\u{1D7EC}", "0"],
+ ["\u{1D7ED}", "1"],
+ ["\u{1D7EE}", "2"],
+ ["\u{1D7EF}", "3"],
+ ["\u{1D7F0}", "4"],
+ ["\u{1D7F1}", "5"],
+ ["\u{1D7F2}", "6"],
+ ["\u{1D7F3}", "7"],
+ ["\u{1D7F4}", "8"],
+ ["\u{1D7F5}", "9"],
+ ["\u{1D7F6}", "0"],
+ ["\u{1D7F7}", "1"],
+ ["\u{1D7F8}", "2"],
+ ["\u{1D7F9}", "3"],
+ ["\u{1D7FA}", "4"],
+ ["\u{1D7FB}", "5"],
+ ["\u{1D7FC}", "6"],
+ ["\u{1D7FD}", "7"],
+ ["\u{1D7FE}", "8"],
+ ["\u{1D7FF}", "9"],
+ ["\u2460", "1"],
+ ["\u2461", "2"],
+ ["\u2462", "3"],
+ ["\u2463", "4"],
+ ["\u2464", "5"],
+ ["\u2465", "6"],
+ ["\u2466", "7"],
+ ["\u2467", "8"],
+ ["\u2468", "9"],
+ ["\u2469", "10"],
+ ["\u246A", "11"],
+ ["\u246B", "12"],
+ ["\u246C", "13"],
+ ["\u246D", "14"],
+ ["\u246E", "15"],
+ ["\u246F", "16"],
+ ["\u2470", "17"],
+ ["\u2471", "18"],
+ ["\u2472", "19"],
+ ["\u2473", "20"],
+ ["\u2474", "1"],
+ ["\u2475", "2"],
+ ["\u2476", "3"],
+ ["\u2477", "4"],
+ ["\u2478", "5"],
+ ["\u2479", "6"],
+ ["\u247A", "7"],
+ ["\u247B", "8"],
+ ["\u247C", "9"],
+ ["\u247D", "10"],
+ ["\u247E", "11"],
+ ["\u247F", "12"],
+ ["\u2480", "13"],
+ ["\u2481", "14"],
+ ["\u2482", "15"],
+ ["\u2483", "16"],
+ ["\u2484", "17"],
+ ["\u2485", "18"],
+ ["\u2486", "19"],
+ ["\u2487", "20"],
+ ["\u2488", "1."],
+ ["\u2489", "2."],
+ ["\u248A", "3."],
+ ["\u248B", "4."],
+ ["\u248C", "5."],
+ ["\u248D", "6."],
+ ["\u248E", "7."],
+ ["\u248F", "8."],
+ ["\u2490", "9."],
+ ["\u2491", "10."],
+ ["\u2492", "11."],
+ ["\u2493", "12."],
+ ["\u2494", "13."],
+ ["\u2495", "14."],
+ ["\u2496", "15."],
+ ["\u2497", "16."],
+ ["\u2498", "17."],
+ ["\u2499", "18."],
+ ["\u249A", "19."],
+ ["\u249B", "20."],
+ ["\u24EA", "0"],
+ ["\u24EB", "11"],
+ ["\u24EC", "12"],
+ ["\u24ED", "13"],
+ ["\u24EE", "14"],
+ ["\u24EF", "15"],
+ ["\u24F0", "16"],
+ ["\u24F1", "17"],
+ ["\u24F2", "18"],
+ ["\u24F3", "19"],
+ ["\u24F4", "20"],
+ ["\u24F5", "1"],
+ ["\u24F6", "2"],
+ ["\u24F7", "3"],
+ ["\u24F8", "4"],
+ ["\u24F9", "5"],
+ ["\u24FA", "6"],
+ ["\u24FB", "7"],
+ ["\u24FC", "8"],
+ ["\u24FD", "9"],
+ ["\u24FE", "10"],
+ ["\u24FF", "0"],
+ // Punctuation
+ ["\u{1F670}", "&"],
+ ["\u{1F671}", "&"],
+ ["\u{1F672}", "&"],
+ ["\u{1F673}", "&"],
+ ["\u{1F674}", "&"],
+ ["\u{1F675}", "&"],
+ ["\u{1F676}", '"'],
+ ["\u{1F677}", '"'],
+ ["\u{1F678}", '"'],
+ ["\u203D", "?!"],
+ ["\u{1F679}", "?!"],
+ ["\u{1F67A}", "?!"],
+ ["\u{1F67B}", "?!"],
+ ["\u{1F67C}", "/"],
+ ["\u{1F67D}", "\\"],
+ // Alchemy
+ ["\u{1F707}", "AR"],
+ ["\u{1F708}", "V"],
+ ["\u{1F709}", "V"],
+ ["\u{1F706}", "VR"],
+ ["\u{1F705}", "VF"],
+ ["\u{1F729}", "2"],
+ ["\u{1F72A}", "5"],
+ ["\u{1F761}", "f"],
+ ["\u{1F762}", "W"],
+ ["\u{1F763}", "U"],
+ ["\u{1F767}", "V"],
+ ["\u{1F768}", "T"],
+ ["\u{1F76A}", "V"],
+ ["\u{1F76B}", "MB"],
+ ["\u{1F76C}", "VB"],
+ ["\u{1F772}", "3B"],
+ ["\u{1F773}", "3B"],
+ // Emojis
+ ["\u{1F4AF}", "100"],
+ ["\u{1F519}", "BACK"],
+ ["\u{1F51A}", "END"],
+ ["\u{1F51B}", "ON!"],
+ ["\u{1F51C}", "SOON"],
+ ["\u{1F51D}", "TOP"],
+ ["\u{1F51E}", "18"],
+ ["\u{1F524}", "abc"],
+ ["\u{1F520}", "ABCD"],
+ ["\u{1F521}", "abcd"],
+ ["\u{1F522}", "1234"],
+ ["\u{1F523}", "T&@%"],
+ ["#\uFE0F\u20E3", "#"],
+ ["*\uFE0F\u20E3", "*"],
+ ["0\uFE0F\u20E3", "0"],
+ ["1\uFE0F\u20E3", "1"],
+ ["2\uFE0F\u20E3", "2"],
+ ["3\uFE0F\u20E3", "3"],
+ ["4\uFE0F\u20E3", "4"],
+ ["5\uFE0F\u20E3", "5"],
+ ["6\uFE0F\u20E3", "6"],
+ ["7\uFE0F\u20E3", "7"],
+ ["8\uFE0F\u20E3", "8"],
+ ["9\uFE0F\u20E3", "9"],
+ ["\u{1F51F}", "10"],
+ ["\u{1F170}\uFE0F", "A"],
+ ["\u{1F171}\uFE0F", "B"],
+ ["\u{1F18E}", "AB"],
+ ["\u{1F191}", "CL"],
+ ["\u{1F17E}\uFE0F", "O"],
+ ["\u{1F17F}", "P"],
+ ["\u{1F198}", "SOS"],
+ ["\u{1F172}", "C"],
+ ["\u{1F173}", "D"],
+ ["\u{1F174}", "E"],
+ ["\u{1F175}", "F"],
+ ["\u{1F176}", "G"],
+ ["\u{1F177}", "H"],
+ ["\u{1F178}", "I"],
+ ["\u{1F179}", "J"],
+ ["\u{1F17A}", "K"],
+ ["\u{1F17B}", "L"],
+ ["\u{1F17C}", "M"],
+ ["\u{1F17D}", "N"],
+ ["\u{1F180}", "Q"],
+ ["\u{1F181}", "R"],
+ ["\u{1F182}", "S"],
+ ["\u{1F183}", "T"],
+ ["\u{1F184}", "U"],
+ ["\u{1F185}", "V"],
+ ["\u{1F186}", "W"],
+ ["\u{1F187}", "X"],
+ ["\u{1F188}", "Y"],
+ ["\u{1F189}", "Z"]
+ ];
+ var replacements_default = replacements;
+
+ // node_modules/@sindresorhus/transliterate/index.js
+ var doCustomReplacements = (string3, replacements2) => {
+ for (const [key, value] of replacements2) {
+ string3 = string3.replace(new RegExp(escapeStringRegexp(key), "g"), value);
+ }
+ return string3;
+ };
+ function transliterate(string3, options2) {
+ if (typeof string3 !== "string") {
+ throw new TypeError(`Expected a string, got \`${typeof string3}\``);
+ }
+ options2 = __spreadValues({
+ customReplacements: []
+ }, options2);
+ const customReplacements = new Map([
+ ...replacements_default,
+ ...options2.customReplacements
+ ]);
+ string3 = string3.normalize();
+ string3 = doCustomReplacements(string3, customReplacements);
+ string3 = string3.normalize("NFD").replace(new RegExp("\\p{Diacritic}", "gu"), "").normalize();
+ return string3;
+ }
+
+ // node_modules/@sindresorhus/slugify/overridable-replacements.js
+ var overridableReplacements = [
+ ["&", " and "],
+ ["\u{1F984}", " unicorn "],
+ ["\u2665", " love "]
+ ];
+ var overridable_replacements_default = overridableReplacements;
+
+ // node_modules/@sindresorhus/slugify/index.js
+ var decamelize = (string3) => {
+ return string3.replace(/([A-Z]{2,})(\d+)/g, "$1 $2").replace(/([a-z\d]+)([A-Z]{2,})/g, "$1 $2").replace(/([a-z\d])([A-Z])/g, "$1 $2").replace(/([A-Z]+)([A-Z][a-rt-z\d]+)/g, "$1 $2");
+ };
+ var removeMootSeparators = (string3, separator) => {
+ const escapedSeparator = escapeStringRegexp(separator);
+ return string3.replace(new RegExp(`${escapedSeparator}{2,}`, "g"), separator).replace(new RegExp(`^${escapedSeparator}|${escapedSeparator}$`, "g"), "");
+ };
+ var buildPatternSlug = (options2) => {
+ let negationSetPattern = "a-z\\d";
+ negationSetPattern += options2.lowercase ? "" : "A-Z";
+ if (options2.preserveCharacters.length > 0) {
+ for (const character of options2.preserveCharacters) {
+ if (character === options2.separator) {
+ throw new Error(`The separator character \`${options2.separator}\` cannot be included in preserved characters: ${options2.preserveCharacters}`);
+ }
+ negationSetPattern += escapeStringRegexp(character);
+ }
+ }
+ return new RegExp(`[^${negationSetPattern}]+`, "g");
+ };
+ function slugify(string3, options2) {
+ if (typeof string3 !== "string") {
+ throw new TypeError(`Expected a string, got \`${typeof string3}\``);
+ }
+ options2 = __spreadValues({
+ separator: "-",
+ lowercase: true,
+ decamelize: true,
+ customReplacements: [],
+ preserveLeadingUnderscore: false,
+ preserveTrailingDash: false,
+ preserveCharacters: []
+ }, options2);
+ const shouldPrependUnderscore = options2.preserveLeadingUnderscore && string3.startsWith("_");
+ const shouldAppendDash = options2.preserveTrailingDash && string3.endsWith("-");
+ const customReplacements = new Map([
+ ...overridable_replacements_default,
+ ...options2.customReplacements
+ ]);
+ string3 = transliterate(string3, { customReplacements });
+ if (options2.decamelize) {
+ string3 = decamelize(string3);
+ }
+ const patternSlug = buildPatternSlug(options2);
+ if (options2.lowercase) {
+ string3 = string3.toLowerCase();
+ }
+ string3 = string3.replace(/([a-zA-Z\d]+)'([ts])(\s|$)/g, "$1$2$3");
+ string3 = string3.replace(patternSlug, options2.separator);
+ string3 = string3.replace(/\\/g, "");
+ if (options2.separator) {
+ string3 = removeMootSeparators(string3, options2.separator);
+ }
+ if (shouldPrependUnderscore) {
+ string3 = `_${string3}`;
+ }
+ if (shouldAppendDash) {
+ string3 = `${string3}-`;
+ }
+ return string3;
+ }
+
+ // node_modules/prosemirror-schema-list/dist/index.js
+ function splitListItem(itemType, itemAttrs) {
+ return function(state, dispatch) {
+ let { $from, $to, node: node2 } = state.selection;
+ if (node2 && node2.isBlock || $from.depth < 2 || !$from.sameParent($to))
+ return false;
+ let grandParent = $from.node(-1);
+ if (grandParent.type != itemType)
+ return false;
+ if ($from.parent.content.size == 0 && $from.node(-1).childCount == $from.indexAfter(-1)) {
+ if ($from.depth == 3 || $from.node(-3).type != itemType || $from.index(-2) != $from.node(-2).childCount - 1)
+ return false;
+ if (dispatch) {
+ let wrap3 = Fragment.empty;
+ let depthBefore = $from.index(-1) ? 1 : $from.index(-2) ? 2 : 3;
+ for (let d6 = $from.depth - depthBefore; d6 >= $from.depth - 3; d6--)
+ wrap3 = Fragment.from($from.node(d6).copy(wrap3));
+ let depthAfter = $from.indexAfter(-1) < $from.node(-2).childCount ? 1 : $from.indexAfter(-2) < $from.node(-3).childCount ? 2 : 3;
+ wrap3 = wrap3.append(Fragment.from(itemType.createAndFill()));
+ let start = $from.before($from.depth - (depthBefore - 1));
+ let tr2 = state.tr.replace(start, $from.after(-depthAfter), new Slice(wrap3, 4 - depthBefore, 0));
+ let sel = -1;
+ tr2.doc.nodesBetween(start, tr2.doc.content.size, (node3, pos) => {
+ if (sel > -1)
+ return false;
+ if (node3.isTextblock && node3.content.size == 0)
+ sel = pos + 1;
+ });
+ if (sel > -1)
+ tr2.setSelection(Selection.near(tr2.doc.resolve(sel)));
+ dispatch(tr2.scrollIntoView());
+ }
+ return true;
+ }
+ let nextType = $to.pos == $from.end() ? grandParent.contentMatchAt(0).defaultType : null;
+ let tr = state.tr.delete($from.pos, $to.pos);
+ let types = nextType ? [itemAttrs ? { type: itemType, attrs: itemAttrs } : null, { type: nextType }] : void 0;
+ if (!canSplit(tr.doc, $from.pos, 2, types))
+ return false;
+ if (dispatch)
+ dispatch(tr.split($from.pos, 2, types).scrollIntoView());
+ return true;
+ };
+ }
+ function liftListItem(itemType) {
+ return function(state, dispatch) {
+ let { $from, $to } = state.selection;
+ let range = $from.blockRange($to, (node2) => node2.childCount > 0 && node2.firstChild.type == itemType);
+ if (!range)
+ return false;
+ if (!dispatch)
+ return true;
+ if ($from.node(range.depth - 1).type == itemType)
+ return liftToOuterList(state, dispatch, itemType, range);
+ else
+ return liftOutOfList(state, dispatch, range);
+ };
+ }
+ function liftToOuterList(state, dispatch, itemType, range) {
+ let tr = state.tr, end = range.end, endOfList = range.$to.end(range.depth);
+ if (end < endOfList) {
+ tr.step(new ReplaceAroundStep(end - 1, endOfList, end, endOfList, new Slice(Fragment.from(itemType.create(null, range.parent.copy())), 1, 0), 1, true));
+ range = new NodeRange(tr.doc.resolve(range.$from.pos), tr.doc.resolve(endOfList), range.depth);
+ }
+ const target = liftTarget(range);
+ if (target == null)
+ return false;
+ tr.lift(range, target);
+ let after = tr.mapping.map(end, -1) - 1;
+ if (canJoin(tr.doc, after))
+ tr.join(after);
+ dispatch(tr.scrollIntoView());
+ return true;
+ }
+ function liftOutOfList(state, dispatch, range) {
+ let tr = state.tr, list4 = range.parent;
+ for (let pos = range.end, i2 = range.endIndex - 1, e2 = range.startIndex; i2 > e2; i2--) {
+ pos -= list4.child(i2).nodeSize;
+ tr.delete(pos - 1, pos + 1);
+ }
+ let $start = tr.doc.resolve(range.start), item = $start.nodeAfter;
+ if (tr.mapping.map(range.end) != range.start + $start.nodeAfter.nodeSize)
+ return false;
+ let atStart = range.startIndex == 0, atEnd = range.endIndex == list4.childCount;
+ let parent = $start.node(-1), indexBefore = $start.index(-1);
+ if (!parent.canReplace(indexBefore + (atStart ? 0 : 1), indexBefore + 1, item.content.append(atEnd ? Fragment.empty : Fragment.from(list4))))
+ return false;
+ let start = $start.pos, end = start + item.nodeSize;
+ tr.step(new ReplaceAroundStep(start - (atStart ? 1 : 0), end + (atEnd ? 1 : 0), start + 1, end - 1, new Slice((atStart ? Fragment.empty : Fragment.from(list4.copy(Fragment.empty))).append(atEnd ? Fragment.empty : Fragment.from(list4.copy(Fragment.empty))), atStart ? 0 : 1, atEnd ? 0 : 1), atStart ? 0 : 1));
+ dispatch(tr.scrollIntoView());
+ return true;
+ }
+ function sinkListItem(itemType) {
+ return function(state, dispatch) {
+ let { $from, $to } = state.selection;
+ let range = $from.blockRange($to, (node2) => node2.childCount > 0 && node2.firstChild.type == itemType);
+ if (!range)
+ return false;
+ let startIndex = range.startIndex;
+ if (startIndex == 0)
+ return false;
+ let parent = range.parent, nodeBefore = parent.child(startIndex - 1);
+ if (nodeBefore.type != itemType)
+ return false;
+ if (dispatch) {
+ let nestedBefore = nodeBefore.lastChild && nodeBefore.lastChild.type == parent.type;
+ let inner = Fragment.from(nestedBefore ? itemType.create() : null);
+ let slice = new Slice(Fragment.from(itemType.create(null, Fragment.from(parent.type.create(null, inner)))), nestedBefore ? 3 : 1, 0);
+ let before = range.start, after = range.end;
+ dispatch(state.tr.step(new ReplaceAroundStep(before - (nestedBefore ? 3 : 1), after, before, after, slice, 1, true)).scrollIntoView());
+ }
+ return true;
+ };
+ }
+
+ // node_modules/mdast-util-definitions/lib/index.js
+ function definitions(tree) {
+ const cache = /* @__PURE__ */ new Map();
+ if (!tree || !tree.type) {
+ throw new Error("mdast-util-definitions expected node");
+ }
+ visit(tree, "definition", function(definition4) {
+ const id = clean(definition4.identifier);
+ if (id && !cache.get(id)) {
+ cache.set(id, definition4);
+ }
+ });
+ return definition3;
+ function definition3(identifier) {
+ const id = clean(identifier);
+ return cache.get(id);
+ }
+ }
+ function clean(value) {
+ return String(value || "").toUpperCase();
+ }
+
+ // node_modules/remark-inline-links/lib/index.js
+ function remarkInlineLinks() {
+ return function(tree) {
+ const definition3 = definitions(tree);
+ visit(tree, function(node2, index2, parent) {
+ if (node2.type === "definition" && parent !== void 0 && typeof index2 === "number") {
+ parent.children.splice(index2, 1);
+ return [SKIP, index2];
+ }
+ if (node2.type === "imageReference" || node2.type === "linkReference") {
+ const def = definition3(node2.identifier);
+ if (def && parent && typeof index2 === "number") {
+ parent.children[index2] = node2.type === "imageReference" ? { type: "image", url: def.url, title: def.title, alt: node2.alt } : {
+ type: "link",
+ url: def.url,
+ title: def.title,
+ children: node2.children
+ };
+ return [SKIP, index2];
+ }
+ }
+ });
+ };
+ }
+
+ // node_modules/@milkdown/preset-commonmark/lib/index.es.js
+ function at2(t2, e2) {
+ var o2;
+ if (!(e2.childCount >= 1 && ((o2 = e2.lastChild) == null ? void 0 : o2.type.name) === "hardbreak")) {
+ t2.next(e2.content);
+ return;
+ }
+ const a2 = [];
+ e2.content.forEach((s2, l5, i2) => {
+ i2 !== e2.childCount - 1 && a2.push(s2);
+ }), t2.next(Fragment.fromArray(a2));
+ }
+ function n3(t2, e2) {
+ return Object.assign(t2, {
+ meta: __spreadValues({
+ package: "@milkdown/preset-commonmark"
+ }, e2)
+ }), t2;
+ }
+ var Z3 = we2("emphasis");
+ n3(Z3, {
+ displayName: "Attr",
+ group: "Emphasis"
+ });
+ var R4 = ye2("emphasis", (t2) => ({
+ attrs: {
+ marker: {
+ default: t2.get(Q2).emphasis || "*"
+ }
+ },
+ parseDOM: [
+ { tag: "i" },
+ { tag: "em" },
+ { style: "font-style", getAttrs: (e2) => e2 === "italic" }
+ ],
+ toDOM: (e2) => ["em", t2.get(Z3.key)(e2)],
+ parseMarkdown: {
+ match: (e2) => e2.type === "emphasis",
+ runner: (e2, r3, a2) => {
+ e2.openMark(a2, { marker: r3.marker }), e2.next(r3.children), e2.closeMark(a2);
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "emphasis",
+ runner: (e2, r3) => {
+ e2.withMark(r3, "emphasis", void 0, {
+ marker: r3.attrs.marker
+ });
+ }
+ }
+ }));
+ n3(R4.mark, {
+ displayName: "MarkSchema",
+ group: "Emphasis"
+ });
+ n3(R4.ctx, {
+ displayName: "MarkSchemaCtx",
+ group: "Emphasis"
+ });
+ var ee2 = re2("ToggleEmphasis", (t2) => () => toggleMark(R4.type(t2)));
+ n3(ee2, {
+ displayName: "Command",
+ group: "Emphasis"
+ });
+ var nt = oe2((t2) => markRule(/(?:^|[^*])\*([^*]+)\*$/, R4.type(t2), {
+ getAttr: () => ({
+ marker: "*"
+ }),
+ updateCaptured: ({ fullMatch: e2, start: r3 }) => e2.startsWith("*") ? {} : { fullMatch: e2.slice(1), start: r3 + 1 }
+ }));
+ n3(nt, {
+ displayName: "InputRule|Star",
+ group: "Emphasis"
+ });
+ var ot2 = oe2((t2) => markRule(/(?:^|[^_])_([^_]+)_$/, R4.type(t2), {
+ getAttr: () => ({
+ marker: "_"
+ }),
+ updateCaptured: ({ fullMatch: e2, start: r3 }) => e2.startsWith("_") ? {} : { fullMatch: e2.slice(1), start: r3 + 1 }
+ }));
+ n3(ot2, {
+ displayName: "InputRule|Underscore",
+ group: "Emphasis"
+ });
+ var te2 = ge2("emphasisKeymap", {
+ ToggleEmphasis: {
+ shortcuts: "Mod-i",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(ee2.key);
+ }
+ }
+ });
+ n3(te2.ctx, {
+ displayName: "KeymapCtx",
+ group: "Emphasis"
+ });
+ n3(te2.shortcuts, {
+ displayName: "Keymap",
+ group: "Emphasis"
+ });
+ var re3 = we2("strong");
+ n3(re3, {
+ displayName: "Attr",
+ group: "Strong"
+ });
+ var $2 = ye2("strong", (t2) => ({
+ attrs: {
+ marker: {
+ default: t2.get(Q2).strong || "*"
+ }
+ },
+ parseDOM: [
+ { tag: "b" },
+ { tag: "strong" },
+ { style: "font-style", getAttrs: (e2) => e2 === "bold" }
+ ],
+ toDOM: (e2) => ["strong", t2.get(re3.key)(e2)],
+ parseMarkdown: {
+ match: (e2) => e2.type === "strong",
+ runner: (e2, r3, a2) => {
+ e2.openMark(a2, { marker: r3.marker }), e2.next(r3.children), e2.closeMark(a2);
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "strong",
+ runner: (e2, r3) => {
+ e2.withMark(r3, "strong", void 0, {
+ marker: r3.attrs.marker
+ });
+ }
+ }
+ }));
+ n3($2.mark, {
+ displayName: "MarkSchema",
+ group: "Strong"
+ });
+ n3($2.ctx, {
+ displayName: "MarkSchemaCtx",
+ group: "Strong"
+ });
+ var ae2 = re2("ToggleStrong", (t2) => () => toggleMark($2.type(t2)));
+ n3(ae2, {
+ displayName: "Command",
+ group: "Strong"
+ });
+ var st = oe2((t2) => markRule(/(?:\*\*|__)([^*_]+)(?:\*\*|__)$/, $2.type(t2), {
+ getAttr: (e2) => ({
+ marker: e2[0].startsWith("*") ? "*" : "_"
+ })
+ }));
+ n3(st, {
+ displayName: "InputRule",
+ group: "Strong"
+ });
+ var ne2 = ge2("strongKeymap", {
+ ToggleBold: {
+ shortcuts: ["Mod-b"],
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(ae2.key);
+ }
+ }
+ });
+ n3(ne2.ctx, {
+ displayName: "KeymapCtx",
+ group: "Strong"
+ });
+ n3(ne2.shortcuts, {
+ displayName: "Keymap",
+ group: "Strong"
+ });
+ var oe3 = we2("inlineCode");
+ n3(oe3, {
+ displayName: "Attr",
+ group: "InlineCode"
+ });
+ var x5 = ye2("inlineCode", (t2) => ({
+ priority: 100,
+ code: true,
+ inclusive: false,
+ parseDOM: [{ tag: "code" }],
+ toDOM: (e2) => ["code", t2.get(oe3.key)(e2)],
+ parseMarkdown: {
+ match: (e2) => e2.type === "inlineCode",
+ runner: (e2, r3, a2) => {
+ e2.openMark(a2), e2.addText(r3.value), e2.closeMark(a2);
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "inlineCode",
+ runner: (e2, r3, a2) => {
+ e2.withMark(r3, "inlineCode", a2.text || "");
+ }
+ }
+ }));
+ n3(x5.mark, {
+ displayName: "MarkSchema",
+ group: "InlineCode"
+ });
+ n3(x5.ctx, {
+ displayName: "MarkSchemaCtx",
+ group: "InlineCode"
+ });
+ var se2 = re2("ToggleInlineCode", (t2) => () => (e2, r3) => {
+ const { selection: a2, tr: o2 } = e2;
+ if (a2.empty)
+ return false;
+ const { from: s2, to: l5 } = a2;
+ return e2.doc.rangeHasMark(s2, l5, x5.type(t2)) ? (r3 == null || r3(o2.removeMark(s2, l5, x5.type(t2))), true) : (Object.keys(e2.schema.marks).filter((m3) => m3 !== x5.type.name).map((m3) => e2.schema.marks[m3]).forEach((m3) => {
+ o2.removeMark(s2, l5, m3);
+ }), r3 == null || r3(o2.addMark(s2, l5, x5.type(t2).create())), true);
+ });
+ n3(se2, {
+ displayName: "Command",
+ group: "InlineCode"
+ });
+ var lt2 = oe2((t2) => markRule(/(?:\`)([^\`]+)(?:\`)$/, x5.type(t2)));
+ n3(lt2, {
+ displayName: "InputRule",
+ group: "InlineCode"
+ });
+ var le2 = ge2("inlineCodeKeymap", {
+ ToggleInlineCode: {
+ shortcuts: "Mod-e",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(se2.key);
+ }
+ }
+ });
+ n3(le2.ctx, {
+ displayName: "KeymapCtx",
+ group: "InlineCode"
+ });
+ n3(le2.shortcuts, {
+ displayName: "Keymap",
+ group: "InlineCode"
+ });
+ var ie5 = we2("link");
+ n3(ie5, {
+ displayName: "Attr",
+ group: "Link"
+ });
+ var B2 = ye2("link", (t2) => ({
+ attrs: {
+ href: {},
+ title: { default: null }
+ },
+ parseDOM: [
+ {
+ tag: "a[href]",
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return { href: e2.getAttribute("href"), title: e2.getAttribute("title") };
+ }
+ }
+ ],
+ toDOM: (e2) => ["a", __spreadValues(__spreadValues({}, t2.get(ie5.key)(e2)), e2.attrs)],
+ parseMarkdown: {
+ match: (e2) => e2.type === "link",
+ runner: (e2, r3, a2) => {
+ const o2 = r3.url, s2 = r3.title;
+ e2.openMark(a2, { href: o2, title: s2 }), e2.next(r3.children), e2.closeMark(a2);
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "link",
+ runner: (e2, r3) => {
+ e2.withMark(r3, "link", void 0, {
+ title: r3.attrs.title,
+ url: r3.attrs.href
+ });
+ }
+ }
+ }));
+ n3(B2.mark, {
+ displayName: "MarkSchema",
+ group: "Link"
+ });
+ var it = re2("ToggleLink", (t2) => (e2 = {}) => toggleMark(B2.type(t2), e2));
+ n3(it, {
+ displayName: "Command",
+ group: "Link"
+ });
+ var dt2 = re2("UpdateLink", (t2) => (e2 = {}) => (r3, a2) => {
+ if (!a2)
+ return false;
+ let o2, s2 = -1;
+ const { selection: l5 } = r3, { from: i2, to: d6 } = l5;
+ if (r3.doc.nodesBetween(i2, i2 === d6 ? d6 + 1 : d6, (y4, b4) => {
+ if (B2.type(t2).isInSet(y4.marks))
+ return o2 = y4, s2 = b4, false;
+ }), !o2)
+ return false;
+ const m3 = o2.marks.find(({ type: y4 }) => y4 === B2.type(t2));
+ if (!m3)
+ return false;
+ const p4 = s2, k4 = s2 + o2.nodeSize, { tr: g5 } = r3, C5 = B2.type(t2).create(__spreadValues(__spreadValues({}, m3.attrs), e2));
+ return C5 ? (a2(
+ g5.removeMark(p4, k4, m3).addMark(p4, k4, C5).setSelection(new TextSelection(g5.selection.$anchor)).scrollIntoView()
+ ), true) : false;
+ });
+ n3(dt2, {
+ displayName: "Command",
+ group: "Link"
+ });
+ var mt2 = W3("doc", () => ({
+ content: "block+",
+ parseMarkdown: {
+ match: ({ type: t2 }) => t2 === "root",
+ runner: (t2, e2, r3) => {
+ t2.injectRoot(e2, r3);
+ }
+ },
+ toMarkdown: {
+ match: (t2) => t2.type.name === "doc",
+ runner: (t2, e2) => {
+ t2.openNode("root"), t2.next(e2.content);
+ }
+ }
+ }));
+ n3(mt2, {
+ displayName: "NodeSchema",
+ group: "Doc"
+ });
+ var de = he("paragraph");
+ n3(de, {
+ displayName: "Attr",
+ group: "Paragraph"
+ });
+ var w5 = fe2("paragraph", (t2) => ({
+ content: "inline*",
+ group: "block",
+ parseDOM: [{ tag: "p" }],
+ toDOM: (e2) => ["p", t2.get(de.key)(e2), 0],
+ parseMarkdown: {
+ match: (e2) => e2.type === "paragraph",
+ runner: (e2, r3, a2) => {
+ e2.openNode(a2), r3.children ? e2.next(r3.children) : e2.addText(r3.value || ""), e2.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "paragraph",
+ runner: (e2, r3) => {
+ e2.openNode("paragraph"), at2(e2, r3), e2.closeNode();
+ }
+ }
+ }));
+ n3(w5.node, {
+ displayName: "NodeSchema",
+ group: "Paragraph"
+ });
+ n3(w5.ctx, {
+ displayName: "NodeSchemaCtx",
+ group: "Paragraph"
+ });
+ var me2 = re2("TurnIntoText", (t2) => () => setBlockType2(w5.type(t2)));
+ n3(me2, {
+ displayName: "Command",
+ group: "Paragraph"
+ });
+ var pe2 = ge2("paragraphKeymap", {
+ TurnIntoText: {
+ shortcuts: "Mod-Alt-0",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(me2.key);
+ }
+ }
+ });
+ n3(pe2.ctx, {
+ displayName: "KeymapCtx",
+ group: "Paragraph"
+ });
+ n3(pe2.shortcuts, {
+ displayName: "Keymap",
+ group: "Paragraph"
+ });
+ var Dt = Array(6).fill(0).map((t2, e2) => e2 + 1);
+ function _t(t2) {
+ return slugify(t2.textContent);
+ }
+ var j4 = h3(_t, "headingIdGenerator");
+ n3(j4, {
+ displayName: "Ctx",
+ group: "Heading"
+ });
+ var ce2 = he("heading");
+ n3(ce2, {
+ displayName: "Attr",
+ group: "Heading"
+ });
+ var H4 = fe2("heading", (t2) => {
+ const e2 = t2.get(j4.key);
+ return {
+ content: "inline*",
+ group: "block",
+ defining: true,
+ attrs: {
+ id: {
+ default: ""
+ },
+ level: {
+ default: 1
+ }
+ },
+ parseDOM: Dt.map((r3) => ({
+ tag: `h${r3}`,
+ getAttrs: (a2) => {
+ if (!(a2 instanceof HTMLElement))
+ throw S(a2);
+ return { level: r3, id: a2.id };
+ }
+ })),
+ toDOM: (r3) => [
+ `h${r3.attrs.level}`,
+ __spreadProps(__spreadValues({}, t2.get(ce2.key)(r3)), {
+ id: r3.attrs.id || e2(r3)
+ }),
+ 0
+ ],
+ parseMarkdown: {
+ match: ({ type: r3 }) => r3 === "heading",
+ runner: (r3, a2, o2) => {
+ const s2 = a2.depth;
+ r3.openNode(o2, { level: s2 }), r3.next(a2.children), r3.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (r3) => r3.type.name === "heading",
+ runner: (r3, a2) => {
+ r3.openNode("heading", void 0, { depth: a2.attrs.level }), at2(r3, a2), r3.closeNode();
+ }
+ }
+ };
+ });
+ n3(H4.node, {
+ displayName: "NodeSchema",
+ group: "Heading"
+ });
+ n3(H4.ctx, {
+ displayName: "NodeSchemaCtx",
+ group: "Heading"
+ });
+ var pt = oe2((t2) => textblockTypeInputRule(new RegExp("^(?#+)\\s$"), H4.type(t2), (e2) => {
+ var l5, i2;
+ const r3 = ((i2 = (l5 = e2.groups) == null ? void 0 : l5.hashes) == null ? void 0 : i2.length) || 0, a2 = t2.get(H3), { $from: o2 } = a2.state.selection, s2 = o2.node();
+ if (s2.type.name === "heading") {
+ let d6 = Number(s2.attrs.level) + Number(r3);
+ return d6 > 6 && (d6 = 6), { level: d6 };
+ }
+ return { level: r3 };
+ }));
+ n3(pt, {
+ displayName: "InputRule",
+ group: "Heading"
+ });
+ var L4 = re2("WrapInHeading", (t2) => (e2) => (e2 != null ? e2 : e2 = 1, e2 < 1 ? setBlockType2(w5.type(t2)) : setBlockType2(H4.type(t2), { level: e2 })));
+ n3(L4, {
+ displayName: "Command",
+ group: "Heading"
+ });
+ var ue3 = re2("DowngradeHeading", (t2) => () => (e2, r3, a2) => {
+ const { $from: o2 } = e2.selection, s2 = o2.node();
+ if (s2.type !== H4.type(t2) || !e2.selection.empty || o2.parentOffset !== 0)
+ return false;
+ const l5 = s2.attrs.level - 1;
+ return l5 ? (r3 == null || r3(
+ e2.tr.setNodeMarkup(e2.selection.$from.before(), void 0, __spreadProps(__spreadValues({}, s2.attrs), {
+ level: l5
+ }))
+ ), true) : setBlockType2(w5.type(t2))(e2, r3, a2);
+ });
+ n3(ue3, {
+ displayName: "Command",
+ group: "Heading"
+ });
+ var ge3 = ge2("headingKeymap", {
+ TurnIntoH1: {
+ shortcuts: "Mod-Alt-1",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(L4.key, 1);
+ }
+ },
+ TurnIntoH2: {
+ shortcuts: "Mod-Alt-2",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(L4.key, 2);
+ }
+ },
+ TurnIntoH3: {
+ shortcuts: "Mod-Alt-3",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(L4.key, 3);
+ }
+ },
+ TurnIntoH4: {
+ shortcuts: "Mod-Alt-4",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(L4.key, 4);
+ }
+ },
+ TurnIntoH5: {
+ shortcuts: "Mod-Alt-5",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(L4.key, 5);
+ }
+ },
+ TurnIntoH6: {
+ shortcuts: "Mod-Alt-6",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(L4.key, 6);
+ }
+ },
+ DowngradeHeading: {
+ shortcuts: ["Delete", "Backspace"],
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(ue3.key);
+ }
+ }
+ });
+ n3(ge3.ctx, {
+ displayName: "KeymapCtx",
+ group: "Heading"
+ });
+ n3(ge3.shortcuts, {
+ displayName: "Keymap",
+ group: "Heading"
+ });
+ var ye3 = he("blockquote");
+ n3(ye3, {
+ displayName: "Attr",
+ group: "Blockquote"
+ });
+ var q5 = fe2("blockquote", (t2) => ({
+ content: "block+",
+ group: "block",
+ defining: true,
+ parseDOM: [{ tag: "blockquote" }],
+ toDOM: (e2) => ["blockquote", t2.get(ye3.key)(e2), 0],
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "blockquote",
+ runner: (e2, r3, a2) => {
+ e2.openNode(a2).next(r3.children).closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "blockquote",
+ runner: (e2, r3) => {
+ e2.openNode("blockquote").next(r3.content).closeNode();
+ }
+ }
+ }));
+ n3(q5.node, {
+ displayName: "NodeSchema",
+ group: "Blockquote"
+ });
+ n3(q5.ctx, {
+ displayName: "NodeSchemaCtx",
+ group: "Blockquote"
+ });
+ var ct2 = oe2((t2) => wrappingInputRule(/^\s*>\s$/, q5.type(t2)));
+ n3(ct2, {
+ displayName: "InputRule",
+ group: "Blockquote"
+ });
+ var ke3 = re2("WrapInBlockquote", (t2) => () => wrapIn(q5.type(t2)));
+ n3(ke3, {
+ displayName: "Command",
+ group: "Blockquote"
+ });
+ var he2 = ge2("blockquoteKeymap", {
+ WrapInBlockquote: {
+ shortcuts: "Mod-Shift-b",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(ke3.key);
+ }
+ }
+ });
+ n3(he2.ctx, {
+ displayName: "KeymapCtx",
+ group: "Blockquote"
+ });
+ n3(he2.shortcuts, {
+ displayName: "Keymap",
+ group: "Blockquote"
+ });
+ var fe3 = he("codeBlock", () => ({
+ pre: {},
+ code: {}
+ }));
+ n3(fe3, {
+ displayName: "Attr",
+ group: "CodeBlock"
+ });
+ var W4 = fe2("code_block", (t2) => ({
+ content: "text*",
+ group: "block",
+ marks: "",
+ defining: true,
+ code: true,
+ attrs: {
+ language: {
+ default: ""
+ }
+ },
+ parseDOM: [
+ {
+ tag: "pre",
+ preserveWhitespace: "full",
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return { language: e2.dataset.language };
+ }
+ }
+ ],
+ toDOM: (e2) => {
+ const r3 = t2.get(fe3.key)(e2);
+ return [
+ "pre",
+ __spreadProps(__spreadValues({}, r3.pre), {
+ "data-language": e2.attrs.language
+ }),
+ ["code", r3.code, 0]
+ ];
+ },
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "code",
+ runner: (e2, r3, a2) => {
+ const o2 = r3.lang, s2 = r3.value;
+ e2.openNode(a2, { language: o2 }), s2 && e2.addText(s2), e2.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "code_block",
+ runner: (e2, r3) => {
+ var a2;
+ e2.addNode("code", void 0, ((a2 = r3.content.firstChild) == null ? void 0 : a2.text) || "", {
+ lang: r3.attrs.language
+ });
+ }
+ }
+ }));
+ n3(W4.node, {
+ displayName: "NodeSchema",
+ group: "CodeBlock"
+ });
+ n3(W4.ctx, {
+ displayName: "NodeSchemaCtx",
+ group: "CodeBlock"
+ });
+ var ut2 = oe2((t2) => textblockTypeInputRule(new RegExp("^```(?[a-z]*)?[\\s\\n]$"), W4.type(t2), (e2) => {
+ var _a;
+ var r3;
+ return {
+ language: (_a = (r3 = e2.groups) == null ? void 0 : r3.language) != null ? _a : ""
+ };
+ }));
+ n3(ut2, {
+ displayName: "InputRule",
+ group: "CodeBlock"
+ });
+ var Ne2 = re2("CreateCodeBlock", (t2) => (e2 = "") => setBlockType2(W4.type(t2), { language: e2 }));
+ n3(Ne2, {
+ displayName: "Command",
+ group: "CodeBlock"
+ });
+ var Et2 = re2("UpdateCodeBlockLanguage", () => ({ pos: t2, language: e2 } = { pos: -1, language: "" }) => (r3, a2) => t2 >= 0 ? (a2 == null || a2(r3.tr.setNodeAttribute(t2, "language", e2)), true) : false);
+ n3(Et2, {
+ displayName: "Command",
+ group: "CodeBlock"
+ });
+ var Ie2 = ge2("codeBlockKeymap", {
+ CreateCodeBlock: {
+ shortcuts: "Mod-Alt-c",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(Ne2.key);
+ }
+ }
+ });
+ n3(Ie2.ctx, {
+ displayName: "KeymapCtx",
+ group: "CodeBlock"
+ });
+ n3(Ie2.shortcuts, {
+ displayName: "Keymap",
+ group: "CodeBlock"
+ });
+ var Ce3 = he("image");
+ n3(Ce3, {
+ displayName: "Attr",
+ group: "Image"
+ });
+ var v2 = fe2("image", (t2) => ({
+ inline: true,
+ group: "inline",
+ selectable: true,
+ draggable: true,
+ marks: "",
+ atom: true,
+ defining: true,
+ isolating: true,
+ attrs: {
+ src: { default: "" },
+ alt: { default: "" },
+ title: { default: "" }
+ },
+ parseDOM: [
+ {
+ tag: "img[src]",
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return {
+ src: e2.getAttribute("src") || "",
+ alt: e2.getAttribute("alt") || "",
+ title: e2.getAttribute("title") || e2.getAttribute("alt") || ""
+ };
+ }
+ }
+ ],
+ toDOM: (e2) => ["img", __spreadValues(__spreadValues({}, t2.get(Ce3.key)(e2)), e2.attrs)],
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "image",
+ runner: (e2, r3, a2) => {
+ const o2 = r3.url, s2 = r3.alt, l5 = r3.title;
+ e2.addNode(a2, {
+ src: o2,
+ alt: s2,
+ title: l5
+ });
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "image",
+ runner: (e2, r3) => {
+ e2.addNode("image", void 0, void 0, {
+ title: r3.attrs.title,
+ url: r3.attrs.src,
+ alt: r3.attrs.alt
+ });
+ }
+ }
+ }));
+ n3(v2.node, {
+ displayName: "NodeSchema",
+ group: "Image"
+ });
+ n3(v2.ctx, {
+ displayName: "NodeSchemaCtx",
+ group: "Image"
+ });
+ var gt = re2("InsertImage", (t2) => (e2 = {}) => (r3, a2) => {
+ if (!a2)
+ return true;
+ const { src: o2 = "", alt: s2 = "", title: l5 = "" } = e2, i2 = v2.type(t2).create({ src: o2, alt: s2, title: l5 });
+ return i2 && a2(r3.tr.replaceSelectionWith(i2).scrollIntoView()), true;
+ });
+ n3(gt, {
+ displayName: "Command",
+ group: "Image"
+ });
+ var yt = re2("UpdateImage", (t2) => (e2 = {}) => (r3, a2) => {
+ const o2 = findSelectedNodeOfType(r3.selection, v2.type(t2));
+ if (!o2)
+ return false;
+ const { node: s2, pos: l5 } = o2, i2 = __spreadValues({}, s2.attrs), { src: d6, alt: m3, title: p4 } = e2;
+ return d6 !== void 0 && (i2.src = d6), m3 !== void 0 && (i2.alt = m3), p4 !== void 0 && (i2.title = p4), a2 == null || a2(r3.tr.setNodeMarkup(l5, void 0, i2).scrollIntoView()), true;
+ });
+ n3(yt, {
+ displayName: "Command",
+ group: "Image"
+ });
+ var Pt = oe2((t2) => new InputRule(
+ new RegExp('!\\[(?.*?)]\\((?.*?)\\s*(?="|\\))"?(?[^"]+)?"?\\)'),
+ (e2, r3, a2, o2) => {
+ const [s2, l5, i2 = "", d6] = r3;
+ return s2 ? e2.tr.replaceWith(a2, o2, v2.type(t2).create({ src: i2, alt: l5, title: d6 })) : null;
+ }
+ ));
+ n3(Pt, {
+ displayName: "InputRule<insertImageInputRule>",
+ group: "Image"
+ });
+ var Me2 = he("hardbreak", (t2) => ({
+ "data-is-inline": t2.attrs.isInline
+ }));
+ n3(Me2, {
+ displayName: "Attr<hardbreak>",
+ group: "Hardbreak"
+ });
+ var S6 = fe2("hardbreak", (t2) => ({
+ inline: true,
+ group: "inline",
+ attrs: {
+ isInline: {
+ default: false
+ }
+ },
+ selectable: false,
+ parseDOM: [{ tag: "br" }],
+ toDOM: (e2) => ["br", t2.get(Me2.key)(e2)],
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "break",
+ runner: (e2, r3, a2) => {
+ var o2;
+ e2.addNode(a2, { isInline: !!((o2 = r3.data) != null && o2.isInline) });
+ }
+ },
+ leafText: () => `
+`,
+ toMarkdown: {
+ match: (e2) => e2.type.name === "hardbreak",
+ runner: (e2, r3) => {
+ r3.attrs.isInline ? e2.addNode("text", void 0, `
+`) : e2.addNode("break");
+ }
+ }
+ }));
+ n3(S6.node, {
+ displayName: "NodeSchema<hardbreak>",
+ group: "Hardbreak"
+ });
+ n3(S6.ctx, {
+ displayName: "NodeSchemaCtx<hardbreak>",
+ group: "Hardbreak"
+ });
+ var be = re2("InsertHardbreak", (t2) => () => (e2, r3) => {
+ var s2;
+ const { selection: a2, tr: o2 } = e2;
+ if (!(a2 instanceof TextSelection))
+ return false;
+ if (a2.empty) {
+ const l5 = a2.$from.node();
+ if (l5.childCount > 0 && ((s2 = l5.lastChild) == null ? void 0 : s2.type.name) === "hardbreak")
+ return r3 == null || r3(
+ o2.replaceRangeWith(a2.to - 1, a2.to, e2.schema.node("paragraph")).setSelection(Selection.near(o2.doc.resolve(a2.to))).scrollIntoView()
+ ), true;
+ }
+ return r3 == null || r3(o2.setMeta("hardbreak", true).replaceSelectionWith(S6.type(t2).create()).scrollIntoView()), true;
+ });
+ n3(be, {
+ displayName: "Command<insertHardbreakCommand>",
+ group: "Hardbreak"
+ });
+ var Le = ge2("hardbreakKeymap", {
+ InsertHardbreak: {
+ shortcuts: "Shift-Enter",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(be.key);
+ }
+ }
+ });
+ n3(Le.ctx, {
+ displayName: "KeymapCtx<hardbreak>",
+ group: "Hardbreak"
+ });
+ n3(Le.shortcuts, {
+ displayName: "Keymap<hardbreak>",
+ group: "Hardbreak"
+ });
+ var xe = he("hr");
+ n3(xe, {
+ displayName: "Attr<hr>",
+ group: "Hr"
+ });
+ var F3 = fe2("hr", (t2) => ({
+ group: "block",
+ parseDOM: [{ tag: "hr" }],
+ toDOM: (e2) => ["hr", t2.get(xe.key)(e2)],
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "thematicBreak",
+ runner: (e2, r3, a2) => {
+ e2.addNode(a2);
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "hr",
+ runner: (e2) => {
+ e2.addNode("thematicBreak");
+ }
+ }
+ }));
+ n3(F3.node, {
+ displayName: "NodeSchema<hr>",
+ group: "Hr"
+ });
+ n3(F3.ctx, {
+ displayName: "NodeSchemaCtx<hr>",
+ group: "Hr"
+ });
+ var kt = oe2((t2) => new InputRule(
+ /^(?:---|___\s|\*\*\*\s)$/,
+ (e2, r3, a2, o2) => {
+ const { tr: s2 } = e2;
+ return r3[0] && s2.replaceWith(a2 - 1, o2, F3.type(t2).create()), s2;
+ }
+ ));
+ n3(kt, {
+ displayName: "InputRule<insertHrInputRule>",
+ group: "Hr"
+ });
+ var ht2 = re2("InsertHr", (t2) => () => (e2, r3) => {
+ if (!r3)
+ return true;
+ const a2 = w5.node.type(t2).create(), { tr: o2, selection: s2 } = e2, { from: l5 } = s2, i2 = F3.type(t2).create();
+ if (!i2)
+ return true;
+ const d6 = o2.replaceSelectionWith(i2).insert(l5, a2), m3 = Selection.findFrom(d6.doc.resolve(l5), 1, true);
+ return m3 && r3(d6.setSelection(m3).scrollIntoView()), true;
+ });
+ n3(ht2, {
+ displayName: "Command<insertHrCommand>",
+ group: "Hr"
+ });
+ var Se = he("bulletList");
+ n3(Se, {
+ displayName: "Attr<bulletList>",
+ group: "BulletList"
+ });
+ var O3 = fe2("bullet_list", (t2) => ({
+ content: "listItem+",
+ group: "block",
+ attrs: {
+ spread: {
+ default: false
+ }
+ },
+ parseDOM: [
+ {
+ tag: "ul",
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return {
+ spread: e2.dataset.spread
+ };
+ }
+ }
+ ],
+ toDOM: (e2) => [
+ "ul",
+ __spreadProps(__spreadValues({}, t2.get(Se.key)(e2)), {
+ "data-spread": e2.attrs.spread
+ }),
+ 0
+ ],
+ parseMarkdown: {
+ match: ({ type: e2, ordered: r3 }) => e2 === "list" && !r3,
+ runner: (e2, r3, a2) => {
+ const o2 = r3.spread != null ? `${r3.spread}` : "false";
+ e2.openNode(a2, { spread: o2 }).next(r3.children).closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "bullet_list",
+ runner: (e2, r3) => {
+ e2.openNode("list", void 0, { ordered: false, spread: r3.attrs.spread === "true" }).next(r3.content).closeNode();
+ }
+ }
+ }));
+ n3(O3.node, {
+ displayName: "NodeSchema<bulletList>",
+ group: "BulletList"
+ });
+ n3(O3.ctx, {
+ displayName: "NodeSchemaCtx<bulletList>",
+ group: "BulletList"
+ });
+ var ft = oe2((t2) => wrappingInputRule(/^\s*([-+*])\s$/, O3.type(t2)));
+ n3(ft, {
+ displayName: "InputRule<wrapInBulletListInputRule>",
+ group: "BulletList"
+ });
+ var Ae2 = re2("WrapInBulletList", (t2) => () => wrapIn(O3.type(t2)));
+ n3(Ae2, {
+ displayName: "Command<wrapInBulletListCommand>",
+ group: "BulletList"
+ });
+ var we3 = ge2("bulletListKeymap", {
+ WrapInBulletList: {
+ shortcuts: "Mod-Alt-8",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(Ae2.key);
+ }
+ }
+ });
+ n3(we3.ctx, {
+ displayName: "KeymapCtx<bulletListKeymap>",
+ group: "BulletList"
+ });
+ n3(we3.shortcuts, {
+ displayName: "Keymap<bulletListKeymap>",
+ group: "BulletList"
+ });
+ var He = he("orderedList");
+ n3(He, {
+ displayName: "Attr<orderedList>",
+ group: "OrderedList"
+ });
+ var T4 = fe2("ordered_list", (t2) => ({
+ content: "listItem+",
+ group: "block",
+ attrs: {
+ order: {
+ default: 1
+ },
+ spread: {
+ default: false
+ }
+ },
+ parseDOM: [
+ {
+ tag: "ol",
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return {
+ spread: e2.dataset.spread,
+ order: e2.hasAttribute("start") ? Number(e2.getAttribute("start")) : 1
+ };
+ }
+ }
+ ],
+ toDOM: (e2) => [
+ "ol",
+ __spreadProps(__spreadValues(__spreadValues({}, t2.get(He.key)(e2)), e2.attrs.order === 1 ? {} : e2.attrs.order), {
+ "data-spread": e2.attrs.spread
+ }),
+ 0
+ ],
+ parseMarkdown: {
+ match: ({ type: e2, ordered: r3 }) => e2 === "list" && !!r3,
+ runner: (e2, r3, a2) => {
+ const o2 = r3.spread != null ? `${r3.spread}` : "true";
+ e2.openNode(a2, { spread: o2 }).next(r3.children).closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "ordered_list",
+ runner: (e2, r3) => {
+ e2.openNode("list", void 0, { ordered: true, start: 1, spread: r3.attrs.spread === "true" }), e2.next(r3.content), e2.closeNode();
+ }
+ }
+ }));
+ n3(T4.node, {
+ displayName: "NodeSchema<orderedList>",
+ group: "OrderedList"
+ });
+ n3(T4.ctx, {
+ displayName: "NodeSchemaCtx<orderedList>",
+ group: "OrderedList"
+ });
+ var Nt = oe2((t2) => wrappingInputRule(
+ /^\s*(\d+)\.\s$/,
+ T4.type(t2),
+ (e2) => ({ order: Number(e2[1]) }),
+ (e2, r3) => r3.childCount + r3.attrs.order === Number(e2[1])
+ ));
+ n3(Nt, {
+ displayName: "InputRule<wrapInOrderedListInputRule>",
+ group: "OrderedList"
+ });
+ var Be = re2("WrapInOrderedList", (t2) => () => wrapIn(T4.type(t2)));
+ n3(Be, {
+ displayName: "Command<wrapInOrderedListCommand>",
+ group: "OrderedList"
+ });
+ var Re = ge2("orderedListKeymap", {
+ WrapInOrderedList: {
+ shortcuts: "Mod-Alt-7",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(Be.key);
+ }
+ }
+ });
+ n3(Re.ctx, {
+ displayName: "KeymapCtx<orderedList>",
+ group: "OrderedList"
+ });
+ n3(Re.shortcuts, {
+ displayName: "Keymap<orderedList>",
+ group: "OrderedList"
+ });
+ var ve2 = he("listItem");
+ n3(ve2, {
+ displayName: "Attr<listItem>",
+ group: "ListItem"
+ });
+ var M5 = fe2("list_item", (t2) => ({
+ group: "listItem",
+ content: "block+",
+ attrs: {
+ label: {
+ default: "\u2022"
+ },
+ listType: {
+ default: "bullet"
+ },
+ spread: {
+ default: "true"
+ }
+ },
+ defining: true,
+ parseDOM: [
+ {
+ tag: "li",
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return {
+ label: e2.dataset.label,
+ listType: e2.dataset["list-type"],
+ spread: e2.dataset.spread
+ };
+ }
+ }
+ ],
+ toDOM: (e2) => [
+ "li",
+ __spreadProps(__spreadValues({}, t2.get(ve2.key)(e2)), {
+ "data-label": e2.attrs.label,
+ "data-list-type": e2.attrs.listType,
+ "data-spread": e2.attrs.spread
+ }),
+ 0
+ ],
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "listItem",
+ runner: (e2, r3, a2) => {
+ const o2 = r3.label != null ? `${r3.label}.` : "\u2022", s2 = r3.label != null ? "ordered" : "bullet", l5 = r3.spread != null ? `${r3.spread}` : "true";
+ e2.openNode(a2, { label: o2, listType: s2, spread: l5 }), e2.next(r3.children), e2.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "list_item",
+ runner: (e2, r3) => {
+ e2.openNode("listItem", void 0, { spread: r3.attrs.spread === "true" }), e2.next(r3.content), e2.closeNode();
+ }
+ }
+ }));
+ n3(M5.node, {
+ displayName: "NodeSchema<listItem>",
+ group: "ListItem"
+ });
+ n3(M5.ctx, {
+ displayName: "NodeSchemaCtx<listItem>",
+ group: "ListItem"
+ });
+ var Oe2 = re2("SinkListItem", (t2) => () => sinkListItem(M5.type(t2)));
+ n3(Oe2, {
+ displayName: "Command<sinkListItemCommand>",
+ group: "ListItem"
+ });
+ var Te2 = re2("LiftListItem", (t2) => () => liftListItem(M5.type(t2)));
+ n3(Te2, {
+ displayName: "Command<liftListItemCommand>",
+ group: "ListItem"
+ });
+ var Ke2 = re2("SplitListItem", (t2) => () => splitListItem(M5.type(t2)));
+ n3(Ke2, {
+ displayName: "Command<splitListItemCommand>",
+ group: "ListItem"
+ });
+ function $t(t2) {
+ return (e2, r3, a2) => {
+ const { selection: o2 } = e2;
+ if (!(o2 instanceof TextSelection))
+ return false;
+ const { empty: s2, $from: l5 } = o2;
+ if (!s2 || l5.parentOffset !== 0)
+ return false;
+ const i2 = l5.node(-1);
+ return i2.type !== M5.type(t2) || i2.firstChild !== l5.node() || l5.node(-2).childCount > 1 ? false : liftListItem(M5.type(t2))(e2, r3, a2);
+ };
+ }
+ var De2 = re2("LiftFirstListItem", (t2) => () => $t(t2));
+ n3(De2, {
+ displayName: "Command<liftFirstListItemCommand>",
+ group: "ListItem"
+ });
+ var _e2 = ge2("listItemKeymap", {
+ NextListItem: {
+ shortcuts: "Enter",
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(Ke2.key);
+ }
+ },
+ SinkListItem: {
+ shortcuts: ["Tab", "Mod-]"],
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(Oe2.key);
+ }
+ },
+ LiftListItem: {
+ shortcuts: ["Shift-Tab", "Mod-["],
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(Te2.key);
+ }
+ },
+ LiftFirstListItem: {
+ shortcuts: ["Backspace", "Delete"],
+ command: (t2) => {
+ const e2 = t2.get(je);
+ return () => e2.call(De2.key);
+ }
+ }
+ });
+ n3(_e2.ctx, {
+ displayName: "KeymapCtx<listItem>",
+ group: "ListItem"
+ });
+ n3(_e2.shortcuts, {
+ displayName: "Keymap<listItem>",
+ group: "ListItem"
+ });
+ var It = W3("text", () => ({
+ group: "inline",
+ parseMarkdown: {
+ match: ({ type: t2 }) => t2 === "text",
+ runner: (t2, e2) => {
+ t2.addText(e2.value);
+ }
+ },
+ toMarkdown: {
+ match: (t2) => t2.type.name === "text",
+ runner: (t2, e2) => {
+ t2.addNode("text", void 0, e2.text);
+ }
+ }
+ }));
+ n3(It, {
+ displayName: "NodeSchema<text>",
+ group: "Text"
+ });
+ var Ee2 = he("html");
+ n3(Ee2, {
+ displayName: "Attr<html>",
+ group: "Html"
+ });
+ var Pe = fe2("html", (t2) => ({
+ atom: true,
+ group: "inline",
+ inline: true,
+ attrs: {
+ value: {
+ default: ""
+ }
+ },
+ toDOM: (e2) => {
+ const r3 = document.createElement("span"), a2 = __spreadProps(__spreadValues({}, t2.get(Ee2.key)(e2)), {
+ "data-value": e2.attrs.value,
+ "data-type": "html"
+ });
+ return r3.textContent = e2.attrs.value, ["span", a2, e2.attrs.value];
+ },
+ parseDOM: [{
+ tag: 'span[data-type="html"]',
+ getAttrs: (e2) => {
+ var _a;
+ return {
+ value: (_a = e2.dataset.value) != null ? _a : ""
+ };
+ }
+ }],
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "html",
+ runner: (e2, r3, a2) => {
+ e2.addNode(a2, { value: r3.value });
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "html",
+ runner: (e2, r3) => {
+ e2.addNode("html", void 0, r3.attrs.value);
+ }
+ }
+ }));
+ n3(Pe.node, {
+ displayName: "NodeSchema<html>",
+ group: "Html"
+ });
+ n3(Pe.ctx, {
+ displayName: "NodeSchemaCtx<html>",
+ group: "Html"
+ });
+ var qt = [
+ mt2,
+ de,
+ w5,
+ j4,
+ ce2,
+ H4,
+ Me2,
+ S6,
+ ye3,
+ q5,
+ fe3,
+ W4,
+ xe,
+ F3,
+ Ce3,
+ v2,
+ Se,
+ O3,
+ He,
+ T4,
+ ve2,
+ M5,
+ Z3,
+ R4,
+ re3,
+ $2,
+ oe3,
+ x5,
+ ie5,
+ B2,
+ Ee2,
+ Pe,
+ It
+ ].flat();
+ var Wt = [
+ ct2,
+ ft,
+ Nt,
+ ut2,
+ kt,
+ pt
+ ].flat();
+ var Ft = [
+ nt,
+ ot2,
+ lt2,
+ st
+ ];
+ var Vt = [
+ me2,
+ ke3,
+ L4,
+ ue3,
+ Ne2,
+ be,
+ ht2,
+ gt,
+ yt,
+ Be,
+ Ae2,
+ Oe2,
+ Ke2,
+ Te2,
+ De2,
+ ee2,
+ se2,
+ ae2,
+ it,
+ dt2
+ ];
+ var Ut = [
+ he2,
+ Ie2,
+ Le,
+ ge3,
+ _e2,
+ Re,
+ we3,
+ pe2,
+ te2,
+ le2,
+ ne2
+ ].flat();
+ var $e = ke2("remarkAddOrderInList", () => () => (t2) => {
+ visit(t2, "list", (e2) => {
+ var _a;
+ if (e2.ordered) {
+ const r3 = (_a = e2.start) != null ? _a : 1;
+ e2.children.forEach((a2, o2) => {
+ a2.label = o2 + r3;
+ });
+ }
+ });
+ });
+ n3($e.plugin, {
+ displayName: "Remark<remarkAddOrderInListPlugin>",
+ group: "Remark"
+ });
+ n3($e.options, {
+ displayName: "RemarkConfig<remarkAddOrderInListPlugin>",
+ group: "Remark"
+ });
+ var qe = ke2("remarkLineBreak", () => () => (t2) => {
+ const e2 = /[\t ]*(?:\r?\n|\r)/g;
+ visit(t2, "text", (r3, a2, o2) => {
+ if (!r3.value || typeof r3.value != "string")
+ return;
+ const s2 = [];
+ let l5 = 0;
+ e2.lastIndex = 0;
+ let i2 = e2.exec(r3.value);
+ for (; i2; ) {
+ const m3 = i2.index;
+ l5 !== m3 && s2.push({ type: "text", value: r3.value.slice(l5, m3) }), s2.push({ type: "break", data: { isInline: true } }), l5 = m3 + i2[0].length, i2 = e2.exec(r3.value);
+ }
+ if (s2.length > 0 && o2 && typeof a2 == "number")
+ return l5 < r3.value.length && s2.push({ type: "text", value: r3.value.slice(l5) }), o2.children.splice(a2, 1, ...s2), a2 + s2.length;
+ });
+ });
+ n3(qe.plugin, {
+ displayName: "Remark<remarkLineBreak>",
+ group: "Remark"
+ });
+ n3(qe.options, {
+ displayName: "RemarkConfig<remarkLineBreak>",
+ group: "Remark"
+ });
+ var We = ke2("remarkInlineLink", () => remarkInlineLinks);
+ n3(We.plugin, {
+ displayName: "Remark<remarkInlineLinkPlugin>",
+ group: "Remark"
+ });
+ n3(We.options, {
+ displayName: "RemarkConfig<remarkInlineLinkPlugin>",
+ group: "Remark"
+ });
+ var Gt = (t2) => !!t2.children;
+ var jt = (t2) => t2.type === "html";
+ function zt(t2, e2) {
+ return r3(t2, 0, null)[0];
+ function r3(a2, o2, s2) {
+ if (Gt(a2)) {
+ const l5 = [];
+ for (let i2 = 0, d6 = a2.children.length; i2 < d6; i2++) {
+ const m3 = a2.children[i2];
+ if (m3) {
+ const p4 = r3(m3, i2, a2);
+ if (p4)
+ for (let k4 = 0, g5 = p4.length; k4 < g5; k4++) {
+ const C5 = p4[k4];
+ C5 && l5.push(C5);
+ }
+ }
+ }
+ a2.children = l5;
+ }
+ return e2(a2, o2, s2);
+ }
+ }
+ var Fe = ke2("remarkHTMLTransformer", () => () => (t2) => {
+ zt(t2, (e2, r3, a2) => jt(e2) ? ((a2 == null ? void 0 : a2.type) === "root" && (e2.children = [__spreadValues({}, e2)], delete e2.value, e2.type = "paragraph"), [e2]) : [e2]);
+ });
+ n3(Fe.plugin, {
+ displayName: "Remark<remarkHtmlTransformer>",
+ group: "Remark"
+ });
+ n3(Fe.options, {
+ displayName: "RemarkConfig<remarkHtmlTransformer>",
+ group: "Remark"
+ });
+ var Ve2 = ke2("remarkMarker", () => () => (t2, e2) => {
+ const r3 = (a2) => e2.value.charAt(a2.position.start.offset);
+ visit(t2, (a2) => ["strong", "emphasis"].includes(a2.type), (a2) => {
+ a2.marker = r3(a2);
+ });
+ });
+ n3(Ve2.plugin, {
+ displayName: "Remark<remarkMarker>",
+ group: "Remark"
+ });
+ n3(Ve2.options, {
+ displayName: "RemarkConfig<remarkMarker>",
+ group: "Remark"
+ });
+ var Ct = ue2(() => {
+ let t2 = false;
+ const e2 = new PluginKey("MILKDOWN_INLINE_NODES_CURSOR"), r3 = new Plugin({
+ key: e2,
+ state: {
+ init() {
+ return false;
+ },
+ apply(a2) {
+ if (!a2.selection.empty)
+ return false;
+ const o2 = a2.selection.$from, s2 = o2.nodeBefore, l5 = o2.nodeAfter;
+ return !!(s2 && l5 && s2.isInline && !s2.isText && l5.isInline && !l5.isText);
+ }
+ },
+ props: {
+ handleDOMEvents: {
+ compositionend: (a2, o2) => t2 ? (t2 = false, requestAnimationFrame(() => {
+ if (r3.getState(a2.state)) {
+ const l5 = a2.state.selection.from;
+ o2.preventDefault(), a2.dispatch(a2.state.tr.insertText(o2.data || "", l5));
+ }
+ }), true) : false,
+ compositionstart: (a2) => (r3.getState(a2.state) && (t2 = true), false),
+ beforeinput: (a2, o2) => {
+ if (r3.getState(a2.state) && o2 instanceof InputEvent && o2.data && !t2) {
+ const l5 = a2.state.selection.from;
+ return o2.preventDefault(), a2.dispatch(a2.state.tr.insertText(o2.data || "", l5)), true;
+ }
+ return false;
+ }
+ },
+ decorations(a2) {
+ if (r3.getState(a2)) {
+ const l5 = a2.selection.$from.pos, i2 = document.createElement("span"), d6 = Decoration.widget(l5, i2, {
+ side: -1
+ }), m3 = document.createElement("span"), p4 = Decoration.widget(l5, m3);
+ return setTimeout(() => {
+ i2.contentEditable = "true", m3.contentEditable = "true";
+ }), DecorationSet.create(a2.doc, [d6, p4]);
+ }
+ return DecorationSet.empty;
+ }
+ }
+ });
+ return r3;
+ });
+ n3(Ct, {
+ displayName: "Prose<inlineNodesCursorPlugin>",
+ group: "Prose"
+ });
+ var Mt = ue2((t2) => new Plugin({
+ key: new PluginKey("MILKDOWN_HARDBREAK_MARKS"),
+ appendTransaction: (e2, r3, a2) => {
+ if (!e2.length)
+ return;
+ const [o2] = e2;
+ if (!o2)
+ return;
+ const [s2] = o2.steps;
+ if (o2.getMeta("hardbreak")) {
+ if (!(s2 instanceof ReplaceStep))
+ return;
+ const { from: d6 } = s2;
+ return a2.tr.setNodeMarkup(d6, S6.type(t2), void 0, []);
+ }
+ if (s2 instanceof AddMarkStep) {
+ let d6 = a2.tr;
+ const { from: m3, to: p4 } = s2;
+ return a2.doc.nodesBetween(m3, p4, (k4, g5) => {
+ k4.type === S6.type(t2) && (d6 = d6.setNodeMarkup(g5, S6.type(t2), void 0, []));
+ }), d6;
+ }
+ }
+ }));
+ n3(Mt, {
+ displayName: "Prose<hardbreakClearMarkPlugin>",
+ group: "Prose"
+ });
+ var Ue = h3(["table", "code_block"], "hardbreakFilterNodes");
+ n3(Ue, {
+ displayName: "Ctx<hardbreakFilterNodes>",
+ group: "Prose"
+ });
+ var bt = ue2((t2) => {
+ const e2 = t2.get(Ue.key);
+ return new Plugin({
+ key: new PluginKey("MILKDOWN_HARDBREAK_FILTER"),
+ filterTransaction: (r3, a2) => {
+ const o2 = r3.getMeta("hardbreak"), [s2] = r3.steps;
+ if (o2 && s2) {
+ const { from: l5 } = s2, i2 = a2.doc.resolve(l5);
+ let d6 = i2.depth, m3 = true;
+ for (; d6 > 0; )
+ e2.includes(i2.node(d6).type.name) && (m3 = false), d6--;
+ return m3;
+ }
+ return true;
+ }
+ });
+ });
+ n3(bt, {
+ displayName: "Prose<hardbreakFilterPlugin>",
+ group: "Prose"
+ });
+ var Lt = ue2((t2) => {
+ const e2 = new PluginKey("MILKDOWN_HEADING_ID"), r3 = (a2) => {
+ if (a2.composing)
+ return;
+ const o2 = t2.get(j4.key), s2 = a2.state.tr.setMeta("addToHistory", false);
+ let l5 = false;
+ a2.state.doc.descendants((i2, d6) => {
+ if (i2.type === H4.type(t2)) {
+ if (i2.textContent.trim().length === 0)
+ return;
+ const m3 = i2.attrs, p4 = o2(i2);
+ m3.id !== p4 && (l5 = true, s2.setMeta(e2, true).setNodeMarkup(d6, void 0, __spreadProps(__spreadValues({}, m3), {
+ id: p4
+ })));
+ }
+ }), l5 && a2.dispatch(s2);
+ };
+ return new Plugin({
+ key: e2,
+ view: (a2) => (r3(a2), {
+ update: (o2) => {
+ r3(o2);
+ }
+ })
+ });
+ });
+ n3(Lt, {
+ displayName: "Prose<syncHeadingIdPlugin>",
+ group: "Prose"
+ });
+ var xt = ue2((t2) => {
+ const e2 = (r3) => {
+ if (r3.composing || !r3.editable)
+ return;
+ const a2 = T4.type(t2), o2 = O3.type(t2), s2 = M5.type(t2), l5 = r3.state, i2 = (p4, k4) => {
+ let g5 = false;
+ const C5 = `${k4 + 1}.`;
+ return p4.label !== C5 && (p4.label = C5, g5 = true), g5;
+ };
+ let d6 = l5.tr, m3 = false;
+ l5.doc.descendants((p4, k4, g5, C5) => {
+ if (p4.type === o2) {
+ const y4 = p4.maybeChild(0);
+ (y4 == null ? void 0 : y4.type) === s2 && y4.attrs.listType === "ordered" && (m3 = true, d6.setNodeMarkup(k4, a2, { spread: "true" }), p4.descendants((b4, Ge, Qt, St) => {
+ if (b4.type === s2) {
+ const je2 = __spreadValues({}, b4.attrs);
+ i2(je2, St) && (d6 = d6.setNodeMarkup(Ge, void 0, je2));
+ }
+ return false;
+ }));
+ } else if (p4.type === s2 && (g5 == null ? void 0 : g5.type) === a2) {
+ const y4 = __spreadValues({}, p4.attrs);
+ let b4 = false;
+ y4.listType !== "ordered" && (y4.listType = "ordered", b4 = true), (g5 == null ? void 0 : g5.maybeChild(0)) && (b4 = i2(y4, C5)), b4 && (d6 = d6.setNodeMarkup(k4, void 0, y4), m3 = true);
+ }
+ }), m3 && r3.dispatch(d6.setMeta("addToHistory", false));
+ };
+ return new Plugin({
+ key: new PluginKey("MILKDOWN_KEEP_LIST_ORDER"),
+ view: (r3) => (e2(r3), {
+ update: (a2) => {
+ e2(a2);
+ }
+ })
+ });
+ });
+ n3(xt, {
+ displayName: "Prose<syncListOrderPlugin>",
+ group: "Prose"
+ });
+ var Jt = [
+ Mt,
+ Ue,
+ bt,
+ Ct,
+ $e,
+ We,
+ qe,
+ Fe,
+ Ve2,
+ Lt,
+ xt
+ ].flat();
+ var cr = [qt, Wt, Ft, Vt, Ut, Jt].flat();
+
+ // node_modules/clsx/dist/clsx.mjs
+ function r2(e2) {
+ var t2, f3, n4 = "";
+ if ("string" == typeof e2 || "number" == typeof e2) n4 += e2;
+ else if ("object" == typeof e2) if (Array.isArray(e2)) {
+ var o2 = e2.length;
+ for (t2 = 0; t2 < o2; t2++) e2[t2] && (f3 = r2(e2[t2])) && (n4 && (n4 += " "), n4 += f3);
+ } else for (f3 in e2) e2[f3] && (n4 && (n4 += " "), n4 += f3);
+ return n4;
+ }
+ function clsx() {
+ for (var e2, t2, f3 = 0, n4 = "", o2 = arguments.length; f3 < o2; f3++) (e2 = arguments[f3]) && (t2 = r2(e2)) && (n4 && (n4 += " "), n4 += t2);
+ return n4;
+ }
+ var clsx_default = clsx;
+
+ // node_modules/@milkdown/components/lib/list-item-block/index.es.js
+ var __defProp2 = Object.defineProperty;
+ var __getOwnPropSymbols2 = Object.getOwnPropertySymbols;
+ var __hasOwnProp2 = Object.prototype.hasOwnProperty;
+ var __propIsEnum2 = Object.prototype.propertyIsEnumerable;
+ var __defNormalProp2 = (obj, key, value) => key in obj ? __defProp2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+ var __spreadValues2 = (a2, b4) => {
+ for (var prop in b4 || (b4 = {}))
+ if (__hasOwnProp2.call(b4, prop))
+ __defNormalProp2(a2, prop, b4[prop]);
+ if (__getOwnPropSymbols2)
+ for (var prop of __getOwnPropSymbols2(b4)) {
+ if (__propIsEnum2.call(b4, prop))
+ __defNormalProp2(a2, prop, b4[prop]);
+ }
+ return a2;
+ };
+ function withMeta(plugin, meta) {
+ Object.assign(plugin, {
+ meta: __spreadValues2({
+ package: "@milkdown/components"
+ }, meta)
+ });
+ return plugin;
+ }
+ var scaleSelector = (selector) => selector.replace(/([^\w\_\-])/g, "\\$1");
+ var serializeRules = ({ cssText, selectorText }, scopeSelector) => `${selectorText.split(/\s*,\s*/).map((selector) => (selector.startsWith(":") ? selector : ":host " + selector).replace(/(:host)\((.+)\)/, "$1$2").replace(/::slotted\((.+)\)/, ":host > $1").replace(/:host/g, scopeSelector))}${cssText.replace(selectorText, "").replace(/(animation(?:-name){0,1}\s*:\s*)([^;}]+)/g, "$1$2-" + scaleSelector(scopeSelector))}`;
+ function getRules(Sheet, scopeSelector) {
+ const { cssRules } = Sheet;
+ let rules = [];
+ for (let i2 = 0; i2 < cssRules.length; i2++) {
+ const rule = cssRules[i2];
+ if (rule instanceof CSSStyleRule) {
+ rules.push(serializeRules(rule, scopeSelector));
+ } else if (rule instanceof CSSKeyframesRule) {
+ const { cssText } = rule;
+ rules.push(cssText.replace(/\s+([^\s{]+)/, " $1-" + scaleSelector(scopeSelector)));
+ } else if (rule instanceof CSSMediaRule) {
+ const { conditionText } = rule;
+ rules.push(`@media ${conditionText}{${getRules(rule, scopeSelector)}}`);
+ }
+ }
+ return rules;
+ }
+ var sandbox;
+ function getSheet(style2) {
+ if (style2 instanceof CSSStyleSheet) {
+ return style2;
+ }
+ if (style2.sheet) {
+ return style2.sheet;
+ }
+ if (!sandbox) {
+ sandbox = document.createElement("iframe");
+ sandbox.style.display = "none";
+ document.body.appendChild(sandbox);
+ }
+ const { contentDocument } = sandbox;
+ contentDocument.head.appendChild(style2);
+ const { sheet } = style2;
+ const { cloneNode } = style2;
+ style2.cloneNode = (deep) => {
+ const copy2 = cloneNode.call(style2);
+ const { cssRules } = sheet;
+ for (let i2 = 0; i2 < cssRules.length; i2++) {
+ copy2.textContent += cssRules[i2].cssText;
+ }
+ return copy2;
+ };
+ return sheet;
+ }
+ var ATTR = "data-sheet";
+ var ID5 = 0;
+ function useCssLightDom(sheet) {
+ const host = useHost();
+ useLayoutEffect(() => {
+ const style2 = document.createElement("style");
+ const { current } = host;
+ if (!current.hasAttribute(ATTR)) {
+ current.setAttribute(ATTR, `${ID5++}`);
+ }
+ current.appendChild(style2);
+ if (style2.sheet) {
+ (Array.isArray(sheet) ? sheet.flat(100) : [sheet]).forEach((target) => {
+ if (!target)
+ return;
+ const sheet2 = getSheet(target);
+ getRules(sheet2, current.localName + `[data-sheet="${current.dataset.sheet}"]`).forEach((rule) => style2.sheet.insertRule(rule, style2.sheet.cssRules.length));
+ });
+ }
+ return () => style2.remove();
+ }, [sheet]);
+ }
+ var style = css`
+ :host > .list-item {
+ display: flex;
+ align-items: start;
+ }
+
+ :host > .list-item > .children {
+ min-width: 0;
+ flex: 1;
+ }
+`;
+ var listItemComponent = ({
+ selected,
+ label,
+ listType,
+ checked,
+ onMount,
+ setAttr,
+ config
+ }) => {
+ const host = useHost();
+ const contentWrapperRef = useRef();
+ useCssLightDom(style);
+ useLayoutEffect(() => {
+ const current = contentWrapperRef.current;
+ if (!current)
+ return;
+ const contentDOM = host.current.querySelector("[data-content-dom]");
+ if (contentDOM) {
+ current.appendChild(contentDOM);
+ onMount == null ? void 0 : onMount();
+ }
+ }, []);
+ const onClickLabel = () => {
+ if (checked == null)
+ return;
+ setAttr == null ? void 0 : setAttr("checked", !checked);
+ };
+ return html2`<host>
+ <li class=${clsx_default("list-item", selected && "ProseMirror-selectednode")}>
+ <div class="label-wrapper" onclick=${onClickLabel} contenteditable="false">${config == null ? void 0 : config.renderLabel(label != null ? label : "", listType != null ? listType : "", checked)}</div>
+ <div class="children" ref=${contentWrapperRef}></div>
+ </li>
+ </host>`;
+ };
+ listItemComponent.props = {
+ label: String,
+ checked: Boolean,
+ listType: String,
+ config: Object,
+ selected: Boolean,
+ setAttr: Function,
+ onMount: Function
+ };
+ var ListItemElement = c4(listItemComponent);
+ var defaultListItemBlockConfig = {
+ renderLabel: (label, listType, checked) => {
+ if (checked == null)
+ return html2`<span class='label'>${listType === "bullet" ? "\u29BF" : label}</span>`;
+ return html2`<input class='label' type="checkbox" checked=${checked} />`;
+ }
+ };
+ var listItemBlockConfig = h3(defaultListItemBlockConfig, "listItemBlockConfigCtx");
+ withMeta(listItemBlockConfig, {
+ displayName: "Config<list-item-block>",
+ group: "ListItemBlock"
+ });
+ customElements.define("milkdown-list-item-block", ListItemElement);
+ var listItemBlockView = le(M5.node, (ctx) => {
+ return (initialNode, view, getPos) => {
+ const dom = document.createElement("milkdown-list-item-block");
+ const contentDOM = document.createElement("div");
+ contentDOM.setAttribute("data-content-dom", "true");
+ contentDOM.classList.add("content-dom");
+ const config = ctx.get(listItemBlockConfig.key);
+ const bindAttrs = (node22) => {
+ dom.listType = node22.attrs.listType;
+ dom.label = node22.attrs.label;
+ dom.checked = node22.attrs.checked;
+ };
+ bindAttrs(initialNode);
+ dom.appendChild(contentDOM);
+ dom.selected = false;
+ dom.setAttr = (attr, value) => {
+ const pos = getPos();
+ if (pos == null)
+ return;
+ view.dispatch(view.state.tr.setNodeAttribute(pos, attr, value));
+ };
+ dom.onMount = () => {
+ var _a;
+ const pos = (_a = getPos()) != null ? _a : 0;
+ const end = pos + initialNode.nodeSize;
+ const { from, to } = view.state.selection;
+ if (view.hasFocus() && pos < from && to < end) {
+ Promise.resolve().then(() => {
+ const p4 = view.state.doc.resolve(pos);
+ view.dispatch(view.state.tr.setSelection(TextSelection.near(p4, 1)));
+ });
+ }
+ };
+ let node2 = initialNode;
+ dom.config = config;
+ return {
+ dom,
+ contentDOM,
+ update: (updatedNode) => {
+ if (updatedNode.type !== initialNode.type)
+ return false;
+ if (updatedNode.sameMarkup(node2) && updatedNode.content.eq(node2.content))
+ return false;
+ node2 = updatedNode;
+ bindAttrs(updatedNode);
+ return true;
+ },
+ ignoreMutation: (mutation) => {
+ if (!dom || !contentDOM)
+ return true;
+ if (mutation.type === "selection")
+ return false;
+ if (contentDOM === mutation.target && mutation.type === "attributes")
+ return true;
+ if (contentDOM.contains(mutation.target))
+ return false;
+ return true;
+ },
+ selectNode: () => {
+ dom.selected = true;
+ },
+ deselectNode: () => {
+ dom.selected = false;
+ },
+ destroy: () => {
+ dom.remove();
+ contentDOM.remove();
+ }
+ };
+ };
+ });
+ withMeta(listItemBlockView, {
+ displayName: "NodeView<list-item-block>",
+ group: "ListItemBlock"
+ });
+ var listItemBlockComponent = [
+ listItemBlockConfig,
+ listItemBlockView
+ ];
+
+ // node_modules/prosemirror-tables/dist/index.js
+ var readFromCache;
+ var addToCache;
+ if (typeof WeakMap != "undefined") {
+ let cache = /* @__PURE__ */ new WeakMap();
+ readFromCache = (key) => cache.get(key);
+ addToCache = (key, value) => {
+ cache.set(key, value);
+ return value;
+ };
+ } else {
+ const cache = [];
+ const cacheSize = 10;
+ let cachePos = 0;
+ readFromCache = (key) => {
+ for (let i2 = 0; i2 < cache.length; i2 += 2)
+ if (cache[i2] == key)
+ return cache[i2 + 1];
+ };
+ addToCache = (key, value) => {
+ if (cachePos == cacheSize)
+ cachePos = 0;
+ cache[cachePos++] = key;
+ return cache[cachePos++] = value;
+ };
+ }
+ var TableMap = class {
+ constructor(width, height, map5, problems) {
+ this.width = width;
+ this.height = height;
+ this.map = map5;
+ this.problems = problems;
+ }
+ // Find the dimensions of the cell at the given position.
+ findCell(pos) {
+ for (let i2 = 0; i2 < this.map.length; i2++) {
+ const curPos = this.map[i2];
+ if (curPos != pos)
+ continue;
+ const left = i2 % this.width;
+ const top = i2 / this.width | 0;
+ let right = left + 1;
+ let bottom = top + 1;
+ for (let j6 = 1; right < this.width && this.map[i2 + j6] == curPos; j6++) {
+ right++;
+ }
+ for (let j6 = 1; bottom < this.height && this.map[i2 + this.width * j6] == curPos; j6++) {
+ bottom++;
+ }
+ return { left, top, right, bottom };
+ }
+ throw new RangeError(`No cell with offset ${pos} found`);
+ }
+ // Find the left side of the cell at the given position.
+ colCount(pos) {
+ for (let i2 = 0; i2 < this.map.length; i2++) {
+ if (this.map[i2] == pos) {
+ return i2 % this.width;
+ }
+ }
+ throw new RangeError(`No cell with offset ${pos} found`);
+ }
+ // Find the next cell in the given direction, starting from the cell
+ // at `pos`, if any.
+ nextCell(pos, axis, dir) {
+ const { left, right, top, bottom } = this.findCell(pos);
+ if (axis == "horiz") {
+ if (dir < 0 ? left == 0 : right == this.width)
+ return null;
+ return this.map[top * this.width + (dir < 0 ? left - 1 : right)];
+ } else {
+ if (dir < 0 ? top == 0 : bottom == this.height)
+ return null;
+ return this.map[left + this.width * (dir < 0 ? top - 1 : bottom)];
+ }
+ }
+ // Get the rectangle spanning the two given cells.
+ rectBetween(a2, b4) {
+ const {
+ left: leftA,
+ right: rightA,
+ top: topA,
+ bottom: bottomA
+ } = this.findCell(a2);
+ const {
+ left: leftB,
+ right: rightB,
+ top: topB,
+ bottom: bottomB
+ } = this.findCell(b4);
+ return {
+ left: Math.min(leftA, leftB),
+ top: Math.min(topA, topB),
+ right: Math.max(rightA, rightB),
+ bottom: Math.max(bottomA, bottomB)
+ };
+ }
+ // Return the position of all cells that have the top left corner in
+ // the given rectangle.
+ cellsInRect(rect) {
+ const result = [];
+ const seen = {};
+ for (let row = rect.top; row < rect.bottom; row++) {
+ for (let col = rect.left; col < rect.right; col++) {
+ const index2 = row * this.width + col;
+ const pos = this.map[index2];
+ if (seen[pos])
+ continue;
+ seen[pos] = true;
+ if (col == rect.left && col && this.map[index2 - 1] == pos || row == rect.top && row && this.map[index2 - this.width] == pos) {
+ continue;
+ }
+ result.push(pos);
+ }
+ }
+ return result;
+ }
+ // Return the position at which the cell at the given row and column
+ // starts, or would start, if a cell started there.
+ positionAt(row, col, table) {
+ for (let i2 = 0, rowStart = 0; ; i2++) {
+ const rowEnd = rowStart + table.child(i2).nodeSize;
+ if (i2 == row) {
+ let index2 = col + row * this.width;
+ const rowEndIndex = (row + 1) * this.width;
+ while (index2 < rowEndIndex && this.map[index2] < rowStart)
+ index2++;
+ return index2 == rowEndIndex ? rowEnd - 1 : this.map[index2];
+ }
+ rowStart = rowEnd;
+ }
+ }
+ // Find the table map for the given table node.
+ static get(table) {
+ return readFromCache(table) || addToCache(table, computeMap(table));
+ }
+ };
+ function computeMap(table) {
+ if (table.type.spec.tableRole != "table")
+ throw new RangeError("Not a table node: " + table.type.name);
+ const width = findWidth(table), height = table.childCount;
+ const map5 = [];
+ let mapPos = 0;
+ let problems = null;
+ const colWidths = [];
+ for (let i2 = 0, e2 = width * height; i2 < e2; i2++)
+ map5[i2] = 0;
+ for (let row = 0, pos = 0; row < height; row++) {
+ const rowNode = table.child(row);
+ pos++;
+ for (let i2 = 0; ; i2++) {
+ while (mapPos < map5.length && map5[mapPos] != 0)
+ mapPos++;
+ if (i2 == rowNode.childCount)
+ break;
+ const cellNode = rowNode.child(i2);
+ const { colspan, rowspan, colwidth } = cellNode.attrs;
+ for (let h5 = 0; h5 < rowspan; h5++) {
+ if (h5 + row >= height) {
+ (problems || (problems = [])).push({
+ type: "overlong_rowspan",
+ pos,
+ n: rowspan - h5
+ });
+ break;
+ }
+ const start = mapPos + h5 * width;
+ for (let w7 = 0; w7 < colspan; w7++) {
+ if (map5[start + w7] == 0)
+ map5[start + w7] = pos;
+ else
+ (problems || (problems = [])).push({
+ type: "collision",
+ row,
+ pos,
+ n: colspan - w7
+ });
+ const colW = colwidth && colwidth[w7];
+ if (colW) {
+ const widthIndex = (start + w7) % width * 2, prev = colWidths[widthIndex];
+ if (prev == null || prev != colW && colWidths[widthIndex + 1] == 1) {
+ colWidths[widthIndex] = colW;
+ colWidths[widthIndex + 1] = 1;
+ } else if (prev == colW) {
+ colWidths[widthIndex + 1]++;
+ }
+ }
+ }
+ }
+ mapPos += colspan;
+ pos += cellNode.nodeSize;
+ }
+ const expectedPos = (row + 1) * width;
+ let missing = 0;
+ while (mapPos < expectedPos)
+ if (map5[mapPos++] == 0)
+ missing++;
+ if (missing)
+ (problems || (problems = [])).push({ type: "missing", row, n: missing });
+ pos++;
+ }
+ const tableMap = new TableMap(width, height, map5, problems);
+ let badWidths = false;
+ for (let i2 = 0; !badWidths && i2 < colWidths.length; i2 += 2)
+ if (colWidths[i2] != null && colWidths[i2 + 1] < height)
+ badWidths = true;
+ if (badWidths)
+ findBadColWidths(tableMap, colWidths, table);
+ return tableMap;
+ }
+ function findWidth(table) {
+ let width = -1;
+ let hasRowSpan = false;
+ for (let row = 0; row < table.childCount; row++) {
+ const rowNode = table.child(row);
+ let rowWidth = 0;
+ if (hasRowSpan)
+ for (let j6 = 0; j6 < row; j6++) {
+ const prevRow = table.child(j6);
+ for (let i2 = 0; i2 < prevRow.childCount; i2++) {
+ const cell = prevRow.child(i2);
+ if (j6 + cell.attrs.rowspan > row)
+ rowWidth += cell.attrs.colspan;
+ }
+ }
+ for (let i2 = 0; i2 < rowNode.childCount; i2++) {
+ const cell = rowNode.child(i2);
+ rowWidth += cell.attrs.colspan;
+ if (cell.attrs.rowspan > 1)
+ hasRowSpan = true;
+ }
+ if (width == -1)
+ width = rowWidth;
+ else if (width != rowWidth)
+ width = Math.max(width, rowWidth);
+ }
+ return width;
+ }
+ function findBadColWidths(map5, colWidths, table) {
+ if (!map5.problems)
+ map5.problems = [];
+ const seen = {};
+ for (let i2 = 0; i2 < map5.map.length; i2++) {
+ const pos = map5.map[i2];
+ if (seen[pos])
+ continue;
+ seen[pos] = true;
+ const node2 = table.nodeAt(pos);
+ if (!node2) {
+ throw new RangeError(`No cell with offset ${pos} found`);
+ }
+ let updated = null;
+ const attrs = node2.attrs;
+ for (let j6 = 0; j6 < attrs.colspan; j6++) {
+ const col = (i2 + j6) % map5.width;
+ const colWidth = colWidths[col * 2];
+ if (colWidth != null && (!attrs.colwidth || attrs.colwidth[j6] != colWidth))
+ (updated || (updated = freshColWidth(attrs)))[j6] = colWidth;
+ }
+ if (updated)
+ map5.problems.unshift({
+ type: "colwidth mismatch",
+ pos,
+ colwidth: updated
+ });
+ }
+ }
+ function freshColWidth(attrs) {
+ if (attrs.colwidth)
+ return attrs.colwidth.slice();
+ const result = [];
+ for (let i2 = 0; i2 < attrs.colspan; i2++)
+ result.push(0);
+ return result;
+ }
+ function getCellAttrs(dom, extraAttrs) {
+ if (typeof dom === "string") {
+ return {};
+ }
+ const widthAttr = dom.getAttribute("data-colwidth");
+ const widths = widthAttr && /^\d+(,\d+)*$/.test(widthAttr) ? widthAttr.split(",").map((s2) => Number(s2)) : null;
+ const colspan = Number(dom.getAttribute("colspan") || 1);
+ const result = {
+ colspan,
+ rowspan: Number(dom.getAttribute("rowspan") || 1),
+ colwidth: widths && widths.length == colspan ? widths : null
+ };
+ for (const prop in extraAttrs) {
+ const getter = extraAttrs[prop].getFromDOM;
+ const value = getter && getter(dom);
+ if (value != null) {
+ result[prop] = value;
+ }
+ }
+ return result;
+ }
+ function setCellAttrs(node2, extraAttrs) {
+ const attrs = {};
+ if (node2.attrs.colspan != 1)
+ attrs.colspan = node2.attrs.colspan;
+ if (node2.attrs.rowspan != 1)
+ attrs.rowspan = node2.attrs.rowspan;
+ if (node2.attrs.colwidth)
+ attrs["data-colwidth"] = node2.attrs.colwidth.join(",");
+ for (const prop in extraAttrs) {
+ const setter = extraAttrs[prop].setDOMAttr;
+ if (setter)
+ setter(node2.attrs[prop], attrs);
+ }
+ return attrs;
+ }
+ function tableNodes(options2) {
+ const extraAttrs = options2.cellAttributes || {};
+ const cellAttrs = {
+ colspan: { default: 1 },
+ rowspan: { default: 1 },
+ colwidth: { default: null }
+ };
+ for (const prop in extraAttrs)
+ cellAttrs[prop] = { default: extraAttrs[prop].default };
+ return {
+ table: {
+ content: "table_row+",
+ tableRole: "table",
+ isolating: true,
+ group: options2.tableGroup,
+ parseDOM: [{ tag: "table" }],
+ toDOM() {
+ return ["table", ["tbody", 0]];
+ }
+ },
+ table_row: {
+ content: "(table_cell | table_header)*",
+ tableRole: "row",
+ parseDOM: [{ tag: "tr" }],
+ toDOM() {
+ return ["tr", 0];
+ }
+ },
+ table_cell: {
+ content: options2.cellContent,
+ attrs: cellAttrs,
+ tableRole: "cell",
+ isolating: true,
+ parseDOM: [
+ { tag: "td", getAttrs: (dom) => getCellAttrs(dom, extraAttrs) }
+ ],
+ toDOM(node2) {
+ return ["td", setCellAttrs(node2, extraAttrs), 0];
+ }
+ },
+ table_header: {
+ content: options2.cellContent,
+ attrs: cellAttrs,
+ tableRole: "header_cell",
+ isolating: true,
+ parseDOM: [
+ { tag: "th", getAttrs: (dom) => getCellAttrs(dom, extraAttrs) }
+ ],
+ toDOM(node2) {
+ return ["th", setCellAttrs(node2, extraAttrs), 0];
+ }
+ }
+ };
+ }
+ function tableNodeTypes(schema) {
+ let result = schema.cached.tableNodeTypes;
+ if (!result) {
+ result = schema.cached.tableNodeTypes = {};
+ for (const name in schema.nodes) {
+ const type = schema.nodes[name], role = type.spec.tableRole;
+ if (role)
+ result[role] = type;
+ }
+ }
+ return result;
+ }
+ var tableEditingKey = new PluginKey("selectingCells");
+ function cellAround($pos) {
+ for (let d6 = $pos.depth - 1; d6 > 0; d6--)
+ if ($pos.node(d6).type.spec.tableRole == "row")
+ return $pos.node(0).resolve($pos.before(d6 + 1));
+ return null;
+ }
+ function isInTable(state) {
+ const $head = state.selection.$head;
+ for (let d6 = $head.depth; d6 > 0; d6--)
+ if ($head.node(d6).type.spec.tableRole == "row")
+ return true;
+ return false;
+ }
+ function selectionCell(state) {
+ const sel = state.selection;
+ if ("$anchorCell" in sel && sel.$anchorCell) {
+ return sel.$anchorCell.pos > sel.$headCell.pos ? sel.$anchorCell : sel.$headCell;
+ } else if ("node" in sel && sel.node && sel.node.type.spec.tableRole == "cell") {
+ return sel.$anchor;
+ }
+ const $cell = cellAround(sel.$head) || cellNear(sel.$head);
+ if ($cell) {
+ return $cell;
+ }
+ throw new RangeError(`No cell found around position ${sel.head}`);
+ }
+ function cellNear($pos) {
+ for (let after = $pos.nodeAfter, pos = $pos.pos; after; after = after.firstChild, pos++) {
+ const role = after.type.spec.tableRole;
+ if (role == "cell" || role == "header_cell")
+ return $pos.doc.resolve(pos);
+ }
+ for (let before = $pos.nodeBefore, pos = $pos.pos; before; before = before.lastChild, pos--) {
+ const role = before.type.spec.tableRole;
+ if (role == "cell" || role == "header_cell")
+ return $pos.doc.resolve(pos - before.nodeSize);
+ }
+ }
+ function pointsAtCell($pos) {
+ return $pos.parent.type.spec.tableRole == "row" && !!$pos.nodeAfter;
+ }
+ function moveCellForward($pos) {
+ return $pos.node(0).resolve($pos.pos + $pos.nodeAfter.nodeSize);
+ }
+ function inSameTable($cellA, $cellB) {
+ return $cellA.depth == $cellB.depth && $cellA.pos >= $cellB.start(-1) && $cellA.pos <= $cellB.end(-1);
+ }
+ function nextCell($pos, axis, dir) {
+ const table = $pos.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = $pos.start(-1);
+ const moved = map5.nextCell($pos.pos - tableStart, axis, dir);
+ return moved == null ? null : $pos.node(0).resolve(tableStart + moved);
+ }
+ function removeColSpan(attrs, pos, n4 = 1) {
+ const result = __spreadProps(__spreadValues({}, attrs), { colspan: attrs.colspan - n4 });
+ if (result.colwidth) {
+ result.colwidth = result.colwidth.slice();
+ result.colwidth.splice(pos, n4);
+ if (!result.colwidth.some((w7) => w7 > 0))
+ result.colwidth = null;
+ }
+ return result;
+ }
+ function addColSpan(attrs, pos, n4 = 1) {
+ const result = __spreadProps(__spreadValues({}, attrs), { colspan: attrs.colspan + n4 });
+ if (result.colwidth) {
+ result.colwidth = result.colwidth.slice();
+ for (let i2 = 0; i2 < n4; i2++)
+ result.colwidth.splice(pos, 0, 0);
+ }
+ return result;
+ }
+ function columnIsHeader(map5, table, col) {
+ const headerCell = tableNodeTypes(table.type.schema).header_cell;
+ for (let row = 0; row < map5.height; row++)
+ if (table.nodeAt(map5.map[col + row * map5.width]).type != headerCell)
+ return false;
+ return true;
+ }
+ var CellSelection = class _CellSelection extends Selection {
+ // A table selection is identified by its anchor and head cells. The
+ // positions given to this constructor should point _before_ two
+ // cells in the same table. They may be the same, to select a single
+ // cell.
+ constructor($anchorCell, $headCell = $anchorCell) {
+ const table = $anchorCell.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = $anchorCell.start(-1);
+ const rect = map5.rectBetween(
+ $anchorCell.pos - tableStart,
+ $headCell.pos - tableStart
+ );
+ const doc4 = $anchorCell.node(0);
+ const cells = map5.cellsInRect(rect).filter((p4) => p4 != $headCell.pos - tableStart);
+ cells.unshift($headCell.pos - tableStart);
+ const ranges = cells.map((pos) => {
+ const cell = table.nodeAt(pos);
+ if (!cell) {
+ throw RangeError(`No cell with offset ${pos} found`);
+ }
+ const from = tableStart + pos + 1;
+ return new SelectionRange(
+ doc4.resolve(from),
+ doc4.resolve(from + cell.content.size)
+ );
+ });
+ super(ranges[0].$from, ranges[0].$to, ranges);
+ this.$anchorCell = $anchorCell;
+ this.$headCell = $headCell;
+ }
+ map(doc4, mapping) {
+ const $anchorCell = doc4.resolve(mapping.map(this.$anchorCell.pos));
+ const $headCell = doc4.resolve(mapping.map(this.$headCell.pos));
+ if (pointsAtCell($anchorCell) && pointsAtCell($headCell) && inSameTable($anchorCell, $headCell)) {
+ const tableChanged = this.$anchorCell.node(-1) != $anchorCell.node(-1);
+ if (tableChanged && this.isRowSelection())
+ return _CellSelection.rowSelection($anchorCell, $headCell);
+ else if (tableChanged && this.isColSelection())
+ return _CellSelection.colSelection($anchorCell, $headCell);
+ else
+ return new _CellSelection($anchorCell, $headCell);
+ }
+ return TextSelection.between($anchorCell, $headCell);
+ }
+ // Returns a rectangular slice of table rows containing the selected
+ // cells.
+ content() {
+ const table = this.$anchorCell.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = this.$anchorCell.start(-1);
+ const rect = map5.rectBetween(
+ this.$anchorCell.pos - tableStart,
+ this.$headCell.pos - tableStart
+ );
+ const seen = {};
+ const rows = [];
+ for (let row = rect.top; row < rect.bottom; row++) {
+ const rowContent = [];
+ for (let index2 = row * map5.width + rect.left, col = rect.left; col < rect.right; col++, index2++) {
+ const pos = map5.map[index2];
+ if (seen[pos])
+ continue;
+ seen[pos] = true;
+ const cellRect = map5.findCell(pos);
+ let cell = table.nodeAt(pos);
+ if (!cell) {
+ throw RangeError(`No cell with offset ${pos} found`);
+ }
+ const extraLeft = rect.left - cellRect.left;
+ const extraRight = cellRect.right - rect.right;
+ if (extraLeft > 0 || extraRight > 0) {
+ let attrs = cell.attrs;
+ if (extraLeft > 0) {
+ attrs = removeColSpan(attrs, 0, extraLeft);
+ }
+ if (extraRight > 0) {
+ attrs = removeColSpan(
+ attrs,
+ attrs.colspan - extraRight,
+ extraRight
+ );
+ }
+ if (cellRect.left < rect.left) {
+ cell = cell.type.createAndFill(attrs);
+ if (!cell) {
+ throw RangeError(
+ `Could not create cell with attrs ${JSON.stringify(attrs)}`
+ );
+ }
+ } else {
+ cell = cell.type.create(attrs, cell.content);
+ }
+ }
+ if (cellRect.top < rect.top || cellRect.bottom > rect.bottom) {
+ const attrs = __spreadProps(__spreadValues({}, cell.attrs), {
+ rowspan: Math.min(cellRect.bottom, rect.bottom) - Math.max(cellRect.top, rect.top)
+ });
+ if (cellRect.top < rect.top) {
+ cell = cell.type.createAndFill(attrs);
+ } else {
+ cell = cell.type.create(attrs, cell.content);
+ }
+ }
+ rowContent.push(cell);
+ }
+ rows.push(table.child(row).copy(Fragment.from(rowContent)));
+ }
+ const fragment = this.isColSelection() && this.isRowSelection() ? table : rows;
+ return new Slice(Fragment.from(fragment), 1, 1);
+ }
+ replace(tr, content3 = Slice.empty) {
+ const mapFrom = tr.steps.length, ranges = this.ranges;
+ for (let i2 = 0; i2 < ranges.length; i2++) {
+ const { $from, $to } = ranges[i2], mapping = tr.mapping.slice(mapFrom);
+ tr.replace(
+ mapping.map($from.pos),
+ mapping.map($to.pos),
+ i2 ? Slice.empty : content3
+ );
+ }
+ const sel = Selection.findFrom(
+ tr.doc.resolve(tr.mapping.slice(mapFrom).map(this.to)),
+ -1
+ );
+ if (sel)
+ tr.setSelection(sel);
+ }
+ replaceWith(tr, node2) {
+ this.replace(tr, new Slice(Fragment.from(node2), 0, 0));
+ }
+ forEachCell(f3) {
+ const table = this.$anchorCell.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = this.$anchorCell.start(-1);
+ const cells = map5.cellsInRect(
+ map5.rectBetween(
+ this.$anchorCell.pos - tableStart,
+ this.$headCell.pos - tableStart
+ )
+ );
+ for (let i2 = 0; i2 < cells.length; i2++) {
+ f3(table.nodeAt(cells[i2]), tableStart + cells[i2]);
+ }
+ }
+ // True if this selection goes all the way from the top to the
+ // bottom of the table.
+ isColSelection() {
+ const anchorTop = this.$anchorCell.index(-1);
+ const headTop = this.$headCell.index(-1);
+ if (Math.min(anchorTop, headTop) > 0)
+ return false;
+ const anchorBottom = anchorTop + this.$anchorCell.nodeAfter.attrs.rowspan;
+ const headBottom = headTop + this.$headCell.nodeAfter.attrs.rowspan;
+ return Math.max(anchorBottom, headBottom) == this.$headCell.node(-1).childCount;
+ }
+ // Returns the smallest column selection that covers the given anchor
+ // and head cell.
+ static colSelection($anchorCell, $headCell = $anchorCell) {
+ const table = $anchorCell.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = $anchorCell.start(-1);
+ const anchorRect = map5.findCell($anchorCell.pos - tableStart);
+ const headRect = map5.findCell($headCell.pos - tableStart);
+ const doc4 = $anchorCell.node(0);
+ if (anchorRect.top <= headRect.top) {
+ if (anchorRect.top > 0)
+ $anchorCell = doc4.resolve(tableStart + map5.map[anchorRect.left]);
+ if (headRect.bottom < map5.height)
+ $headCell = doc4.resolve(
+ tableStart + map5.map[map5.width * (map5.height - 1) + headRect.right - 1]
+ );
+ } else {
+ if (headRect.top > 0)
+ $headCell = doc4.resolve(tableStart + map5.map[headRect.left]);
+ if (anchorRect.bottom < map5.height)
+ $anchorCell = doc4.resolve(
+ tableStart + map5.map[map5.width * (map5.height - 1) + anchorRect.right - 1]
+ );
+ }
+ return new _CellSelection($anchorCell, $headCell);
+ }
+ // True if this selection goes all the way from the left to the
+ // right of the table.
+ isRowSelection() {
+ const table = this.$anchorCell.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = this.$anchorCell.start(-1);
+ const anchorLeft = map5.colCount(this.$anchorCell.pos - tableStart);
+ const headLeft = map5.colCount(this.$headCell.pos - tableStart);
+ if (Math.min(anchorLeft, headLeft) > 0)
+ return false;
+ const anchorRight = anchorLeft + this.$anchorCell.nodeAfter.attrs.colspan;
+ const headRight = headLeft + this.$headCell.nodeAfter.attrs.colspan;
+ return Math.max(anchorRight, headRight) == map5.width;
+ }
+ eq(other) {
+ return other instanceof _CellSelection && other.$anchorCell.pos == this.$anchorCell.pos && other.$headCell.pos == this.$headCell.pos;
+ }
+ // Returns the smallest row selection that covers the given anchor
+ // and head cell.
+ static rowSelection($anchorCell, $headCell = $anchorCell) {
+ const table = $anchorCell.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = $anchorCell.start(-1);
+ const anchorRect = map5.findCell($anchorCell.pos - tableStart);
+ const headRect = map5.findCell($headCell.pos - tableStart);
+ const doc4 = $anchorCell.node(0);
+ if (anchorRect.left <= headRect.left) {
+ if (anchorRect.left > 0)
+ $anchorCell = doc4.resolve(
+ tableStart + map5.map[anchorRect.top * map5.width]
+ );
+ if (headRect.right < map5.width)
+ $headCell = doc4.resolve(
+ tableStart + map5.map[map5.width * (headRect.top + 1) - 1]
+ );
+ } else {
+ if (headRect.left > 0)
+ $headCell = doc4.resolve(tableStart + map5.map[headRect.top * map5.width]);
+ if (anchorRect.right < map5.width)
+ $anchorCell = doc4.resolve(
+ tableStart + map5.map[map5.width * (anchorRect.top + 1) - 1]
+ );
+ }
+ return new _CellSelection($anchorCell, $headCell);
+ }
+ toJSON() {
+ return {
+ type: "cell",
+ anchor: this.$anchorCell.pos,
+ head: this.$headCell.pos
+ };
+ }
+ static fromJSON(doc4, json) {
+ return new _CellSelection(doc4.resolve(json.anchor), doc4.resolve(json.head));
+ }
+ static create(doc4, anchorCell, headCell = anchorCell) {
+ return new _CellSelection(doc4.resolve(anchorCell), doc4.resolve(headCell));
+ }
+ getBookmark() {
+ return new CellBookmark(this.$anchorCell.pos, this.$headCell.pos);
+ }
+ };
+ CellSelection.prototype.visible = false;
+ Selection.jsonID("cell", CellSelection);
+ var CellBookmark = class _CellBookmark {
+ constructor(anchor, head) {
+ this.anchor = anchor;
+ this.head = head;
+ }
+ map(mapping) {
+ return new _CellBookmark(mapping.map(this.anchor), mapping.map(this.head));
+ }
+ resolve(doc4) {
+ const $anchorCell = doc4.resolve(this.anchor), $headCell = doc4.resolve(this.head);
+ if ($anchorCell.parent.type.spec.tableRole == "row" && $headCell.parent.type.spec.tableRole == "row" && $anchorCell.index() < $anchorCell.parent.childCount && $headCell.index() < $headCell.parent.childCount && inSameTable($anchorCell, $headCell))
+ return new CellSelection($anchorCell, $headCell);
+ else
+ return Selection.near($headCell, 1);
+ }
+ };
+ function drawCellSelection(state) {
+ if (!(state.selection instanceof CellSelection))
+ return null;
+ const cells = [];
+ state.selection.forEachCell((node2, pos) => {
+ cells.push(
+ Decoration.node(pos, pos + node2.nodeSize, { class: "selectedCell" })
+ );
+ });
+ return DecorationSet.create(state.doc, cells);
+ }
+ function isCellBoundarySelection({ $from, $to }) {
+ if ($from.pos == $to.pos || $from.pos < $from.pos - 6)
+ return false;
+ let afterFrom = $from.pos;
+ let beforeTo = $to.pos;
+ let depth = $from.depth;
+ for (; depth >= 0; depth--, afterFrom++)
+ if ($from.after(depth + 1) < $from.end(depth))
+ break;
+ for (let d6 = $to.depth; d6 >= 0; d6--, beforeTo--)
+ if ($to.before(d6 + 1) > $to.start(d6))
+ break;
+ return afterFrom == beforeTo && /row|table/.test($from.node(depth).type.spec.tableRole);
+ }
+ function isTextSelectionAcrossCells({ $from, $to }) {
+ let fromCellBoundaryNode;
+ let toCellBoundaryNode;
+ for (let i2 = $from.depth; i2 > 0; i2--) {
+ const node2 = $from.node(i2);
+ if (node2.type.spec.tableRole === "cell" || node2.type.spec.tableRole === "header_cell") {
+ fromCellBoundaryNode = node2;
+ break;
+ }
+ }
+ for (let i2 = $to.depth; i2 > 0; i2--) {
+ const node2 = $to.node(i2);
+ if (node2.type.spec.tableRole === "cell" || node2.type.spec.tableRole === "header_cell") {
+ toCellBoundaryNode = node2;
+ break;
+ }
+ }
+ return fromCellBoundaryNode !== toCellBoundaryNode && $to.parentOffset === 0;
+ }
+ function normalizeSelection(state, tr, allowTableNodeSelection) {
+ const sel = (tr || state).selection;
+ const doc4 = (tr || state).doc;
+ let normalize3;
+ let role;
+ if (sel instanceof NodeSelection && (role = sel.node.type.spec.tableRole)) {
+ if (role == "cell" || role == "header_cell") {
+ normalize3 = CellSelection.create(doc4, sel.from);
+ } else if (role == "row") {
+ const $cell = doc4.resolve(sel.from + 1);
+ normalize3 = CellSelection.rowSelection($cell, $cell);
+ } else if (!allowTableNodeSelection) {
+ const map5 = TableMap.get(sel.node);
+ const start = sel.from + 1;
+ const lastCell = start + map5.map[map5.width * map5.height - 1];
+ normalize3 = CellSelection.create(doc4, start + 1, lastCell);
+ }
+ } else if (sel instanceof TextSelection && isCellBoundarySelection(sel)) {
+ normalize3 = TextSelection.create(doc4, sel.from);
+ } else if (sel instanceof TextSelection && isTextSelectionAcrossCells(sel)) {
+ normalize3 = TextSelection.create(doc4, sel.$from.start(), sel.$from.end());
+ }
+ if (normalize3)
+ (tr || (tr = state.tr)).setSelection(normalize3);
+ return tr;
+ }
+ var fixTablesKey = new PluginKey("fix-tables");
+ function changedDescendants(old, cur, offset, f3) {
+ const oldSize = old.childCount, curSize = cur.childCount;
+ outer:
+ for (let i2 = 0, j6 = 0; i2 < curSize; i2++) {
+ const child = cur.child(i2);
+ for (let scan = j6, e2 = Math.min(oldSize, i2 + 3); scan < e2; scan++) {
+ if (old.child(scan) == child) {
+ j6 = scan + 1;
+ offset += child.nodeSize;
+ continue outer;
+ }
+ }
+ f3(child, offset);
+ if (j6 < oldSize && old.child(j6).sameMarkup(child))
+ changedDescendants(old.child(j6), child, offset + 1, f3);
+ else
+ child.nodesBetween(0, child.content.size, f3, offset + 1);
+ offset += child.nodeSize;
+ }
+ }
+ function fixTables(state, oldState) {
+ let tr;
+ const check = (node2, pos) => {
+ if (node2.type.spec.tableRole == "table")
+ tr = fixTable(state, node2, pos, tr);
+ };
+ if (!oldState)
+ state.doc.descendants(check);
+ else if (oldState.doc != state.doc)
+ changedDescendants(oldState.doc, state.doc, 0, check);
+ return tr;
+ }
+ function fixTable(state, table, tablePos, tr) {
+ const map5 = TableMap.get(table);
+ if (!map5.problems)
+ return tr;
+ if (!tr)
+ tr = state.tr;
+ const mustAdd = [];
+ for (let i2 = 0; i2 < map5.height; i2++)
+ mustAdd.push(0);
+ for (let i2 = 0; i2 < map5.problems.length; i2++) {
+ const prob = map5.problems[i2];
+ if (prob.type == "collision") {
+ const cell = table.nodeAt(prob.pos);
+ if (!cell)
+ continue;
+ const attrs = cell.attrs;
+ for (let j6 = 0; j6 < attrs.rowspan; j6++)
+ mustAdd[prob.row + j6] += prob.n;
+ tr.setNodeMarkup(
+ tr.mapping.map(tablePos + 1 + prob.pos),
+ null,
+ removeColSpan(attrs, attrs.colspan - prob.n, prob.n)
+ );
+ } else if (prob.type == "missing") {
+ mustAdd[prob.row] += prob.n;
+ } else if (prob.type == "overlong_rowspan") {
+ const cell = table.nodeAt(prob.pos);
+ if (!cell)
+ continue;
+ tr.setNodeMarkup(tr.mapping.map(tablePos + 1 + prob.pos), null, __spreadProps(__spreadValues({}, cell.attrs), {
+ rowspan: cell.attrs.rowspan - prob.n
+ }));
+ } else if (prob.type == "colwidth mismatch") {
+ const cell = table.nodeAt(prob.pos);
+ if (!cell)
+ continue;
+ tr.setNodeMarkup(tr.mapping.map(tablePos + 1 + prob.pos), null, __spreadProps(__spreadValues({}, cell.attrs), {
+ colwidth: prob.colwidth
+ }));
+ }
+ }
+ let first, last;
+ for (let i2 = 0; i2 < mustAdd.length; i2++)
+ if (mustAdd[i2]) {
+ if (first == null)
+ first = i2;
+ last = i2;
+ }
+ for (let i2 = 0, pos = tablePos + 1; i2 < map5.height; i2++) {
+ const row = table.child(i2);
+ const end = pos + row.nodeSize;
+ const add = mustAdd[i2];
+ if (add > 0) {
+ let role = "cell";
+ if (row.firstChild) {
+ role = row.firstChild.type.spec.tableRole;
+ }
+ const nodes = [];
+ for (let j6 = 0; j6 < add; j6++) {
+ const node2 = tableNodeTypes(state.schema)[role].createAndFill();
+ if (node2)
+ nodes.push(node2);
+ }
+ const side = (i2 == 0 || first == i2 - 1) && last == i2 ? pos + 1 : end - 1;
+ tr.insert(tr.mapping.map(side), nodes);
+ }
+ pos = end;
+ }
+ return tr.setMeta(fixTablesKey, { fixTables: true });
+ }
+ function pastedCells(slice) {
+ if (!slice.size)
+ return null;
+ let { content: content3, openStart, openEnd } = slice;
+ while (content3.childCount == 1 && (openStart > 0 && openEnd > 0 || content3.child(0).type.spec.tableRole == "table")) {
+ openStart--;
+ openEnd--;
+ content3 = content3.child(0).content;
+ }
+ const first = content3.child(0);
+ const role = first.type.spec.tableRole;
+ const schema = first.type.schema, rows = [];
+ if (role == "row") {
+ for (let i2 = 0; i2 < content3.childCount; i2++) {
+ let cells = content3.child(i2).content;
+ const left = i2 ? 0 : Math.max(0, openStart - 1);
+ const right = i2 < content3.childCount - 1 ? 0 : Math.max(0, openEnd - 1);
+ if (left || right)
+ cells = fitSlice(
+ tableNodeTypes(schema).row,
+ new Slice(cells, left, right)
+ ).content;
+ rows.push(cells);
+ }
+ } else if (role == "cell" || role == "header_cell") {
+ rows.push(
+ openStart || openEnd ? fitSlice(
+ tableNodeTypes(schema).row,
+ new Slice(content3, openStart, openEnd)
+ ).content : content3
+ );
+ } else {
+ return null;
+ }
+ return ensureRectangular(schema, rows);
+ }
+ function ensureRectangular(schema, rows) {
+ const widths = [];
+ for (let i2 = 0; i2 < rows.length; i2++) {
+ const row = rows[i2];
+ for (let j6 = row.childCount - 1; j6 >= 0; j6--) {
+ const { rowspan, colspan } = row.child(j6).attrs;
+ for (let r3 = i2; r3 < i2 + rowspan; r3++)
+ widths[r3] = (widths[r3] || 0) + colspan;
+ }
+ }
+ let width = 0;
+ for (let r3 = 0; r3 < widths.length; r3++)
+ width = Math.max(width, widths[r3]);
+ for (let r3 = 0; r3 < widths.length; r3++) {
+ if (r3 >= rows.length)
+ rows.push(Fragment.empty);
+ if (widths[r3] < width) {
+ const empty3 = tableNodeTypes(schema).cell.createAndFill();
+ const cells = [];
+ for (let i2 = widths[r3]; i2 < width; i2++) {
+ cells.push(empty3);
+ }
+ rows[r3] = rows[r3].append(Fragment.from(cells));
+ }
+ }
+ return { height: rows.length, width, rows };
+ }
+ function fitSlice(nodeType, slice) {
+ const node2 = nodeType.createAndFill();
+ const tr = new Transform(node2).replace(0, node2.content.size, slice);
+ return tr.doc;
+ }
+ function clipCells({ width, height, rows }, newWidth, newHeight) {
+ if (width != newWidth) {
+ const added = [];
+ const newRows = [];
+ for (let row = 0; row < rows.length; row++) {
+ const frag = rows[row], cells = [];
+ for (let col = added[row] || 0, i2 = 0; col < newWidth; i2++) {
+ let cell = frag.child(i2 % frag.childCount);
+ if (col + cell.attrs.colspan > newWidth)
+ cell = cell.type.createChecked(
+ removeColSpan(
+ cell.attrs,
+ cell.attrs.colspan,
+ col + cell.attrs.colspan - newWidth
+ ),
+ cell.content
+ );
+ cells.push(cell);
+ col += cell.attrs.colspan;
+ for (let j6 = 1; j6 < cell.attrs.rowspan; j6++)
+ added[row + j6] = (added[row + j6] || 0) + cell.attrs.colspan;
+ }
+ newRows.push(Fragment.from(cells));
+ }
+ rows = newRows;
+ width = newWidth;
+ }
+ if (height != newHeight) {
+ const newRows = [];
+ for (let row = 0, i2 = 0; row < newHeight; row++, i2++) {
+ const cells = [], source = rows[i2 % height];
+ for (let j6 = 0; j6 < source.childCount; j6++) {
+ let cell = source.child(j6);
+ if (row + cell.attrs.rowspan > newHeight)
+ cell = cell.type.create(
+ __spreadProps(__spreadValues({}, cell.attrs), {
+ rowspan: Math.max(1, newHeight - cell.attrs.rowspan)
+ }),
+ cell.content
+ );
+ cells.push(cell);
+ }
+ newRows.push(Fragment.from(cells));
+ }
+ rows = newRows;
+ height = newHeight;
+ }
+ return { width, height, rows };
+ }
+ function growTable(tr, map5, table, start, width, height, mapFrom) {
+ const schema = tr.doc.type.schema;
+ const types = tableNodeTypes(schema);
+ let empty3;
+ let emptyHead;
+ if (width > map5.width) {
+ for (let row = 0, rowEnd = 0; row < map5.height; row++) {
+ const rowNode = table.child(row);
+ rowEnd += rowNode.nodeSize;
+ const cells = [];
+ let add;
+ if (rowNode.lastChild == null || rowNode.lastChild.type == types.cell)
+ add = empty3 || (empty3 = types.cell.createAndFill());
+ else
+ add = emptyHead || (emptyHead = types.header_cell.createAndFill());
+ for (let i2 = map5.width; i2 < width; i2++)
+ cells.push(add);
+ tr.insert(tr.mapping.slice(mapFrom).map(rowEnd - 1 + start), cells);
+ }
+ }
+ if (height > map5.height) {
+ const cells = [];
+ for (let i2 = 0, start2 = (map5.height - 1) * map5.width; i2 < Math.max(map5.width, width); i2++) {
+ const header = i2 >= map5.width ? false : table.nodeAt(map5.map[start2 + i2]).type == types.header_cell;
+ cells.push(
+ header ? emptyHead || (emptyHead = types.header_cell.createAndFill()) : empty3 || (empty3 = types.cell.createAndFill())
+ );
+ }
+ const emptyRow = types.row.create(null, Fragment.from(cells)), rows = [];
+ for (let i2 = map5.height; i2 < height; i2++)
+ rows.push(emptyRow);
+ tr.insert(tr.mapping.slice(mapFrom).map(start + table.nodeSize - 2), rows);
+ }
+ return !!(empty3 || emptyHead);
+ }
+ function isolateHorizontal(tr, map5, table, start, left, right, top, mapFrom) {
+ if (top == 0 || top == map5.height)
+ return false;
+ let found2 = false;
+ for (let col = left; col < right; col++) {
+ const index2 = top * map5.width + col, pos = map5.map[index2];
+ if (map5.map[index2 - map5.width] == pos) {
+ found2 = true;
+ const cell = table.nodeAt(pos);
+ const { top: cellTop, left: cellLeft } = map5.findCell(pos);
+ tr.setNodeMarkup(tr.mapping.slice(mapFrom).map(pos + start), null, __spreadProps(__spreadValues({}, cell.attrs), {
+ rowspan: top - cellTop
+ }));
+ tr.insert(
+ tr.mapping.slice(mapFrom).map(map5.positionAt(top, cellLeft, table)),
+ cell.type.createAndFill(__spreadProps(__spreadValues({}, cell.attrs), {
+ rowspan: cellTop + cell.attrs.rowspan - top
+ }))
+ );
+ col += cell.attrs.colspan - 1;
+ }
+ }
+ return found2;
+ }
+ function isolateVertical(tr, map5, table, start, top, bottom, left, mapFrom) {
+ if (left == 0 || left == map5.width)
+ return false;
+ let found2 = false;
+ for (let row = top; row < bottom; row++) {
+ const index2 = row * map5.width + left, pos = map5.map[index2];
+ if (map5.map[index2 - 1] == pos) {
+ found2 = true;
+ const cell = table.nodeAt(pos);
+ const cellLeft = map5.colCount(pos);
+ const updatePos = tr.mapping.slice(mapFrom).map(pos + start);
+ tr.setNodeMarkup(
+ updatePos,
+ null,
+ removeColSpan(
+ cell.attrs,
+ left - cellLeft,
+ cell.attrs.colspan - (left - cellLeft)
+ )
+ );
+ tr.insert(
+ updatePos + cell.nodeSize,
+ cell.type.createAndFill(
+ removeColSpan(cell.attrs, 0, left - cellLeft)
+ )
+ );
+ row += cell.attrs.rowspan - 1;
+ }
+ }
+ return found2;
+ }
+ function insertCells(state, dispatch, tableStart, rect, cells) {
+ let table = tableStart ? state.doc.nodeAt(tableStart - 1) : state.doc;
+ if (!table) {
+ throw new Error("No table found");
+ }
+ let map5 = TableMap.get(table);
+ const { top, left } = rect;
+ const right = left + cells.width, bottom = top + cells.height;
+ const tr = state.tr;
+ let mapFrom = 0;
+ function recomp() {
+ table = tableStart ? tr.doc.nodeAt(tableStart - 1) : tr.doc;
+ if (!table) {
+ throw new Error("No table found");
+ }
+ map5 = TableMap.get(table);
+ mapFrom = tr.mapping.maps.length;
+ }
+ if (growTable(tr, map5, table, tableStart, right, bottom, mapFrom))
+ recomp();
+ if (isolateHorizontal(tr, map5, table, tableStart, left, right, top, mapFrom))
+ recomp();
+ if (isolateHorizontal(tr, map5, table, tableStart, left, right, bottom, mapFrom))
+ recomp();
+ if (isolateVertical(tr, map5, table, tableStart, top, bottom, left, mapFrom))
+ recomp();
+ if (isolateVertical(tr, map5, table, tableStart, top, bottom, right, mapFrom))
+ recomp();
+ for (let row = top; row < bottom; row++) {
+ const from = map5.positionAt(row, left, table), to = map5.positionAt(row, right, table);
+ tr.replace(
+ tr.mapping.slice(mapFrom).map(from + tableStart),
+ tr.mapping.slice(mapFrom).map(to + tableStart),
+ new Slice(cells.rows[row - top], 0, 0)
+ );
+ }
+ recomp();
+ tr.setSelection(
+ new CellSelection(
+ tr.doc.resolve(tableStart + map5.positionAt(top, left, table)),
+ tr.doc.resolve(tableStart + map5.positionAt(bottom - 1, right - 1, table))
+ )
+ );
+ dispatch(tr);
+ }
+ var handleKeyDown = keydownHandler({
+ ArrowLeft: arrow("horiz", -1),
+ ArrowRight: arrow("horiz", 1),
+ ArrowUp: arrow("vert", -1),
+ ArrowDown: arrow("vert", 1),
+ "Shift-ArrowLeft": shiftArrow("horiz", -1),
+ "Shift-ArrowRight": shiftArrow("horiz", 1),
+ "Shift-ArrowUp": shiftArrow("vert", -1),
+ "Shift-ArrowDown": shiftArrow("vert", 1),
+ Backspace: deleteCellSelection,
+ "Mod-Backspace": deleteCellSelection,
+ Delete: deleteCellSelection,
+ "Mod-Delete": deleteCellSelection
+ });
+ function maybeSetSelection(state, dispatch, selection) {
+ if (selection.eq(state.selection))
+ return false;
+ if (dispatch)
+ dispatch(state.tr.setSelection(selection).scrollIntoView());
+ return true;
+ }
+ function arrow(axis, dir) {
+ return (state, dispatch, view) => {
+ if (!view)
+ return false;
+ const sel = state.selection;
+ if (sel instanceof CellSelection) {
+ return maybeSetSelection(
+ state,
+ dispatch,
+ Selection.near(sel.$headCell, dir)
+ );
+ }
+ if (axis != "horiz" && !sel.empty)
+ return false;
+ const end = atEndOfCell(view, axis, dir);
+ if (end == null)
+ return false;
+ if (axis == "horiz") {
+ return maybeSetSelection(
+ state,
+ dispatch,
+ Selection.near(state.doc.resolve(sel.head + dir), dir)
+ );
+ } else {
+ const $cell = state.doc.resolve(end);
+ const $next = nextCell($cell, axis, dir);
+ let newSel;
+ if ($next)
+ newSel = Selection.near($next, 1);
+ else if (dir < 0)
+ newSel = Selection.near(state.doc.resolve($cell.before(-1)), -1);
+ else
+ newSel = Selection.near(state.doc.resolve($cell.after(-1)), 1);
+ return maybeSetSelection(state, dispatch, newSel);
+ }
+ };
+ }
+ function shiftArrow(axis, dir) {
+ return (state, dispatch, view) => {
+ if (!view)
+ return false;
+ const sel = state.selection;
+ let cellSel;
+ if (sel instanceof CellSelection) {
+ cellSel = sel;
+ } else {
+ const end = atEndOfCell(view, axis, dir);
+ if (end == null)
+ return false;
+ cellSel = new CellSelection(state.doc.resolve(end));
+ }
+ const $head = nextCell(cellSel.$headCell, axis, dir);
+ if (!$head)
+ return false;
+ return maybeSetSelection(
+ state,
+ dispatch,
+ new CellSelection(cellSel.$anchorCell, $head)
+ );
+ };
+ }
+ function deleteCellSelection(state, dispatch) {
+ const sel = state.selection;
+ if (!(sel instanceof CellSelection))
+ return false;
+ if (dispatch) {
+ const tr = state.tr;
+ const baseContent = tableNodeTypes(state.schema).cell.createAndFill().content;
+ sel.forEachCell((cell, pos) => {
+ if (!cell.content.eq(baseContent))
+ tr.replace(
+ tr.mapping.map(pos + 1),
+ tr.mapping.map(pos + cell.nodeSize - 1),
+ new Slice(baseContent, 0, 0)
+ );
+ });
+ if (tr.docChanged)
+ dispatch(tr);
+ }
+ return true;
+ }
+ function handleTripleClick2(view, pos) {
+ const doc4 = view.state.doc, $cell = cellAround(doc4.resolve(pos));
+ if (!$cell)
+ return false;
+ view.dispatch(view.state.tr.setSelection(new CellSelection($cell)));
+ return true;
+ }
+ function handlePaste(view, _3, slice) {
+ if (!isInTable(view.state))
+ return false;
+ let cells = pastedCells(slice);
+ const sel = view.state.selection;
+ if (sel instanceof CellSelection) {
+ if (!cells)
+ cells = {
+ width: 1,
+ height: 1,
+ rows: [
+ Fragment.from(
+ fitSlice(tableNodeTypes(view.state.schema).cell, slice)
+ )
+ ]
+ };
+ const table = sel.$anchorCell.node(-1);
+ const start = sel.$anchorCell.start(-1);
+ const rect = TableMap.get(table).rectBetween(
+ sel.$anchorCell.pos - start,
+ sel.$headCell.pos - start
+ );
+ cells = clipCells(cells, rect.right - rect.left, rect.bottom - rect.top);
+ insertCells(view.state, view.dispatch, start, rect, cells);
+ return true;
+ } else if (cells) {
+ const $cell = selectionCell(view.state);
+ const start = $cell.start(-1);
+ insertCells(
+ view.state,
+ view.dispatch,
+ start,
+ TableMap.get($cell.node(-1)).findCell($cell.pos - start),
+ cells
+ );
+ return true;
+ } else {
+ return false;
+ }
+ }
+ function handleMouseDown(view, startEvent) {
+ var _a;
+ if (startEvent.ctrlKey || startEvent.metaKey)
+ return;
+ const startDOMCell = domInCell(view, startEvent.target);
+ let $anchor;
+ if (startEvent.shiftKey && view.state.selection instanceof CellSelection) {
+ setCellSelection(view.state.selection.$anchorCell, startEvent);
+ startEvent.preventDefault();
+ } else if (startEvent.shiftKey && startDOMCell && ($anchor = cellAround(view.state.selection.$anchor)) != null && ((_a = cellUnderMouse(view, startEvent)) == null ? void 0 : _a.pos) != $anchor.pos) {
+ setCellSelection($anchor, startEvent);
+ startEvent.preventDefault();
+ } else if (!startDOMCell) {
+ return;
+ }
+ function setCellSelection($anchor2, event) {
+ let $head = cellUnderMouse(view, event);
+ const starting = tableEditingKey.getState(view.state) == null;
+ if (!$head || !inSameTable($anchor2, $head)) {
+ if (starting)
+ $head = $anchor2;
+ else
+ return;
+ }
+ const selection = new CellSelection($anchor2, $head);
+ if (starting || !view.state.selection.eq(selection)) {
+ const tr = view.state.tr.setSelection(selection);
+ if (starting)
+ tr.setMeta(tableEditingKey, $anchor2.pos);
+ view.dispatch(tr);
+ }
+ }
+ function stop() {
+ view.root.removeEventListener("mouseup", stop);
+ view.root.removeEventListener("dragstart", stop);
+ view.root.removeEventListener("mousemove", move);
+ if (tableEditingKey.getState(view.state) != null)
+ view.dispatch(view.state.tr.setMeta(tableEditingKey, -1));
+ }
+ function move(_event) {
+ const event = _event;
+ const anchor = tableEditingKey.getState(view.state);
+ let $anchor2;
+ if (anchor != null) {
+ $anchor2 = view.state.doc.resolve(anchor);
+ } else if (domInCell(view, event.target) != startDOMCell) {
+ $anchor2 = cellUnderMouse(view, startEvent);
+ if (!$anchor2)
+ return stop();
+ }
+ if ($anchor2)
+ setCellSelection($anchor2, event);
+ }
+ view.root.addEventListener("mouseup", stop);
+ view.root.addEventListener("dragstart", stop);
+ view.root.addEventListener("mousemove", move);
+ }
+ function atEndOfCell(view, axis, dir) {
+ if (!(view.state.selection instanceof TextSelection))
+ return null;
+ const { $head } = view.state.selection;
+ for (let d6 = $head.depth - 1; d6 >= 0; d6--) {
+ const parent = $head.node(d6), index2 = dir < 0 ? $head.index(d6) : $head.indexAfter(d6);
+ if (index2 != (dir < 0 ? 0 : parent.childCount))
+ return null;
+ if (parent.type.spec.tableRole == "cell" || parent.type.spec.tableRole == "header_cell") {
+ const cellPos = $head.before(d6);
+ const dirStr = axis == "vert" ? dir > 0 ? "down" : "up" : dir > 0 ? "right" : "left";
+ return view.endOfTextblock(dirStr) ? cellPos : null;
+ }
+ }
+ return null;
+ }
+ function domInCell(view, dom) {
+ for (; dom && dom != view.dom; dom = dom.parentNode) {
+ if (dom.nodeName == "TD" || dom.nodeName == "TH") {
+ return dom;
+ }
+ }
+ return null;
+ }
+ function cellUnderMouse(view, event) {
+ const mousePos = view.posAtCoords({
+ left: event.clientX,
+ top: event.clientY
+ });
+ if (!mousePos)
+ return null;
+ return mousePos ? cellAround(view.state.doc.resolve(mousePos.pos)) : null;
+ }
+ var TableView = class {
+ constructor(node2, cellMinWidth) {
+ this.node = node2;
+ this.cellMinWidth = cellMinWidth;
+ this.dom = document.createElement("div");
+ this.dom.className = "tableWrapper";
+ this.table = this.dom.appendChild(document.createElement("table"));
+ this.colgroup = this.table.appendChild(document.createElement("colgroup"));
+ updateColumnsOnResize(node2, this.colgroup, this.table, cellMinWidth);
+ this.contentDOM = this.table.appendChild(document.createElement("tbody"));
+ }
+ update(node2) {
+ if (node2.type != this.node.type)
+ return false;
+ this.node = node2;
+ updateColumnsOnResize(node2, this.colgroup, this.table, this.cellMinWidth);
+ return true;
+ }
+ ignoreMutation(record) {
+ return record.type == "attributes" && (record.target == this.table || this.colgroup.contains(record.target));
+ }
+ };
+ function updateColumnsOnResize(node2, colgroup, table, cellMinWidth, overrideCol, overrideValue) {
+ var _a;
+ let totalWidth = 0;
+ let fixedWidth = true;
+ let nextDOM = colgroup.firstChild;
+ const row = node2.firstChild;
+ if (!row)
+ return;
+ for (let i2 = 0, col = 0; i2 < row.childCount; i2++) {
+ const { colspan, colwidth } = row.child(i2).attrs;
+ for (let j6 = 0; j6 < colspan; j6++, col++) {
+ const hasWidth = overrideCol == col ? overrideValue : colwidth && colwidth[j6];
+ const cssWidth = hasWidth ? hasWidth + "px" : "";
+ totalWidth += hasWidth || cellMinWidth;
+ if (!hasWidth)
+ fixedWidth = false;
+ if (!nextDOM) {
+ colgroup.appendChild(document.createElement("col")).style.width = cssWidth;
+ } else {
+ if (nextDOM.style.width != cssWidth)
+ nextDOM.style.width = cssWidth;
+ nextDOM = nextDOM.nextSibling;
+ }
+ }
+ }
+ while (nextDOM) {
+ const after = nextDOM.nextSibling;
+ (_a = nextDOM.parentNode) == null ? void 0 : _a.removeChild(nextDOM);
+ nextDOM = after;
+ }
+ if (fixedWidth) {
+ table.style.width = totalWidth + "px";
+ table.style.minWidth = "";
+ } else {
+ table.style.width = "";
+ table.style.minWidth = totalWidth + "px";
+ }
+ }
+ var columnResizingPluginKey = new PluginKey(
+ "tableColumnResizing"
+ );
+ function columnResizing({
+ handleWidth = 5,
+ cellMinWidth = 25,
+ View = TableView,
+ lastColumnResizable = true
+ } = {}) {
+ const plugin = new Plugin({
+ key: columnResizingPluginKey,
+ state: {
+ init(_3, state) {
+ plugin.spec.props.nodeViews[tableNodeTypes(state.schema).table.name] = (node2, view) => new View(node2, cellMinWidth, view);
+ return new ResizeState(-1, false);
+ },
+ apply(tr, prev) {
+ return prev.apply(tr);
+ }
+ },
+ props: {
+ attributes: (state) => {
+ const pluginState = columnResizingPluginKey.getState(state);
+ return pluginState && pluginState.activeHandle > -1 ? { class: "resize-cursor" } : {};
+ },
+ handleDOMEvents: {
+ mousemove: (view, event) => {
+ handleMouseMove(
+ view,
+ event,
+ handleWidth,
+ cellMinWidth,
+ lastColumnResizable
+ );
+ },
+ mouseleave: (view) => {
+ handleMouseLeave(view);
+ },
+ mousedown: (view, event) => {
+ handleMouseDown2(view, event, cellMinWidth);
+ }
+ },
+ decorations: (state) => {
+ const pluginState = columnResizingPluginKey.getState(state);
+ if (pluginState && pluginState.activeHandle > -1) {
+ return handleDecorations(state, pluginState.activeHandle);
+ }
+ },
+ nodeViews: {}
+ }
+ });
+ return plugin;
+ }
+ var ResizeState = class _ResizeState {
+ constructor(activeHandle, dragging) {
+ this.activeHandle = activeHandle;
+ this.dragging = dragging;
+ }
+ apply(tr) {
+ const state = this;
+ const action = tr.getMeta(columnResizingPluginKey);
+ if (action && action.setHandle != null)
+ return new _ResizeState(action.setHandle, false);
+ if (action && action.setDragging !== void 0)
+ return new _ResizeState(state.activeHandle, action.setDragging);
+ if (state.activeHandle > -1 && tr.docChanged) {
+ let handle2 = tr.mapping.map(state.activeHandle, -1);
+ if (!pointsAtCell(tr.doc.resolve(handle2))) {
+ handle2 = -1;
+ }
+ return new _ResizeState(handle2, state.dragging);
+ }
+ return state;
+ }
+ };
+ function handleMouseMove(view, event, handleWidth, cellMinWidth, lastColumnResizable) {
+ const pluginState = columnResizingPluginKey.getState(view.state);
+ if (!pluginState)
+ return;
+ if (!pluginState.dragging) {
+ const target = domCellAround(event.target);
+ let cell = -1;
+ if (target) {
+ const { left, right } = target.getBoundingClientRect();
+ if (event.clientX - left <= handleWidth)
+ cell = edgeCell(view, event, "left", handleWidth);
+ else if (right - event.clientX <= handleWidth)
+ cell = edgeCell(view, event, "right", handleWidth);
+ }
+ if (cell != pluginState.activeHandle) {
+ if (!lastColumnResizable && cell !== -1) {
+ const $cell = view.state.doc.resolve(cell);
+ const table = $cell.node(-1);
+ const map5 = TableMap.get(table);
+ const tableStart = $cell.start(-1);
+ const col = map5.colCount($cell.pos - tableStart) + $cell.nodeAfter.attrs.colspan - 1;
+ if (col == map5.width - 1) {
+ return;
+ }
+ }
+ updateHandle(view, cell);
+ }
+ }
+ }
+ function handleMouseLeave(view) {
+ const pluginState = columnResizingPluginKey.getState(view.state);
+ if (pluginState && pluginState.activeHandle > -1 && !pluginState.dragging)
+ updateHandle(view, -1);
+ }
+ function handleMouseDown2(view, event, cellMinWidth) {
+ var _a;
+ const win = (_a = view.dom.ownerDocument.defaultView) != null ? _a : window;
+ const pluginState = columnResizingPluginKey.getState(view.state);
+ if (!pluginState || pluginState.activeHandle == -1 || pluginState.dragging)
+ return false;
+ const cell = view.state.doc.nodeAt(pluginState.activeHandle);
+ const width = currentColWidth(view, pluginState.activeHandle, cell.attrs);
+ view.dispatch(
+ view.state.tr.setMeta(columnResizingPluginKey, {
+ setDragging: { startX: event.clientX, startWidth: width }
+ })
+ );
+ function finish(event2) {
+ win.removeEventListener("mouseup", finish);
+ win.removeEventListener("mousemove", move);
+ const pluginState2 = columnResizingPluginKey.getState(view.state);
+ if (pluginState2 == null ? void 0 : pluginState2.dragging) {
+ updateColumnWidth(
+ view,
+ pluginState2.activeHandle,
+ draggedWidth(pluginState2.dragging, event2, cellMinWidth)
+ );
+ view.dispatch(
+ view.state.tr.setMeta(columnResizingPluginKey, { setDragging: null })
+ );
+ }
+ }
+ function move(event2) {
+ if (!event2.which)
+ return finish(event2);
+ const pluginState2 = columnResizingPluginKey.getState(view.state);
+ if (!pluginState2)
+ return;
+ if (pluginState2.dragging) {
+ const dragged = draggedWidth(pluginState2.dragging, event2, cellMinWidth);
+ displayColumnWidth(view, pluginState2.activeHandle, dragged, cellMinWidth);
+ }
+ }
+ win.addEventListener("mouseup", finish);
+ win.addEventListener("mousemove", move);
+ event.preventDefault();
+ return true;
+ }
+ function currentColWidth(view, cellPos, { colspan, colwidth }) {
+ const width = colwidth && colwidth[colwidth.length - 1];
+ if (width)
+ return width;
+ const dom = view.domAtPos(cellPos);
+ const node2 = dom.node.childNodes[dom.offset];
+ let domWidth = node2.offsetWidth, parts = colspan;
+ if (colwidth) {
+ for (let i2 = 0; i2 < colspan; i2++)
+ if (colwidth[i2]) {
+ domWidth -= colwidth[i2];
+ parts--;
+ }
+ }
+ return domWidth / parts;
+ }
+ function domCellAround(target) {
+ while (target && target.nodeName != "TD" && target.nodeName != "TH")
+ target = target.classList && target.classList.contains("ProseMirror") ? null : target.parentNode;
+ return target;
+ }
+ function edgeCell(view, event, side, handleWidth) {
+ const offset = side == "right" ? -handleWidth : handleWidth;
+ const found2 = view.posAtCoords({
+ left: event.clientX + offset,
+ top: event.clientY
+ });
+ if (!found2)
+ return -1;
+ const { pos } = found2;
+ const $cell = cellAround(view.state.doc.resolve(pos));
+ if (!$cell)
+ return -1;
+ if (side == "right")
+ return $cell.pos;
+ const map5 = TableMap.get($cell.node(-1)), start = $cell.start(-1);
+ const index2 = map5.map.indexOf($cell.pos - start);
+ return index2 % map5.width == 0 ? -1 : start + map5.map[index2 - 1];
+ }
+ function draggedWidth(dragging, event, cellMinWidth) {
+ const offset = event.clientX - dragging.startX;
+ return Math.max(cellMinWidth, dragging.startWidth + offset);
+ }
+ function updateHandle(view, value) {
+ view.dispatch(
+ view.state.tr.setMeta(columnResizingPluginKey, { setHandle: value })
+ );
+ }
+ function updateColumnWidth(view, cell, width) {
+ const $cell = view.state.doc.resolve(cell);
+ const table = $cell.node(-1), map5 = TableMap.get(table), start = $cell.start(-1);
+ const col = map5.colCount($cell.pos - start) + $cell.nodeAfter.attrs.colspan - 1;
+ const tr = view.state.tr;
+ for (let row = 0; row < map5.height; row++) {
+ const mapIndex = row * map5.width + col;
+ if (row && map5.map[mapIndex] == map5.map[mapIndex - map5.width])
+ continue;
+ const pos = map5.map[mapIndex];
+ const attrs = table.nodeAt(pos).attrs;
+ const index2 = attrs.colspan == 1 ? 0 : col - map5.colCount(pos);
+ if (attrs.colwidth && attrs.colwidth[index2] == width)
+ continue;
+ const colwidth = attrs.colwidth ? attrs.colwidth.slice() : zeroes(attrs.colspan);
+ colwidth[index2] = width;
+ tr.setNodeMarkup(start + pos, null, __spreadProps(__spreadValues({}, attrs), { colwidth }));
+ }
+ if (tr.docChanged)
+ view.dispatch(tr);
+ }
+ function displayColumnWidth(view, cell, width, cellMinWidth) {
+ const $cell = view.state.doc.resolve(cell);
+ const table = $cell.node(-1), start = $cell.start(-1);
+ const col = TableMap.get(table).colCount($cell.pos - start) + $cell.nodeAfter.attrs.colspan - 1;
+ let dom = view.domAtPos($cell.start(-1)).node;
+ while (dom && dom.nodeName != "TABLE") {
+ dom = dom.parentNode;
+ }
+ if (!dom)
+ return;
+ updateColumnsOnResize(
+ table,
+ dom.firstChild,
+ dom,
+ cellMinWidth,
+ col,
+ width
+ );
+ }
+ function zeroes(n4) {
+ return Array(n4).fill(0);
+ }
+ function handleDecorations(state, cell) {
+ const decorations = [];
+ const $cell = state.doc.resolve(cell);
+ const table = $cell.node(-1);
+ if (!table) {
+ return DecorationSet.empty;
+ }
+ const map5 = TableMap.get(table);
+ const start = $cell.start(-1);
+ const col = map5.colCount($cell.pos - start) + $cell.nodeAfter.attrs.colspan;
+ for (let row = 0; row < map5.height; row++) {
+ const index2 = col + row * map5.width - 1;
+ if ((col == map5.width || map5.map[index2] != map5.map[index2 + 1]) && (row == 0 || map5.map[index2] != map5.map[index2 - map5.width])) {
+ const cellPos = map5.map[index2];
+ const pos = start + cellPos + table.nodeAt(cellPos).nodeSize - 1;
+ const dom = document.createElement("div");
+ dom.className = "column-resize-handle";
+ decorations.push(Decoration.widget(pos, dom));
+ }
+ }
+ return DecorationSet.create(state.doc, decorations);
+ }
+ function selectedRect(state) {
+ const sel = state.selection;
+ const $pos = selectionCell(state);
+ const table = $pos.node(-1);
+ const tableStart = $pos.start(-1);
+ const map5 = TableMap.get(table);
+ const rect = sel instanceof CellSelection ? map5.rectBetween(
+ sel.$anchorCell.pos - tableStart,
+ sel.$headCell.pos - tableStart
+ ) : map5.findCell($pos.pos - tableStart);
+ return __spreadProps(__spreadValues({}, rect), { tableStart, map: map5, table });
+ }
+ function addColumn(tr, { map: map5, tableStart, table }, col) {
+ let refColumn = col > 0 ? -1 : 0;
+ if (columnIsHeader(map5, table, col + refColumn)) {
+ refColumn = col == 0 || col == map5.width ? null : 0;
+ }
+ for (let row = 0; row < map5.height; row++) {
+ const index2 = row * map5.width + col;
+ if (col > 0 && col < map5.width && map5.map[index2 - 1] == map5.map[index2]) {
+ const pos = map5.map[index2];
+ const cell = table.nodeAt(pos);
+ tr.setNodeMarkup(
+ tr.mapping.map(tableStart + pos),
+ null,
+ addColSpan(cell.attrs, col - map5.colCount(pos))
+ );
+ row += cell.attrs.rowspan - 1;
+ } else {
+ const type = refColumn == null ? tableNodeTypes(table.type.schema).cell : table.nodeAt(map5.map[index2 + refColumn]).type;
+ const pos = map5.positionAt(row, col, table);
+ tr.insert(tr.mapping.map(tableStart + pos), type.createAndFill());
+ }
+ }
+ return tr;
+ }
+ function addColumnBefore(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ if (dispatch) {
+ const rect = selectedRect(state);
+ dispatch(addColumn(state.tr, rect, rect.left));
+ }
+ return true;
+ }
+ function addColumnAfter(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ if (dispatch) {
+ const rect = selectedRect(state);
+ dispatch(addColumn(state.tr, rect, rect.right));
+ }
+ return true;
+ }
+ function removeColumn(tr, { map: map5, table, tableStart }, col) {
+ const mapStart = tr.mapping.maps.length;
+ for (let row = 0; row < map5.height; ) {
+ const index2 = row * map5.width + col;
+ const pos = map5.map[index2];
+ const cell = table.nodeAt(pos);
+ const attrs = cell.attrs;
+ if (col > 0 && map5.map[index2 - 1] == pos || col < map5.width - 1 && map5.map[index2 + 1] == pos) {
+ tr.setNodeMarkup(
+ tr.mapping.slice(mapStart).map(tableStart + pos),
+ null,
+ removeColSpan(attrs, col - map5.colCount(pos))
+ );
+ } else {
+ const start = tr.mapping.slice(mapStart).map(tableStart + pos);
+ tr.delete(start, start + cell.nodeSize);
+ }
+ row += attrs.rowspan;
+ }
+ }
+ function deleteColumn(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ if (dispatch) {
+ const rect = selectedRect(state);
+ const tr = state.tr;
+ if (rect.left == 0 && rect.right == rect.map.width)
+ return false;
+ for (let i2 = rect.right - 1; ; i2--) {
+ removeColumn(tr, rect, i2);
+ if (i2 == rect.left)
+ break;
+ const table = rect.tableStart ? tr.doc.nodeAt(rect.tableStart - 1) : tr.doc;
+ if (!table) {
+ throw RangeError("No table found");
+ }
+ rect.table = table;
+ rect.map = TableMap.get(table);
+ }
+ dispatch(tr);
+ }
+ return true;
+ }
+ function removeRow(tr, { map: map5, table, tableStart }, row) {
+ let rowPos = 0;
+ for (let i2 = 0; i2 < row; i2++)
+ rowPos += table.child(i2).nodeSize;
+ const nextRow = rowPos + table.child(row).nodeSize;
+ const mapFrom = tr.mapping.maps.length;
+ tr.delete(rowPos + tableStart, nextRow + tableStart);
+ const seen = /* @__PURE__ */ new Set();
+ for (let col = 0, index2 = row * map5.width; col < map5.width; col++, index2++) {
+ const pos = map5.map[index2];
+ if (seen.has(pos))
+ continue;
+ seen.add(pos);
+ if (row > 0 && pos == map5.map[index2 - map5.width]) {
+ const attrs = table.nodeAt(pos).attrs;
+ tr.setNodeMarkup(tr.mapping.slice(mapFrom).map(pos + tableStart), null, __spreadProps(__spreadValues({}, attrs), {
+ rowspan: attrs.rowspan - 1
+ }));
+ col += attrs.colspan - 1;
+ } else if (row < map5.height && pos == map5.map[index2 + map5.width]) {
+ const cell = table.nodeAt(pos);
+ const attrs = cell.attrs;
+ const copy2 = cell.type.create(
+ __spreadProps(__spreadValues({}, attrs), { rowspan: cell.attrs.rowspan - 1 }),
+ cell.content
+ );
+ const newPos = map5.positionAt(row + 1, col, table);
+ tr.insert(tr.mapping.slice(mapFrom).map(tableStart + newPos), copy2);
+ col += attrs.colspan - 1;
+ }
+ }
+ }
+ function deleteRow(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ if (dispatch) {
+ const rect = selectedRect(state), tr = state.tr;
+ if (rect.top == 0 && rect.bottom == rect.map.height)
+ return false;
+ for (let i2 = rect.bottom - 1; ; i2--) {
+ removeRow(tr, rect, i2);
+ if (i2 == rect.top)
+ break;
+ const table = rect.tableStart ? tr.doc.nodeAt(rect.tableStart - 1) : tr.doc;
+ if (!table) {
+ throw RangeError("No table found");
+ }
+ rect.table = table;
+ rect.map = TableMap.get(rect.table);
+ }
+ dispatch(tr);
+ }
+ return true;
+ }
+ function setCellAttr(name, value) {
+ return function(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ const $cell = selectionCell(state);
+ if ($cell.nodeAfter.attrs[name] === value)
+ return false;
+ if (dispatch) {
+ const tr = state.tr;
+ if (state.selection instanceof CellSelection)
+ state.selection.forEachCell((node2, pos) => {
+ if (node2.attrs[name] !== value)
+ tr.setNodeMarkup(pos, null, __spreadProps(__spreadValues({}, node2.attrs), {
+ [name]: value
+ }));
+ });
+ else
+ tr.setNodeMarkup($cell.pos, null, __spreadProps(__spreadValues({}, $cell.nodeAfter.attrs), {
+ [name]: value
+ }));
+ dispatch(tr);
+ }
+ return true;
+ };
+ }
+ function deprecated_toggleHeader(type) {
+ return function(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ if (dispatch) {
+ const types = tableNodeTypes(state.schema);
+ const rect = selectedRect(state), tr = state.tr;
+ const cells = rect.map.cellsInRect(
+ type == "column" ? {
+ left: rect.left,
+ top: 0,
+ right: rect.right,
+ bottom: rect.map.height
+ } : type == "row" ? {
+ left: 0,
+ top: rect.top,
+ right: rect.map.width,
+ bottom: rect.bottom
+ } : rect
+ );
+ const nodes = cells.map((pos) => rect.table.nodeAt(pos));
+ for (let i2 = 0; i2 < cells.length; i2++)
+ if (nodes[i2].type == types.header_cell)
+ tr.setNodeMarkup(
+ rect.tableStart + cells[i2],
+ types.cell,
+ nodes[i2].attrs
+ );
+ if (tr.steps.length == 0)
+ for (let i2 = 0; i2 < cells.length; i2++)
+ tr.setNodeMarkup(
+ rect.tableStart + cells[i2],
+ types.header_cell,
+ nodes[i2].attrs
+ );
+ dispatch(tr);
+ }
+ return true;
+ };
+ }
+ function isHeaderEnabledByType(type, rect, types) {
+ const cellPositions = rect.map.cellsInRect({
+ left: 0,
+ top: 0,
+ right: type == "row" ? rect.map.width : 1,
+ bottom: type == "column" ? rect.map.height : 1
+ });
+ for (let i2 = 0; i2 < cellPositions.length; i2++) {
+ const cell = rect.table.nodeAt(cellPositions[i2]);
+ if (cell && cell.type !== types.header_cell) {
+ return false;
+ }
+ }
+ return true;
+ }
+ function toggleHeader(type, options2) {
+ options2 = options2 || { useDeprecatedLogic: false };
+ if (options2.useDeprecatedLogic)
+ return deprecated_toggleHeader(type);
+ return function(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ if (dispatch) {
+ const types = tableNodeTypes(state.schema);
+ const rect = selectedRect(state), tr = state.tr;
+ const isHeaderRowEnabled = isHeaderEnabledByType("row", rect, types);
+ const isHeaderColumnEnabled = isHeaderEnabledByType(
+ "column",
+ rect,
+ types
+ );
+ const isHeaderEnabled = type === "column" ? isHeaderRowEnabled : type === "row" ? isHeaderColumnEnabled : false;
+ const selectionStartsAt = isHeaderEnabled ? 1 : 0;
+ const cellsRect = type == "column" ? {
+ left: 0,
+ top: selectionStartsAt,
+ right: 1,
+ bottom: rect.map.height
+ } : type == "row" ? {
+ left: selectionStartsAt,
+ top: 0,
+ right: rect.map.width,
+ bottom: 1
+ } : rect;
+ const newType = type == "column" ? isHeaderColumnEnabled ? types.cell : types.header_cell : type == "row" ? isHeaderRowEnabled ? types.cell : types.header_cell : types.cell;
+ rect.map.cellsInRect(cellsRect).forEach((relativeCellPos) => {
+ const cellPos = relativeCellPos + rect.tableStart;
+ const cell = tr.doc.nodeAt(cellPos);
+ if (cell) {
+ tr.setNodeMarkup(cellPos, newType, cell.attrs);
+ }
+ });
+ dispatch(tr);
+ }
+ return true;
+ };
+ }
+ var toggleHeaderRow = toggleHeader("row", {
+ useDeprecatedLogic: true
+ });
+ var toggleHeaderColumn = toggleHeader("column", {
+ useDeprecatedLogic: true
+ });
+ var toggleHeaderCell = toggleHeader("cell", {
+ useDeprecatedLogic: true
+ });
+ function findNextCell($cell, dir) {
+ if (dir < 0) {
+ const before = $cell.nodeBefore;
+ if (before)
+ return $cell.pos - before.nodeSize;
+ for (let row = $cell.index(-1) - 1, rowEnd = $cell.before(); row >= 0; row--) {
+ const rowNode = $cell.node(-1).child(row);
+ const lastChild = rowNode.lastChild;
+ if (lastChild) {
+ return rowEnd - 1 - lastChild.nodeSize;
+ }
+ rowEnd -= rowNode.nodeSize;
+ }
+ } else {
+ if ($cell.index() < $cell.parent.childCount - 1) {
+ return $cell.pos + $cell.nodeAfter.nodeSize;
+ }
+ const table = $cell.node(-1);
+ for (let row = $cell.indexAfter(-1), rowStart = $cell.after(); row < table.childCount; row++) {
+ const rowNode = table.child(row);
+ if (rowNode.childCount)
+ return rowStart + 1;
+ rowStart += rowNode.nodeSize;
+ }
+ }
+ return null;
+ }
+ function goToNextCell(direction) {
+ return function(state, dispatch) {
+ if (!isInTable(state))
+ return false;
+ const cell = findNextCell(selectionCell(state), direction);
+ if (cell == null)
+ return false;
+ if (dispatch) {
+ const $cell = state.doc.resolve(cell);
+ dispatch(
+ state.tr.setSelection(TextSelection.between($cell, moveCellForward($cell))).scrollIntoView()
+ );
+ }
+ return true;
+ };
+ }
+ function deleteTable(state, dispatch) {
+ const $pos = state.selection.$anchor;
+ for (let d6 = $pos.depth; d6 > 0; d6--) {
+ const node2 = $pos.node(d6);
+ if (node2.type.spec.tableRole == "table") {
+ if (dispatch)
+ dispatch(
+ state.tr.delete($pos.before(d6), $pos.after(d6)).scrollIntoView()
+ );
+ return true;
+ }
+ }
+ return false;
+ }
+ function tableEditing({
+ allowTableNodeSelection = false
+ } = {}) {
+ return new Plugin({
+ key: tableEditingKey,
+ // This piece of state is used to remember when a mouse-drag
+ // cell-selection is happening, so that it can continue even as
+ // transactions (which might move its anchor cell) come in.
+ state: {
+ init() {
+ return null;
+ },
+ apply(tr, cur) {
+ const set = tr.getMeta(tableEditingKey);
+ if (set != null)
+ return set == -1 ? null : set;
+ if (cur == null || !tr.docChanged)
+ return cur;
+ const { deleted, pos } = tr.mapping.mapResult(cur);
+ return deleted ? null : pos;
+ }
+ },
+ props: {
+ decorations: drawCellSelection,
+ handleDOMEvents: {
+ mousedown: handleMouseDown
+ },
+ createSelectionBetween(view) {
+ return tableEditingKey.getState(view.state) != null ? view.state.selection : null;
+ },
+ handleTripleClick: handleTripleClick2,
+ handleKeyDown,
+ handlePaste
+ },
+ appendTransaction(_3, oldState, state) {
+ return normalizeSelection(
+ state,
+ fixTables(state, oldState),
+ allowTableNodeSelection
+ );
+ }
+ });
+ }
+
+ // node_modules/ccount/index.js
+ function ccount(value, character) {
+ const source = String(value);
+ if (typeof character !== "string") {
+ throw new TypeError("Expected character");
+ }
+ let count = 0;
+ let index2 = source.indexOf(character);
+ while (index2 !== -1) {
+ count++;
+ index2 = source.indexOf(character, index2 + character.length);
+ }
+ return count;
+ }
+
+ // node_modules/mdast-util-find-and-replace/lib/index.js
+ function findAndReplace(tree, list4, options2) {
+ const settings = options2 || {};
+ const ignored = convert(settings.ignore || []);
+ const pairs = toPairs(list4);
+ let pairIndex = -1;
+ while (++pairIndex < pairs.length) {
+ visitParents(tree, "text", visitor);
+ }
+ function visitor(node2, parents) {
+ let index2 = -1;
+ let grandparent;
+ while (++index2 < parents.length) {
+ const parent = parents[index2];
+ const siblings = grandparent ? grandparent.children : void 0;
+ if (ignored(
+ parent,
+ siblings ? siblings.indexOf(parent) : void 0,
+ grandparent
+ )) {
+ return;
+ }
+ grandparent = parent;
+ }
+ if (grandparent) {
+ return handler(node2, parents);
+ }
+ }
+ function handler(node2, parents) {
+ const parent = parents[parents.length - 1];
+ const find = pairs[pairIndex][0];
+ const replace3 = pairs[pairIndex][1];
+ let start = 0;
+ const siblings = parent.children;
+ const index2 = siblings.indexOf(node2);
+ let change = false;
+ let nodes = [];
+ find.lastIndex = 0;
+ let match = find.exec(node2.value);
+ while (match) {
+ const position2 = match.index;
+ const matchObject = {
+ index: match.index,
+ input: match.input,
+ stack: [...parents, node2]
+ };
+ let value = replace3(...match, matchObject);
+ if (typeof value === "string") {
+ value = value.length > 0 ? { type: "text", value } : void 0;
+ }
+ if (value === false) {
+ find.lastIndex = position2 + 1;
+ } else {
+ if (start !== position2) {
+ nodes.push({
+ type: "text",
+ value: node2.value.slice(start, position2)
+ });
+ }
+ if (Array.isArray(value)) {
+ nodes.push(...value);
+ } else if (value) {
+ nodes.push(value);
+ }
+ start = position2 + match[0].length;
+ change = true;
+ }
+ if (!find.global) {
+ break;
+ }
+ match = find.exec(node2.value);
+ }
+ if (change) {
+ if (start < node2.value.length) {
+ nodes.push({ type: "text", value: node2.value.slice(start) });
+ }
+ parent.children.splice(index2, 1, ...nodes);
+ } else {
+ nodes = [node2];
+ }
+ return index2 + nodes.length;
+ }
+ }
+ function toPairs(tupleOrList) {
+ const result = [];
+ if (!Array.isArray(tupleOrList)) {
+ throw new TypeError("Expected find and replace tuple or list of tuples");
+ }
+ const list4 = !tupleOrList[0] || Array.isArray(tupleOrList[0]) ? tupleOrList : [tupleOrList];
+ let index2 = -1;
+ while (++index2 < list4.length) {
+ const tuple = list4[index2];
+ result.push([toExpression(tuple[0]), toFunction(tuple[1])]);
+ }
+ return result;
+ }
+ function toExpression(find) {
+ return typeof find === "string" ? new RegExp(escapeStringRegexp(find), "g") : find;
+ }
+ function toFunction(replace3) {
+ return typeof replace3 === "function" ? replace3 : function() {
+ return replace3;
+ };
+ }
+
+ // node_modules/mdast-util-gfm-autolink-literal/lib/index.js
+ var inConstruct = "phrasing";
+ var notInConstruct = ["autolink", "link", "image", "label"];
+ function gfmAutolinkLiteralFromMarkdown() {
+ return {
+ transforms: [transformGfmAutolinkLiterals],
+ enter: {
+ literalAutolink: enterLiteralAutolink,
+ literalAutolinkEmail: enterLiteralAutolinkValue,
+ literalAutolinkHttp: enterLiteralAutolinkValue,
+ literalAutolinkWww: enterLiteralAutolinkValue
+ },
+ exit: {
+ literalAutolink: exitLiteralAutolink,
+ literalAutolinkEmail: exitLiteralAutolinkEmail,
+ literalAutolinkHttp: exitLiteralAutolinkHttp,
+ literalAutolinkWww: exitLiteralAutolinkWww
+ }
+ };
+ }
+ function gfmAutolinkLiteralToMarkdown() {
+ return {
+ unsafe: [
+ {
+ character: "@",
+ before: "[+\\-.\\w]",
+ after: "[\\-.\\w]",
+ inConstruct,
+ notInConstruct
+ },
+ {
+ character: ".",
+ before: "[Ww]",
+ after: "[\\-.\\w]",
+ inConstruct,
+ notInConstruct
+ },
+ {
+ character: ":",
+ before: "[ps]",
+ after: "\\/",
+ inConstruct,
+ notInConstruct
+ }
+ ]
+ };
+ }
+ function enterLiteralAutolink(token) {
+ this.enter({ type: "link", title: null, url: "", children: [] }, token);
+ }
+ function enterLiteralAutolinkValue(token) {
+ this.config.enter.autolinkProtocol.call(this, token);
+ }
+ function exitLiteralAutolinkHttp(token) {
+ this.config.exit.autolinkProtocol.call(this, token);
+ }
+ function exitLiteralAutolinkWww(token) {
+ this.config.exit.data.call(this, token);
+ const node2 = this.stack[this.stack.length - 1];
+ ok2(node2.type === "link");
+ node2.url = "http://" + this.sliceSerialize(token);
+ }
+ function exitLiteralAutolinkEmail(token) {
+ this.config.exit.autolinkEmail.call(this, token);
+ }
+ function exitLiteralAutolink(token) {
+ this.exit(token);
+ }
+ function transformGfmAutolinkLiterals(tree) {
+ findAndReplace(
+ tree,
+ [
+ [/(https?:\/\/|www(?=\.))([-.\w]+)([^ \t\r\n]*)/gi, findUrl],
+ [/([-.\w+]+)@([-\w]+(?:\.[-\w]+)+)/g, findEmail]
+ ],
+ { ignore: ["link", "linkReference"] }
+ );
+ }
+ function findUrl(_3, protocol, domain2, path3, match) {
+ let prefix = "";
+ if (!previous2(match)) {
+ return false;
+ }
+ if (/^w/i.test(protocol)) {
+ domain2 = protocol + domain2;
+ protocol = "";
+ prefix = "http://";
+ }
+ if (!isCorrectDomain(domain2)) {
+ return false;
+ }
+ const parts = splitUrl(domain2 + path3);
+ if (!parts[0]) return false;
+ const result = {
+ type: "link",
+ title: null,
+ url: prefix + protocol + parts[0],
+ children: [{ type: "text", value: protocol + parts[0] }]
+ };
+ if (parts[1]) {
+ return [result, { type: "text", value: parts[1] }];
+ }
+ return result;
+ }
+ function findEmail(_3, atext, label, match) {
+ if (
+ // Not an expected previous character.
+ !previous2(match, true) || // Label ends in not allowed character.
+ /[-\d_]$/.test(label)
+ ) {
+ return false;
+ }
+ return {
+ type: "link",
+ title: null,
+ url: "mailto:" + atext + "@" + label,
+ children: [{ type: "text", value: atext + "@" + label }]
+ };
+ }
+ function isCorrectDomain(domain2) {
+ const parts = domain2.split(".");
+ if (parts.length < 2 || parts[parts.length - 1] && (/_/.test(parts[parts.length - 1]) || !/[a-zA-Z\d]/.test(parts[parts.length - 1])) || parts[parts.length - 2] && (/_/.test(parts[parts.length - 2]) || !/[a-zA-Z\d]/.test(parts[parts.length - 2]))) {
+ return false;
+ }
+ return true;
+ }
+ function splitUrl(url) {
+ const trailExec = /[!"&'),.:;<>?\]}]+$/.exec(url);
+ if (!trailExec) {
+ return [url, void 0];
+ }
+ url = url.slice(0, trailExec.index);
+ let trail2 = trailExec[0];
+ let closingParenIndex = trail2.indexOf(")");
+ const openingParens = ccount(url, "(");
+ let closingParens = ccount(url, ")");
+ while (closingParenIndex !== -1 && openingParens > closingParens) {
+ url += trail2.slice(0, closingParenIndex + 1);
+ trail2 = trail2.slice(closingParenIndex + 1);
+ closingParenIndex = trail2.indexOf(")");
+ closingParens++;
+ }
+ return [url, trail2];
+ }
+ function previous2(match, email) {
+ const code3 = match.input.charCodeAt(match.index - 1);
+ return (match.index === 0 || unicodeWhitespace(code3) || unicodePunctuation(code3)) && (!email || code3 !== 47);
+ }
+
+ // node_modules/mdast-util-gfm-footnote/lib/index.js
+ footnoteReference.peek = footnoteReferencePeek;
+ function gfmFootnoteFromMarkdown() {
+ return {
+ enter: {
+ gfmFootnoteDefinition: enterFootnoteDefinition,
+ gfmFootnoteDefinitionLabelString: enterFootnoteDefinitionLabelString,
+ gfmFootnoteCall: enterFootnoteCall,
+ gfmFootnoteCallString: enterFootnoteCallString
+ },
+ exit: {
+ gfmFootnoteDefinition: exitFootnoteDefinition,
+ gfmFootnoteDefinitionLabelString: exitFootnoteDefinitionLabelString,
+ gfmFootnoteCall: exitFootnoteCall,
+ gfmFootnoteCallString: exitFootnoteCallString
+ }
+ };
+ }
+ function gfmFootnoteToMarkdown() {
+ return {
+ // This is on by default already.
+ unsafe: [{ character: "[", inConstruct: ["phrasing", "label", "reference"] }],
+ handlers: { footnoteDefinition, footnoteReference }
+ };
+ }
+ function enterFootnoteDefinition(token) {
+ this.enter(
+ { type: "footnoteDefinition", identifier: "", label: "", children: [] },
+ token
+ );
+ }
+ function enterFootnoteDefinitionLabelString() {
+ this.buffer();
+ }
+ function exitFootnoteDefinitionLabelString(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ ok2(node2.type === "footnoteDefinition");
+ node2.label = label;
+ node2.identifier = normalizeIdentifier(
+ this.sliceSerialize(token)
+ ).toLowerCase();
+ }
+ function exitFootnoteDefinition(token) {
+ this.exit(token);
+ }
+ function enterFootnoteCall(token) {
+ this.enter({ type: "footnoteReference", identifier: "", label: "" }, token);
+ }
+ function enterFootnoteCallString() {
+ this.buffer();
+ }
+ function exitFootnoteCallString(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ ok2(node2.type === "footnoteReference");
+ node2.label = label;
+ node2.identifier = normalizeIdentifier(
+ this.sliceSerialize(token)
+ ).toLowerCase();
+ }
+ function exitFootnoteCall(token) {
+ this.exit(token);
+ }
+ function footnoteReference(node2, _3, state, info) {
+ const tracker = state.createTracker(info);
+ let value = tracker.move("[^");
+ const exit3 = state.enter("footnoteReference");
+ const subexit = state.enter("reference");
+ value += tracker.move(
+ state.safe(state.associationId(node2), __spreadProps(__spreadValues({}, tracker.current()), {
+ before: value,
+ after: "]"
+ }))
+ );
+ subexit();
+ exit3();
+ value += tracker.move("]");
+ return value;
+ }
+ function footnoteReferencePeek() {
+ return "[";
+ }
+ function footnoteDefinition(node2, _3, state, info) {
+ const tracker = state.createTracker(info);
+ let value = tracker.move("[^");
+ const exit3 = state.enter("footnoteDefinition");
+ const subexit = state.enter("label");
+ value += tracker.move(
+ state.safe(state.associationId(node2), __spreadProps(__spreadValues({}, tracker.current()), {
+ before: value,
+ after: "]"
+ }))
+ );
+ subexit();
+ value += tracker.move(
+ "]:" + (node2.children && node2.children.length > 0 ? " " : "")
+ );
+ tracker.shift(4);
+ value += tracker.move(
+ state.indentLines(state.containerFlow(node2, tracker.current()), map4)
+ );
+ exit3();
+ return value;
+ }
+ function map4(line, index2, blank) {
+ if (index2 === 0) {
+ return line;
+ }
+ return (blank ? "" : " ") + line;
+ }
+
+ // node_modules/mdast-util-gfm-strikethrough/lib/index.js
+ var constructsWithoutStrikethrough = [
+ "autolink",
+ "destinationLiteral",
+ "destinationRaw",
+ "reference",
+ "titleQuote",
+ "titleApostrophe"
+ ];
+ handleDelete.peek = peekDelete;
+ function gfmStrikethroughFromMarkdown() {
+ return {
+ canContainEols: ["delete"],
+ enter: { strikethrough: enterStrikethrough },
+ exit: { strikethrough: exitStrikethrough }
+ };
+ }
+ function gfmStrikethroughToMarkdown() {
+ return {
+ unsafe: [
+ {
+ character: "~",
+ inConstruct: "phrasing",
+ notInConstruct: constructsWithoutStrikethrough
+ }
+ ],
+ handlers: { delete: handleDelete }
+ };
+ }
+ function enterStrikethrough(token) {
+ this.enter({ type: "delete", children: [] }, token);
+ }
+ function exitStrikethrough(token) {
+ this.exit(token);
+ }
+ function handleDelete(node2, _3, state, info) {
+ const tracker = state.createTracker(info);
+ const exit3 = state.enter("strikethrough");
+ let value = tracker.move("~~");
+ value += state.containerPhrasing(node2, __spreadProps(__spreadValues({}, tracker.current()), {
+ before: value,
+ after: "~"
+ }));
+ value += tracker.move("~~");
+ exit3();
+ return value;
+ }
+ function peekDelete() {
+ return "~";
+ }
+
+ // node_modules/markdown-table/index.js
+ function markdownTable(table, options2 = {}) {
+ const align = (options2.align || []).concat();
+ const stringLength = options2.stringLength || defaultStringLength;
+ const alignments = [];
+ const cellMatrix = [];
+ const sizeMatrix = [];
+ const longestCellByColumn = [];
+ let mostCellsPerRow = 0;
+ let rowIndex = -1;
+ while (++rowIndex < table.length) {
+ const row2 = [];
+ const sizes2 = [];
+ let columnIndex2 = -1;
+ if (table[rowIndex].length > mostCellsPerRow) {
+ mostCellsPerRow = table[rowIndex].length;
+ }
+ while (++columnIndex2 < table[rowIndex].length) {
+ const cell = serialize(table[rowIndex][columnIndex2]);
+ if (options2.alignDelimiters !== false) {
+ const size = stringLength(cell);
+ sizes2[columnIndex2] = size;
+ if (longestCellByColumn[columnIndex2] === void 0 || size > longestCellByColumn[columnIndex2]) {
+ longestCellByColumn[columnIndex2] = size;
+ }
+ }
+ row2.push(cell);
+ }
+ cellMatrix[rowIndex] = row2;
+ sizeMatrix[rowIndex] = sizes2;
+ }
+ let columnIndex = -1;
+ if (typeof align === "object" && "length" in align) {
+ while (++columnIndex < mostCellsPerRow) {
+ alignments[columnIndex] = toAlignment(align[columnIndex]);
+ }
+ } else {
+ const code3 = toAlignment(align);
+ while (++columnIndex < mostCellsPerRow) {
+ alignments[columnIndex] = code3;
+ }
+ }
+ columnIndex = -1;
+ const row = [];
+ const sizes = [];
+ while (++columnIndex < mostCellsPerRow) {
+ const code3 = alignments[columnIndex];
+ let before = "";
+ let after = "";
+ if (code3 === 99) {
+ before = ":";
+ after = ":";
+ } else if (code3 === 108) {
+ before = ":";
+ } else if (code3 === 114) {
+ after = ":";
+ }
+ let size = options2.alignDelimiters === false ? 1 : Math.max(
+ 1,
+ longestCellByColumn[columnIndex] - before.length - after.length
+ );
+ const cell = before + "-".repeat(size) + after;
+ if (options2.alignDelimiters !== false) {
+ size = before.length + size + after.length;
+ if (size > longestCellByColumn[columnIndex]) {
+ longestCellByColumn[columnIndex] = size;
+ }
+ sizes[columnIndex] = size;
+ }
+ row[columnIndex] = cell;
+ }
+ cellMatrix.splice(1, 0, row);
+ sizeMatrix.splice(1, 0, sizes);
+ rowIndex = -1;
+ const lines = [];
+ while (++rowIndex < cellMatrix.length) {
+ const row2 = cellMatrix[rowIndex];
+ const sizes2 = sizeMatrix[rowIndex];
+ columnIndex = -1;
+ const line = [];
+ while (++columnIndex < mostCellsPerRow) {
+ const cell = row2[columnIndex] || "";
+ let before = "";
+ let after = "";
+ if (options2.alignDelimiters !== false) {
+ const size = longestCellByColumn[columnIndex] - (sizes2[columnIndex] || 0);
+ const code3 = alignments[columnIndex];
+ if (code3 === 114) {
+ before = " ".repeat(size);
+ } else if (code3 === 99) {
+ if (size % 2) {
+ before = " ".repeat(size / 2 + 0.5);
+ after = " ".repeat(size / 2 - 0.5);
+ } else {
+ before = " ".repeat(size / 2);
+ after = before;
+ }
+ } else {
+ after = " ".repeat(size);
+ }
+ }
+ if (options2.delimiterStart !== false && !columnIndex) {
+ line.push("|");
+ }
+ if (options2.padding !== false && // Don’t add the opening space if we’re not aligning and the cell is
+ // empty: there will be a closing space.
+ !(options2.alignDelimiters === false && cell === "") && (options2.delimiterStart !== false || columnIndex)) {
+ line.push(" ");
+ }
+ if (options2.alignDelimiters !== false) {
+ line.push(before);
+ }
+ line.push(cell);
+ if (options2.alignDelimiters !== false) {
+ line.push(after);
+ }
+ if (options2.padding !== false) {
+ line.push(" ");
+ }
+ if (options2.delimiterEnd !== false || columnIndex !== mostCellsPerRow - 1) {
+ line.push("|");
+ }
+ }
+ lines.push(
+ options2.delimiterEnd === false ? line.join("").replace(/ +$/, "") : line.join("")
+ );
+ }
+ return lines.join("\n");
+ }
+ function serialize(value) {
+ return value === null || value === void 0 ? "" : String(value);
+ }
+ function defaultStringLength(value) {
+ return value.length;
+ }
+ function toAlignment(value) {
+ const code3 = typeof value === "string" ? value.codePointAt(0) : 0;
+ return code3 === 67 || code3 === 99 ? 99 : code3 === 76 || code3 === 108 ? 108 : code3 === 82 || code3 === 114 ? 114 : 0;
+ }
+
+ // node_modules/mdast-util-gfm-table/lib/index.js
+ function gfmTableFromMarkdown() {
+ return {
+ enter: {
+ table: enterTable,
+ tableData: enterCell,
+ tableHeader: enterCell,
+ tableRow: enterRow
+ },
+ exit: {
+ codeText: exitCodeText,
+ table: exitTable,
+ tableData: exit2,
+ tableHeader: exit2,
+ tableRow: exit2
+ }
+ };
+ }
+ function enterTable(token) {
+ const align = token._align;
+ ok2(align, "expected `_align` on table");
+ this.enter(
+ {
+ type: "table",
+ align: align.map(function(d6) {
+ return d6 === "none" ? null : d6;
+ }),
+ children: []
+ },
+ token
+ );
+ this.data.inTable = true;
+ }
+ function exitTable(token) {
+ this.exit(token);
+ this.data.inTable = void 0;
+ }
+ function enterRow(token) {
+ this.enter({ type: "tableRow", children: [] }, token);
+ }
+ function exit2(token) {
+ this.exit(token);
+ }
+ function enterCell(token) {
+ this.enter({ type: "tableCell", children: [] }, token);
+ }
+ function exitCodeText(token) {
+ let value = this.resume();
+ if (this.data.inTable) {
+ value = value.replace(/\\([\\|])/g, replace2);
+ }
+ const node2 = this.stack[this.stack.length - 1];
+ ok2(node2.type === "inlineCode");
+ node2.value = value;
+ this.exit(token);
+ }
+ function replace2($0, $1) {
+ return $1 === "|" ? $1 : $0;
+ }
+ function gfmTableToMarkdown(options2) {
+ const settings = options2 || {};
+ const padding = settings.tableCellPadding;
+ const alignDelimiters = settings.tablePipeAlign;
+ const stringLength = settings.stringLength;
+ const around = padding ? " " : "|";
+ return {
+ unsafe: [
+ { character: "\r", inConstruct: "tableCell" },
+ { character: "\n", inConstruct: "tableCell" },
+ // A pipe, when followed by a tab or space (padding), or a dash or colon
+ // (unpadded delimiter row), could result in a table.
+ { atBreak: true, character: "|", after: "[ :-]" },
+ // A pipe in a cell must be encoded.
+ { character: "|", inConstruct: "tableCell" },
+ // A colon must be followed by a dash, in which case it could start a
+ // delimiter row.
+ { atBreak: true, character: ":", after: "-" },
+ // A delimiter row can also start with a dash, when followed by more
+ // dashes, a colon, or a pipe.
+ // This is a stricter version than the built in check for lists, thematic
+ // breaks, and setex heading underlines though:
+ // <https://github.com/syntax-tree/mdast-util-to-markdown/blob/51a2038/lib/unsafe.js#L57>
+ { atBreak: true, character: "-", after: "[:|-]" }
+ ],
+ handlers: {
+ inlineCode: inlineCodeWithTable,
+ table: handleTable,
+ tableCell: handleTableCell,
+ tableRow: handleTableRow
+ }
+ };
+ function handleTable(node2, _3, state, info) {
+ return serializeData(handleTableAsData(node2, state, info), node2.align);
+ }
+ function handleTableRow(node2, _3, state, info) {
+ const row = handleTableRowAsData(node2, state, info);
+ const value = serializeData([row]);
+ return value.slice(0, value.indexOf("\n"));
+ }
+ function handleTableCell(node2, _3, state, info) {
+ const exit3 = state.enter("tableCell");
+ const subexit = state.enter("phrasing");
+ const value = state.containerPhrasing(node2, __spreadProps(__spreadValues({}, info), {
+ before: around,
+ after: around
+ }));
+ subexit();
+ exit3();
+ return value;
+ }
+ function serializeData(matrix, align) {
+ return markdownTable(matrix, {
+ align,
+ // @ts-expect-error: `markdown-table` types should support `null`.
+ alignDelimiters,
+ // @ts-expect-error: `markdown-table` types should support `null`.
+ padding,
+ // @ts-expect-error: `markdown-table` types should support `null`.
+ stringLength
+ });
+ }
+ function handleTableAsData(node2, state, info) {
+ const children = node2.children;
+ let index2 = -1;
+ const result = [];
+ const subexit = state.enter("table");
+ while (++index2 < children.length) {
+ result[index2] = handleTableRowAsData(children[index2], state, info);
+ }
+ subexit();
+ return result;
+ }
+ function handleTableRowAsData(node2, state, info) {
+ const children = node2.children;
+ let index2 = -1;
+ const result = [];
+ const subexit = state.enter("tableRow");
+ while (++index2 < children.length) {
+ result[index2] = handleTableCell(children[index2], node2, state, info);
+ }
+ subexit();
+ return result;
+ }
+ function inlineCodeWithTable(node2, parent, state) {
+ let value = handle.inlineCode(node2, parent, state);
+ if (state.stack.includes("tableCell")) {
+ value = value.replace(/\|/g, "\\$&");
+ }
+ return value;
+ }
+ }
+
+ // node_modules/mdast-util-gfm-task-list-item/lib/index.js
+ function gfmTaskListItemFromMarkdown() {
+ return {
+ exit: {
+ taskListCheckValueChecked: exitCheck,
+ taskListCheckValueUnchecked: exitCheck,
+ paragraph: exitParagraphWithTaskListItem
+ }
+ };
+ }
+ function gfmTaskListItemToMarkdown() {
+ return {
+ unsafe: [{ atBreak: true, character: "-", after: "[:|-]" }],
+ handlers: { listItem: listItemWithTaskListItem }
+ };
+ }
+ function exitCheck(token) {
+ const node2 = this.stack[this.stack.length - 2];
+ ok2(node2.type === "listItem");
+ node2.checked = token.type === "taskListCheckValueChecked";
+ }
+ function exitParagraphWithTaskListItem(token) {
+ const parent = this.stack[this.stack.length - 2];
+ if (parent && parent.type === "listItem" && typeof parent.checked === "boolean") {
+ const node2 = this.stack[this.stack.length - 1];
+ ok2(node2.type === "paragraph");
+ const head = node2.children[0];
+ if (head && head.type === "text") {
+ const siblings = parent.children;
+ let index2 = -1;
+ let firstParaghraph;
+ while (++index2 < siblings.length) {
+ const sibling = siblings[index2];
+ if (sibling.type === "paragraph") {
+ firstParaghraph = sibling;
+ break;
+ }
+ }
+ if (firstParaghraph === node2) {
+ head.value = head.value.slice(1);
+ if (head.value.length === 0) {
+ node2.children.shift();
+ } else if (node2.position && head.position && typeof head.position.start.offset === "number") {
+ head.position.start.column++;
+ head.position.start.offset++;
+ node2.position.start = Object.assign({}, head.position.start);
+ }
+ }
+ }
+ }
+ this.exit(token);
+ }
+ function listItemWithTaskListItem(node2, parent, state, info) {
+ const head = node2.children[0];
+ const checkable = typeof node2.checked === "boolean" && head && head.type === "paragraph";
+ const checkbox = "[" + (node2.checked ? "x" : " ") + "] ";
+ const tracker = state.createTracker(info);
+ if (checkable) {
+ tracker.move(checkbox);
+ }
+ let value = handle.listItem(node2, parent, state, __spreadValues(__spreadValues({}, info), tracker.current()));
+ if (checkable) {
+ value = value.replace(/^(?:[*+-]|\d+\.)([\r\n]| {1,3})/, check);
+ }
+ return value;
+ function check($0) {
+ return $0 + checkbox;
+ }
+ }
+
+ // node_modules/mdast-util-gfm/lib/index.js
+ function gfmFromMarkdown() {
+ return [
+ gfmAutolinkLiteralFromMarkdown(),
+ gfmFootnoteFromMarkdown(),
+ gfmStrikethroughFromMarkdown(),
+ gfmTableFromMarkdown(),
+ gfmTaskListItemFromMarkdown()
+ ];
+ }
+ function gfmToMarkdown(options2) {
+ return {
+ extensions: [
+ gfmAutolinkLiteralToMarkdown(),
+ gfmFootnoteToMarkdown(),
+ gfmStrikethroughToMarkdown(),
+ gfmTableToMarkdown(options2),
+ gfmTaskListItemToMarkdown()
+ ]
+ };
+ }
+
+ // node_modules/micromark-extension-gfm-autolink-literal/lib/syntax.js
+ var wwwPrefix = {
+ tokenize: tokenizeWwwPrefix,
+ partial: true
+ };
+ var domain = {
+ tokenize: tokenizeDomain,
+ partial: true
+ };
+ var path2 = {
+ tokenize: tokenizePath,
+ partial: true
+ };
+ var trail = {
+ tokenize: tokenizeTrail,
+ partial: true
+ };
+ var emailDomainDotTrail = {
+ tokenize: tokenizeEmailDomainDotTrail,
+ partial: true
+ };
+ var wwwAutolink = {
+ tokenize: tokenizeWwwAutolink,
+ previous: previousWww
+ };
+ var protocolAutolink = {
+ tokenize: tokenizeProtocolAutolink,
+ previous: previousProtocol
+ };
+ var emailAutolink = {
+ tokenize: tokenizeEmailAutolink,
+ previous: previousEmail
+ };
+ var text4 = {};
+ function gfmAutolinkLiteral() {
+ return {
+ text: text4
+ };
+ }
+ var code2 = 48;
+ while (code2 < 123) {
+ text4[code2] = emailAutolink;
+ code2++;
+ if (code2 === 58) code2 = 65;
+ else if (code2 === 91) code2 = 97;
+ }
+ text4[43] = emailAutolink;
+ text4[45] = emailAutolink;
+ text4[46] = emailAutolink;
+ text4[95] = emailAutolink;
+ text4[72] = [emailAutolink, protocolAutolink];
+ text4[104] = [emailAutolink, protocolAutolink];
+ text4[87] = [emailAutolink, wwwAutolink];
+ text4[119] = [emailAutolink, wwwAutolink];
+ function tokenizeEmailAutolink(effects, ok3, nok) {
+ const self2 = this;
+ let dot;
+ let data;
+ return start;
+ function start(code3) {
+ if (!gfmAtext(code3) || !previousEmail.call(self2, self2.previous) || previousUnbalanced(self2.events)) {
+ return nok(code3);
+ }
+ effects.enter("literalAutolink");
+ effects.enter("literalAutolinkEmail");
+ return atext(code3);
+ }
+ function atext(code3) {
+ if (gfmAtext(code3)) {
+ effects.consume(code3);
+ return atext;
+ }
+ if (code3 === 64) {
+ effects.consume(code3);
+ return emailDomain;
+ }
+ return nok(code3);
+ }
+ function emailDomain(code3) {
+ if (code3 === 46) {
+ return effects.check(
+ emailDomainDotTrail,
+ emailDomainAfter,
+ emailDomainDot
+ )(code3);
+ }
+ if (code3 === 45 || code3 === 95 || asciiAlphanumeric(code3)) {
+ data = true;
+ effects.consume(code3);
+ return emailDomain;
+ }
+ return emailDomainAfter(code3);
+ }
+ function emailDomainDot(code3) {
+ effects.consume(code3);
+ dot = true;
+ return emailDomain;
+ }
+ function emailDomainAfter(code3) {
+ if (data && dot && asciiAlpha(self2.previous)) {
+ effects.exit("literalAutolinkEmail");
+ effects.exit("literalAutolink");
+ return ok3(code3);
+ }
+ return nok(code3);
+ }
+ }
+ function tokenizeWwwAutolink(effects, ok3, nok) {
+ const self2 = this;
+ return wwwStart;
+ function wwwStart(code3) {
+ if (code3 !== 87 && code3 !== 119 || !previousWww.call(self2, self2.previous) || previousUnbalanced(self2.events)) {
+ return nok(code3);
+ }
+ effects.enter("literalAutolink");
+ effects.enter("literalAutolinkWww");
+ return effects.check(
+ wwwPrefix,
+ effects.attempt(domain, effects.attempt(path2, wwwAfter), nok),
+ nok
+ )(code3);
+ }
+ function wwwAfter(code3) {
+ effects.exit("literalAutolinkWww");
+ effects.exit("literalAutolink");
+ return ok3(code3);
+ }
+ }
+ function tokenizeProtocolAutolink(effects, ok3, nok) {
+ const self2 = this;
+ let buffer = "";
+ let seen = false;
+ return protocolStart;
+ function protocolStart(code3) {
+ if ((code3 === 72 || code3 === 104) && previousProtocol.call(self2, self2.previous) && !previousUnbalanced(self2.events)) {
+ effects.enter("literalAutolink");
+ effects.enter("literalAutolinkHttp");
+ buffer += String.fromCodePoint(code3);
+ effects.consume(code3);
+ return protocolPrefixInside;
+ }
+ return nok(code3);
+ }
+ function protocolPrefixInside(code3) {
+ if (asciiAlpha(code3) && buffer.length < 5) {
+ buffer += String.fromCodePoint(code3);
+ effects.consume(code3);
+ return protocolPrefixInside;
+ }
+ if (code3 === 58) {
+ const protocol = buffer.toLowerCase();
+ if (protocol === "http" || protocol === "https") {
+ effects.consume(code3);
+ return protocolSlashesInside;
+ }
+ }
+ return nok(code3);
+ }
+ function protocolSlashesInside(code3) {
+ if (code3 === 47) {
+ effects.consume(code3);
+ if (seen) {
+ return afterProtocol;
+ }
+ seen = true;
+ return protocolSlashesInside;
+ }
+ return nok(code3);
+ }
+ function afterProtocol(code3) {
+ return code3 === null || asciiControl(code3) || markdownLineEndingOrSpace(code3) || unicodeWhitespace(code3) || unicodePunctuation(code3) ? nok(code3) : effects.attempt(domain, effects.attempt(path2, protocolAfter), nok)(code3);
+ }
+ function protocolAfter(code3) {
+ effects.exit("literalAutolinkHttp");
+ effects.exit("literalAutolink");
+ return ok3(code3);
+ }
+ }
+ function tokenizeWwwPrefix(effects, ok3, nok) {
+ let size = 0;
+ return wwwPrefixInside;
+ function wwwPrefixInside(code3) {
+ if ((code3 === 87 || code3 === 119) && size < 3) {
+ size++;
+ effects.consume(code3);
+ return wwwPrefixInside;
+ }
+ if (code3 === 46 && size === 3) {
+ effects.consume(code3);
+ return wwwPrefixAfter;
+ }
+ return nok(code3);
+ }
+ function wwwPrefixAfter(code3) {
+ return code3 === null ? nok(code3) : ok3(code3);
+ }
+ }
+ function tokenizeDomain(effects, ok3, nok) {
+ let underscoreInLastSegment;
+ let underscoreInLastLastSegment;
+ let seen;
+ return domainInside;
+ function domainInside(code3) {
+ if (code3 === 46 || code3 === 95) {
+ return effects.check(trail, domainAfter, domainAtPunctuation)(code3);
+ }
+ if (code3 === null || markdownLineEndingOrSpace(code3) || unicodeWhitespace(code3) || code3 !== 45 && unicodePunctuation(code3)) {
+ return domainAfter(code3);
+ }
+ seen = true;
+ effects.consume(code3);
+ return domainInside;
+ }
+ function domainAtPunctuation(code3) {
+ if (code3 === 95) {
+ underscoreInLastSegment = true;
+ } else {
+ underscoreInLastLastSegment = underscoreInLastSegment;
+ underscoreInLastSegment = void 0;
+ }
+ effects.consume(code3);
+ return domainInside;
+ }
+ function domainAfter(code3) {
+ if (underscoreInLastLastSegment || underscoreInLastSegment || !seen) {
+ return nok(code3);
+ }
+ return ok3(code3);
+ }
+ }
+ function tokenizePath(effects, ok3) {
+ let sizeOpen = 0;
+ let sizeClose = 0;
+ return pathInside;
+ function pathInside(code3) {
+ if (code3 === 40) {
+ sizeOpen++;
+ effects.consume(code3);
+ return pathInside;
+ }
+ if (code3 === 41 && sizeClose < sizeOpen) {
+ return pathAtPunctuation(code3);
+ }
+ if (code3 === 33 || code3 === 34 || code3 === 38 || code3 === 39 || code3 === 41 || code3 === 42 || code3 === 44 || code3 === 46 || code3 === 58 || code3 === 59 || code3 === 60 || code3 === 63 || code3 === 93 || code3 === 95 || code3 === 126) {
+ return effects.check(trail, ok3, pathAtPunctuation)(code3);
+ }
+ if (code3 === null || markdownLineEndingOrSpace(code3) || unicodeWhitespace(code3)) {
+ return ok3(code3);
+ }
+ effects.consume(code3);
+ return pathInside;
+ }
+ function pathAtPunctuation(code3) {
+ if (code3 === 41) {
+ sizeClose++;
+ }
+ effects.consume(code3);
+ return pathInside;
+ }
+ }
+ function tokenizeTrail(effects, ok3, nok) {
+ return trail2;
+ function trail2(code3) {
+ if (code3 === 33 || code3 === 34 || code3 === 39 || code3 === 41 || code3 === 42 || code3 === 44 || code3 === 46 || code3 === 58 || code3 === 59 || code3 === 63 || code3 === 95 || code3 === 126) {
+ effects.consume(code3);
+ return trail2;
+ }
+ if (code3 === 38) {
+ effects.consume(code3);
+ return trailCharRefStart;
+ }
+ if (code3 === 93) {
+ effects.consume(code3);
+ return trailBracketAfter;
+ }
+ if (
+ // `<` is an end.
+ code3 === 60 || // So is whitespace.
+ code3 === null || markdownLineEndingOrSpace(code3) || unicodeWhitespace(code3)
+ ) {
+ return ok3(code3);
+ }
+ return nok(code3);
+ }
+ function trailBracketAfter(code3) {
+ if (code3 === null || code3 === 40 || code3 === 91 || markdownLineEndingOrSpace(code3) || unicodeWhitespace(code3)) {
+ return ok3(code3);
+ }
+ return trail2(code3);
+ }
+ function trailCharRefStart(code3) {
+ return asciiAlpha(code3) ? trailCharRefInside(code3) : nok(code3);
+ }
+ function trailCharRefInside(code3) {
+ if (code3 === 59) {
+ effects.consume(code3);
+ return trail2;
+ }
+ if (asciiAlpha(code3)) {
+ effects.consume(code3);
+ return trailCharRefInside;
+ }
+ return nok(code3);
+ }
+ }
+ function tokenizeEmailDomainDotTrail(effects, ok3, nok) {
+ return start;
+ function start(code3) {
+ effects.consume(code3);
+ return after;
+ }
+ function after(code3) {
+ return asciiAlphanumeric(code3) ? nok(code3) : ok3(code3);
+ }
+ }
+ function previousWww(code3) {
+ return code3 === null || code3 === 40 || code3 === 42 || code3 === 95 || code3 === 91 || code3 === 93 || code3 === 126 || markdownLineEndingOrSpace(code3);
+ }
+ function previousProtocol(code3) {
+ return !asciiAlpha(code3);
+ }
+ function previousEmail(code3) {
+ return !(code3 === 47 || gfmAtext(code3));
+ }
+ function gfmAtext(code3) {
+ return code3 === 43 || code3 === 45 || code3 === 46 || code3 === 95 || asciiAlphanumeric(code3);
+ }
+ function previousUnbalanced(events) {
+ let index2 = events.length;
+ let result = false;
+ while (index2--) {
+ const token = events[index2][1];
+ if ((token.type === "labelLink" || token.type === "labelImage") && !token._balanced) {
+ result = true;
+ break;
+ }
+ if (token._gfmAutolinkLiteralWalkedInto) {
+ result = false;
+ break;
+ }
+ }
+ if (events.length > 0 && !result) {
+ events[events.length - 1][1]._gfmAutolinkLiteralWalkedInto = true;
+ }
+ return result;
+ }
+
+ // node_modules/micromark-extension-gfm-footnote/lib/syntax.js
+ var indent = {
+ tokenize: tokenizeIndent2,
+ partial: true
+ };
+ function gfmFootnote() {
+ return {
+ document: {
+ [91]: {
+ tokenize: tokenizeDefinitionStart,
+ continuation: {
+ tokenize: tokenizeDefinitionContinuation
+ },
+ exit: gfmFootnoteDefinitionEnd
+ }
+ },
+ text: {
+ [91]: {
+ tokenize: tokenizeGfmFootnoteCall
+ },
+ [93]: {
+ add: "after",
+ tokenize: tokenizePotentialGfmFootnoteCall,
+ resolveTo: resolveToPotentialGfmFootnoteCall
+ }
+ }
+ };
+ }
+ function tokenizePotentialGfmFootnoteCall(effects, ok3, nok) {
+ const self2 = this;
+ let index2 = self2.events.length;
+ const defined = self2.parser.gfmFootnotes || (self2.parser.gfmFootnotes = []);
+ let labelStart;
+ while (index2--) {
+ const token = self2.events[index2][1];
+ if (token.type === "labelImage") {
+ labelStart = token;
+ break;
+ }
+ if (token.type === "gfmFootnoteCall" || token.type === "labelLink" || token.type === "label" || token.type === "image" || token.type === "link") {
+ break;
+ }
+ }
+ return start;
+ function start(code3) {
+ if (!labelStart || !labelStart._balanced) {
+ return nok(code3);
+ }
+ const id = normalizeIdentifier(
+ self2.sliceSerialize({
+ start: labelStart.end,
+ end: self2.now()
+ })
+ );
+ if (id.codePointAt(0) !== 94 || !defined.includes(id.slice(1))) {
+ return nok(code3);
+ }
+ effects.enter("gfmFootnoteCallLabelMarker");
+ effects.consume(code3);
+ effects.exit("gfmFootnoteCallLabelMarker");
+ return ok3(code3);
+ }
+ }
+ function resolveToPotentialGfmFootnoteCall(events, context) {
+ let index2 = events.length;
+ let labelStart;
+ while (index2--) {
+ if (events[index2][1].type === "labelImage" && events[index2][0] === "enter") {
+ labelStart = events[index2][1];
+ break;
+ }
+ }
+ events[index2 + 1][1].type = "data";
+ events[index2 + 3][1].type = "gfmFootnoteCallLabelMarker";
+ const call = {
+ type: "gfmFootnoteCall",
+ start: Object.assign({}, events[index2 + 3][1].start),
+ end: Object.assign({}, events[events.length - 1][1].end)
+ };
+ const marker = {
+ type: "gfmFootnoteCallMarker",
+ start: Object.assign({}, events[index2 + 3][1].end),
+ end: Object.assign({}, events[index2 + 3][1].end)
+ };
+ marker.end.column++;
+ marker.end.offset++;
+ marker.end._bufferIndex++;
+ const string3 = {
+ type: "gfmFootnoteCallString",
+ start: Object.assign({}, marker.end),
+ end: Object.assign({}, events[events.length - 1][1].start)
+ };
+ const chunk = {
+ type: "chunkString",
+ contentType: "string",
+ start: Object.assign({}, string3.start),
+ end: Object.assign({}, string3.end)
+ };
+ const replacement = [
+ // Take the `labelImageMarker` (now `data`, the `!`)
+ events[index2 + 1],
+ events[index2 + 2],
+ ["enter", call, context],
+ // The `[`
+ events[index2 + 3],
+ events[index2 + 4],
+ // The `^`.
+ ["enter", marker, context],
+ ["exit", marker, context],
+ // Everything in between.
+ ["enter", string3, context],
+ ["enter", chunk, context],
+ ["exit", chunk, context],
+ ["exit", string3, context],
+ // The ending (`]`, properly parsed and labelled).
+ events[events.length - 2],
+ events[events.length - 1],
+ ["exit", call, context]
+ ];
+ events.splice(index2, events.length - index2 + 1, ...replacement);
+ return events;
+ }
+ function tokenizeGfmFootnoteCall(effects, ok3, nok) {
+ const self2 = this;
+ const defined = self2.parser.gfmFootnotes || (self2.parser.gfmFootnotes = []);
+ let size = 0;
+ let data;
+ return start;
+ function start(code3) {
+ effects.enter("gfmFootnoteCall");
+ effects.enter("gfmFootnoteCallLabelMarker");
+ effects.consume(code3);
+ effects.exit("gfmFootnoteCallLabelMarker");
+ return callStart;
+ }
+ function callStart(code3) {
+ if (code3 !== 94) return nok(code3);
+ effects.enter("gfmFootnoteCallMarker");
+ effects.consume(code3);
+ effects.exit("gfmFootnoteCallMarker");
+ effects.enter("gfmFootnoteCallString");
+ effects.enter("chunkString").contentType = "string";
+ return callData;
+ }
+ function callData(code3) {
+ if (
+ // Too long.
+ size > 999 || // Closing brace with nothing.
+ code3 === 93 && !data || // Space or tab is not supported by GFM for some reason.
+ // `\n` and `[` not being supported makes sense.
+ code3 === null || code3 === 91 || markdownLineEndingOrSpace(code3)
+ ) {
+ return nok(code3);
+ }
+ if (code3 === 93) {
+ effects.exit("chunkString");
+ const token = effects.exit("gfmFootnoteCallString");
+ if (!defined.includes(normalizeIdentifier(self2.sliceSerialize(token)))) {
+ return nok(code3);
+ }
+ effects.enter("gfmFootnoteCallLabelMarker");
+ effects.consume(code3);
+ effects.exit("gfmFootnoteCallLabelMarker");
+ effects.exit("gfmFootnoteCall");
+ return ok3;
+ }
+ if (!markdownLineEndingOrSpace(code3)) {
+ data = true;
+ }
+ size++;
+ effects.consume(code3);
+ return code3 === 92 ? callEscape : callData;
+ }
+ function callEscape(code3) {
+ if (code3 === 91 || code3 === 92 || code3 === 93) {
+ effects.consume(code3);
+ size++;
+ return callData;
+ }
+ return callData(code3);
+ }
+ }
+ function tokenizeDefinitionStart(effects, ok3, nok) {
+ const self2 = this;
+ const defined = self2.parser.gfmFootnotes || (self2.parser.gfmFootnotes = []);
+ let identifier;
+ let size = 0;
+ let data;
+ return start;
+ function start(code3) {
+ effects.enter("gfmFootnoteDefinition")._container = true;
+ effects.enter("gfmFootnoteDefinitionLabel");
+ effects.enter("gfmFootnoteDefinitionLabelMarker");
+ effects.consume(code3);
+ effects.exit("gfmFootnoteDefinitionLabelMarker");
+ return labelAtMarker;
+ }
+ function labelAtMarker(code3) {
+ if (code3 === 94) {
+ effects.enter("gfmFootnoteDefinitionMarker");
+ effects.consume(code3);
+ effects.exit("gfmFootnoteDefinitionMarker");
+ effects.enter("gfmFootnoteDefinitionLabelString");
+ effects.enter("chunkString").contentType = "string";
+ return labelInside;
+ }
+ return nok(code3);
+ }
+ function labelInside(code3) {
+ if (
+ // Too long.
+ size > 999 || // Closing brace with nothing.
+ code3 === 93 && !data || // Space or tab is not supported by GFM for some reason.
+ // `\n` and `[` not being supported makes sense.
+ code3 === null || code3 === 91 || markdownLineEndingOrSpace(code3)
+ ) {
+ return nok(code3);
+ }
+ if (code3 === 93) {
+ effects.exit("chunkString");
+ const token = effects.exit("gfmFootnoteDefinitionLabelString");
+ identifier = normalizeIdentifier(self2.sliceSerialize(token));
+ effects.enter("gfmFootnoteDefinitionLabelMarker");
+ effects.consume(code3);
+ effects.exit("gfmFootnoteDefinitionLabelMarker");
+ effects.exit("gfmFootnoteDefinitionLabel");
+ return labelAfter;
+ }
+ if (!markdownLineEndingOrSpace(code3)) {
+ data = true;
+ }
+ size++;
+ effects.consume(code3);
+ return code3 === 92 ? labelEscape : labelInside;
+ }
+ function labelEscape(code3) {
+ if (code3 === 91 || code3 === 92 || code3 === 93) {
+ effects.consume(code3);
+ size++;
+ return labelInside;
+ }
+ return labelInside(code3);
+ }
+ function labelAfter(code3) {
+ if (code3 === 58) {
+ effects.enter("definitionMarker");
+ effects.consume(code3);
+ effects.exit("definitionMarker");
+ if (!defined.includes(identifier)) {
+ defined.push(identifier);
+ }
+ return factorySpace(
+ effects,
+ whitespaceAfter,
+ "gfmFootnoteDefinitionWhitespace"
+ );
+ }
+ return nok(code3);
+ }
+ function whitespaceAfter(code3) {
+ return ok3(code3);
+ }
+ }
+ function tokenizeDefinitionContinuation(effects, ok3, nok) {
+ return effects.check(blankLine, ok3, effects.attempt(indent, ok3, nok));
+ }
+ function gfmFootnoteDefinitionEnd(effects) {
+ effects.exit("gfmFootnoteDefinition");
+ }
+ function tokenizeIndent2(effects, ok3, nok) {
+ const self2 = this;
+ return factorySpace(
+ effects,
+ afterPrefix,
+ "gfmFootnoteDefinitionIndent",
+ 4 + 1
+ );
+ function afterPrefix(code3) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "gfmFootnoteDefinitionIndent" && tail[2].sliceSerialize(tail[1], true).length === 4 ? ok3(code3) : nok(code3);
+ }
+ }
+
+ // node_modules/micromark-extension-gfm-strikethrough/lib/syntax.js
+ function gfmStrikethrough(options2) {
+ const options_ = options2 || {};
+ let single = options_.singleTilde;
+ const tokenizer = {
+ tokenize: tokenizeStrikethrough,
+ resolveAll: resolveAllStrikethrough
+ };
+ if (single === null || single === void 0) {
+ single = true;
+ }
+ return {
+ text: {
+ [126]: tokenizer
+ },
+ insideSpan: {
+ null: [tokenizer]
+ },
+ attentionMarkers: {
+ null: [126]
+ }
+ };
+ function resolveAllStrikethrough(events, context) {
+ let index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][0] === "enter" && events[index2][1].type === "strikethroughSequenceTemporary" && events[index2][1]._close) {
+ let open = index2;
+ while (open--) {
+ if (events[open][0] === "exit" && events[open][1].type === "strikethroughSequenceTemporary" && events[open][1]._open && // If the sizes are the same:
+ events[index2][1].end.offset - events[index2][1].start.offset === events[open][1].end.offset - events[open][1].start.offset) {
+ events[index2][1].type = "strikethroughSequence";
+ events[open][1].type = "strikethroughSequence";
+ const strikethrough = {
+ type: "strikethrough",
+ start: Object.assign({}, events[open][1].start),
+ end: Object.assign({}, events[index2][1].end)
+ };
+ const text5 = {
+ type: "strikethroughText",
+ start: Object.assign({}, events[open][1].end),
+ end: Object.assign({}, events[index2][1].start)
+ };
+ const nextEvents = [
+ ["enter", strikethrough, context],
+ ["enter", events[open][1], context],
+ ["exit", events[open][1], context],
+ ["enter", text5, context]
+ ];
+ const insideSpan2 = context.parser.constructs.insideSpan.null;
+ if (insideSpan2) {
+ splice(
+ nextEvents,
+ nextEvents.length,
+ 0,
+ resolveAll(insideSpan2, events.slice(open + 1, index2), context)
+ );
+ }
+ splice(nextEvents, nextEvents.length, 0, [
+ ["exit", text5, context],
+ ["enter", events[index2][1], context],
+ ["exit", events[index2][1], context],
+ ["exit", strikethrough, context]
+ ]);
+ splice(events, open - 1, index2 - open + 3, nextEvents);
+ index2 = open + nextEvents.length - 2;
+ break;
+ }
+ }
+ }
+ }
+ index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][1].type === "strikethroughSequenceTemporary") {
+ events[index2][1].type = "data";
+ }
+ }
+ return events;
+ }
+ function tokenizeStrikethrough(effects, ok3, nok) {
+ const previous3 = this.previous;
+ const events = this.events;
+ let size = 0;
+ return start;
+ function start(code3) {
+ if (previous3 === 126 && events[events.length - 1][1].type !== "characterEscape") {
+ return nok(code3);
+ }
+ effects.enter("strikethroughSequenceTemporary");
+ return more(code3);
+ }
+ function more(code3) {
+ const before = classifyCharacter(previous3);
+ if (code3 === 126) {
+ if (size > 1) return nok(code3);
+ effects.consume(code3);
+ size++;
+ return more;
+ }
+ if (size < 2 && !single) return nok(code3);
+ const token = effects.exit("strikethroughSequenceTemporary");
+ const after = classifyCharacter(code3);
+ token._open = !after || after === 2 && Boolean(before);
+ token._close = !before || before === 2 && Boolean(after);
+ return ok3(code3);
+ }
+ }
+ }
+
+ // node_modules/micromark-extension-gfm-table/lib/edit-map.js
+ var EditMap = class {
+ /**
+ * Create a new edit map.
+ */
+ constructor() {
+ this.map = [];
+ }
+ /**
+ * Create an edit: a remove and/or add at a certain place.
+ *
+ * @param {number} index
+ * @param {number} remove
+ * @param {Array<Event>} add
+ * @returns {undefined}
+ */
+ add(index2, remove, add) {
+ addImpl(this, index2, remove, add);
+ }
+ // To do: add this when moving to `micromark`.
+ // /**
+ // * Create an edit: but insert `add` before existing additions.
+ // *
+ // * @param {number} index
+ // * @param {number} remove
+ // * @param {Array<Event>} add
+ // * @returns {undefined}
+ // */
+ // addBefore(index, remove, add) {
+ // addImpl(this, index, remove, add, true)
+ // }
+ /**
+ * Done, change the events.
+ *
+ * @param {Array<Event>} events
+ * @returns {undefined}
+ */
+ consume(events) {
+ this.map.sort(function(a2, b4) {
+ return a2[0] - b4[0];
+ });
+ if (this.map.length === 0) {
+ return;
+ }
+ let index2 = this.map.length;
+ const vecs = [];
+ while (index2 > 0) {
+ index2 -= 1;
+ vecs.push(
+ events.slice(this.map[index2][0] + this.map[index2][1]),
+ this.map[index2][2]
+ );
+ events.length = this.map[index2][0];
+ }
+ vecs.push([...events]);
+ events.length = 0;
+ let slice = vecs.pop();
+ while (slice) {
+ events.push(...slice);
+ slice = vecs.pop();
+ }
+ this.map.length = 0;
+ }
+ };
+ function addImpl(editMap, at4, remove, add) {
+ let index2 = 0;
+ if (remove === 0 && add.length === 0) {
+ return;
+ }
+ while (index2 < editMap.map.length) {
+ if (editMap.map[index2][0] === at4) {
+ editMap.map[index2][1] += remove;
+ editMap.map[index2][2].push(...add);
+ return;
+ }
+ index2 += 1;
+ }
+ editMap.map.push([at4, remove, add]);
+ }
+
+ // node_modules/micromark-extension-gfm-table/lib/infer.js
+ function gfmTableAlign(events, index2) {
+ let inDelimiterRow = false;
+ const align = [];
+ while (index2 < events.length) {
+ const event = events[index2];
+ if (inDelimiterRow) {
+ if (event[0] === "enter") {
+ if (event[1].type === "tableContent") {
+ align.push(
+ events[index2 + 1][1].type === "tableDelimiterMarker" ? "left" : "none"
+ );
+ }
+ } else if (event[1].type === "tableContent") {
+ if (events[index2 - 1][1].type === "tableDelimiterMarker") {
+ const alignIndex = align.length - 1;
+ align[alignIndex] = align[alignIndex] === "left" ? "center" : "right";
+ }
+ } else if (event[1].type === "tableDelimiterRow") {
+ break;
+ }
+ } else if (event[0] === "enter" && event[1].type === "tableDelimiterRow") {
+ inDelimiterRow = true;
+ }
+ index2 += 1;
+ }
+ return align;
+ }
+
+ // node_modules/micromark-extension-gfm-table/lib/syntax.js
+ function gfmTable() {
+ return {
+ flow: {
+ null: {
+ tokenize: tokenizeTable,
+ resolveAll: resolveTable
+ }
+ }
+ };
+ }
+ function tokenizeTable(effects, ok3, nok) {
+ const self2 = this;
+ let size = 0;
+ let sizeB = 0;
+ let seen;
+ return start;
+ function start(code3) {
+ let index2 = self2.events.length - 1;
+ while (index2 > -1) {
+ const type = self2.events[index2][1].type;
+ if (type === "lineEnding" || // Note: markdown-rs uses `whitespace` instead of `linePrefix`
+ type === "linePrefix")
+ index2--;
+ else break;
+ }
+ const tail = index2 > -1 ? self2.events[index2][1].type : null;
+ const next = tail === "tableHead" || tail === "tableRow" ? bodyRowStart : headRowBefore;
+ if (next === bodyRowStart && self2.parser.lazy[self2.now().line]) {
+ return nok(code3);
+ }
+ return next(code3);
+ }
+ function headRowBefore(code3) {
+ effects.enter("tableHead");
+ effects.enter("tableRow");
+ return headRowStart(code3);
+ }
+ function headRowStart(code3) {
+ if (code3 === 124) {
+ return headRowBreak(code3);
+ }
+ seen = true;
+ sizeB += 1;
+ return headRowBreak(code3);
+ }
+ function headRowBreak(code3) {
+ if (code3 === null) {
+ return nok(code3);
+ }
+ if (markdownLineEnding(code3)) {
+ if (sizeB > 1) {
+ sizeB = 0;
+ self2.interrupt = true;
+ effects.exit("tableRow");
+ effects.enter("lineEnding");
+ effects.consume(code3);
+ effects.exit("lineEnding");
+ return headDelimiterStart;
+ }
+ return nok(code3);
+ }
+ if (markdownSpace(code3)) {
+ return factorySpace(effects, headRowBreak, "whitespace")(code3);
+ }
+ sizeB += 1;
+ if (seen) {
+ seen = false;
+ size += 1;
+ }
+ if (code3 === 124) {
+ effects.enter("tableCellDivider");
+ effects.consume(code3);
+ effects.exit("tableCellDivider");
+ seen = true;
+ return headRowBreak;
+ }
+ effects.enter("data");
+ return headRowData(code3);
+ }
+ function headRowData(code3) {
+ if (code3 === null || code3 === 124 || markdownLineEndingOrSpace(code3)) {
+ effects.exit("data");
+ return headRowBreak(code3);
+ }
+ effects.consume(code3);
+ return code3 === 92 ? headRowEscape : headRowData;
+ }
+ function headRowEscape(code3) {
+ if (code3 === 92 || code3 === 124) {
+ effects.consume(code3);
+ return headRowData;
+ }
+ return headRowData(code3);
+ }
+ function headDelimiterStart(code3) {
+ self2.interrupt = false;
+ if (self2.parser.lazy[self2.now().line]) {
+ return nok(code3);
+ }
+ effects.enter("tableDelimiterRow");
+ seen = false;
+ if (markdownSpace(code3)) {
+ return factorySpace(
+ effects,
+ headDelimiterBefore,
+ "linePrefix",
+ self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4
+ )(code3);
+ }
+ return headDelimiterBefore(code3);
+ }
+ function headDelimiterBefore(code3) {
+ if (code3 === 45 || code3 === 58) {
+ return headDelimiterValueBefore(code3);
+ }
+ if (code3 === 124) {
+ seen = true;
+ effects.enter("tableCellDivider");
+ effects.consume(code3);
+ effects.exit("tableCellDivider");
+ return headDelimiterCellBefore;
+ }
+ return headDelimiterNok(code3);
+ }
+ function headDelimiterCellBefore(code3) {
+ if (markdownSpace(code3)) {
+ return factorySpace(effects, headDelimiterValueBefore, "whitespace")(code3);
+ }
+ return headDelimiterValueBefore(code3);
+ }
+ function headDelimiterValueBefore(code3) {
+ if (code3 === 58) {
+ sizeB += 1;
+ seen = true;
+ effects.enter("tableDelimiterMarker");
+ effects.consume(code3);
+ effects.exit("tableDelimiterMarker");
+ return headDelimiterLeftAlignmentAfter;
+ }
+ if (code3 === 45) {
+ sizeB += 1;
+ return headDelimiterLeftAlignmentAfter(code3);
+ }
+ if (code3 === null || markdownLineEnding(code3)) {
+ return headDelimiterCellAfter(code3);
+ }
+ return headDelimiterNok(code3);
+ }
+ function headDelimiterLeftAlignmentAfter(code3) {
+ if (code3 === 45) {
+ effects.enter("tableDelimiterFiller");
+ return headDelimiterFiller(code3);
+ }
+ return headDelimiterNok(code3);
+ }
+ function headDelimiterFiller(code3) {
+ if (code3 === 45) {
+ effects.consume(code3);
+ return headDelimiterFiller;
+ }
+ if (code3 === 58) {
+ seen = true;
+ effects.exit("tableDelimiterFiller");
+ effects.enter("tableDelimiterMarker");
+ effects.consume(code3);
+ effects.exit("tableDelimiterMarker");
+ return headDelimiterRightAlignmentAfter;
+ }
+ effects.exit("tableDelimiterFiller");
+ return headDelimiterRightAlignmentAfter(code3);
+ }
+ function headDelimiterRightAlignmentAfter(code3) {
+ if (markdownSpace(code3)) {
+ return factorySpace(effects, headDelimiterCellAfter, "whitespace")(code3);
+ }
+ return headDelimiterCellAfter(code3);
+ }
+ function headDelimiterCellAfter(code3) {
+ if (code3 === 124) {
+ return headDelimiterBefore(code3);
+ }
+ if (code3 === null || markdownLineEnding(code3)) {
+ if (!seen || size !== sizeB) {
+ return headDelimiterNok(code3);
+ }
+ effects.exit("tableDelimiterRow");
+ effects.exit("tableHead");
+ return ok3(code3);
+ }
+ return headDelimiterNok(code3);
+ }
+ function headDelimiterNok(code3) {
+ return nok(code3);
+ }
+ function bodyRowStart(code3) {
+ effects.enter("tableRow");
+ return bodyRowBreak(code3);
+ }
+ function bodyRowBreak(code3) {
+ if (code3 === 124) {
+ effects.enter("tableCellDivider");
+ effects.consume(code3);
+ effects.exit("tableCellDivider");
+ return bodyRowBreak;
+ }
+ if (code3 === null || markdownLineEnding(code3)) {
+ effects.exit("tableRow");
+ return ok3(code3);
+ }
+ if (markdownSpace(code3)) {
+ return factorySpace(effects, bodyRowBreak, "whitespace")(code3);
+ }
+ effects.enter("data");
+ return bodyRowData(code3);
+ }
+ function bodyRowData(code3) {
+ if (code3 === null || code3 === 124 || markdownLineEndingOrSpace(code3)) {
+ effects.exit("data");
+ return bodyRowBreak(code3);
+ }
+ effects.consume(code3);
+ return code3 === 92 ? bodyRowEscape : bodyRowData;
+ }
+ function bodyRowEscape(code3) {
+ if (code3 === 92 || code3 === 124) {
+ effects.consume(code3);
+ return bodyRowData;
+ }
+ return bodyRowData(code3);
+ }
+ }
+ function resolveTable(events, context) {
+ let index2 = -1;
+ let inFirstCellAwaitingPipe = true;
+ let rowKind = 0;
+ let lastCell = [0, 0, 0, 0];
+ let cell = [0, 0, 0, 0];
+ let afterHeadAwaitingFirstBodyRow = false;
+ let lastTableEnd = 0;
+ let currentTable;
+ let currentBody;
+ let currentCell;
+ const map5 = new EditMap();
+ while (++index2 < events.length) {
+ const event = events[index2];
+ const token = event[1];
+ if (event[0] === "enter") {
+ if (token.type === "tableHead") {
+ afterHeadAwaitingFirstBodyRow = false;
+ if (lastTableEnd !== 0) {
+ flushTableEnd(map5, context, lastTableEnd, currentTable, currentBody);
+ currentBody = void 0;
+ lastTableEnd = 0;
+ }
+ currentTable = {
+ type: "table",
+ start: Object.assign({}, token.start),
+ // Note: correct end is set later.
+ end: Object.assign({}, token.end)
+ };
+ map5.add(index2, 0, [["enter", currentTable, context]]);
+ } else if (token.type === "tableRow" || token.type === "tableDelimiterRow") {
+ inFirstCellAwaitingPipe = true;
+ currentCell = void 0;
+ lastCell = [0, 0, 0, 0];
+ cell = [0, index2 + 1, 0, 0];
+ if (afterHeadAwaitingFirstBodyRow) {
+ afterHeadAwaitingFirstBodyRow = false;
+ currentBody = {
+ type: "tableBody",
+ start: Object.assign({}, token.start),
+ // Note: correct end is set later.
+ end: Object.assign({}, token.end)
+ };
+ map5.add(index2, 0, [["enter", currentBody, context]]);
+ }
+ rowKind = token.type === "tableDelimiterRow" ? 2 : currentBody ? 3 : 1;
+ } else if (rowKind && (token.type === "data" || token.type === "tableDelimiterMarker" || token.type === "tableDelimiterFiller")) {
+ inFirstCellAwaitingPipe = false;
+ if (cell[2] === 0) {
+ if (lastCell[1] !== 0) {
+ cell[0] = cell[1];
+ currentCell = flushCell(
+ map5,
+ context,
+ lastCell,
+ rowKind,
+ void 0,
+ currentCell
+ );
+ lastCell = [0, 0, 0, 0];
+ }
+ cell[2] = index2;
+ }
+ } else if (token.type === "tableCellDivider") {
+ if (inFirstCellAwaitingPipe) {
+ inFirstCellAwaitingPipe = false;
+ } else {
+ if (lastCell[1] !== 0) {
+ cell[0] = cell[1];
+ currentCell = flushCell(
+ map5,
+ context,
+ lastCell,
+ rowKind,
+ void 0,
+ currentCell
+ );
+ }
+ lastCell = cell;
+ cell = [lastCell[1], index2, 0, 0];
+ }
+ }
+ } else if (token.type === "tableHead") {
+ afterHeadAwaitingFirstBodyRow = true;
+ lastTableEnd = index2;
+ } else if (token.type === "tableRow" || token.type === "tableDelimiterRow") {
+ lastTableEnd = index2;
+ if (lastCell[1] !== 0) {
+ cell[0] = cell[1];
+ currentCell = flushCell(
+ map5,
+ context,
+ lastCell,
+ rowKind,
+ index2,
+ currentCell
+ );
+ } else if (cell[1] !== 0) {
+ currentCell = flushCell(map5, context, cell, rowKind, index2, currentCell);
+ }
+ rowKind = 0;
+ } else if (rowKind && (token.type === "data" || token.type === "tableDelimiterMarker" || token.type === "tableDelimiterFiller")) {
+ cell[3] = index2;
+ }
+ }
+ if (lastTableEnd !== 0) {
+ flushTableEnd(map5, context, lastTableEnd, currentTable, currentBody);
+ }
+ map5.consume(context.events);
+ index2 = -1;
+ while (++index2 < context.events.length) {
+ const event = context.events[index2];
+ if (event[0] === "enter" && event[1].type === "table") {
+ event[1]._align = gfmTableAlign(context.events, index2);
+ }
+ }
+ return events;
+ }
+ function flushCell(map5, context, range, rowKind, rowEnd, previousCell) {
+ const groupName = rowKind === 1 ? "tableHeader" : rowKind === 2 ? "tableDelimiter" : "tableData";
+ const valueName = "tableContent";
+ if (range[0] !== 0) {
+ previousCell.end = Object.assign({}, getPoint(context.events, range[0]));
+ map5.add(range[0], 0, [["exit", previousCell, context]]);
+ }
+ const now = getPoint(context.events, range[1]);
+ previousCell = {
+ type: groupName,
+ start: Object.assign({}, now),
+ // Note: correct end is set later.
+ end: Object.assign({}, now)
+ };
+ map5.add(range[1], 0, [["enter", previousCell, context]]);
+ if (range[2] !== 0) {
+ const relatedStart = getPoint(context.events, range[2]);
+ const relatedEnd = getPoint(context.events, range[3]);
+ const valueToken = {
+ type: valueName,
+ start: Object.assign({}, relatedStart),
+ end: Object.assign({}, relatedEnd)
+ };
+ map5.add(range[2], 0, [["enter", valueToken, context]]);
+ if (rowKind !== 2) {
+ const start = context.events[range[2]];
+ const end = context.events[range[3]];
+ start[1].end = Object.assign({}, end[1].end);
+ start[1].type = "chunkText";
+ start[1].contentType = "text";
+ if (range[3] > range[2] + 1) {
+ const a2 = range[2] + 1;
+ const b4 = range[3] - range[2] - 1;
+ map5.add(a2, b4, []);
+ }
+ }
+ map5.add(range[3] + 1, 0, [["exit", valueToken, context]]);
+ }
+ if (rowEnd !== void 0) {
+ previousCell.end = Object.assign({}, getPoint(context.events, rowEnd));
+ map5.add(rowEnd, 0, [["exit", previousCell, context]]);
+ previousCell = void 0;
+ }
+ return previousCell;
+ }
+ function flushTableEnd(map5, context, index2, table, tableBody) {
+ const exits = [];
+ const related = getPoint(context.events, index2);
+ if (tableBody) {
+ tableBody.end = Object.assign({}, related);
+ exits.push(["exit", tableBody, context]);
+ }
+ table.end = Object.assign({}, related);
+ exits.push(["exit", table, context]);
+ map5.add(index2 + 1, 0, exits);
+ }
+ function getPoint(events, index2) {
+ const event = events[index2];
+ const side = event[0] === "enter" ? "start" : "end";
+ return event[1][side];
+ }
+
+ // node_modules/micromark-extension-gfm-task-list-item/lib/syntax.js
+ var tasklistCheck = {
+ tokenize: tokenizeTasklistCheck
+ };
+ function gfmTaskListItem() {
+ return {
+ text: {
+ [91]: tasklistCheck
+ }
+ };
+ }
+ function tokenizeTasklistCheck(effects, ok3, nok) {
+ const self2 = this;
+ return open;
+ function open(code3) {
+ if (
+ // Exit if there’s stuff before.
+ self2.previous !== null || // Exit if not in the first content that is the first child of a list
+ // item.
+ !self2._gfmTasklistFirstContentOfListItem
+ ) {
+ return nok(code3);
+ }
+ effects.enter("taskListCheck");
+ effects.enter("taskListCheckMarker");
+ effects.consume(code3);
+ effects.exit("taskListCheckMarker");
+ return inside;
+ }
+ function inside(code3) {
+ if (markdownLineEndingOrSpace(code3)) {
+ effects.enter("taskListCheckValueUnchecked");
+ effects.consume(code3);
+ effects.exit("taskListCheckValueUnchecked");
+ return close2;
+ }
+ if (code3 === 88 || code3 === 120) {
+ effects.enter("taskListCheckValueChecked");
+ effects.consume(code3);
+ effects.exit("taskListCheckValueChecked");
+ return close2;
+ }
+ return nok(code3);
+ }
+ function close2(code3) {
+ if (code3 === 93) {
+ effects.enter("taskListCheckMarker");
+ effects.consume(code3);
+ effects.exit("taskListCheckMarker");
+ effects.exit("taskListCheck");
+ return after;
+ }
+ return nok(code3);
+ }
+ function after(code3) {
+ if (markdownLineEnding(code3)) {
+ return ok3(code3);
+ }
+ if (markdownSpace(code3)) {
+ return effects.check(
+ {
+ tokenize: spaceThenNonSpace
+ },
+ ok3,
+ nok
+ )(code3);
+ }
+ return nok(code3);
+ }
+ }
+ function spaceThenNonSpace(effects, ok3, nok) {
+ return factorySpace(effects, after, "whitespace");
+ function after(code3) {
+ return code3 === null ? nok(code3) : ok3(code3);
+ }
+ }
+
+ // node_modules/micromark-extension-gfm/index.js
+ function gfm(options2) {
+ return combineExtensions([
+ gfmAutolinkLiteral(),
+ gfmFootnote(),
+ gfmStrikethrough(options2),
+ gfmTable(),
+ gfmTaskListItem()
+ ]);
+ }
+
+ // node_modules/remark-gfm/lib/index.js
+ var emptyOptions2 = {};
+ function remarkGfm(options2) {
+ const self2 = (
+ /** @type {Processor} */
+ this
+ );
+ const settings = options2 || emptyOptions2;
+ const data = self2.data();
+ const micromarkExtensions = data.micromarkExtensions || (data.micromarkExtensions = []);
+ const fromMarkdownExtensions = data.fromMarkdownExtensions || (data.fromMarkdownExtensions = []);
+ const toMarkdownExtensions = data.toMarkdownExtensions || (data.toMarkdownExtensions = []);
+ micromarkExtensions.push(gfm(settings));
+ fromMarkdownExtensions.push(gfmFromMarkdown());
+ toMarkdownExtensions.push(gfmToMarkdown(settings));
+ }
+
+ // node_modules/@milkdown/preset-gfm/lib/index.es.js
+ function d5(e2, t2) {
+ return Object.assign(e2, {
+ meta: __spreadValues({
+ package: "@milkdown/preset-gfm"
+ }, t2)
+ }), e2;
+ }
+ var K4 = we2("strike_through");
+ d5(K4, {
+ displayName: "Attr<strikethrough>",
+ group: "Strikethrough"
+ });
+ var T5 = ye2("strike_through", (e2) => ({
+ parseDOM: [
+ { tag: "del" },
+ { style: "text-decoration", getAttrs: (t2) => t2 === "line-through" }
+ ],
+ toDOM: (t2) => ["del", e2.get(K4.key)(t2)],
+ parseMarkdown: {
+ match: (t2) => t2.type === "delete",
+ runner: (t2, n4, o2) => {
+ t2.openMark(o2), t2.next(n4.children), t2.closeMark(o2);
+ }
+ },
+ toMarkdown: {
+ match: (t2) => t2.type.name === "strike_through",
+ runner: (t2, n4) => {
+ t2.withMark(n4, "delete");
+ }
+ }
+ }));
+ d5(T5.mark, {
+ displayName: "MarkSchema<strikethrough>",
+ group: "Strikethrough"
+ });
+ d5(T5.ctx, {
+ displayName: "MarkSchemaCtx<strikethrough>",
+ group: "Strikethrough"
+ });
+ var H5 = re2("ToggleStrikeThrough", (e2) => () => toggleMark(T5.type(e2)));
+ d5(H5, {
+ displayName: "Command<ToggleStrikethrough>",
+ group: "Strikethrough"
+ });
+ var ae3 = oe2((e2) => markRule(/~([^~]+)~$/, T5.type(e2)));
+ d5(ae3, {
+ displayName: "InputRule<strikethrough>",
+ group: "Strikethrough"
+ });
+ var L5 = ge2("strikeThroughKeymap", {
+ ToggleStrikethrough: {
+ shortcuts: "Mod-Alt-x",
+ command: (e2) => {
+ const t2 = e2.get(je);
+ return () => t2.call(H5.key);
+ }
+ }
+ });
+ d5(L5.ctx, {
+ displayName: "KeymapCtx<strikethrough>",
+ group: "Strikethrough"
+ });
+ d5(L5.shortcuts, {
+ displayName: "Keymap<strikethrough>",
+ group: "Strikethrough"
+ });
+ function se3(e2, t2 = 3, n4 = 3) {
+ const o2 = Array(n4).fill(0).map(() => M6.type(e2).createAndFill()), l5 = Array(n4).fill(0).map(() => I3.type(e2).createAndFill()), r3 = Array(t2).fill(0).map((s2, c6) => R5.type(e2).create(null, c6 === 0 ? l5 : o2));
+ return S7.type(e2).create(null, r3);
+ }
+ function w6(e2) {
+ return findParentNode((t2) => t2.type.spec.tableRole === "table")(e2);
+ }
+ function b3(e2, t2) {
+ const n4 = w6(t2);
+ if (!n4)
+ return;
+ const o2 = TableMap.get(n4.node);
+ if (!(e2 < 0 || e2 >= o2.width))
+ return o2.cellsInRect({ left: e2, right: e2 + 1, top: 0, bottom: o2.height }).map((l5) => {
+ const r3 = n4.node.nodeAt(l5);
+ if (!r3)
+ return;
+ const s2 = l5 + n4.start;
+ return {
+ pos: s2,
+ start: s2 + 1,
+ node: r3
+ };
+ }).filter((l5) => l5 != null);
+ }
+ function C4(e2, t2) {
+ const n4 = w6(t2);
+ if (!n4)
+ return;
+ const o2 = TableMap.get(n4.node);
+ if (!(e2 < 0 || e2 >= o2.height))
+ return o2.cellsInRect({ left: 0, right: o2.width, top: e2, bottom: e2 + 1 }).map((l5) => {
+ const r3 = n4.node.nodeAt(l5);
+ if (!r3)
+ return;
+ const s2 = l5 + n4.start;
+ return {
+ pos: s2,
+ start: s2 + 1,
+ node: r3
+ };
+ }).filter((l5) => l5 != null);
+ }
+ function Je(e2) {
+ const t2 = w6(e2);
+ if (!t2)
+ return;
+ const n4 = TableMap.get(t2.node);
+ return n4.cellsInRect({
+ left: 0,
+ right: n4.width,
+ top: 0,
+ bottom: n4.height
+ }).map((l5) => {
+ const r3 = t2.node.nodeAt(l5), s2 = l5 + t2.start;
+ return { pos: s2, start: s2 + 1, node: r3 };
+ });
+ }
+ function Qe(e2) {
+ const t2 = Je(e2.selection);
+ if (t2 && t2[0]) {
+ const n4 = e2.doc.resolve(t2[0].pos), o2 = t2[t2.length - 1];
+ if (o2) {
+ const l5 = e2.doc.resolve(o2.pos);
+ return cloneTr(e2.setSelection(new CellSelection(l5, n4)));
+ }
+ }
+ return e2;
+ }
+ function ce3(e2, t2, { map: n4, tableStart: o2, table: l5 }, r3) {
+ const s2 = Array(r3).fill(0).reduce((i2, m3, a2) => i2 + l5.child(a2).nodeSize, o2), c6 = Array(n4.width).fill(0).map((i2, m3) => {
+ const a2 = l5.nodeAt(n4.map[m3]);
+ return M6.type(e2).createAndFill({ alignment: a2 == null ? void 0 : a2.attrs.alignment });
+ });
+ return t2.insert(s2, R5.type(e2).create(null, c6)), t2;
+ }
+ function ie6(e2) {
+ return (t2) => (n4) => {
+ const o2 = w6(n4.selection), l5 = e2 === "row";
+ if (o2) {
+ const r3 = TableMap.get(o2.node);
+ if (t2 >= 0 && t2 < (l5 ? r3.height : r3.width)) {
+ const s2 = r3.positionAt(
+ l5 ? t2 : r3.height - 1,
+ l5 ? r3.width - 1 : t2,
+ o2.node
+ ), c6 = n4.doc.resolve(o2.start + s2), i2 = l5 ? CellSelection.rowSelection : CellSelection.colSelection, m3 = r3.positionAt(l5 ? t2 : 0, l5 ? 0 : t2, o2.node), a2 = n4.doc.resolve(o2.start + m3);
+ return cloneTr(n4.setSelection(i2(c6, a2)));
+ }
+ }
+ return n4;
+ };
+ }
+ var Ye = ie6("row");
+ var et = ie6("col");
+ function q6(e2) {
+ return e2[0].map((t2, n4) => e2.map((o2) => o2[n4]));
+ }
+ function de2(e2, t2) {
+ const n4 = [], o2 = TableMap.get(e2);
+ for (let r3 = 0; r3 < o2.height; r3++) {
+ const s2 = e2.child(r3), c6 = [];
+ for (let i2 = 0; i2 < o2.width; i2++) {
+ if (!t2[r3][i2])
+ continue;
+ const m3 = o2.map[r3 * o2.width + i2], a2 = t2[r3][i2], p4 = e2.nodeAt(m3).type.createChecked(
+ Object.assign({}, a2.attrs),
+ a2.content,
+ a2.marks
+ );
+ c6.push(p4);
+ }
+ n4.push(s2.type.createChecked(s2.attrs, c6, s2.marks));
+ }
+ return e2.type.createChecked(
+ e2.attrs,
+ n4,
+ e2.marks
+ );
+ }
+ function me3(e2) {
+ const t2 = TableMap.get(e2), n4 = [];
+ for (let o2 = 0; o2 < t2.height; o2++) {
+ const l5 = [], r3 = {};
+ for (let s2 = 0; s2 < t2.width; s2++) {
+ const c6 = t2.map[o2 * t2.width + s2], i2 = e2.nodeAt(c6), m3 = t2.findCell(c6);
+ if (r3[c6] || m3.top !== o2) {
+ l5.push(null);
+ continue;
+ }
+ r3[c6] = true, l5.push(i2);
+ }
+ n4.push(l5);
+ }
+ return n4;
+ }
+ function ue4(e2, t2, n4, o2) {
+ const l5 = t2[0] > n4[0] ? -1 : 1, r3 = e2.splice(t2[0], t2.length), s2 = r3.length % 2 === 0 ? 1 : 0;
+ let c6;
+ return o2 === -1 && l5 === 1 ? c6 = n4[0] - 1 : o2 === 1 && l5 === -1 ? c6 = n4[n4.length - 1] - s2 + 1 : c6 = l5 === -1 ? n4[0] : n4[n4.length - 1] - s2, e2.splice(c6, 0, ...r3), e2;
+ }
+ function tt(e2, t2, n4, o2) {
+ let l5 = q6(me3(e2.node));
+ return l5 = ue4(l5, t2, n4, o2), l5 = q6(l5), de2(e2.node, l5);
+ }
+ function ot3(e2, t2, n4, o2) {
+ let l5 = me3(e2.node);
+ return l5 = ue4(l5, t2, n4, o2), de2(e2.node, l5);
+ }
+ function J5(e2, t2) {
+ let n4 = e2, o2 = e2;
+ for (let a2 = e2; a2 >= 0; a2--) {
+ const u4 = b3(a2, t2.selection);
+ u4 && u4.forEach((p4) => {
+ const f3 = p4.node.attrs.colspan + a2 - 1;
+ f3 >= n4 && (n4 = a2), f3 > o2 && (o2 = f3);
+ });
+ }
+ for (let a2 = e2; a2 <= o2; a2++) {
+ const u4 = b3(a2, t2.selection);
+ u4 && u4.forEach((p4) => {
+ const f3 = p4.node.attrs.colspan + a2 - 1;
+ p4.node.attrs.colspan > 1 && f3 > o2 && (o2 = f3);
+ });
+ }
+ const l5 = [];
+ for (let a2 = n4; a2 <= o2; a2++) {
+ const u4 = b3(a2, t2.selection);
+ u4 && u4.length && l5.push(a2);
+ }
+ n4 = l5[0], o2 = l5[l5.length - 1];
+ const r3 = b3(n4, t2.selection), s2 = C4(0, t2.selection), c6 = t2.doc.resolve(
+ r3[r3.length - 1].pos
+ );
+ let i2;
+ for (let a2 = o2; a2 >= n4; a2--) {
+ const u4 = b3(a2, t2.selection);
+ if (u4 && u4.length) {
+ for (let p4 = s2.length - 1; p4 >= 0; p4--)
+ if (s2[p4].pos === u4[0].pos) {
+ i2 = u4[0];
+ break;
+ }
+ if (i2)
+ break;
+ }
+ }
+ const m3 = t2.doc.resolve(i2.pos);
+ return { $anchor: c6, $head: m3, indexes: l5 };
+ }
+ function Q4(e2, t2) {
+ let n4 = e2, o2 = e2;
+ for (let a2 = e2; a2 >= 0; a2--)
+ C4(a2, t2.selection).forEach((p4) => {
+ const f3 = p4.node.attrs.rowspan + a2 - 1;
+ f3 >= n4 && (n4 = a2), f3 > o2 && (o2 = f3);
+ });
+ for (let a2 = e2; a2 <= o2; a2++)
+ C4(a2, t2.selection).forEach((p4) => {
+ const f3 = p4.node.attrs.rowspan + a2 - 1;
+ p4.node.attrs.rowspan > 1 && f3 > o2 && (o2 = f3);
+ });
+ const l5 = [];
+ for (let a2 = n4; a2 <= o2; a2++) {
+ const u4 = C4(a2, t2.selection);
+ u4 && u4.length && l5.push(a2);
+ }
+ n4 = l5[0], o2 = l5[l5.length - 1];
+ const r3 = C4(n4, t2.selection), s2 = b3(0, t2.selection), c6 = t2.doc.resolve(r3[r3.length - 1].pos);
+ let i2;
+ for (let a2 = o2; a2 >= n4; a2--) {
+ const u4 = C4(a2, t2.selection);
+ if (u4 && u4.length) {
+ for (let p4 = s2.length - 1; p4 >= 0; p4--)
+ if (s2[p4].pos === u4[0].pos) {
+ i2 = u4[0];
+ break;
+ }
+ if (i2)
+ break;
+ }
+ }
+ const m3 = t2.doc.resolve(i2.pos);
+ return { $anchor: c6, $head: m3, indexes: l5 };
+ }
+ function nt2(e2, t2, n4, o2 = true) {
+ const l5 = w6(e2.selection);
+ if (!l5)
+ return e2;
+ const { indexes: r3 } = J5(t2, e2), { indexes: s2 } = J5(n4, e2);
+ if (r3.includes(n4))
+ return e2;
+ const c6 = tt(
+ l5,
+ r3,
+ s2,
+ 0
+ ), i2 = cloneTr(e2).replaceWith(
+ l5.pos,
+ l5.pos + l5.node.nodeSize,
+ c6
+ );
+ if (!o2)
+ return i2;
+ const m3 = TableMap.get(c6), a2 = l5.start, u4 = n4, p4 = m3.positionAt(m3.height - 1, u4, c6), f3 = i2.doc.resolve(a2 + p4), $3 = CellSelection.colSelection, P4 = m3.positionAt(0, u4, c6), _3 = i2.doc.resolve(a2 + P4);
+ return i2.setSelection($3(f3, _3));
+ }
+ function lt3(e2, t2, n4, o2 = true) {
+ const l5 = w6(e2.selection);
+ if (!l5)
+ return e2;
+ const { indexes: r3 } = Q4(t2, e2), { indexes: s2 } = Q4(n4, e2);
+ if (r3.includes(n4))
+ return e2;
+ const c6 = ot3(
+ l5,
+ r3,
+ s2,
+ 0
+ ), i2 = cloneTr(e2).replaceWith(
+ l5.pos,
+ l5.pos + l5.node.nodeSize,
+ c6
+ );
+ if (!o2)
+ return i2;
+ const m3 = TableMap.get(c6), a2 = l5.start, u4 = n4, p4 = m3.positionAt(u4, m3.width - 1, c6), f3 = i2.doc.resolve(a2 + p4), $3 = CellSelection.rowSelection, P4 = m3.positionAt(u4, 0, c6), _3 = i2.doc.resolve(a2 + P4);
+ return i2.setSelection($3(f3, _3));
+ }
+ var v3 = tableNodes({
+ tableGroup: "block",
+ cellContent: "paragraph",
+ cellAttributes: {
+ alignment: {
+ default: "left",
+ getFromDOM: (e2) => e2.style.textAlign || "left",
+ setDOMAttr: (e2, t2) => {
+ t2.style = `text-align: ${e2 || "left"}`;
+ }
+ }
+ }
+ });
+ var S7 = fe2("table", () => __spreadProps(__spreadValues({}, v3.table), {
+ parseMarkdown: {
+ match: (e2) => e2.type === "table",
+ runner: (e2, t2, n4) => {
+ const o2 = t2.align, l5 = t2.children.map((r3, s2) => __spreadProps(__spreadValues({}, r3), {
+ align: o2,
+ isHeader: s2 === 0
+ }));
+ e2.openNode(n4), e2.next(l5), e2.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "table",
+ runner: (e2, t2) => {
+ var l5;
+ const n4 = (l5 = t2.content.firstChild) == null ? void 0 : l5.content;
+ if (!n4)
+ return;
+ const o2 = [];
+ n4.forEach((r3) => {
+ o2.push(r3.attrs.alignment);
+ }), e2.openNode("table", void 0, { align: o2 }), e2.next(t2.content), e2.closeNode();
+ }
+ }
+ }));
+ d5(S7.node, {
+ displayName: "NodeSchema<table>",
+ group: "Table"
+ });
+ d5(S7.ctx, {
+ displayName: "NodeSchemaCtx<table>",
+ group: "Table"
+ });
+ var R5 = fe2("table_row", () => __spreadProps(__spreadValues({}, v3.table_row), {
+ parseMarkdown: {
+ match: (e2) => e2.type === "tableRow",
+ runner: (e2, t2, n4) => {
+ const o2 = t2.align, l5 = t2.children.map((r3, s2) => __spreadProps(__spreadValues({}, r3), {
+ align: o2[s2],
+ isHeader: t2.isHeader
+ }));
+ e2.openNode(n4), e2.next(l5), e2.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "table_row",
+ runner: (e2, t2) => {
+ e2.openNode("tableRow"), e2.next(t2.content), e2.closeNode();
+ }
+ }
+ }));
+ d5(R5.node, {
+ displayName: "NodeSchema<tableRow>",
+ group: "Table"
+ });
+ d5(R5.ctx, {
+ displayName: "NodeSchemaCtx<tableRow>",
+ group: "Table"
+ });
+ var M6 = fe2("table_cell", () => __spreadProps(__spreadValues({}, v3.table_cell), {
+ parseMarkdown: {
+ match: (e2) => e2.type === "tableCell" && !e2.isHeader,
+ runner: (e2, t2, n4) => {
+ const o2 = t2.align;
+ e2.openNode(n4, { alignment: o2 }).openNode(e2.schema.nodes.paragraph).next(t2.children).closeNode().closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "table_cell",
+ runner: (e2, t2) => {
+ e2.openNode("tableCell").next(t2.content).closeNode();
+ }
+ }
+ }));
+ d5(M6.node, {
+ displayName: "NodeSchema<tableCell>",
+ group: "Table"
+ });
+ d5(M6.ctx, {
+ displayName: "NodeSchemaCtx<tableCell>",
+ group: "Table"
+ });
+ var I3 = fe2("table_header", () => __spreadProps(__spreadValues({}, v3.table_header), {
+ parseMarkdown: {
+ match: (e2) => e2.type === "tableCell" && !!e2.isHeader,
+ runner: (e2, t2, n4) => {
+ const o2 = t2.align;
+ e2.openNode(n4, { alignment: o2 }), e2.openNode(e2.schema.nodes.paragraph), e2.next(t2.children), e2.closeNode(), e2.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === "table_header",
+ runner: (e2, t2) => {
+ e2.openNode("tableCell"), e2.next(t2.content), e2.closeNode();
+ }
+ }
+ }));
+ d5(I3.node, {
+ displayName: "NodeSchema<tableHeader>",
+ group: "Table"
+ });
+ d5(I3.ctx, {
+ displayName: "NodeSchemaCtx<tableHeader>",
+ group: "Table"
+ });
+ var pe3 = oe2((e2) => new InputRule(
+ new RegExp("^\\|(?<col>\\d+)[xX](?<row>\\d+)\\|\\s$"),
+ (t2, n4, o2, l5) => {
+ var i2, m3;
+ const r3 = t2.doc.resolve(o2);
+ if (!r3.node(-1).canReplaceWith(r3.index(-1), r3.indexAfter(-1), S7.type(e2)))
+ return null;
+ const s2 = se3(
+ e2,
+ Number((i2 = n4.groups) == null ? void 0 : i2.row),
+ Number((m3 = n4.groups) == null ? void 0 : m3.col)
+ ), c6 = t2.tr.replaceRangeWith(o2, l5, s2);
+ return c6.setSelection(TextSelection.create(c6.doc, o2 + 3)).scrollIntoView();
+ }
+ ));
+ d5(pe3, {
+ displayName: "InputRule<insertTableInputRule>",
+ group: "Table"
+ });
+ var W5 = re2("GoToPrevTableCell", () => () => goToNextCell(-1));
+ d5(W5, {
+ displayName: "Command<goToPrevTableCellCommand>",
+ group: "Table"
+ });
+ var G4 = re2("GoToNextTableCell", () => () => goToNextCell(1));
+ d5(G4, {
+ displayName: "Command<goToNextTableCellCommand>",
+ group: "Table"
+ });
+ var z4 = re2("BreakTable", (e2) => () => (t2, n4) => {
+ if (!isInTable(t2))
+ return false;
+ const { $head: o2 } = t2.selection, l5 = o2.after(), r3 = t2.tr.replaceWith(l5, l5, w5.type(e2).createAndFill());
+ return r3.setSelection(Selection.near(r3.doc.resolve(l5), 1)).scrollIntoView(), n4 == null || n4(r3), true;
+ });
+ d5(z4, {
+ displayName: "Command<breakTableCommand>",
+ group: "Table"
+ });
+ var fe4 = re2("InsertTable", (e2) => ({ row: t2, col: n4 } = {}) => (o2, l5) => {
+ const { selection: r3, tr: s2 } = o2, { from: c6 } = r3, i2 = se3(e2, t2, n4), m3 = s2.replaceSelectionWith(i2), a2 = Selection.findFrom(m3.doc.resolve(c6), 1, true);
+ return a2 && m3.setSelection(a2), l5 == null || l5(m3), true;
+ });
+ d5(fe4, {
+ displayName: "Command<insertTableCommand>",
+ group: "Table"
+ });
+ var he3 = re2("MoveRow", () => ({ from: e2, to: t2 } = {}) => (n4, o2) => {
+ const { tr: l5 } = n4;
+ return !!(o2 == null ? void 0 : o2(lt3(l5, e2 != null ? e2 : 0, t2 != null ? t2 : 0, true)));
+ });
+ d5(he3, {
+ displayName: "Command<moveRowCommand>",
+ group: "Table"
+ });
+ var ge4 = re2("MoveCol", () => ({ from: e2, to: t2 } = {}) => (n4, o2) => {
+ const { tr: l5 } = n4;
+ return !!(o2 == null ? void 0 : o2(nt2(l5, e2 != null ? e2 : 0, t2 != null ? t2 : 0, true)));
+ });
+ d5(ge4, {
+ displayName: "Command<moveColCommand>",
+ group: "Table"
+ });
+ var be2 = re2("SelectRow", () => (e2 = 0) => (t2, n4) => {
+ const { tr: o2 } = t2;
+ return !!(n4 == null ? void 0 : n4(Ye(e2)(o2)));
+ });
+ d5(be2, {
+ displayName: "Command<selectRowCommand>",
+ group: "Table"
+ });
+ var Ce4 = re2("SelectCol", () => (e2 = 0) => (t2, n4) => {
+ const { tr: o2 } = t2;
+ return !!(n4 == null ? void 0 : n4(et(e2)(o2)));
+ });
+ d5(Ce4, {
+ displayName: "Command<selectColCommand>",
+ group: "Table"
+ });
+ var ye4 = re2("SelectTable", () => () => (e2, t2) => {
+ const { tr: n4 } = e2;
+ return !!(t2 == null ? void 0 : t2(Qe(n4)));
+ });
+ d5(ye4, {
+ displayName: "Command<selectTableCommand>",
+ group: "Table"
+ });
+ var ke4 = re2("DeleteSelectedCells", () => () => (e2, t2) => {
+ const { selection: n4 } = e2;
+ if (!(n4 instanceof CellSelection))
+ return false;
+ const o2 = n4.isRowSelection(), l5 = n4.isColSelection();
+ return o2 && l5 ? deleteTable(e2, t2) : l5 ? deleteColumn(e2, t2) : deleteRow(e2, t2);
+ });
+ d5(ke4, {
+ displayName: "Command<deleteSelectedCellsCommand>",
+ group: "Table"
+ });
+ var we4 = re2("AddColBefore", () => () => addColumnBefore);
+ d5(we4, {
+ displayName: "Command<addColBeforeCommand>",
+ group: "Table"
+ });
+ var Ne3 = re2("AddColAfter", () => () => addColumnAfter);
+ d5(Ne3, {
+ displayName: "Command<addColAfterCommand>",
+ group: "Table"
+ });
+ var Te3 = re2("AddRowBefore", (e2) => () => (t2, n4) => {
+ if (!isInTable(t2))
+ return false;
+ if (n4) {
+ const o2 = selectedRect(t2);
+ n4(ce3(e2, t2.tr, o2, o2.top));
+ }
+ return true;
+ });
+ d5(Te3, {
+ displayName: "Command<addRowBeforeCommand>",
+ group: "Table"
+ });
+ var Se2 = re2("AddRowAfter", (e2) => () => (t2, n4) => {
+ if (!isInTable(t2))
+ return false;
+ if (n4) {
+ const o2 = selectedRect(t2);
+ n4(ce3(e2, t2.tr, o2, o2.bottom));
+ }
+ return true;
+ });
+ d5(Se2, {
+ displayName: "Command<addRowAfterCommand>",
+ group: "Table"
+ });
+ var Re2 = re2("SetAlign", () => (e2 = "left") => setCellAttr("alignment", e2));
+ d5(Re2, {
+ displayName: "Command<setAlignCommand>",
+ group: "Table"
+ });
+ var j5 = ge2("tableKeymap", {
+ NextCell: {
+ shortcuts: ["Mod-]", "Tab"],
+ command: (e2) => {
+ const t2 = e2.get(je);
+ return () => t2.call(G4.key);
+ }
+ },
+ PrevCell: {
+ shortcuts: ["Mod-[", "Shift-Tab"],
+ command: (e2) => {
+ const t2 = e2.get(je);
+ return () => t2.call(W5.key);
+ }
+ },
+ ExitTable: {
+ shortcuts: ["Mod-Enter"],
+ command: (e2) => {
+ const t2 = e2.get(je);
+ return () => t2.call(z4.key);
+ }
+ }
+ });
+ d5(j5.ctx, {
+ displayName: "KeymapCtx<table>",
+ group: "Table"
+ });
+ d5(j5.shortcuts, {
+ displayName: "Keymap<table>",
+ group: "Table"
+ });
+ var E4 = "footnote_definition";
+ var Y2 = "footnoteDefinition";
+ var Z4 = fe2("footnote_definition", () => ({
+ group: "block",
+ content: "block+",
+ defining: true,
+ attrs: {
+ label: {
+ default: ""
+ }
+ },
+ parseDOM: [
+ {
+ tag: `dl[data-type="${E4}"]`,
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return {
+ label: e2.dataset.label
+ };
+ },
+ contentElement: "dd"
+ }
+ ],
+ toDOM: (e2) => {
+ const t2 = e2.attrs.label;
+ return [
+ "dl",
+ {
+ // TODO: add a prosemirror plugin to sync label on change
+ "data-label": t2,
+ "data-type": E4
+ },
+ ["dt", t2],
+ ["dd", 0]
+ ];
+ },
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === Y2,
+ runner: (e2, t2, n4) => {
+ e2.openNode(n4, {
+ label: t2.label
+ }).next(t2.children).closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === E4,
+ runner: (e2, t2) => {
+ e2.openNode(Y2, void 0, {
+ label: t2.attrs.label,
+ identifier: t2.attrs.label
+ }).next(t2.content).closeNode();
+ }
+ }
+ }));
+ d5(Z4.ctx, {
+ displayName: "NodeSchemaCtx<footnodeDef>",
+ group: "footnote"
+ });
+ d5(Z4.node, {
+ displayName: "NodeSchema<footnodeDef>",
+ group: "footnote"
+ });
+ var D3 = "footnote_reference";
+ var V3 = fe2("footnote_reference", () => ({
+ group: "inline",
+ inline: true,
+ atom: true,
+ attrs: {
+ label: {
+ default: ""
+ }
+ },
+ parseDOM: [
+ {
+ tag: `sup[data-type="${D3}"]`,
+ getAttrs: (e2) => {
+ if (!(e2 instanceof HTMLElement))
+ throw S(e2);
+ return {
+ label: e2.dataset.label
+ };
+ }
+ }
+ ],
+ toDOM: (e2) => {
+ const t2 = e2.attrs.label;
+ return [
+ "sup",
+ {
+ // TODO: add a prosemirror plugin to sync label on change
+ "data-label": t2,
+ "data-type": D3
+ },
+ t2
+ ];
+ },
+ parseMarkdown: {
+ match: ({ type: e2 }) => e2 === "footnoteReference",
+ runner: (e2, t2, n4) => {
+ e2.addNode(n4, {
+ label: t2.label
+ });
+ }
+ },
+ toMarkdown: {
+ match: (e2) => e2.type.name === D3,
+ runner: (e2, t2) => {
+ e2.addNode("footnoteReference", void 0, void 0, {
+ label: t2.attrs.label,
+ identifier: t2.attrs.label
+ });
+ }
+ }
+ }));
+ d5(V3.ctx, {
+ displayName: "NodeSchemaCtx<footnodeRef>",
+ group: "footnote"
+ });
+ d5(V3.node, {
+ displayName: "NodeSchema<footnodeRef>",
+ group: "footnote"
+ });
+ var Me3 = M5.extendSchema((e2) => (t2) => {
+ const n4 = e2(t2);
+ return __spreadProps(__spreadValues({}, n4), {
+ attrs: __spreadProps(__spreadValues({}, n4.attrs), {
+ checked: {
+ default: null
+ }
+ }),
+ parseDOM: [
+ {
+ tag: 'li[data-item-type="task"]',
+ getAttrs: (o2) => {
+ if (!(o2 instanceof HTMLElement))
+ throw S(o2);
+ return {
+ label: o2.dataset.label,
+ listType: o2.dataset["list-type"],
+ spread: o2.dataset.spread,
+ checked: o2.dataset.checked ? o2.dataset.checked === "true" : null
+ };
+ }
+ },
+ ...(n4 == null ? void 0 : n4.parseDOM) || []
+ ],
+ toDOM: (o2) => n4.toDOM && o2.attrs.checked == null ? n4.toDOM(o2) : [
+ "li",
+ {
+ "data-item-type": "task",
+ "data-label": o2.attrs.label,
+ "data-list-type": o2.attrs.listType,
+ "data-spread": o2.attrs.spread,
+ "data-checked": o2.attrs.checked
+ },
+ 0
+ ],
+ parseMarkdown: {
+ match: ({ type: o2 }) => o2 === "listItem",
+ runner: (o2, l5, r3) => {
+ if (l5.checked == null) {
+ n4.parseMarkdown.runner(o2, l5, r3);
+ return;
+ }
+ const s2 = l5.label != null ? `${l5.label}.` : "\u2022", c6 = l5.checked != null ? !!l5.checked : null, i2 = l5.label != null ? "ordered" : "bullet", m3 = l5.spread != null ? `${l5.spread}` : "true";
+ o2.openNode(r3, { label: s2, listType: i2, spread: m3, checked: c6 }), o2.next(l5.children), o2.closeNode();
+ }
+ },
+ toMarkdown: {
+ match: (o2) => o2.type.name === "list_item",
+ runner: (o2, l5) => {
+ if (l5.attrs.checked == null) {
+ n4.toMarkdown.runner(o2, l5);
+ return;
+ }
+ const r3 = l5.attrs.label, s2 = l5.attrs.listType, c6 = l5.attrs.spread === "true", i2 = l5.attrs.checked;
+ o2.openNode("listItem", void 0, { label: r3, listType: s2, spread: c6, checked: i2 }), o2.next(l5.content), o2.closeNode();
+ }
+ }
+ });
+ });
+ d5(Me3, {
+ displayName: "NodeSchema<listItem>",
+ group: "ListItem"
+ });
+ var Ae3 = oe2(() => new InputRule(new RegExp("^\\[(?<checked>\\s|x)\\]\\s$"), (e2, t2, n4, o2) => {
+ var a2;
+ const l5 = e2.doc.resolve(n4);
+ let r3 = 0, s2 = l5.node(r3);
+ for (; s2 && s2.type.name !== "list_item"; )
+ r3--, s2 = l5.node(r3);
+ if (!s2 || s2.attrs.checked != null)
+ return null;
+ const c6 = ((a2 = t2.groups) == null ? void 0 : a2.checked) === "x", i2 = l5.before(r3), m3 = e2.tr;
+ return m3.deleteRange(n4, o2).setNodeMarkup(i2, void 0, __spreadProps(__spreadValues({}, s2.attrs), { checked: c6 })), m3;
+ }));
+ d5(Ae3, {
+ displayName: "InputRule<wrapInTaskListInputRule>",
+ group: "ListItem"
+ });
+ var rt = [
+ L5,
+ j5
+ ].flat();
+ var at3 = [
+ pe3,
+ Ae3
+ ];
+ var st2 = [
+ ae3
+ ];
+ var xe2 = ue2((e2) => {
+ const t2 = new PluginKey("MILKDOWN_AUTO_INSERT_ZERO_SPACE"), n4 = (l5) => l5.type === w5.type(e2), o2 = (l5) => n4(l5) && l5.nodeSize === 2;
+ return new Plugin({
+ key: t2,
+ props: {
+ handleDOMEvents: {
+ compositionstart(l5) {
+ const { state: r3, dispatch: s2 } = l5, { tr: c6, selection: i2 } = r3, { $from: m3 } = i2;
+ return browser.safari && isInTable(r3) && i2.empty && o2(m3.parent) && s2(c6.insertText("\u2060", m3.start())), false;
+ },
+ compositionend(l5) {
+ const { state: r3, dispatch: s2 } = l5, { tr: c6, selection: i2 } = r3, { $from: m3 } = i2;
+ return browser.safari && isInTable(r3) && i2.empty && n4(m3.parent) && m3.parent.textContent.startsWith("\u2060") && s2(c6.delete(m3.start(), m3.start() + 1)), false;
+ }
+ }
+ }
+ });
+ });
+ d5(xe2, {
+ displayName: "Prose<autoInsertZeroSpaceInTablePlugin>",
+ group: "Prose"
+ });
+ var ve3 = ue2(() => columnResizing({}));
+ d5(ve3, {
+ displayName: "Prose<columnResizingPlugin>",
+ group: "Prose"
+ });
+ var Ie3 = ue2(() => tableEditing());
+ d5(Ie3, {
+ displayName: "Prose<tableEditingPlugin>",
+ group: "Prose"
+ });
+ var U4 = ke2("remarkGFM", () => remarkGfm);
+ d5(U4.plugin, {
+ displayName: "Remark<remarkGFMPlugin>",
+ group: "Remark"
+ });
+ d5(U4.options, {
+ displayName: "RemarkConfig<remarkGFMPlugin>",
+ group: "Remark"
+ });
+ var ct3 = [
+ xe2,
+ ve3,
+ Ie3,
+ U4
+ ].flat();
+ var it2 = [
+ Me3,
+ S7,
+ R5,
+ I3,
+ M6,
+ Z4,
+ V3,
+ K4,
+ T5
+ ].flat();
+ var dt3 = [
+ G4,
+ W5,
+ z4,
+ fe4,
+ he3,
+ ge4,
+ be2,
+ Ce4,
+ ye4,
+ ke4,
+ Te3,
+ Se2,
+ we4,
+ Ne3,
+ Re2,
+ H5
+ ];
+ var wt = [it2, at3, st2, rt, ct3, dt3].flat();
+
+ // node_modules/@milkdown/theme-nord/lib/index.es.js
+ function c5(e2) {
+ e2.update(ae, (r3) => {
+ const o2 = r3.attributes;
+ return __spreadProps(__spreadValues({}, r3), {
+ attributes: (n4) => {
+ const t2 = typeof o2 == "function" ? o2(n4) : o2;
+ return __spreadProps(__spreadValues({}, t2), {
+ class: clsx_default("prose dark:prose-invert outline-none", (t2 == null ? void 0 : t2.class) || "", "milkdown-theme-nord")
+ });
+ }
+ });
+ });
+ }
+
+ // node_modules/@milkdown/plugin-listener/lib/index.es.js
+ var import_lodash = __toESM(require_lodash(), 1);
+ var l4 = class {
+ constructor() {
+ this.beforeMountedListeners = [], this.mountedListeners = [], this.updatedListeners = [], this.markdownUpdatedListeners = [], this.blurListeners = [], this.focusListeners = [], this.destroyListeners = [], this.beforeMount = (s2) => (this.beforeMountedListeners.push(s2), this), this.mounted = (s2) => (this.mountedListeners.push(s2), this), this.updated = (s2) => (this.updatedListeners.push(s2), this);
+ }
+ /// A getter to get all [subscribers](#interface-subscribers). You should not use this method directly.
+ get listeners() {
+ return {
+ beforeMount: this.beforeMountedListeners,
+ mounted: this.mountedListeners,
+ updated: this.updatedListeners,
+ markdownUpdated: this.markdownUpdatedListeners,
+ blur: this.blurListeners,
+ focus: this.focusListeners,
+ destroy: this.destroyListeners
+ };
+ }
+ /// Subscribe to the markdownUpdated event.
+ /// This event will be triggered after the editor state is updated and **the document is changed**.
+ /// The second parameter is the current markdown and the third parameter is the previous markdown.
+ markdownUpdated(s2) {
+ return this.markdownUpdatedListeners.push(s2), this;
+ }
+ /// Subscribe to the blur event.
+ /// This event will be triggered when the editor is blurred.
+ blur(s2) {
+ return this.blurListeners.push(s2), this;
+ }
+ /// Subscribe to the focus event.
+ /// This event will be triggered when the editor is focused.
+ focus(s2) {
+ return this.focusListeners.push(s2), this;
+ }
+ /// Subscribe to the destroy event.
+ /// This event will be triggered before the editor is destroyed.
+ destroy(s2) {
+ return this.destroyListeners.push(s2), this;
+ }
+ };
+ var h4 = H(new l4(), "listener");
+ var M7 = new PluginKey("MILKDOWN_LISTENER");
+ var U5 = (t2) => (t2.inject(h4, new l4()), async () => {
+ await t2.wait(M4);
+ const s2 = t2.get(h4), { listeners: r3 } = s2;
+ r3.beforeMount.forEach((e2) => e2(t2)), await t2.wait($);
+ const u4 = t2.get(te);
+ let n4 = null, d6 = null;
+ const p4 = new Plugin({
+ key: M7,
+ view: () => ({
+ destroy: () => {
+ r3.destroy.forEach((e2) => e2(t2));
+ }
+ }),
+ props: {
+ handleDOMEvents: {
+ focus: () => (r3.focus.forEach((e2) => e2(t2)), false),
+ blur: () => (r3.blur.forEach((e2) => e2(t2)), false)
+ }
+ },
+ state: {
+ init: (e2, a2) => {
+ n4 = a2.doc, d6 = u4(a2.doc);
+ },
+ apply: (e2) => !e2.docChanged || e2.getMeta("addToHistory") === false ? void 0 : (0, import_lodash.default)(() => {
+ const { doc: i2 } = e2;
+ if (r3.updated.length > 0 && n4 && !n4.eq(i2) && r3.updated.forEach((o2) => {
+ o2(t2, i2, n4);
+ }), r3.markdownUpdated.length > 0 && n4 && !n4.eq(i2)) {
+ const o2 = u4(i2);
+ r3.markdownUpdated.forEach((f3) => {
+ f3(t2, o2, d6);
+ }), d6 = o2;
+ }
+ n4 = i2;
+ }, 200)()
+ }
+ });
+ t2.update(N2, (e2) => e2.concat(p4)), await t2.wait(ne), r3.mounted.forEach((e2) => e2(t2));
+ });
+ U5.meta = {
+ package: "@milkdown/plugin-listener",
+ displayName: "Listener"
+ };
+
+ // frontend/main.ts
+ var markdown = `# Milkdown Vanilla Commonmark
+
+> You're scared of a world where you're needed.
+
+This is a demo for using Milkdown with **Vanilla Typescript**.
+
+- A list
+- [ ] Something to do
+- [x] Something done`;
+ function configureListItem(ctx) {
+ ctx.set(listItemBlockConfig.key, {
+ renderLabel: (label, listType, checked) => {
+ if (checked == null) {
+ if (listType === "bullet") {
+ return html2`<span class='label'>•</span>`;
+ }
+ return html2`<span class='label'>${label}</span>`;
+ } else {
+ return html2`<input class='label' type="checkbox" checked=${checked} />`;
+ }
+ }
+ });
+ }
+ Oe.make().config((ctx) => {
+ ctx.set(ce, "#editor");
+ ctx.set(re, markdown);
+ const listener = ctx.get(h4);
+ listener.markdownUpdated((ctx2, markdown2, prevMarkdown) => {
+ if (markdown2 !== prevMarkdown) {
+ console.log(markdown2);
+ }
+ });
+ }).config(configureListItem).use(cr).use(wt).use(c5).use(U5).use(listItemBlockComponent).create();
+})();
diff --git a/static/style.css b/static/style.css
new file mode 100644
index 0000000..69a048a
--- /dev/null
+++ b/static/style.css
@@ -0,0 +1,2693 @@
+/*
+! tailwindcss v3.4.3 | MIT License | https://tailwindcss.com
+*/
+
+/*
+1. Prevent padding and border from affecting element width. (https://github.com/mozdevs/cssremedy/issues/4)
+2. Allow adding a border to an element by just adding a border-width. (https://github.com/tailwindcss/tailwindcss/pull/116)
+*/
+
+*,
+::before,
+::after {
+ box-sizing: border-box;
+ /* 1 */
+ border-width: 0;
+ /* 2 */
+ border-style: solid;
+ /* 2 */
+ border-color: #e5e7eb;
+ /* 2 */
+}
+
+::before,
+::after {
+ --tw-content: '';
+}
+
+/*
+1. Use a consistent sensible line-height in all browsers.
+2. Prevent adjustments of font size after orientation changes in iOS.
+3. Use a more readable tab size.
+4. Use the user's configured `sans` font-family by default.
+5. Use the user's configured `sans` font-feature-settings by default.
+6. Use the user's configured `sans` font-variation-settings by default.
+7. Disable tap highlights on iOS
+*/
+
+html,
+:host {
+ line-height: 1.5;
+ /* 1 */
+ -webkit-text-size-adjust: 100%;
+ /* 2 */
+ -moz-tab-size: 4;
+ /* 3 */
+ -o-tab-size: 4;
+ tab-size: 4;
+ /* 3 */
+ font-family: ui-sans-serif, system-ui, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
+ /* 4 */
+ font-feature-settings: normal;
+ /* 5 */
+ font-variation-settings: normal;
+ /* 6 */
+ -webkit-tap-highlight-color: transparent;
+ /* 7 */
+}
+
+/*
+1. Remove the margin in all browsers.
+2. Inherit line-height from `html` so users can set them as a class directly on the `html` element.
+*/
+
+body {
+ margin: 0;
+ /* 1 */
+ line-height: inherit;
+ /* 2 */
+}
+
+/*
+1. Add the correct height in Firefox.
+2. Correct the inheritance of border color in Firefox. (https://bugzilla.mozilla.org/show_bug.cgi?id=190655)
+3. Ensure horizontal rules are visible by default.
+*/
+
+hr {
+ height: 0;
+ /* 1 */
+ color: inherit;
+ /* 2 */
+ border-top-width: 1px;
+ /* 3 */
+}
+
+/*
+Add the correct text decoration in Chrome, Edge, and Safari.
+*/
+
+abbr:where([title]) {
+ -webkit-text-decoration: underline dotted;
+ text-decoration: underline dotted;
+}
+
+/*
+Remove the default font size and weight for headings.
+*/
+
+h1,
+h2,
+h3,
+h4,
+h5,
+h6 {
+ font-size: inherit;
+ font-weight: inherit;
+}
+
+/*
+Reset links to optimize for opt-in styling instead of opt-out.
+*/
+
+a {
+ color: inherit;
+ text-decoration: inherit;
+}
+
+/*
+Add the correct font weight in Edge and Safari.
+*/
+
+b,
+strong {
+ font-weight: bolder;
+}
+
+/*
+1. Use the user's configured `mono` font-family by default.
+2. Use the user's configured `mono` font-feature-settings by default.
+3. Use the user's configured `mono` font-variation-settings by default.
+4. Correct the odd `em` font sizing in all browsers.
+*/
+
+code,
+kbd,
+samp,
+pre {
+ font-family: ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+ /* 1 */
+ font-feature-settings: normal;
+ /* 2 */
+ font-variation-settings: normal;
+ /* 3 */
+ font-size: 1em;
+ /* 4 */
+}
+
+/*
+Add the correct font size in all browsers.
+*/
+
+small {
+ font-size: 80%;
+}
+
+/*
+Prevent `sub` and `sup` elements from affecting the line height in all browsers.
+*/
+
+sub,
+sup {
+ font-size: 75%;
+ line-height: 0;
+ position: relative;
+ vertical-align: baseline;
+}
+
+sub {
+ bottom: -0.25em;
+}
+
+sup {
+ top: -0.5em;
+}
+
+/*
+1. Remove text indentation from table contents in Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=999088, https://bugs.webkit.org/show_bug.cgi?id=201297)
+2. Correct table border color inheritance in all Chrome and Safari. (https://bugs.chromium.org/p/chromium/issues/detail?id=935729, https://bugs.webkit.org/show_bug.cgi?id=195016)
+3. Remove gaps between table borders by default.
+*/
+
+table {
+ text-indent: 0;
+ /* 1 */
+ border-color: inherit;
+ /* 2 */
+ border-collapse: collapse;
+ /* 3 */
+}
+
+/*
+1. Change the font styles in all browsers.
+2. Remove the margin in Firefox and Safari.
+3. Remove default padding in all browsers.
+*/
+
+button,
+input,
+optgroup,
+select,
+textarea {
+ font-family: inherit;
+ /* 1 */
+ font-feature-settings: inherit;
+ /* 1 */
+ font-variation-settings: inherit;
+ /* 1 */
+ font-size: 100%;
+ /* 1 */
+ font-weight: inherit;
+ /* 1 */
+ line-height: inherit;
+ /* 1 */
+ letter-spacing: inherit;
+ /* 1 */
+ color: inherit;
+ /* 1 */
+ margin: 0;
+ /* 2 */
+ padding: 0;
+ /* 3 */
+}
+
+/*
+Remove the inheritance of text transform in Edge and Firefox.
+*/
+
+button,
+select {
+ text-transform: none;
+}
+
+/*
+1. Correct the inability to style clickable types in iOS and Safari.
+2. Remove default button styles.
+*/
+
+button,
+input:where([type='button']),
+input:where([type='reset']),
+input:where([type='submit']) {
+ -webkit-appearance: button;
+ /* 1 */
+ background-color: transparent;
+ /* 2 */
+ background-image: none;
+ /* 2 */
+}
+
+/*
+Use the modern Firefox focus style for all focusable elements.
+*/
+
+:-moz-focusring {
+ outline: auto;
+}
+
+/*
+Remove the additional `:invalid` styles in Firefox. (https://github.com/mozilla/gecko-dev/blob/2f9eacd9d3d995c937b4251a5557d95d494c9be1/layout/style/res/forms.css#L728-L737)
+*/
+
+:-moz-ui-invalid {
+ box-shadow: none;
+}
+
+/*
+Add the correct vertical alignment in Chrome and Firefox.
+*/
+
+progress {
+ vertical-align: baseline;
+}
+
+/*
+Correct the cursor style of increment and decrement buttons in Safari.
+*/
+
+::-webkit-inner-spin-button,
+::-webkit-outer-spin-button {
+ height: auto;
+}
+
+/*
+1. Correct the odd appearance in Chrome and Safari.
+2. Correct the outline style in Safari.
+*/
+
+[type='search'] {
+ -webkit-appearance: textfield;
+ /* 1 */
+ outline-offset: -2px;
+ /* 2 */
+}
+
+/*
+Remove the inner padding in Chrome and Safari on macOS.
+*/
+
+::-webkit-search-decoration {
+ -webkit-appearance: none;
+}
+
+/*
+1. Correct the inability to style clickable types in iOS and Safari.
+2. Change font properties to `inherit` in Safari.
+*/
+
+::-webkit-file-upload-button {
+ -webkit-appearance: button;
+ /* 1 */
+ font: inherit;
+ /* 2 */
+}
+
+/*
+Add the correct display in Chrome and Safari.
+*/
+
+summary {
+ display: list-item;
+}
+
+/*
+Removes the default spacing and border for appropriate elements.
+*/
+
+blockquote,
+dl,
+dd,
+h1,
+h2,
+h3,
+h4,
+h5,
+h6,
+hr,
+figure,
+p,
+pre {
+ margin: 0;
+}
+
+fieldset {
+ margin: 0;
+ padding: 0;
+}
+
+legend {
+ padding: 0;
+}
+
+ol,
+ul,
+menu {
+ list-style: none;
+ margin: 0;
+ padding: 0;
+}
+
+/*
+Reset default styling for dialogs.
+*/
+
+dialog {
+ padding: 0;
+}
+
+/*
+Prevent resizing textareas horizontally by default.
+*/
+
+textarea {
+ resize: vertical;
+}
+
+/*
+1. Reset the default placeholder opacity in Firefox. (https://github.com/tailwindlabs/tailwindcss/issues/3300)
+2. Set the default placeholder color to the user's configured gray 400 color.
+*/
+
+input::-moz-placeholder, textarea::-moz-placeholder {
+ opacity: 1;
+ /* 1 */
+ color: #9ca3af;
+ /* 2 */
+}
+
+input::placeholder,
+textarea::placeholder {
+ opacity: 1;
+ /* 1 */
+ color: #9ca3af;
+ /* 2 */
+}
+
+/*
+Set the default cursor for buttons.
+*/
+
+button,
+[role="button"] {
+ cursor: pointer;
+}
+
+/*
+Make sure disabled buttons don't get the pointer cursor.
+*/
+
+:disabled {
+ cursor: default;
+}
+
+/*
+1. Make replaced elements `display: block` by default. (https://github.com/mozdevs/cssremedy/issues/14)
+2. Add `vertical-align: middle` to align replaced elements more sensibly by default. (https://github.com/jensimmons/cssremedy/issues/14#issuecomment-634934210)
+ This can trigger a poorly considered lint error in some tools but is included by design.
+*/
+
+img,
+svg,
+video,
+canvas,
+audio,
+iframe,
+embed,
+object {
+ display: block;
+ /* 1 */
+ vertical-align: middle;
+ /* 2 */
+}
+
+/*
+Constrain images and videos to the parent width and preserve their intrinsic aspect ratio. (https://github.com/mozdevs/cssremedy/issues/14)
+*/
+
+img,
+video {
+ max-width: 100%;
+ height: auto;
+}
+
+/* Make elements with the HTML hidden attribute stay hidden by default */
+
+[hidden] {
+ display: none;
+}
+
+:root,
+[data-theme] {
+ background-color: var(--fallback-b1,oklch(var(--b1)/1));
+ color: var(--fallback-bc,oklch(var(--bc)/1));
+}
+
+@supports not (color: oklch(0% 0 0)) {
+ :root {
+ color-scheme: light;
+ --fallback-p: #491eff;
+ --fallback-pc: #d4dbff;
+ --fallback-s: #ff41c7;
+ --fallback-sc: #fff9fc;
+ --fallback-a: #00cfbd;
+ --fallback-ac: #00100d;
+ --fallback-n: #2b3440;
+ --fallback-nc: #d7dde4;
+ --fallback-b1: #ffffff;
+ --fallback-b2: #e5e6e6;
+ --fallback-b3: #e5e6e6;
+ --fallback-bc: #1f2937;
+ --fallback-in: #00b3f0;
+ --fallback-inc: #000000;
+ --fallback-su: #00ca92;
+ --fallback-suc: #000000;
+ --fallback-wa: #ffc22d;
+ --fallback-wac: #000000;
+ --fallback-er: #ff6f70;
+ --fallback-erc: #000000;
+ }
+
+ @media (prefers-color-scheme: dark) {
+ :root {
+ color-scheme: dark;
+ --fallback-p: #7582ff;
+ --fallback-pc: #050617;
+ --fallback-s: #ff71cf;
+ --fallback-sc: #190211;
+ --fallback-a: #00c7b5;
+ --fallback-ac: #000e0c;
+ --fallback-n: #2a323c;
+ --fallback-nc: #a6adbb;
+ --fallback-b1: #1d232a;
+ --fallback-b2: #191e24;
+ --fallback-b3: #15191e;
+ --fallback-bc: #a6adbb;
+ --fallback-in: #00b3f0;
+ --fallback-inc: #000000;
+ --fallback-su: #00ca92;
+ --fallback-suc: #000000;
+ --fallback-wa: #ffc22d;
+ --fallback-wac: #000000;
+ --fallback-er: #ff6f70;
+ --fallback-erc: #000000;
+ }
+ }
+}
+
+html {
+ -webkit-tap-highlight-color: transparent;
+}
+
+:root {
+ --p: 81.1787% 0.091182 6.323441;
+ --rounded-box: 1rem;
+ --rounded-btn: 0.5rem;
+ --rounded-badge: 1.9rem;
+ --animation-btn: 0.25s;
+ --animation-input: .2s;
+ --btn-focus-scale: 0.95;
+ --border-btn: 1px;
+ --tab-border: 1px;
+ --tab-radius: 0.5rem;
+ --pc: 16.1631% 0.019731 7.611912;
+ --s: 80.2505% 0.120284 226.513023;
+ --sc: 15.921% 0.023483 228.193635;
+ --a: 86.2762% 0.090464 154.896727;
+ --ac: 17.1651% 0.017414 151.988369;
+ --n: 70.1674% 0.322491 328.363418;
+ --nc: 14.047% 0.06456 328.363418;
+ --b1: 100% 0 0;
+ --b2: 90.0601% 0 0;
+ --b3: 80.1517% 0 0;
+ --bc: 20.0193% 0 0;
+ --in: 51.0573% 0.230053 276.965635;
+ --inc: 90.2553% 0.04582 275.978968;
+ --su: 51.0938% 0.086055 186.391359;
+ --suc: 90.2981% 0.017553 183.500117;
+ --wa: 79.5243% 0.161668 86.046788;
+ --wac: 15.9399% 0.03259 87.51442;
+ --er: 63.6834% 0.207849 25.331328;
+ --erc: 13.0045% 0.039838 24.572492;
+}
+
+[type='text'],input:where(:not([type])),[type='email'],[type='url'],[type='password'],[type='number'],[type='date'],[type='datetime-local'],[type='month'],[type='search'],[type='tel'],[type='time'],[type='week'],[multiple],textarea,select {
+ -webkit-appearance: none;
+ -moz-appearance: none;
+ appearance: none;
+ background-color: #fff;
+ border-color: #6b7280;
+ border-width: 1px;
+ border-radius: 0px;
+ padding-top: 0.5rem;
+ padding-right: 0.75rem;
+ padding-bottom: 0.5rem;
+ padding-left: 0.75rem;
+ font-size: 1rem;
+ line-height: 1.5rem;
+ --tw-shadow: 0 0 #0000;
+}
+
+[type='text']:focus, input:where(:not([type])):focus, [type='email']:focus, [type='url']:focus, [type='password']:focus, [type='number']:focus, [type='date']:focus, [type='datetime-local']:focus, [type='month']:focus, [type='search']:focus, [type='tel']:focus, [type='time']:focus, [type='week']:focus, [multiple]:focus, textarea:focus, select:focus {
+ outline: 2px solid transparent;
+ outline-offset: 2px;
+ --tw-ring-inset: var(--tw-empty,/*!*/ /*!*/);
+ --tw-ring-offset-width: 0px;
+ --tw-ring-offset-color: #fff;
+ --tw-ring-color: #2563eb;
+ --tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);
+ --tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);
+ box-shadow: var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow);
+ border-color: #2563eb;
+}
+
+input::-moz-placeholder, textarea::-moz-placeholder {
+ color: #6b7280;
+ opacity: 1;
+}
+
+input::placeholder,textarea::placeholder {
+ color: #6b7280;
+ opacity: 1;
+}
+
+::-webkit-datetime-edit-fields-wrapper {
+ padding: 0;
+}
+
+::-webkit-date-and-time-value {
+ min-height: 1.5em;
+ text-align: inherit;
+}
+
+::-webkit-datetime-edit {
+ display: inline-flex;
+}
+
+::-webkit-datetime-edit,::-webkit-datetime-edit-year-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute-field,::-webkit-datetime-edit-second-field,::-webkit-datetime-edit-millisecond-field,::-webkit-datetime-edit-meridiem-field {
+ padding-top: 0;
+ padding-bottom: 0;
+}
+
+select {
+ background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='none' viewBox='0 0 20 20'%3e%3cpath stroke='%236b7280' stroke-linecap='round' stroke-linejoin='round' stroke-width='1.5' d='M6 8l4 4 4-4'/%3e%3c/svg%3e");
+ background-position: right 0.5rem center;
+ background-repeat: no-repeat;
+ background-size: 1.5em 1.5em;
+ padding-right: 2.5rem;
+ -webkit-print-color-adjust: exact;
+ print-color-adjust: exact;
+}
+
+[multiple],[size]:where(select:not([size="1"])) {
+ background-image: initial;
+ background-position: initial;
+ background-repeat: unset;
+ background-size: initial;
+ padding-right: 0.75rem;
+ -webkit-print-color-adjust: unset;
+ print-color-adjust: unset;
+}
+
+[type='checkbox'],[type='radio'] {
+ -webkit-appearance: none;
+ -moz-appearance: none;
+ appearance: none;
+ padding: 0;
+ -webkit-print-color-adjust: exact;
+ print-color-adjust: exact;
+ display: inline-block;
+ vertical-align: middle;
+ background-origin: border-box;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ user-select: none;
+ flex-shrink: 0;
+ height: 1rem;
+ width: 1rem;
+ color: #2563eb;
+ background-color: #fff;
+ border-color: #6b7280;
+ border-width: 1px;
+ --tw-shadow: 0 0 #0000;
+}
+
+[type='checkbox'] {
+ border-radius: 0px;
+}
+
+[type='radio'] {
+ border-radius: 100%;
+}
+
+[type='checkbox']:focus,[type='radio']:focus {
+ outline: 2px solid transparent;
+ outline-offset: 2px;
+ --tw-ring-inset: var(--tw-empty,/*!*/ /*!*/);
+ --tw-ring-offset-width: 2px;
+ --tw-ring-offset-color: #fff;
+ --tw-ring-color: #2563eb;
+ --tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);
+ --tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color);
+ box-shadow: var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow);
+}
+
+[type='checkbox']:checked,[type='radio']:checked {
+ border-color: transparent;
+ background-color: currentColor;
+ background-size: 100% 100%;
+ background-position: center;
+ background-repeat: no-repeat;
+}
+
+[type='checkbox']:checked {
+ background-image: url("data:image/svg+xml,%3csvg viewBox='0 0 16 16' fill='white' xmlns='http://www.w3.org/2000/svg'%3e%3cpath d='M12.207 4.793a1 1 0 010 1.414l-5 5a1 1 0 01-1.414 0l-2-2a1 1 0 011.414-1.414L6.5 9.086l4.293-4.293a1 1 0 011.414 0z'/%3e%3c/svg%3e");
+}
+
+@media (forced-colors: active) {
+ [type='checkbox']:checked {
+ -webkit-appearance: auto;
+ -moz-appearance: auto;
+ appearance: auto;
+ }
+}
+
+[type='radio']:checked {
+ background-image: url("data:image/svg+xml,%3csvg viewBox='0 0 16 16' fill='white' xmlns='http://www.w3.org/2000/svg'%3e%3ccircle cx='8' cy='8' r='3'/%3e%3c/svg%3e");
+}
+
+@media (forced-colors: active) {
+ [type='radio']:checked {
+ -webkit-appearance: auto;
+ -moz-appearance: auto;
+ appearance: auto;
+ }
+}
+
+[type='checkbox']:checked:hover,[type='checkbox']:checked:focus,[type='radio']:checked:hover,[type='radio']:checked:focus {
+ border-color: transparent;
+ background-color: currentColor;
+}
+
+[type='checkbox']:indeterminate {
+ background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='none' viewBox='0 0 16 16'%3e%3cpath stroke='white' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='M4 8h8'/%3e%3c/svg%3e");
+ border-color: transparent;
+ background-color: currentColor;
+ background-size: 100% 100%;
+ background-position: center;
+ background-repeat: no-repeat;
+}
+
+@media (forced-colors: active) {
+ [type='checkbox']:indeterminate {
+ -webkit-appearance: auto;
+ -moz-appearance: auto;
+ appearance: auto;
+ }
+}
+
+[type='checkbox']:indeterminate:hover,[type='checkbox']:indeterminate:focus {
+ border-color: transparent;
+ background-color: currentColor;
+}
+
+[type='file'] {
+ background: unset;
+ border-color: inherit;
+ border-width: 0;
+ border-radius: 0;
+ padding: 0;
+ font-size: unset;
+ line-height: inherit;
+}
+
+[type='file']:focus {
+ outline: 1px solid ButtonText;
+ outline: 1px auto -webkit-focus-ring-color;
+}
+
+*, ::before, ::after {
+ --tw-border-spacing-x: 0;
+ --tw-border-spacing-y: 0;
+ --tw-translate-x: 0;
+ --tw-translate-y: 0;
+ --tw-rotate: 0;
+ --tw-skew-x: 0;
+ --tw-skew-y: 0;
+ --tw-scale-x: 1;
+ --tw-scale-y: 1;
+ --tw-pan-x: ;
+ --tw-pan-y: ;
+ --tw-pinch-zoom: ;
+ --tw-scroll-snap-strictness: proximity;
+ --tw-gradient-from-position: ;
+ --tw-gradient-via-position: ;
+ --tw-gradient-to-position: ;
+ --tw-ordinal: ;
+ --tw-slashed-zero: ;
+ --tw-numeric-figure: ;
+ --tw-numeric-spacing: ;
+ --tw-numeric-fraction: ;
+ --tw-ring-inset: ;
+ --tw-ring-offset-width: 0px;
+ --tw-ring-offset-color: #fff;
+ --tw-ring-color: rgb(59 130 246 / 0.5);
+ --tw-ring-offset-shadow: 0 0 #0000;
+ --tw-ring-shadow: 0 0 #0000;
+ --tw-shadow: 0 0 #0000;
+ --tw-shadow-colored: 0 0 #0000;
+ --tw-blur: ;
+ --tw-brightness: ;
+ --tw-contrast: ;
+ --tw-grayscale: ;
+ --tw-hue-rotate: ;
+ --tw-invert: ;
+ --tw-saturate: ;
+ --tw-sepia: ;
+ --tw-drop-shadow: ;
+ --tw-backdrop-blur: ;
+ --tw-backdrop-brightness: ;
+ --tw-backdrop-contrast: ;
+ --tw-backdrop-grayscale: ;
+ --tw-backdrop-hue-rotate: ;
+ --tw-backdrop-invert: ;
+ --tw-backdrop-opacity: ;
+ --tw-backdrop-saturate: ;
+ --tw-backdrop-sepia: ;
+ --tw-contain-size: ;
+ --tw-contain-layout: ;
+ --tw-contain-paint: ;
+ --tw-contain-style: ;
+}
+
+::backdrop {
+ --tw-border-spacing-x: 0;
+ --tw-border-spacing-y: 0;
+ --tw-translate-x: 0;
+ --tw-translate-y: 0;
+ --tw-rotate: 0;
+ --tw-skew-x: 0;
+ --tw-skew-y: 0;
+ --tw-scale-x: 1;
+ --tw-scale-y: 1;
+ --tw-pan-x: ;
+ --tw-pan-y: ;
+ --tw-pinch-zoom: ;
+ --tw-scroll-snap-strictness: proximity;
+ --tw-gradient-from-position: ;
+ --tw-gradient-via-position: ;
+ --tw-gradient-to-position: ;
+ --tw-ordinal: ;
+ --tw-slashed-zero: ;
+ --tw-numeric-figure: ;
+ --tw-numeric-spacing: ;
+ --tw-numeric-fraction: ;
+ --tw-ring-inset: ;
+ --tw-ring-offset-width: 0px;
+ --tw-ring-offset-color: #fff;
+ --tw-ring-color: rgb(59 130 246 / 0.5);
+ --tw-ring-offset-shadow: 0 0 #0000;
+ --tw-ring-shadow: 0 0 #0000;
+ --tw-shadow: 0 0 #0000;
+ --tw-shadow-colored: 0 0 #0000;
+ --tw-blur: ;
+ --tw-brightness: ;
+ --tw-contrast: ;
+ --tw-grayscale: ;
+ --tw-hue-rotate: ;
+ --tw-invert: ;
+ --tw-saturate: ;
+ --tw-sepia: ;
+ --tw-drop-shadow: ;
+ --tw-backdrop-blur: ;
+ --tw-backdrop-brightness: ;
+ --tw-backdrop-contrast: ;
+ --tw-backdrop-grayscale: ;
+ --tw-backdrop-hue-rotate: ;
+ --tw-backdrop-invert: ;
+ --tw-backdrop-opacity: ;
+ --tw-backdrop-saturate: ;
+ --tw-backdrop-sepia: ;
+ --tw-contain-size: ;
+ --tw-contain-layout: ;
+ --tw-contain-paint: ;
+ --tw-contain-style: ;
+}
+
+.avatar.placeholder > div {
+ display: flex;
+ align-items: center;
+ justify-content: center;
+}
+
+@media (hover:hover) {
+ .label a:hover {
+ --tw-text-opacity: 1;
+ color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
+ }
+}
+
+.btn {
+ display: inline-flex;
+ height: 3rem;
+ min-height: 3rem;
+ flex-shrink: 0;
+ cursor: pointer;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ user-select: none;
+ flex-wrap: wrap;
+ align-items: center;
+ justify-content: center;
+ border-radius: var(--rounded-btn, 0.5rem);
+ border-color: transparent;
+ border-color: oklch(var(--btn-color, var(--b2)) / var(--tw-border-opacity));
+ padding-left: 1rem;
+ padding-right: 1rem;
+ text-align: center;
+ font-size: 0.875rem;
+ line-height: 1em;
+ gap: 0.5rem;
+ font-weight: 600;
+ text-decoration-line: none;
+ transition-duration: 200ms;
+ transition-timing-function: cubic-bezier(0, 0, 0.2, 1);
+ border-width: var(--border-btn, 1px);
+ animation: button-pop var(--animation-btn, 0.25s) ease-out;
+ transition-property: color, background-color, border-color, opacity, box-shadow, transform;
+ --tw-text-opacity: 1;
+ color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
+ --tw-shadow: 0 1px 2px 0 rgb(0 0 0 / 0.05);
+ --tw-shadow-colored: 0 1px 2px 0 var(--tw-shadow-color);
+ box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
+ outline-color: var(--fallback-bc,oklch(var(--bc)/1));
+ background-color: oklch(var(--btn-color, var(--b2)) / var(--tw-bg-opacity));
+ --tw-bg-opacity: 1;
+ --tw-border-opacity: 1;
+}
+
+.btn-disabled,
+ .btn[disabled],
+ .btn:disabled {
+ pointer-events: none;
+}
+
+:where(.btn:is(input[type="checkbox"])),
+:where(.btn:is(input[type="radio"])) {
+ width: auto;
+ -webkit-appearance: none;
+ -moz-appearance: none;
+ appearance: none;
+}
+
+.btn:is(input[type="checkbox"]):after,
+.btn:is(input[type="radio"]):after {
+ --tw-content: attr(aria-label);
+ content: var(--tw-content);
+}
+
+.card {
+ position: relative;
+ display: flex;
+ flex-direction: column;
+ border-radius: var(--rounded-box, 1rem);
+}
+
+.card:focus {
+ outline: 2px solid transparent;
+ outline-offset: 2px;
+}
+
+.card-body {
+ display: flex;
+ flex: 1 1 auto;
+ flex-direction: column;
+ padding: var(--padding-card, 2rem);
+ gap: 0.5rem;
+}
+
+.card-body :where(p) {
+ flex-grow: 1;
+}
+
+.card-actions {
+ display: flex;
+ flex-wrap: wrap;
+ align-items: flex-start;
+ gap: 0.5rem;
+}
+
+.card figure {
+ display: flex;
+ align-items: center;
+ justify-content: center;
+}
+
+.card.image-full {
+ display: grid;
+}
+
+.card.image-full:before {
+ position: relative;
+ content: "";
+ z-index: 10;
+ border-radius: var(--rounded-box, 1rem);
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-n,oklch(var(--n)/var(--tw-bg-opacity)));
+ opacity: 0.75;
+}
+
+.card.image-full:before,
+ .card.image-full > * {
+ grid-column-start: 1;
+ grid-row-start: 1;
+}
+
+.card.image-full > figure img {
+ height: 100%;
+ -o-object-fit: cover;
+ object-fit: cover;
+}
+
+.card.image-full > .card-body {
+ position: relative;
+ z-index: 20;
+ --tw-text-opacity: 1;
+ color: var(--fallback-nc,oklch(var(--nc)/var(--tw-text-opacity)));
+}
+
+.checkbox {
+ flex-shrink: 0;
+ --chkbg: var(--fallback-bc,oklch(var(--bc)/1));
+ --chkfg: var(--fallback-b1,oklch(var(--b1)/1));
+ height: 1.5rem;
+ width: 1.5rem;
+ cursor: pointer;
+ -webkit-appearance: none;
+ -moz-appearance: none;
+ appearance: none;
+ border-radius: var(--rounded-btn, 0.5rem);
+ border-width: 1px;
+ border-color: var(--fallback-bc,oklch(var(--bc)/var(--tw-border-opacity)));
+ --tw-border-opacity: 0.2;
+}
+
+@media (hover: hover) {
+ .btn:hover {
+ --tw-border-opacity: 1;
+ border-color: var(--fallback-b3,oklch(var(--b3)/var(--tw-border-opacity)));
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-b3,oklch(var(--b3)/var(--tw-bg-opacity)));
+ }
+
+ @supports (color: color-mix(in oklab, black, black)) {
+ .btn:hover {
+ background-color: color-mix(
+ in oklab,
+ oklch(var(--btn-color, var(--b2)) / var(--tw-bg-opacity, 1)) 90%,
+ black
+ );
+ border-color: color-mix(
+ in oklab,
+ oklch(var(--btn-color, var(--b2)) / var(--tw-border-opacity, 1)) 90%,
+ black
+ );
+ }
+ }
+
+ @supports not (color: oklch(0% 0 0)) {
+ .btn:hover {
+ background-color: var(--btn-color, var(--fallback-b2));
+ border-color: var(--btn-color, var(--fallback-b2));
+ }
+ }
+
+ .btn.glass:hover {
+ --glass-opacity: 25%;
+ --glass-border-opacity: 15%;
+ }
+
+ .btn-outline.btn-primary:hover {
+ --tw-text-opacity: 1;
+ color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
+ }
+
+ @supports (color: color-mix(in oklab, black, black)) {
+ .btn-outline.btn-primary:hover {
+ background-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
+ border-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
+ }
+ }
+
+ .btn-disabled:hover,
+ .btn[disabled]:hover,
+ .btn:disabled:hover {
+ --tw-border-opacity: 0;
+ background-color: var(--fallback-n,oklch(var(--n)/var(--tw-bg-opacity)));
+ --tw-bg-opacity: 0.2;
+ color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
+ --tw-text-opacity: 0.2;
+ }
+
+ @supports (color: color-mix(in oklab, black, black)) {
+ .btn:is(input[type="checkbox"]:checked):hover, .btn:is(input[type="radio"]:checked):hover {
+ background-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
+ border-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
+ }
+ }
+}
+
+.label {
+ display: flex;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ user-select: none;
+ align-items: center;
+ justify-content: space-between;
+ padding-left: 0.25rem;
+ padding-right: 0.25rem;
+ padding-top: 0.5rem;
+ padding-bottom: 0.5rem;
+}
+
+.input {
+ flex-shrink: 1;
+ -webkit-appearance: none;
+ -moz-appearance: none;
+ appearance: none;
+ height: 3rem;
+ padding-left: 1rem;
+ padding-right: 1rem;
+ font-size: 1rem;
+ line-height: 2;
+ line-height: 1.5rem;
+ border-radius: var(--rounded-btn, 0.5rem);
+ border-width: 1px;
+ border-color: transparent;
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-b1,oklch(var(--b1)/var(--tw-bg-opacity)));
+}
+
+.input[type="number"]::-webkit-inner-spin-button,
+.input-md[type="number"]::-webkit-inner-spin-button {
+ margin-top: -1rem;
+ margin-bottom: -1rem;
+ margin-inline-end: -1rem;
+}
+
+.link {
+ cursor: pointer;
+ text-decoration-line: underline;
+}
+
+.navbar {
+ display: flex;
+ align-items: center;
+ padding: var(--navbar-padding, 0.5rem);
+ min-height: 4rem;
+ width: 100%;
+}
+
+:where(.navbar > *:not(script, style)) {
+ display: inline-flex;
+ align-items: center;
+}
+
+.navbar-start {
+ width: 50%;
+ justify-content: flex-start;
+}
+
+.navbar-end {
+ width: 50%;
+ justify-content: flex-end;
+}
+
+.btm-nav > * .label {
+ font-size: 1rem;
+ line-height: 1.5rem;
+}
+
+.btn:active:hover,
+ .btn:active:focus {
+ animation: button-pop 0s ease-out;
+ transform: scale(var(--btn-focus-scale, 0.97));
+}
+
+@supports not (color: oklch(0% 0 0)) {
+ .btn {
+ background-color: var(--btn-color, var(--fallback-b2));
+ border-color: var(--btn-color, var(--fallback-b2));
+ }
+
+ .btn-primary {
+ --btn-color: var(--fallback-p);
+ }
+
+ .prose :where(code):not(:where([class~="not-prose"] *, pre *)) {
+ background-color: var(--fallback-b3,oklch(var(--b3)/1));
+ }
+}
+
+@supports (color: color-mix(in oklab, black, black)) {
+ .btn-outline.btn-primary.btn-active {
+ background-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
+ border-color: color-mix(in oklab, var(--fallback-p,oklch(var(--p)/1)) 90%, black);
+ }
+}
+
+.btn:focus-visible {
+ outline-style: solid;
+ outline-width: 2px;
+ outline-offset: 2px;
+}
+
+.btn-primary {
+ --tw-text-opacity: 1;
+ color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
+ outline-color: var(--fallback-p,oklch(var(--p)/1));
+}
+
+@supports (color: oklch(0% 0 0)) {
+ .btn-primary {
+ --btn-color: var(--p);
+ }
+}
+
+.btn.glass {
+ --tw-shadow: 0 0 #0000;
+ --tw-shadow-colored: 0 0 #0000;
+ box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
+ outline-color: currentColor;
+}
+
+.btn.glass.btn-active {
+ --glass-opacity: 25%;
+ --glass-border-opacity: 15%;
+}
+
+.btn-outline.btn-primary {
+ --tw-text-opacity: 1;
+ color: var(--fallback-p,oklch(var(--p)/var(--tw-text-opacity)));
+}
+
+.btn-outline.btn-primary.btn-active {
+ --tw-text-opacity: 1;
+ color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
+}
+
+.btn.btn-disabled,
+ .btn[disabled],
+ .btn:disabled {
+ --tw-border-opacity: 0;
+ background-color: var(--fallback-n,oklch(var(--n)/var(--tw-bg-opacity)));
+ --tw-bg-opacity: 0.2;
+ color: var(--fallback-bc,oklch(var(--bc)/var(--tw-text-opacity)));
+ --tw-text-opacity: 0.2;
+}
+
+.btn:is(input[type="checkbox"]:checked),
+.btn:is(input[type="radio"]:checked) {
+ --tw-border-opacity: 1;
+ border-color: var(--fallback-p,oklch(var(--p)/var(--tw-border-opacity)));
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-p,oklch(var(--p)/var(--tw-bg-opacity)));
+ --tw-text-opacity: 1;
+ color: var(--fallback-pc,oklch(var(--pc)/var(--tw-text-opacity)));
+}
+
+.btn:is(input[type="checkbox"]:checked):focus-visible, .btn:is(input[type="radio"]:checked):focus-visible {
+ outline-color: var(--fallback-p,oklch(var(--p)/1));
+}
+
+@keyframes button-pop {
+ 0% {
+ transform: scale(var(--btn-focus-scale, 0.98));
+ }
+
+ 40% {
+ transform: scale(1.02);
+ }
+
+ 100% {
+ transform: scale(1);
+ }
+}
+
+.card :where(figure:first-child) {
+ overflow: hidden;
+ border-start-start-radius: inherit;
+ border-start-end-radius: inherit;
+ border-end-start-radius: unset;
+ border-end-end-radius: unset;
+}
+
+.card :where(figure:last-child) {
+ overflow: hidden;
+ border-start-start-radius: unset;
+ border-start-end-radius: unset;
+ border-end-start-radius: inherit;
+ border-end-end-radius: inherit;
+}
+
+.card:focus-visible {
+ outline: 2px solid currentColor;
+ outline-offset: 2px;
+}
+
+.card.bordered {
+ border-width: 1px;
+ --tw-border-opacity: 1;
+ border-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-border-opacity)));
+}
+
+.card.compact .card-body {
+ padding: 1rem;
+ font-size: 0.875rem;
+ line-height: 1.25rem;
+}
+
+.card-title {
+ display: flex;
+ align-items: center;
+ gap: 0.5rem;
+ font-size: 1.25rem;
+ line-height: 1.75rem;
+ font-weight: 600;
+}
+
+.card.image-full :where(figure) {
+ overflow: hidden;
+ border-radius: inherit;
+}
+
+.checkbox:focus {
+ box-shadow: none;
+}
+
+.checkbox:focus-visible {
+ outline-style: solid;
+ outline-width: 2px;
+ outline-offset: 2px;
+ outline-color: var(--fallback-bc,oklch(var(--bc)/1));
+}
+
+.checkbox:disabled {
+ border-width: 0px;
+ cursor: not-allowed;
+ border-color: transparent;
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-bc,oklch(var(--bc)/var(--tw-bg-opacity)));
+ opacity: 0.2;
+}
+
+.checkbox:checked,
+ .checkbox[aria-checked="true"] {
+ background-repeat: no-repeat;
+ animation: checkmark var(--animation-input, 0.2s) ease-out;
+ background-color: var(--chkbg);
+ background-image: linear-gradient(-45deg, transparent 65%, var(--chkbg) 65.99%),
+ linear-gradient(45deg, transparent 75%, var(--chkbg) 75.99%),
+ linear-gradient(-45deg, var(--chkbg) 40%, transparent 40.99%),
+ linear-gradient(
+ 45deg,
+ var(--chkbg) 30%,
+ var(--chkfg) 30.99%,
+ var(--chkfg) 40%,
+ transparent 40.99%
+ ),
+ linear-gradient(-45deg, var(--chkfg) 50%, var(--chkbg) 50.99%);
+}
+
+.checkbox:indeterminate {
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-bc,oklch(var(--bc)/var(--tw-bg-opacity)));
+ background-repeat: no-repeat;
+ animation: checkmark var(--animation-input, 0.2s) ease-out;
+ background-image: linear-gradient(90deg, transparent 80%, var(--chkbg) 80%),
+ linear-gradient(-90deg, transparent 80%, var(--chkbg) 80%),
+ linear-gradient(0deg, var(--chkbg) 43%, var(--chkfg) 43%, var(--chkfg) 57%, var(--chkbg) 57%);
+}
+
+@keyframes checkmark {
+ 0% {
+ background-position-y: 5px;
+ }
+
+ 50% {
+ background-position-y: -2px;
+ }
+
+ 100% {
+ background-position-y: 0;
+ }
+}
+
+.input input {
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-p,oklch(var(--p)/var(--tw-bg-opacity)));
+ background-color: transparent;
+}
+
+.input input:focus {
+ outline: 2px solid transparent;
+ outline-offset: 2px;
+}
+
+.input[list]::-webkit-calendar-picker-indicator {
+ line-height: 1em;
+}
+
+.input-bordered {
+ border-color: var(--fallback-bc,oklch(var(--bc)/0.2));
+}
+
+.input:focus,
+ .input:focus-within {
+ box-shadow: none;
+ border-color: var(--fallback-bc,oklch(var(--bc)/0.2));
+ outline-style: solid;
+ outline-width: 2px;
+ outline-offset: 2px;
+ outline-color: var(--fallback-bc,oklch(var(--bc)/0.2));
+}
+
+.input:has(> input[disabled]),
+ .input-disabled,
+ .input:disabled,
+ .input[disabled] {
+ cursor: not-allowed;
+ --tw-border-opacity: 1;
+ border-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-border-opacity)));
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-bg-opacity)));
+ color: var(--fallback-bc,oklch(var(--bc)/0.4));
+}
+
+.input:has(> input[disabled])::-moz-placeholder, .input-disabled::-moz-placeholder, .input:disabled::-moz-placeholder, .input[disabled]::-moz-placeholder {
+ color: var(--fallback-bc,oklch(var(--bc)/var(--tw-placeholder-opacity)));
+ --tw-placeholder-opacity: 0.2;
+}
+
+.input:has(> input[disabled])::placeholder,
+ .input-disabled::placeholder,
+ .input:disabled::placeholder,
+ .input[disabled]::placeholder {
+ color: var(--fallback-bc,oklch(var(--bc)/var(--tw-placeholder-opacity)));
+ --tw-placeholder-opacity: 0.2;
+}
+
+.input:has(> input[disabled]) > input[disabled] {
+ cursor: not-allowed;
+}
+
+.input::-webkit-date-and-time-value {
+ text-align: inherit;
+}
+
+.link:focus {
+ outline: 2px solid transparent;
+ outline-offset: 2px;
+}
+
+.link:focus-visible {
+ outline: 2px solid currentColor;
+ outline-offset: 2px;
+}
+
+.mockup-phone .display {
+ overflow: hidden;
+ border-radius: 40px;
+ margin-top: -25px;
+}
+
+.mockup-browser .mockup-browser-toolbar .input {
+ position: relative;
+ margin-left: auto;
+ margin-right: auto;
+ display: block;
+ height: 1.75rem;
+ width: 24rem;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ white-space: nowrap;
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-b2,oklch(var(--b2)/var(--tw-bg-opacity)));
+ padding-left: 2rem;
+ direction: ltr;
+}
+
+.mockup-browser .mockup-browser-toolbar .input:before {
+ content: "";
+ position: absolute;
+ left: 0.5rem;
+ top: 50%;
+ aspect-ratio: 1 / 1;
+ height: 0.75rem;
+ --tw-translate-y: -50%;
+ transform: translate(var(--tw-translate-x), var(--tw-translate-y)) rotate(var(--tw-rotate)) skewX(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y));
+ border-radius: 9999px;
+ border-width: 2px;
+ border-color: currentColor;
+ opacity: 0.6;
+}
+
+.mockup-browser .mockup-browser-toolbar .input:after {
+ content: "";
+ position: absolute;
+ left: 1.25rem;
+ top: 50%;
+ height: 0.5rem;
+ --tw-translate-y: 25%;
+ --tw-rotate: -45deg;
+ transform: translate(var(--tw-translate-x), var(--tw-translate-y)) rotate(var(--tw-rotate)) skewX(var(--tw-skew-x)) skewY(var(--tw-skew-y)) scaleX(var(--tw-scale-x)) scaleY(var(--tw-scale-y));
+ border-radius: 9999px;
+ border-width: 1px;
+ border-color: currentColor;
+ opacity: 0.6;
+}
+
+@keyframes modal-pop {
+ 0% {
+ opacity: 0;
+ }
+}
+
+@keyframes progress-loading {
+ 50% {
+ background-position-x: -115%;
+ }
+}
+
+@keyframes radiomark {
+ 0% {
+ box-shadow: 0 0 0 12px var(--fallback-b1,oklch(var(--b1)/1)) inset,
+ 0 0 0 12px var(--fallback-b1,oklch(var(--b1)/1)) inset;
+ }
+
+ 50% {
+ box-shadow: 0 0 0 3px var(--fallback-b1,oklch(var(--b1)/1)) inset,
+ 0 0 0 3px var(--fallback-b1,oklch(var(--b1)/1)) inset;
+ }
+
+ 100% {
+ box-shadow: 0 0 0 4px var(--fallback-b1,oklch(var(--b1)/1)) inset,
+ 0 0 0 4px var(--fallback-b1,oklch(var(--b1)/1)) inset;
+ }
+}
+
+@keyframes rating-pop {
+ 0% {
+ transform: translateY(-0.125em);
+ }
+
+ 40% {
+ transform: translateY(-0.125em);
+ }
+
+ 100% {
+ transform: translateY(0);
+ }
+}
+
+@keyframes skeleton {
+ from {
+ background-position: 150%;
+ }
+
+ to {
+ background-position: -50%;
+ }
+}
+
+@keyframes toast-pop {
+ 0% {
+ transform: scale(0.9);
+ opacity: 0;
+ }
+
+ 100% {
+ transform: scale(1);
+ opacity: 1;
+ }
+}
+
+:root .prose {
+ --tw-prose-body: var(--fallback-bc,oklch(var(--bc)/0.8));
+ --tw-prose-headings: var(--fallback-bc,oklch(var(--bc)/1));
+ --tw-prose-lead: var(--fallback-bc,oklch(var(--bc)/1));
+ --tw-prose-links: var(--fallback-bc,oklch(var(--bc)/1));
+ --tw-prose-bold: var(--fallback-bc,oklch(var(--bc)/1));
+ --tw-prose-counters: var(--fallback-bc,oklch(var(--bc)/1));
+ --tw-prose-bullets: var(--fallback-bc,oklch(var(--bc)/0.5));
+ --tw-prose-hr: var(--fallback-bc,oklch(var(--bc)/0.2));
+ --tw-prose-quotes: var(--fallback-bc,oklch(var(--bc)/1));
+ --tw-prose-quote-borders: var(--fallback-bc,oklch(var(--bc)/0.2));
+ --tw-prose-captions: var(--fallback-bc,oklch(var(--bc)/0.5));
+ --tw-prose-code: var(--fallback-bc,oklch(var(--bc)/1));
+ --tw-prose-pre-code: var(--fallback-nc,oklch(var(--nc)/1));
+ --tw-prose-pre-bg: var(--fallback-n,oklch(var(--n)/1));
+ --tw-prose-th-borders: var(--fallback-bc,oklch(var(--bc)/0.5));
+ --tw-prose-td-borders: var(--fallback-bc,oklch(var(--bc)/0.2));
+}
+
+.prose :where(code):not(:where([class~="not-prose"] *, pre *)) {
+ padding: 1px 8px;
+ border-radius: var(--rounded-badge);
+ font-weight: initial;
+ background-color: var(--fallback-bc,oklch(var(--bc)/0.1));
+}
+
+.prose :where(code):not(:where([class~="not-prose"], [class~="not-prose"] *))::before, .prose :where(code):not(:where([class~="not-prose"], [class~="not-prose"] *))::after {
+ display: none;
+}
+
+.prose pre code {
+ border-radius: 0;
+ padding: 0;
+}
+
+.prose :where(tbody tr, thead):not(:where([class~="not-prose"] *)) {
+ border-bottom-color: var(--fallback-bc,oklch(var(--bc)/0.2));
+}
+
+.card-compact .card-body {
+ padding: 1rem;
+ font-size: 0.875rem;
+ line-height: 1.25rem;
+}
+
+.card-compact .card-title {
+ margin-bottom: 0.25rem;
+}
+
+.card-normal .card-body {
+ padding: var(--padding-card, 2rem);
+ font-size: 1rem;
+ line-height: 1.5rem;
+}
+
+.card-normal .card-title {
+ margin-bottom: 0.75rem;
+}
+
+.prose {
+ color: var(--tw-prose-body);
+ max-width: 65ch;
+}
+
+.prose :where(p):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 1.25em;
+ margin-bottom: 1.25em;
+}
+
+.prose :where([class~="lead"]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-lead);
+ font-size: 1.25em;
+ line-height: 1.6;
+ margin-top: 1.2em;
+ margin-bottom: 1.2em;
+}
+
+.prose :where(a):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-links);
+ text-decoration: underline;
+ font-weight: 500;
+}
+
+.prose :where(strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-bold);
+ font-weight: 600;
+}
+
+.prose :where(a strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(blockquote strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(thead th strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(ol):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: decimal;
+ margin-top: 1.25em;
+ margin-bottom: 1.25em;
+ padding-inline-start: 1.625em;
+}
+
+.prose :where(ol[type="A"]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: upper-alpha;
+}
+
+.prose :where(ol[type="a"]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: lower-alpha;
+}
+
+.prose :where(ol[type="A" s]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: upper-alpha;
+}
+
+.prose :where(ol[type="a" s]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: lower-alpha;
+}
+
+.prose :where(ol[type="I"]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: upper-roman;
+}
+
+.prose :where(ol[type="i"]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: lower-roman;
+}
+
+.prose :where(ol[type="I" s]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: upper-roman;
+}
+
+.prose :where(ol[type="i" s]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: lower-roman;
+}
+
+.prose :where(ol[type="1"]):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: decimal;
+}
+
+.prose :where(ul):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ list-style-type: disc;
+ margin-top: 1.25em;
+ margin-bottom: 1.25em;
+ padding-inline-start: 1.625em;
+}
+
+.prose :where(ol > li):not(:where([class~="not-prose"],[class~="not-prose"] *))::marker {
+ font-weight: 400;
+ color: var(--tw-prose-counters);
+}
+
+.prose :where(ul > li):not(:where([class~="not-prose"],[class~="not-prose"] *))::marker {
+ color: var(--tw-prose-bullets);
+}
+
+.prose :where(dt):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-headings);
+ font-weight: 600;
+ margin-top: 1.25em;
+}
+
+.prose :where(hr):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ border-color: var(--tw-prose-hr);
+ border-top-width: 1px;
+ margin-top: 3em;
+ margin-bottom: 3em;
+}
+
+.prose :where(blockquote):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ font-weight: 500;
+ font-style: italic;
+ color: var(--tw-prose-quotes);
+ border-inline-start-width: 0.25rem;
+ border-inline-start-color: var(--tw-prose-quote-borders);
+ quotes: "\201C""\201D""\2018""\2019";
+ margin-top: 1.6em;
+ margin-bottom: 1.6em;
+ padding-inline-start: 1em;
+}
+
+.prose :where(blockquote p:first-of-type):not(:where([class~="not-prose"],[class~="not-prose"] *))::before {
+ content: open-quote;
+}
+
+.prose :where(blockquote p:last-of-type):not(:where([class~="not-prose"],[class~="not-prose"] *))::after {
+ content: close-quote;
+}
+
+.prose :where(h1):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-headings);
+ font-weight: 800;
+ font-size: 2.25em;
+ margin-top: 0;
+ margin-bottom: 0.8888889em;
+ line-height: 1.1111111;
+}
+
+.prose :where(h1 strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ font-weight: 900;
+ color: inherit;
+}
+
+.prose :where(h2):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-headings);
+ font-weight: 700;
+ font-size: 1.5em;
+ margin-top: 2em;
+ margin-bottom: 1em;
+ line-height: 1.3333333;
+}
+
+.prose :where(h2 strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ font-weight: 800;
+ color: inherit;
+}
+
+.prose :where(h3):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-headings);
+ font-weight: 600;
+ font-size: 1.25em;
+ margin-top: 1.6em;
+ margin-bottom: 0.6em;
+ line-height: 1.6;
+}
+
+.prose :where(h3 strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ font-weight: 700;
+ color: inherit;
+}
+
+.prose :where(h4):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-headings);
+ font-weight: 600;
+ margin-top: 1.5em;
+ margin-bottom: 0.5em;
+ line-height: 1.5;
+}
+
+.prose :where(h4 strong):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ font-weight: 700;
+ color: inherit;
+}
+
+.prose :where(img):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 2em;
+ margin-bottom: 2em;
+}
+
+.prose :where(picture):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ display: block;
+ margin-top: 2em;
+ margin-bottom: 2em;
+}
+
+.prose :where(video):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 2em;
+ margin-bottom: 2em;
+}
+
+.prose :where(kbd):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ font-weight: 500;
+ font-family: inherit;
+ color: var(--tw-prose-kbd);
+ box-shadow: 0 0 0 1px rgb(var(--tw-prose-kbd-shadows) / 10%), 0 3px 0 rgb(var(--tw-prose-kbd-shadows) / 10%);
+ font-size: 0.875em;
+ border-radius: 0.3125rem;
+ padding-top: 0.1875em;
+ padding-inline-end: 0.375em;
+ padding-bottom: 0.1875em;
+ padding-inline-start: 0.375em;
+}
+
+.prose :where(code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-code);
+ font-weight: 600;
+ font-size: 0.875em;
+}
+
+.prose :where(code):not(:where([class~="not-prose"],[class~="not-prose"] *))::before {
+ content: "`";
+}
+
+.prose :where(code):not(:where([class~="not-prose"],[class~="not-prose"] *))::after {
+ content: "`";
+}
+
+.prose :where(a code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(h1 code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(h2 code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+ font-size: 0.875em;
+}
+
+.prose :where(h3 code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+ font-size: 0.9em;
+}
+
+.prose :where(h4 code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(blockquote code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(thead th code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: inherit;
+}
+
+.prose :where(pre):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-pre-code);
+ background-color: var(--tw-prose-pre-bg);
+ overflow-x: auto;
+ font-weight: 400;
+ font-size: 0.875em;
+ line-height: 1.7142857;
+ margin-top: 1.7142857em;
+ margin-bottom: 1.7142857em;
+ border-radius: 0.375rem;
+ padding-top: 0.8571429em;
+ padding-inline-end: 1.1428571em;
+ padding-bottom: 0.8571429em;
+ padding-inline-start: 1.1428571em;
+}
+
+.prose :where(pre code):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ background-color: transparent;
+ border-width: 0;
+ border-radius: 0;
+ padding: 0;
+ font-weight: inherit;
+ color: inherit;
+ font-size: inherit;
+ font-family: inherit;
+ line-height: inherit;
+}
+
+.prose :where(pre code):not(:where([class~="not-prose"],[class~="not-prose"] *))::before {
+ content: none;
+}
+
+.prose :where(pre code):not(:where([class~="not-prose"],[class~="not-prose"] *))::after {
+ content: none;
+}
+
+.prose :where(table):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ width: 100%;
+ table-layout: auto;
+ text-align: start;
+ margin-top: 2em;
+ margin-bottom: 2em;
+ font-size: 0.875em;
+ line-height: 1.7142857;
+}
+
+.prose :where(thead):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ border-bottom-width: 1px;
+ border-bottom-color: var(--tw-prose-th-borders);
+}
+
+.prose :where(thead th):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-headings);
+ font-weight: 600;
+ vertical-align: bottom;
+ padding-inline-end: 0.5714286em;
+ padding-bottom: 0.5714286em;
+ padding-inline-start: 0.5714286em;
+}
+
+.prose :where(tbody tr):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ border-bottom-width: 1px;
+ border-bottom-color: var(--tw-prose-td-borders);
+}
+
+.prose :where(tbody tr:last-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ border-bottom-width: 0;
+}
+
+.prose :where(tbody td):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ vertical-align: baseline;
+}
+
+.prose :where(tfoot):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ border-top-width: 1px;
+ border-top-color: var(--tw-prose-th-borders);
+}
+
+.prose :where(tfoot td):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ vertical-align: top;
+}
+
+.prose :where(figure > *):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0;
+ margin-bottom: 0;
+}
+
+.prose :where(figcaption):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ color: var(--tw-prose-captions);
+ font-size: 0.875em;
+ line-height: 1.4285714;
+ margin-top: 0.8571429em;
+}
+
+.prose {
+ --tw-prose-body: #374151;
+ --tw-prose-headings: #111827;
+ --tw-prose-lead: #4b5563;
+ --tw-prose-links: #111827;
+ --tw-prose-bold: #111827;
+ --tw-prose-counters: #6b7280;
+ --tw-prose-bullets: #d1d5db;
+ --tw-prose-hr: #e5e7eb;
+ --tw-prose-quotes: #111827;
+ --tw-prose-quote-borders: #e5e7eb;
+ --tw-prose-captions: #6b7280;
+ --tw-prose-kbd: #111827;
+ --tw-prose-kbd-shadows: 17 24 39;
+ --tw-prose-code: #111827;
+ --tw-prose-pre-code: #e5e7eb;
+ --tw-prose-pre-bg: #1f2937;
+ --tw-prose-th-borders: #d1d5db;
+ --tw-prose-td-borders: #e5e7eb;
+ --tw-prose-invert-body: #d1d5db;
+ --tw-prose-invert-headings: #fff;
+ --tw-prose-invert-lead: #9ca3af;
+ --tw-prose-invert-links: #fff;
+ --tw-prose-invert-bold: #fff;
+ --tw-prose-invert-counters: #9ca3af;
+ --tw-prose-invert-bullets: #4b5563;
+ --tw-prose-invert-hr: #374151;
+ --tw-prose-invert-quotes: #f3f4f6;
+ --tw-prose-invert-quote-borders: #374151;
+ --tw-prose-invert-captions: #9ca3af;
+ --tw-prose-invert-kbd: #fff;
+ --tw-prose-invert-kbd-shadows: 255 255 255;
+ --tw-prose-invert-code: #fff;
+ --tw-prose-invert-pre-code: #d1d5db;
+ --tw-prose-invert-pre-bg: rgb(0 0 0 / 50%);
+ --tw-prose-invert-th-borders: #4b5563;
+ --tw-prose-invert-td-borders: #374151;
+ font-size: 1rem;
+ line-height: 1.75;
+}
+
+.prose :where(picture > img):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0;
+ margin-bottom: 0;
+}
+
+.prose :where(li):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0.5em;
+ margin-bottom: 0.5em;
+}
+
+.prose :where(ol > li):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ padding-inline-start: 0.375em;
+}
+
+.prose :where(ul > li):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ padding-inline-start: 0.375em;
+}
+
+.prose :where(.prose > ul > li p):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0.75em;
+ margin-bottom: 0.75em;
+}
+
+.prose :where(.prose > ul > li > p:first-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 1.25em;
+}
+
+.prose :where(.prose > ul > li > p:last-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-bottom: 1.25em;
+}
+
+.prose :where(.prose > ol > li > p:first-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 1.25em;
+}
+
+.prose :where(.prose > ol > li > p:last-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-bottom: 1.25em;
+}
+
+.prose :where(ul ul, ul ol, ol ul, ol ol):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0.75em;
+ margin-bottom: 0.75em;
+}
+
+.prose :where(dl):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 1.25em;
+ margin-bottom: 1.25em;
+}
+
+.prose :where(dd):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0.5em;
+ padding-inline-start: 1.625em;
+}
+
+.prose :where(hr + *):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0;
+}
+
+.prose :where(h2 + *):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0;
+}
+
+.prose :where(h3 + *):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0;
+}
+
+.prose :where(h4 + *):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0;
+}
+
+.prose :where(thead th:first-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ padding-inline-start: 0;
+}
+
+.prose :where(thead th:last-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ padding-inline-end: 0;
+}
+
+.prose :where(tbody td, tfoot td):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ padding-top: 0.5714286em;
+ padding-inline-end: 0.5714286em;
+ padding-bottom: 0.5714286em;
+ padding-inline-start: 0.5714286em;
+}
+
+.prose :where(tbody td:first-child, tfoot td:first-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ padding-inline-start: 0;
+}
+
+.prose :where(tbody td:last-child, tfoot td:last-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ padding-inline-end: 0;
+}
+
+.prose :where(figure):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 2em;
+ margin-bottom: 2em;
+}
+
+.prose :where(.prose > :first-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-top: 0;
+}
+
+.prose :where(.prose > :last-child):not(:where([class~="not-prose"],[class~="not-prose"] *)) {
+ margin-bottom: 0;
+}
+
+.sr-only {
+ position: absolute;
+ width: 1px;
+ height: 1px;
+ padding: 0;
+ margin: -1px;
+ overflow: hidden;
+ clip: rect(0, 0, 0, 0);
+ white-space: nowrap;
+ border-width: 0;
+}
+
+.fixed {
+ position: fixed;
+}
+
+.inset-y-0 {
+ top: 0px;
+ bottom: 0px;
+}
+
+.z-50 {
+ z-index: 50;
+}
+
+.-mx-2 {
+ margin-left: -0.5rem;
+ margin-right: -0.5rem;
+}
+
+.-mx-6 {
+ margin-left: -1.5rem;
+ margin-right: -1.5rem;
+}
+
+.mt-10 {
+ margin-top: 2.5rem;
+}
+
+.mt-2 {
+ margin-top: 0.5rem;
+}
+
+.mt-6 {
+ margin-top: 1.5rem;
+}
+
+.mt-auto {
+ margin-top: auto;
+}
+
+.block {
+ display: block;
+}
+
+.flex {
+ display: flex;
+}
+
+.h-16 {
+ height: 4rem;
+}
+
+.h-6 {
+ height: 1.5rem;
+}
+
+.h-8 {
+ height: 2rem;
+}
+
+.h-full {
+ height: 100%;
+}
+
+.min-h-full {
+ min-height: 100%;
+}
+
+.w-10 {
+ width: 2.5rem;
+}
+
+.w-6 {
+ width: 1.5rem;
+}
+
+.w-72 {
+ width: 18rem;
+}
+
+.w-8 {
+ width: 2rem;
+}
+
+.w-96 {
+ width: 24rem;
+}
+
+.w-auto {
+ width: auto;
+}
+
+.w-full {
+ width: 100%;
+}
+
+.flex-1 {
+ flex: 1 1 0%;
+}
+
+.shrink-0 {
+ flex-shrink: 0;
+}
+
+.grow {
+ flex-grow: 1;
+}
+
+.flex-col {
+ flex-direction: column;
+}
+
+.items-center {
+ align-items: center;
+}
+
+.justify-end {
+ justify-content: flex-end;
+}
+
+.justify-center {
+ justify-content: center;
+}
+
+.justify-around {
+ justify-content: space-around;
+}
+
+.gap-2 {
+ gap: 0.5rem;
+}
+
+.gap-x-3 {
+ -moz-column-gap: 0.75rem;
+ column-gap: 0.75rem;
+}
+
+.gap-x-4 {
+ -moz-column-gap: 1rem;
+ column-gap: 1rem;
+}
+
+.gap-y-4 {
+ row-gap: 1rem;
+}
+
+.gap-y-5 {
+ row-gap: 1.25rem;
+}
+
+.gap-y-7 {
+ row-gap: 1.75rem;
+}
+
+.space-y-1 > :not([hidden]) ~ :not([hidden]) {
+ --tw-space-y-reverse: 0;
+ margin-top: calc(0.25rem * calc(1 - var(--tw-space-y-reverse)));
+ margin-bottom: calc(0.25rem * var(--tw-space-y-reverse));
+}
+
+.space-y-6 > :not([hidden]) ~ :not([hidden]) {
+ --tw-space-y-reverse: 0;
+ margin-top: calc(1.5rem * calc(1 - var(--tw-space-y-reverse)));
+ margin-bottom: calc(1.5rem * var(--tw-space-y-reverse));
+}
+
+.overflow-y-auto {
+ overflow-y: auto;
+}
+
+.truncate {
+ overflow: hidden;
+ text-overflow: ellipsis;
+ white-space: nowrap;
+}
+
+.rounded-full {
+ border-radius: 9999px;
+}
+
+.rounded-lg {
+ border-radius: 0.5rem;
+}
+
+.rounded-md {
+ border-radius: 0.375rem;
+}
+
+.border {
+ border-width: 1px;
+}
+
+.border-0 {
+ border-width: 0px;
+}
+
+.border-2 {
+ border-width: 2px;
+}
+
+.border-r {
+ border-right-width: 1px;
+}
+
+.border-solid {
+ border-style: solid;
+}
+
+.border-gray-200 {
+ --tw-border-opacity: 1;
+ border-color: rgb(229 231 235 / var(--tw-border-opacity));
+}
+
+.bg-accent {
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-a,oklch(var(--a)/var(--tw-bg-opacity)));
+}
+
+.bg-base-100 {
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-b1,oklch(var(--b1)/var(--tw-bg-opacity)));
+}
+
+.bg-gray-100 {
+ --tw-bg-opacity: 1;
+ background-color: rgb(243 244 246 / var(--tw-bg-opacity));
+}
+
+.bg-gray-50 {
+ --tw-bg-opacity: 1;
+ background-color: rgb(249 250 251 / var(--tw-bg-opacity));
+}
+
+.bg-secondary {
+ --tw-bg-opacity: 1;
+ background-color: var(--fallback-s,oklch(var(--s)/var(--tw-bg-opacity)));
+}
+
+.bg-white {
+ --tw-bg-opacity: 1;
+ background-color: rgb(255 255 255 / var(--tw-bg-opacity));
+}
+
+.p-2 {
+ padding: 0.5rem;
+}
+
+.px-6 {
+ padding-left: 1.5rem;
+ padding-right: 1.5rem;
+}
+
+.px-8 {
+ padding-left: 2rem;
+ padding-right: 2rem;
+}
+
+.py-1 {
+ padding-top: 0.25rem;
+ padding-bottom: 0.25rem;
+}
+
+.py-1\.5 {
+ padding-top: 0.375rem;
+ padding-bottom: 0.375rem;
+}
+
+.py-10 {
+ padding-top: 2.5rem;
+ padding-bottom: 2.5rem;
+}
+
+.py-12 {
+ padding-top: 3rem;
+ padding-bottom: 3rem;
+}
+
+.py-3 {
+ padding-top: 0.75rem;
+ padding-bottom: 0.75rem;
+}
+
+.py-8 {
+ padding-top: 2rem;
+ padding-bottom: 2rem;
+}
+
+.pl-72 {
+ padding-left: 18rem;
+}
+
+.text-center {
+ text-align: center;
+}
+
+.text-2xl {
+ font-size: 1.5rem;
+ line-height: 2rem;
+}
+
+.text-\[0\.625rem\] {
+ font-size: 0.625rem;
+}
+
+.text-sm {
+ font-size: 0.875rem;
+ line-height: 1.25rem;
+}
+
+.text-xl {
+ font-size: 1.25rem;
+ line-height: 1.75rem;
+}
+
+.text-xs {
+ font-size: 0.75rem;
+ line-height: 1rem;
+}
+
+.font-bold {
+ font-weight: 700;
+}
+
+.font-medium {
+ font-weight: 500;
+}
+
+.font-semibold {
+ font-weight: 600;
+}
+
+.italic {
+ font-style: italic;
+}
+
+.leading-6 {
+ line-height: 1.5rem;
+}
+
+.leading-9 {
+ line-height: 2.25rem;
+}
+
+.tracking-tight {
+ letter-spacing: -0.025em;
+}
+
+.text-accent-content {
+ --tw-text-opacity: 1;
+ color: var(--fallback-ac,oklch(var(--ac)/var(--tw-text-opacity)));
+}
+
+.text-gray-400 {
+ --tw-text-opacity: 1;
+ color: rgb(156 163 175 / var(--tw-text-opacity));
+}
+
+.text-gray-500 {
+ --tw-text-opacity: 1;
+ color: rgb(107 114 128 / var(--tw-text-opacity));
+}
+
+.text-gray-700 {
+ --tw-text-opacity: 1;
+ color: rgb(55 65 81 / var(--tw-text-opacity));
+}
+
+.text-gray-900 {
+ --tw-text-opacity: 1;
+ color: rgb(17 24 39 / var(--tw-text-opacity));
+}
+
+.text-indigo-600 {
+ --tw-text-opacity: 1;
+ color: rgb(79 70 229 / var(--tw-text-opacity));
+}
+
+.text-secondary-content {
+ --tw-text-opacity: 1;
+ color: var(--fallback-sc,oklch(var(--sc)/var(--tw-text-opacity)));
+}
+
+.shadow {
+ --tw-shadow: 0 1px 3px 0 rgb(0 0 0 / 0.1), 0 1px 2px -1px rgb(0 0 0 / 0.1);
+ --tw-shadow-colored: 0 1px 3px 0 var(--tw-shadow-color), 0 1px 2px -1px var(--tw-shadow-color);
+ box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
+}
+
+.shadow-md {
+ --tw-shadow: 0 4px 6px -1px rgb(0 0 0 / 0.1), 0 2px 4px -2px rgb(0 0 0 / 0.1);
+ --tw-shadow-colored: 0 4px 6px -1px var(--tw-shadow-color), 0 2px 4px -2px var(--tw-shadow-color);
+ box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
+}
+
+.shadow-sm {
+ --tw-shadow: 0 1px 2px 0 rgb(0 0 0 / 0.05);
+ --tw-shadow-colored: 0 1px 2px 0 var(--tw-shadow-color);
+ box-shadow: var(--tw-ring-offset-shadow, 0 0 #0000), var(--tw-ring-shadow, 0 0 #0000), var(--tw-shadow);
+}
+
+.ring-1 {
+ --tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);
+ --tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(1px + var(--tw-ring-offset-width)) var(--tw-ring-color);
+ box-shadow: var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow, 0 0 #0000);
+}
+
+.ring-inset {
+ --tw-ring-inset: inset;
+}
+
+.ring-gray-300 {
+ --tw-ring-opacity: 1;
+ --tw-ring-color: rgb(209 213 219 / var(--tw-ring-opacity));
+}
+
+/* Borrowed from https://github.com/Milkdown/milkdown/blob/main/e2e/src/list-item-block/style.css
+which is licensed under MIT. */
+
+.prose :where(li):not(:where([class~="not-prose"] *)) {
+ margin-top: 0.5em;
+ margin-bottom: 0;
+}
+
+.prose :where(blockquote):not(:where([class~="not-prose"] *)) {
+ font-style: inherit;
+ font-weight: inherit;
+}
+
+.prose :where(ul ul, ul ol, ol ul, ol ol):not(:where([class~="not-prose"] *)) {
+ margin-top: 0.5em;
+ margin-bottom: 0;
+}
+
+.prose ol,
+.prose ul {
+ list-style: none !important;
+ padding: 0;
+}
+
+.prose li p {
+ margin: 0px !important;
+ line-height: 1.5rem !important;
+}
+
+.prose li p + p {
+ margin-top: 0.5rem !important;
+}
+
+.prose li.ProseMirror-selectednode {
+ outline: 2px solid #8cf;
+}
+
+.prose li::after {
+ all: unset !important;
+}
+
+milkdown-list-item-block .list-item {
+ gap: 8px;
+}
+
+milkdown-list-item-block .label-wrapper {
+ height: 24px;
+ display: inline-flex;
+ justify-content: center;
+ align-items: center;
+ color: darkcyan;
+}
+
+/* End borrowed block. */
+
+.placeholder\:text-gray-400::-moz-placeholder {
+ --tw-text-opacity: 1;
+ color: rgb(156 163 175 / var(--tw-text-opacity));
+}
+
+.placeholder\:text-gray-400::placeholder {
+ --tw-text-opacity: 1;
+ color: rgb(156 163 175 / var(--tw-text-opacity));
+}
+
+.hover\:bg-gray-100:hover {
+ --tw-bg-opacity: 1;
+ background-color: rgb(243 244 246 / var(--tw-bg-opacity));
+}
+
+.hover\:bg-gray-50:hover {
+ --tw-bg-opacity: 1;
+ background-color: rgb(249 250 251 / var(--tw-bg-opacity));
+}
+
+.hover\:text-gray-900:hover {
+ --tw-text-opacity: 1;
+ color: rgb(17 24 39 / var(--tw-text-opacity));
+}
+
+.hover\:text-indigo-600:hover {
+ --tw-text-opacity: 1;
+ color: rgb(79 70 229 / var(--tw-text-opacity));
+}
+
+.focus\:ring-2:focus {
+ --tw-ring-offset-shadow: var(--tw-ring-inset) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color);
+ --tw-ring-shadow: var(--tw-ring-inset) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color);
+ box-shadow: var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow, 0 0 #0000);
+}
+
+.focus\:ring-inset:focus {
+ --tw-ring-inset: inset;
+}
+
+.focus\:ring-accent:focus {
+ --tw-ring-opacity: 1;
+ --tw-ring-color: var(--fallback-a,oklch(var(--a)/var(--tw-ring-opacity)));
+}
+
+.group:hover .group-hover\:border-indigo-600 {
+ --tw-border-opacity: 1;
+ border-color: rgb(79 70 229 / var(--tw-border-opacity));
+}
+
+.group:hover .group-hover\:text-gray-900 {
+ --tw-text-opacity: 1;
+ color: rgb(17 24 39 / var(--tw-text-opacity));
+}
+
+.group:hover .group-hover\:text-indigo-600 {
+ --tw-text-opacity: 1;
+ color: rgb(79 70 229 / var(--tw-text-opacity));
+}
+
+@media (min-width: 640px) {
+ .sm\:mx-auto {
+ margin-left: auto;
+ margin-right: auto;
+ }
+
+ .sm\:w-full {
+ width: 100%;
+ }
+
+ .sm\:max-w-\[480px\] {
+ max-width: 480px;
+ }
+
+ .sm\:max-w-md {
+ max-width: 28rem;
+ }
+
+ .sm\:rounded-lg {
+ border-radius: 0.5rem;
+ }
+
+ .sm\:px-12 {
+ padding-left: 3rem;
+ padding-right: 3rem;
+ }
+
+ .sm\:px-6 {
+ padding-left: 1.5rem;
+ padding-right: 1.5rem;
+ }
+
+ .sm\:text-sm {
+ font-size: 0.875rem;
+ line-height: 1.25rem;
+ }
+
+ .sm\:leading-6 {
+ line-height: 1.5rem;
+ }
+}
+
+@media (min-width: 1024px) {
+ .lg\:px-8 {
+ padding-left: 2rem;
+ padding-right: 2rem;
+ }
+}
diff --git a/tailwind.config.js b/tailwind.config.js
index cd2cb6a..92ed479 100644
--- a/tailwind.config.js
+++ b/tailwind.config.js
@@ -1,11 +1,13 @@
/** @type {import('tailwindcss').Config} */
module.exports = {
- content: ["./templates/**/*.html"],
+ content: ["./templates/**/*.html", "./frontend/**/*.ts"],
theme: {
extend: {},
},
plugins: [
require('daisyui'),
+ require('@tailwindcss/typography'),
+ require('@tailwindcss/forms'),
],
daisyui: {
themes: [
diff --git a/templates/documents/list_documents.html b/templates/documents/list_documents.html
index 0fc4e48..dbd9a70 100644
--- a/templates/documents/list_documents.html
+++ b/templates/documents/list_documents.html
@@ -22,6 +22,7 @@
</div>
<div class="px-8 py-8 flex flex-col gap-y-4">
+ <div id="editor" class="prose bg-white"></div>
{% for document in documents %}
<div class="card w-96 bg-base-100 shadow-md border-2 border-solid">
@@ -29,6 +30,7 @@
<h2 class="card-title">{{ document.name }}</h2>
<div class="card-actions justify-end">
<button class="btn btn-primary">Open</button>
+
</div>
</div>
</div>
diff --git a/templates/head.html b/templates/head.html
index 3dacea1..50866bd 100644
--- a/templates/head.html
+++ b/templates/head.html
@@ -3,6 +3,7 @@
<meta http-equiv="X-UA-Compatible" content="IE=edge">
<meta name="viewport" content="width=device-width, initial-scale=1.0">
<title>Pique
+